HOME |
PRODUCT
| CAS NO | Product Name |
| 100-00-5 | 4-Chloronitrobenzene |
| 100-01-6 | 4-Nitroaniline |
| 100-02-7 | p-Nitrophenol |
| 1000-28-8 |
1H,1H,2'H-Perfluorodipropyl ether |
| 1000525-62-1 |
Cyclopropanepropanoic acid, b-oxo-1-(trifluoromethyl)- |
| 100-06-1 | 4 Methoxy Acetophenone |
| 100-07-2 |
p-Anisoyl Chloride |
| 10008-97-6 |
2-(1,1,2,2-Tetrafluoroethoxy)benzoic acid |
| 10009-25-3 |
4-(1,1,2,2-Tetrafluoroethoxy)benzoic acid |
| 100-09-4 | P-anisic acid |
| 100-10-7 | 4-Dimethylaminobenzaldehyde |
| 10010-93-2 |
5(3)-Methyl-3(5)-(trifluoromethyl)pyrazole |
| 100-11-8 | 4-nitrobenzyl bromide |
| 100-16-3 | 4-Nitrophenylhydrazine |
| 100165-88-6 |
(S)-(-)-2,2′-Bis(di-p-tolylphosphino)-1,1′-binaphthyl |
| 100-20-9 | Terephthaloyl chloride |
| 100-22-1 | N,N,N´,N´-Tetramethyl-1,4-phenylenediamine |
| 10026-19-4 |
COBALT IODIDE Hexahydrate |
| 1002-69-3 |
1-chlorodecane |
| 10028-22-5 |
Ferric Sulfate |
| 100-28-7 | 4-Nitrophenyl isocyanate |
| 100-32-3 | p-Nitrophenyldisufide |
| 10034-85-2 |
Hydroiodic Acid 55% to 57% Solution |
| 1003-56-1 |
2-Hydroxy-3-methylpyridine |
| 100-36-7 | N,N-Diethylethylenediamine |
| 1003-67-4 |
4-Methylpyridine-n-oxide |
| 100367-40-6 |
2-Amino-5-bromo-3-nitro-4-MP |
| 1003-68-5 |
2-Hydroxy-5-methylpyridine |
| 1003872-58-9 |
trans-4-Aminoadamantane-1-Carboxylic Acid Methyl Ester Hydrochloride |
| 100-39-0 | benzyl Bromide |
| 100-47-0 |
Benzonitrile |
| 100-50-5 | 3-Cyclohexene-1-Carboxaldehyde |
| 100-51-6 | Benzyl Alcohol |
| 100-52-7 | Benzaldehyde |
| 1006-23-1 |
5-Nitroso-2,4,6-triaminopyrimidine |
| 1000-90-4 | Zine isopropyl xanthate |
| 10025-67-9 | Sulphur Monochloride |
| 1003-03-8 | Cyclopentylamine |
| 100361-18-0 | 7-Chloro-1-Cyclopropyl-6-fluoro-1,4-oxo-1,8-naphthyridine-3-carboxylic acid |
| 1004-38-2 | 2,4,6-triaminopyrimidine |
| 10043-11-5 | Boron Nitride |
| 10043-52-4 | Calcium Chloride 95% |
| 1006-94-6 | 5-Methoxyindole |
| 10061-68-4 | N,N'-Diethyltrimethylenediamine |
| 1006873-58-0 | 5-Ethyl-2-Methylpyridine Borane |
| 10075-50-0 | 5-Bromoindole |
| 10079-20-6 | V.S.Ortho Anisidine |
| 100-79-8 |
Solketal |
| 10081-67-1 | 4,4'-Bis(α,α'-dimethyl benzyl)diphenylamine |
| 100-83-4 |
3-Hydroxybenzaldehyde |
| 1008-72-6 |
Sodium 2-sulfobenzaldehyde |
| 10101-63-0 |
Lead Iodide |
| 10102-18-8 |
Sodium Selenite |
| 101054-93-7 |
4,4,4-Trifluorobutan-2-ol |
| 101-06-4 |
N,N-dibenzylethanolamine |
| 101-11-1 |
N-Ethyl-N-phenyl-3-sulfobenzylamine |
| 101-14-4 | 3,3'-Dichloro-4,4'-diaminodiphenylmethane |
| 101156-31-4 |
2,3,5,6-Tetrafluorophenyl methacrylate |
| 101156-32-5 |
2,3,5,6-Tetrafluorophenyl acrylate |
| 101-37-1 | 2,4,6-Triallyloxy-1,3,5-triazine |
| 101-39-3 | α-Methylcinnamaldehyde |
| 10139-47-6 |
Zinc Iodide |
| 101-41-7 | Methyl Phenyl Acetate |
| 101-43-9 | Cyclohexyl methacrylate |
| 101-50-8 | para amino azo benzene 3,4'-disulphonic acid |
| 10160-24-4 |
7-bromo-1-heptanol |
| 101654-28-8 |
2-Nitro-4-hydroxypyridine |
| 101-67-7 | 4,4’-Di-iso-octyldiphenylamin |
| 101-72-4 | N-isopropyl-N'-phenyl-p-phenylenediamine |
| 1017254-82-8 |
(Di-tert-butylphosphino)ferrocene, tetrafluoroborate salt |
| 101-75-7 | 4-Phenylazodiphenylamine |
| 1017-60-3 |
Bis(4-methylphenyl)phosphine |
| 10177-29-4 |
4-Chloronicotinic Acid |
| 101-77-9 |
4,4'-METHYLENEDIANILINE (MDA) |
| 101-81-5 | Di Phenyl Methane |
| 101-84-8 | Di Phenyl Oxide |
| 10186-63-7 |
Methyl 2-methoxytetrafluoropropionate |
| 10186-66-0 |
Ethyl 2-ethoxy-2,3,3,3-tetrafluoropropionate |
| 10186-73-9 |
Ethyl 2-bromotetrafluoropropionate |
| 101947-16-4 |
1H,1H,2H,2H-Perfluorodecyltriethoxysilane |
| 101975-15-9 |
4'-(1,1,2,2-Tetrafluoroethoxy)acetophenone |
| 101975-16-0 |
3'-(1,1,2,2-Tetrafluoroethoxy)acetophenone |
| 101-98-4 | N-Benzyl-N-methylethanolamine |
| 1010-60-2 | 2-Chloro-1,4-naphthoquinone |
| 10101-88-9 | Sodium thiophosphate |
| 10114-58-6 | BASIC BROWN 1 |
| 10128-55-9 | Luminore green 525T |
| 1013-75-8 | N-Ethyl-N-Phenylurethane |
| 1013-88-3 | Benzo phenone imine |
| 101357-19-1 | PIGMENT VIOLET 3 |
| 10155-47-2 | 2-hydroxy-3-naphthoic acid morpholinopropylamide |
| 101708-53-6 | 8-Acetamido-2-(2-hydroxy-5-sulfophenyl)azo-1-naphthol-3,6-disulfonic acid |
| 101852-89-5 | 2-(2-Anilinovinyl-3-(4-sulfobutyl)benzoxazolium betaine |
| 102061-83-6 |
Sodium perfluorohexylsulfinate |
| 102-06-7 | Diphenyl guanidine(DPG,D) |
| 102-08-9 | N-N'-Diphenylthiourea |
| 1021176-69-1 |
5-[Bis(cyclohexyl)phosphino]-1′,3′,5′-triphenyl-1,4′-bi-1H-pyrazole |
| 10213-79-3 |
Sodium metasilicate pentahydrate |
| 10215-33-5 |
3-butoxy-1-propanol |
| 102-19-2 | Iso Amyl Phenyl Acetate |
| 102-20-5 | Phenyl Ethyl Phenyl Acetate |
| 102-40-9 | 2,2'-[m-Phenylenebis(oxy)]bis[ethanol] |
| 102-47-6 |
3,4-Dichlorobenzyl Chloride |
| 102-52-3 | 1,1,3,3-Tetramethoxypropane |
| 102-54-5 | Ferrocene |
| 1025716-99-7 |
BENZOIC ACID, 3-[(AMINOIMINO METHYL) AMINO]-4-METHYL-, METHYL ESTER, NITRATE |
| 102690-88-0 |
Bis(2-cyanoethyl)-N,N-diisopropylphosphoramidite |
| 102691-36-1 |
2-Cyanoethyl N,N,N’,N’-tetraisopropylphosphorodiamidite |
| 102-70-5 |
Triallylamine |
| 102-76-1 | Triacetin |
| 102-77-2 | N-Oxydiethylene-2-benzothiazole sulfonamide |
| 102780-88-1 |
2-Iodoperfluoro(2-methylpentane) |
| 102782-97-8 |
Glycidoxypropyl-terminated polydimethylsiloxane |
| 102-79-4 | 2,2'-(Butylimino)Diethanol |
| 102029-44-7 | [R]-4-Benzyl-2-oxazolidinone |
| 102113-98-4 | Bis(4-biphenylyl)amine |
| 10217-34-2 | 2-(3,4-Epoxycyclohexyl)ethyltriethoxysilane |
| 10222-01-2 | 2,2-Dibromo-2-Cyanoacetamide |
| 10226-30-9 | 6-Chloro-2-hexanone |
| 10230-26-9 | 1,2-dibromocyclopentane |
| 10234-77-2 | 5-Methyl-3-pyrazolidinone hydrochloride |
| 1025-15-6 | Triallyl isocyanurate |
| 10254-57-6 | Dibutylcarbamodithioic acid methylene ester |
| 102570-64-9 | 2,5-Bis(4-Aminophenyl)pyrimdine |
| 10258-54-5 | 2-Methoxyethyl Cyanoacetate |
| 10294-34-5 | Boron trichloride |
| 1029636-02-9 |
4-Chloro-3(5)-difluoromethyl-5(3)-phenylpyrazole |
| 1029636-05-2 |
4-Chloro-3(5)-perfluorooctyl-5(3)-phenylpyrazole |
| 1029636-11-0 |
4-Chloro-3(5)-perfluorohexyl-5(3)-phenylpyrazole |
| 1029636-15-4 |
4-Chloro-3(5)-nonafluorobutyl-5(3)-phenylpyrazole |
| 1029636-42-7 |
3(5)-Difluoromethyl-5(3)-(4-methoxyphenyl)pyrazole |
| 1029650-61-0 |
3(5)-Perfluorooctyl-5(3)-phenylpyrazole |
| 10297-05-9 |
1-chloro-4-iodobutane |
| 1030269-32-9 |
3,5-Bis(nonafluorobutyl)pyrazole |
| 103068-41-3 |
4-Fluororesorcinol |
| 103099-52-1 |
1,3-Bis(dicyclohexylphosphino)propane |
| 103-16-2 | 4-(Benzyloxy)phenol |
| 10317-10-9 |
3-chloro-2-methyl-1-propanol |
| 1032021-83-2 |
Iododifluoroacetic acid |
| 10321-14-9 |
Trifluoropyruvic acid monohydrate |
| 103-23-1 | Dioctyl adipate |
| 10331-08-5 |
1H,1H,8H-Perfluorooctane-1-ol |
| 103-32-2 | N-Benzylaniline |
| 103-34-4 | 4,4-Dithio dimorpholine |
| 103-36-6 | Ethyl Cinnamate |
| 103421-62-1 |
Bis(trimethylphosphine)nickel dichloride |
| 1034-39-5 |
Triphenylphosphine dibromide |
| 103-44-6 | 2-Ethylhexyl vinyl ether |
| 103-45-7 | Phenyl Ethyl Acetate |
| 103-48-0 | Phenyl Ethyl Iso Butyrate |
| 103573-07-5 |
Perfluoro(5-aza-4-nonene) |
| 103-5-9 | Di Methyl Phenyl Ethyl Carbinol |
| 103-54-8 | Cinnamyl Acetate |
| 103-60-6 | Phenoxy Ethyl Iso Butyrate |
| 103-61-7 | Cinnamyl Butyrate |
| 103628-86-0 |
Allyl 1H,1H,2H,2H-perfluorooctyl ether |
| 103-72-0 | Phenyl isothiocyanate |
| 10372-98-2 |
Perfluoro(isopropyl vinyl)ether |
| 103-74-2 | 2-Pyridineethanol |
| 103-75-3 | 2-Ethoxy-3,4-dihydro-2H-pyran |
| 103-81-1 | Phenylacetamide |
| 103-82-2 | Phenyl Acetic Acid |
| 103-84-4 | Acetanilide |
| 1038-66-0 |
4,4'-Diaminooctafluorobiphenyl |
| 10386-84-2 |
4,4'-Dibromooctafluorobiphenyl |
| 1031-15-8 | Methyltriphenylphosphonium chloride |
| 10312-55-7 | 2-Aminoterephthalic acid |
| 103146-26-5 | benzonitrile, 4-[4-(dimethylamino)-1-(4-fluorophenyl)-1-hydroxybutyl]-3-(hydroxymethyl)-,hydrobromide |
| 10320-42-0 | 2-Chloro-5-nitropyrimidine |
| 1034-49-7 | Bromomethyltriphenylphosphonium bromide |
| 10347-88-3 | 3-Tert-Butyladipic acid |
| 10352-88-2 | Trans-2-Heptenoic acid |
| 1035265-72-5 | (trans,trans)-[1,1' -Bicyclohexyl]-4,4'-dicarboxylic acid 4-Methyl ester |
| 103534-62-9 | 3-(2-Hydroxyethyl)-9-methyl-3'-(3-sulfatobutyl)thiacarbocyanine betaine |
| 103597-45-1 | 2,2'-Methylenebis[6-(2H-benzotriazol-2-yl)-4-(1,1,3,3-tetramethylbutyl)phenol] |
| 10373-78-1 | DL-Camphorquinone |
| 103962-05-6 |
4-TRIFLUOROMETHOXY IODOBENZENE |
| 104-01-8 | 4-Methoxyphenylacetic Acid |
| 104-21-2 | Para Anisyl Acetate |
| 104224-63-7 |
2-(1-Adamantyl)-4-Bromo-Anisole |
| 104224-68-2 |
2-(1-Adamantyl)-4-Bromophenol |
| 104-23-4 | para amino azo bezene 4-sulphonic acid |
| 104291-39-6 |
4,4,4-Trifluoro-3-(trifluoromethyl)crotonal |
| 104315-28-8 |
5-Fluoro-1-methyl-3-pentafluoroethyl-4-trifluoromethyl-1H-pyrazole |
| 1043-50-1 |
Decafluorodiphenyl sulfide |
| 104-38-1 | 1,4-Bis(2-hydroxyethoxy)benzene |
| 104451-70-9 |
2,3,6-Trifluorobenzaldehyde |
| 104-47-2 | p-Methoxyphenylacetonitrile |
| 10450-60-9 |
Periodic Acid |
| 104-50-7 |
Gamma-Octalactone |
| 104-55-2 | Cinnamic Aldehyde |
| 104-58-5 |
N-(3-hydroxypropyl)piperidine |
| 104-61-0 |
Gamma-Nonalactone |
| 104-66-5 | 1,2-Diphenoxy ethane (glycol diphenyl ether) |
| 104-67-6 |
Gamma-Undecalactone |
| 104-83-6 |
|4-Chlorobenzyl Chloride |
| 104857-88-7 |
Methyl pentafluoropropionylacetate |
| 104863-67-4 |
N-Methoxy-N-methyltrifluoroacetamide |
| 104-86-9 | 4-Chlorobenzylamine |
| 104-92-7 | 4-Bromoanisole |
| 10493-44-4 |
4-Bromo-1,1,2-trifluorobut-1-ene |
| 104-93-8 | Para Cresyl Methyl Ether |
| 10420-89-0 | S-(+)-1-(1-Naphthyl) Ethylamine |
| 10425-11-3 | 3,4-dihydroxy benzophenone |
| 104295-55-8 | 2-Naphthylamine-6-sulphomethylamide |
| 10431-98-8 | 2-Ethyl-2-oxazoline |
| 104618-32-8 | Phthalimido Cyclohexanone |
| 1047-16-1 | Pigment Violet 19 |
| 10472-24-9 | Methyl 2-oxocyclopentanecrbo-xylate |
| 10477-47-1 | Propargyl acrylate |
| 104810-47-1 | α-[3-[3-(2H-Benzotriazol-2-yl)-5-(1,1-dimethylethyl)-4-hydroxyphenyl] -1-oxopropyl]-, ω-[3-[3-(2H-benzotriazol-2-yl)-5-(1,1-dimethylethyl)-4-hydroxyphenyl]-1-oxopropoxy], poly(oxy-1,2-ethanediyl) |
| 104810-48-2 | [3-[3-(2H-Benzotriazol-2-yl)-5-(1,1-dimethylethyl)-4-hydroxyphenyl]-1-oxopropyl]-hydroxy-, poly(oxo-1,2-ethanediyl) |
| 10488-69-4 | Ethyl-4-chloro-3-hydroxybutyrate |
| 10493-43-3 | Perfluoroethylvinyl Ether (PEVE) |
| 1049726-96-6 |
Sodium 2′-dicyclohexylphosphino-2,6-dimethoxy-1,1′-biphenyl-3-sulfonate hydrate |
| 105-08-8 | 1,4-Cyclohexanedimethanol |
| 105-11-3 | p-Benzoquinone Dioxime |
| 105-12-4 | p-Dinitrozobenzene |
| 105-13-5 | Para Anisyl Alcohol |
| 105-21-5 |
Gamma-Heptalactone |
| 10523-68-9 |
2-Adamantanamine hydrochloride |
| 105-34-0 | Methyl Cyanoacetate |
| 105-36-2 | Ethyl bromoacetate |
| 10536-62-6 |
Bis(pentafluorophenyl)dimethylsilane |
| 105-39-5 | Ethyl chloroacetate |
| 105484-55-7 |
8-chlorooctanoic acid ethyl ester |
| 105-50-0 | Diethyl acetone-1,3-dicarboxylate |
| 105-53-3 | Diethyl Malonate |
| 105-54-4 | Ethyl Butyrate |
| 105-55-5 | N,N'-Diethylthiourea |
| 105-56-6 | Ethyl Cyanoacetate |
| 1055888-89-5 |
3-(Di-tert-butylphosphonium)propane sulfonate |
| 105596-63-2 |
2-MethoxyIso Nicotinic Acid |
| 105-67-9 |
2,4-dimethyl-Phenol |
| 105-81-7 | N-Allyl-N'-(2-hydroxyethyl)thiourea |
| 105-85-1 | Citronellyl formate |
| 105-87-3 | Geranyl Acetate |
| 105919-28-6 |
2-fluoro-CyClopropanamine |
| 105931-73-5 |
1-BROMO-3-FLUORO-4-IODOBENZENE |
| 105935-24-8 |
tert-Butyl2-(trifluoromethyl)acrylate |
| 105-99-7 | Dibutyl Adipate |
| 10500-57-9 | 5,6,7,8-Tetrahydroquinoline |
| 105176-22-5 | 4,5-Diphenyl-2-{5-[3-ethoxy-4-(3-ethyl-5methyl-2-benthiazolinylidene)-2butenylidene]-3-ethyl-4-oxo-2thiazolidinylidene}methyl-3-ethylthiazolium iodide |
| 10526-07-5 | 1,3-Bis(3-aminophenoxy)benzene |
| 10541-83-0 | 4-(Methylamino)benzoic acid |
| 10545-99-0 | Sulphur Dichloride |
| 10558-25-5 | 4-Bromo-3,5-dimethylisoxazole |
| 105601-04-5 | 3-[1-(Dimethylamino)ethyl]phenol |
| 10591-85-2 | Tetrabenzylthiuram disulfide |
| 10597-60-1 | 4-(2-hydroxyethyl)-1,2-dihydroxybenzene |
| 10599-69-6 | 2-Methyl-5-propionylfuran |
| 10599-70-9 | 3-Acetyl-2,5-dimethylfuran |
| 106-21-8 | 3,7-Dimethyl-1-octanol |
| 106-22-9 | β-Citronellol |
| 106-23-0 | Citronellal |
| 106-24-1 | Geraniol (Various Grade) |
| 106-25-2 | Nerol |
| 106261-49-8 |
4-[(4-Methylpiperazin-1-yl)methyl]benzoic acid dihydrochloride |
| 106261-64-7 |
4-(4-Methylpiperazinylmethyl)benzoyl chloride dihydrochloride |
| 106-37-6 | 1,4-dibromobenzene |
| 106-38-7 | 4-bromotoluene |
| 106-39-8 | 1-bromo-4-chlorobenzene |
| 106-41-2 | 4-Bromophenol |
| 106-43-4 |
P-Chlorotoluene |
| 106-44-5 |
p-cresol |
| 106447-97-6 |
2-Amino-4-(trifluoromethyl)pyridine |
| 106-46-7 | 1,4-Dichlorobenzene |
| 106-47-8 | 4-Chloroaniline |
| 106-48-9 | 4-Chloro Phenol |
| 106-50-3 | p-Phenylenediamine |
| 106-51-4 |
P-benzoquinone |
| 106538-78-7 |
Methyl 2,2,3,4,4,4-hexafluorobutyrate |
| 106-54-7 |
4-chlorothiophenol |
| 106-56-6 | Ethyl Cyanoacetate |
| 1066-51-9 |
(Aminomethyl)phosphonic acid |
| 106-72-9 | Melonal |
| 1067-73-8 |
Diethyl 2-oxobutylphosphonate |
| 1067-74-9 |
Methyl diethylphosphonoacetate |
| 106-86-5 | 4-Vinyl-1-cyclohexene-1,2-epoxide |
| 106-90-1 |
2,3-Epoxypropyl acrylate |
| 1069-08-5 |
Diethylphosphoramidous dichloride |
| 106-91-2 | Glycidyl Methacrylate |
| 106-92-3 | Allyl Glycidyl Ether |
| 106-93-4 | 1,2-dibromoethane |
| 106-94-5 | 1-bromopropane |
| 106264-79-3 | Dimethyl thio-toluene diamine |
| 1064-48-8 | Acid Black 1 C.I. 20470 |
| 106556-36-9 | 2-(2-Hydroxy-4-methoxyphenyl)-4,6-diphenyl-1,3,5-triazine |
| 1067-53-4 | Vinyltris(2-methoxyethoxy)silane |
| 1068-57-1 | Acetohydrazide |
| 1069-62-1 |
(2-ACETYL-4-METHYLPENTYL)TRIMETHYL AMMONIUM IODIDE |
| 106-96-7 |
Propargyl Bromide |
| 106990-43-6 | N,N''-Ethylenebis[N,N'-bis[2,4-bis[butyl(1,2,2,6,6-pentamethylpiperidine-4-yl)amino]-1,3,5-triazine-6-yl]trimethylenediamine] |
| 107018-39-3 |
Ethyl 2-hydroxy-2-(trifluoromethyl)propionate |
| 107-02-8 | Acrolein |
| 107-04-0 | 1-bromo-2-chloroethane |
| 107070-09-7 |
2-Iodo-3,3,3-trifluoropropene |
| 107-07-3 | 2-chloroethanol |
| 107-08-4 |
n-Iodo Propane OR Propyl Iodide |
| 1070896-59-1 |
4-Piperidinone,3-fluoro,HCl |
| 1070955-78-0 |
4-Piperidinone,3-fluoro |
| 107100-16-3 |
5-Bromo-3,4-dimethylbenzene-1,2-diamine |
| 107103-95-7 |
2-Methyl-4,4,4-trifluorobutan-1-ol |
| 107-11-9 |
Monoallylamine |
| 107-14-2 |
Chloroacetonitrile |
| 107-25-5 | Methyl vinyl ether |
| 107267-44-7 |
2,3,5,6-Tetrafluorobenzyl chloride |
| 1072-97-5 |
2-Amino-5-bromopyridine |
| 1072-98-6 |
2-Amino-5-chloropyridine |
| 1073-23-0 |
2,6-Lutidine-n-oxide |
| 107368-61-6 |
Methyl perfluoro(1,4-dimethyl-2,5-dioxaoctyl) ketone |
| 107-41-5 | Hexylene Glycol |
| 107432-46-2 |
1-Iodo-1-(heptafluoropropoxy)-1,1,1,2-tetrafluoroethane |
| 107-59-5 | tert-butylchloroacetate |
| 107-75-5 | Hydroxy Citronellal |
| 107-81-3 | 2-bromopentane |
| 107-91-5 | Cyanoacetamide |
| 107-92-6 | Butylic acid |
| 1070-10-6 | Tetra 2-ethylhexyl titanate |
| 1070-70-8 | 1,4-Bis(acryloyloxy)butane |
| 1071-93-8 | Adipic Dihydrazide |
| 1071-93-8 | Adipic Dihydrazide |
| 1072-71-5 | 2,5-Dimercapto-1,3,4-thiadiazole |
| 1073-67-2 | 4-chlorostyrene Pyrisoxazole |
| 1073-67-2 | 4-Chlorostyrene |
| 1074-38-0 |
2-Nitro-5-methylpyridine |
| 1074-82-4 | Potassium Phthalimide |
| 1074-86-8 | Indole-4-carbaldehyde |
| 1074-91-5 |
1-Bromo-2,3,4,5-tetrafluorobenzene |
| 1074-98-2 |
3-Methyl-4-nitropyridine-n-oxide |
| 107504-08-5 |
5-Fluoropyridine-2-carboxylicacid |
| 1075-49-6 | 4-Vinylbenzoic acid |
| 107551-72-4 |
2,2,3,3-Tetrafluoropropyl trifluoroacetate |
| 1075-76-9 | 3-Anilinopropionitrile |
| 1076-38-6 |
4-Hydroxy Coumarine |
| 107650-06-6 |
1H,1H,2H,3H,3H-Perfluorononane-1,2-diol |
| 107-96-0 |
3-mercaptopropionic acid |
| 108-00-9 | N,N-Dimethylethylenediamine |
| 1081534-24-8 |
1-Bromo-2-chloro-1,1,2-trifluorobutane |
| 108-29-2 | γ-valerolactone |
| 108-42-9 | 3-Chloroaniline |
| 108-39-4 |
m-Cresol |
| 108-45-2 | m-Phenylene Diamine |
| 108-46-3 | Resorcinol |
| 108549-23-1 |
Dibenzyl diisopropylphosphoramidite |
| 108554-72-9 |
Allyl tetraisopropylphosphorodiamidite |
| 108-59-8 | Dimethyl Malonate |
| 1086372-16-8 |
(1R,2S)-2-fluorocyclopropanamine |
| 108661-89-8 |
(2-Bromo-1,1-difluoroethyl)benzene |
| 108-67-8 |
Mesitylene |
| 108-77-0 | Cyanuric Chloride |
| 108-85-0 | bromocyclohexane |
| 108858-09-9 |
1-(2-Chlorotetrafluoroethyl)trifluoroethanesultone |
| 108-86-1 | Bromobenzene |
| 108-89-4 |
4-Methylpyridine |
| 108-90-7 | Chlorobenzene |
| 108517-41-5 | 5',6'-Dimethyl-5-methoxy-3,3',9triethylselenathiacarbocyanine perchlorate |
| 108-99-6 |
3-Methylpyridine |
| 109-00-2 |
3-Hydroxypyridine |
| 109-04-6 |
2-Bromopyridine |
| 109-09-1 |
2-Chloropyridine |
| 109-16-0 | Triethyleneglycoldimethacrylate |
| 109-17-1 | Tetraethylene glycol dimethacrylate |
| 1093215-92-9 |
POTASSIUM 2-IODO-5-METHYLBENZENESULFONATE |
| 109-43-3 | Dibutyl Sebacate |
| 109-53-5 | Isobutyl vinyl ether |
| 109574-81-4 |
3-Iodo-5,5,6,6,7,7,8,8,8-nonafluorooctan-1-ol |
| 109-63-7 | Boron Trifluoride Diethyl Ether |
| 109-64-8 | 1,3-dibromopropane |
| 109-65-9 | 1-bromobutane |
| 109-70-6 | 1-bromo-3-chloropropane |
| 109-77-3 | Malononitrile |
| 109-85-3 |
2-methoxyethylamine |
| 109872-87-9 |
Methyl difluoroiodoacetate |
| 109-92-2 | Ethyl vinyl ether |
| 109037-78-7 | Butyl titanium phosphate |
| 1095-78-9 | 2,2-Bis(4-aminophenyl)hexafluoropropane |
| 109561-07-1 | 1,4-Bis[2-methacryloxyethyl)amino]-9,10-anthraquinone |
| 109993-33-1 |
4,5,5-Trifluoropent-4-en-1-ol |
| 110003-22-0 |
4,5,5-Trifluoropent-4-enoic acid |
| 110-03-2 |
2,5-Dimethyl-2,5-Hexanediol |
| 1100832-66-3 |
3-Chloro-4-(1,1,2,3,3,3-hexafluoropropoxy)aniline |
| 110-16-7 | Maleic Acid |
| 110254-90-5 |
4,4-Bis(trifluoromethyl)-5,5,6,6,7,7,7-heptafluoroheptan-1-ol |
| 110260-75-8 |
Methyl 2H,2H,3H,3H-perfluorononanoate |
| 110-27-0 | Isopropyl myristate |
| 1103738-26-6 |
(2-CHLORO-5-IODOPHENYL)(4-ETHOXYPHENYL)METHANONE |
| 1103738-29-9 |
1-CHLORO-2-(4-ETHOXYBENZYL)-4-IODOBENZENE |
| 110-41-8 | 2-Methylundecanal (Aldehyde C12 MNA) |
| 110-51-0 | Pyridine borane |
| 110-52-1 | 1,4-dibromobutane |
| 110-53-2 | 1-bromopentane |
| 110-56-5 |
1,4-dichlorobutane |
| 110-70-3 | N,N’-Dimethylethylenediamine |
| 110-76-9 |
2-ethoxyethylamine |
| 110-87-2 | 3,4-dihydro-2H-pyran |
| 1109-15-5 |
Tris(pentafluorophenyl)borane |
| 110-94-1 | 1,5-Glutaric Acid |
| 1100-88-5 | Benzyltriphenylphosphonium chloride |
| 1103-38-4 | Pigment Red 49:1 |
| 1103652-30-7 | 2-[3-(1-Cyclohexyl-2,3-dimethyl-5-[2-(3-ethyl6,7,8,9-tetrahydronaphtho[2,1-d]-2thiazolylidene)ethylidene]-4-oxo-2imidazolidinylidene)-1-propenyl]-3ethylbenzoxazolium iodide |
| 110553-27-0 | 2-Methyl-4,6-bis[(octylthio)methyl]phenol |
| 1106667-73-5 | 3,3'-Diethyl-6-diethylamino-4',5'diphenylbenzothiazolothiazolo-2,2'trimethinecyanine iodide |
| 110675-26-8 | 2,4-Bis(dodecylthiomethyl)-6-methylphenol |
| 1107-00-2 | 2,2-Bis(3,4-anhydrodicarboxyphenyl)-hexafluoropropane |
| 11070-44-3 | 3 or 4-methyl-1,2,3,6-tetrahydrophthalic anhydride |
| 111079-04-0 |
1-Phenyl-5(3)-methyl-3(5)-(trifluoromethyl)pyrazole |
| 111-12-6 | Methyl Heptine Carbonate |
| 1111-92-8 |
Dimethylphosphinic chloride |
| 111234-64-1 |
2,6-Dichloro-3,5-difluoro-4-(trifluoromethyl)phenylhydrazine |
| 111-24-0 | 1,5-dibromopentane |
| 111-25-1 | 1-bromohexane |
| 111-29-5 | 1,5-Pentanediol |
| 111-30-8 | Glutaraldehyde |
| 111-34-2 | n-Butyl vinyl ether |
| 111-44-4 | Diethylene Glycol Dichloride |
| 111-45-5 | 2-Allyloxyethanol |
| 111512-63-1 |
Bis[heptafluoro-1,1-bis(trifluoromethyl)butyl] trisulfide |
| 111-64-8 | Octanoyl chloride |
| 111-68-2 | N-HEPTYLAMINE |
| 111-71-7 | Heptanaol (Aldehyde C7) |
| 1117-71-1 |
Bromo Methyl Crotonate |
| 111-80-8 | Methyl Octine Carbonate |
| 111-83-1 | 1-bromooctane |
| 111-85-3 | n-Octyl chloride |
| 111128-12-2 | 2-（4-Bromomethyl）Phenylpropionic Acid |
| 1114-51-8 | N,N-diethyl Propionamide |
| 1116-98-9 | Tert-Butyl Cyanoacetate |
| 1117-86-8 | 1,2-Octanediol |
| 1118-89-4 |
Diethyl L-glutamate hydrochloride |
| 1119-40-0 | Pimelic acid |
| 1119-40-0 | Dimethyl Glutaric |
| 1119-51-3 |
5-bromo-1-pentene |
| 111974-69-7 | Quetiapine hemifumarate |
| 1120-90-7 |
3-Iodo Pyridine |
| 112101-75-4 |
-(-)-5-(2-Amino-propyl)-2-methoxy-benzenesulfonamide HCl |
| 112101-81-2 |
R-(-)-5-(2-Amino-propyl)-2-methoxy-benzenesulfonamide |
| 112-13-0 | n-Decanoyl chloride |
| 112-16-3 | Lauroyl chloride |
| 1121-86-4 |
1-FLUORO-3-IODOBENZENE |
| 1122-54-9 |
4-Acetylpyridine |
| 112-26-5 | Triethyleneglycol Dichloride |
| 112-29-8 | 1-bromodecane |
| 112-31-2 | Decanal (Aldehyde C-10) |
| 112-39-0 | Methyl Palmitate |
| 1124-33-0 |
4-Nitropyridine-n-oxide |
| 112-44-7 | Undecanal (Aldehyde C-11 Undecylic) |
| 112-45-8 | 10-Undecenal (Aldehyde C11 Undecylenic) |
| 112-47-0 | 1,10-Decanediol |
| 112-49-2 |
triethylene glycol dimethyl ether |
| 112-52-7 |
1-chlorododecane |
| 112-54-9 | Dodecanal (Aldehyde C12 Lauric) |
| 112671-42-8 |
4-Bromo-1-Iodo-2-Nitrobenzene |
| 112-71-0 | 1-bromotetradecane |
| 112-73-2 |
Bis(2-butoxyethyl)ether |
| 112-82-3 | 1-bromohexandecane |
| 112-89-0 | 1-bromooctadecane |
| 1120-64-5 | 2-Methyl-2-oxazoline |
| 1120-71-4 | 1,3-Propanesultone |
| 112022-81-8 | (S)-Methyl Oxazaborolidine |
| 112022-83-0 | (R)-2-Methyl oxazaborolidine |
| 112068-01-6 | (S)-(-)-α,α-Diphenyl prolinol |
| 112078-08-7 | PTCDI |
| 1122-28-7 | Imidazole-4,5-dicarbonitrile |
| 112246-73-8 | (+)-β-Chlorodiisopinocampheylborane |
| 1123-28-0 | 1-HYDROXY-CYCLOHEXANECARBOXYLIC ACID |
| 112339-60-3 | 2-Methyl-3-(4-sulfobutyl)benzoxazolium betaine |
| 1127-01-1 | Ethyl 1-Hydroxycyclohexane Carboxylate |
| 1127-59-9 | 7-Methylisatine |
| 1129-30-2 |
2,6-Diacetylpyridine |
| 112955-03-0 | 3-Ethyl-8-methoxyquinoline |
| 1131-15-3 |
Phenylsuccinic Anhydride |
| 113-24-6 | Sodium Pyruvate |
| 1131-01-7 | N-(2-Chloroacetyl)-2,6-dimethylaniline |
| 1131-01-7 | 2-Chloro-N-(2,6-dimethylphenyl)acetamide |
| 1131541-76-8 |
1-(Perfluorohexyl)trifluoroethanesultone |
| 1134-36-7 | 3-Amino-4-hydroxybiphenyl |
| 113485-46 -4 |
3,5-Dichloro-4-methylbenzoyl chloride |
| 113507-82-7 |
Perfluoro(2-ethoxyethane)sulfonic acid |
| 113507-87-2 |
Sodium perfluoro(2-ethoxyethane)sulfonate |
| 1135-24-6 |
Ferulic acid |
| 113601-46-0 |
3-Bromo-2,4,5,6-tetrafluorobenzotrifluoride |
| 113688-49-6 |
1-(2-Bromotetrafluoroethyl)cyclohexene |
| 1137-42-4 |
4-Hydroxybenzophenone |
| 1137-73-1 | N-Phenyliminnodiacetic acid |
| 113869-06-0 | Coumarin 314T |
| 113995-55-4 | 6-Sulfo-TMBI |
| 114-07-8 | Erythromycin |
| 114435-02-8 | 4-Fluoro-1,3-dioxolan-2-one |
| 1146182-96-8 | 2,2'-Bipyridine, 4,4'-bis[5-(hexylthio)-2thienyl] |
| 114772-38-2 |
methyl 4’-bromomethylbiphenyl-2-carboxylate |
| 114772-53-1 | 2-cyano-4’-methylbiphenyl |
| 114772-54-2 | 2-cyano-4’-(bromomethyl)biphenyl |
| 114810-56-9 |
2-Iodo-4,5,5,5-tetrafluoro-4-(trifluoromethyl)pentan-1-ol |
| 114859-23-3 |
2,3,4,5,6-Pentafluorobenzyl methacrylate |
| 114873-37-9 |
1,4,7,10-tetraazacyclododecane-1,4,7,10-triacetic acid |
| 114971-52-7 |
BENZYLTRIMETHYLAMMONIUM DICHLOROIODATE |
| 115-19-5 |
2-Methyl-3-Butyn-2-ol |
| 115347-68-7 |
3,3-Bis(trifluoromethyl)-4,4,5,5,6,6,6-heptafluoro-1-iodohexane |
| 115787-50-3 |
5-Bromoacetyl-2-hydroxybenzaldehyde |
| 115787-53-6 |
5-tert-butylamineacetyl-2-hydroxybenzaldehyde |
| 115-86-6 | Triphenyl phosphate |
| 115258-10-1 | N-[3-[Tris(trimethylsiloxy)silyl]propyl]acrylamide |
| 115262-01-6 |
Trimethyl(bromodifluoromethyl)silane |
| 115324-57-7 | Methyl-alpha-cyano-ß-(1-naphthyl)acrylate |
| 115345-38-5 | 1-(4-Phenoxy-3-sulfophenyl)-3-heptadecyl-4-isopropyl-2-2pyrazolin-5-one |
| 115372-36-6 | 3-Hydroxy-1-adamantyl methacrylate |
| 1155-00-6 | o-Nitrophenyldisulfide |
| 11588-02-6 |
2-Chloro-5-nitrobenzonitrile |
| 115-96-8 |
TRIS(2-CHLOROETHYL) PHOSPHATE |
| 1160861-53-9 |
2-(Di-tert-butylphosphino)-3,6-dimethoxy-2′,4′,6′-triisopropyl-1,1′-biphenyl |
| 116091-63-5 | 2-Methoxy-5-(2-oxopropyl)benzenesulphonamide |
| 116146-19-1 |
Bis(1H,1H,7H-perfluoroheptyloxy)methane |
| 116-15-4 |
Hexafluoropropene |
| 1163-19-5 | Decabromodiphenyl ether |
| 116313-85-0 | 3,4-dihydroxy-5-nitro benzyaldehyde |
| 1165943-93-0 | Dye C106 |
| 116163-96-3 |
1,3-Bis[bis(o-methoxyphenyl)phosphino]propane |
| 116586-94-8 |
3,3,3-Trifluoropropanal dimethylacetal |
| 116632-41-8 |
2-CHLORO-5-IODOTOLUENE |
| 1166-52-5 | Lauryl gallate |
| 116661-86-0 | (2S,3S)-3-[(t-butoxycarbonyl)amino]-2-hydroxy-4-phenylbutyric acid |
| 117-08-8 |
Tetrachlorophthalic Anhydride |
| 1171-47-7 |
2,2-Bis(4-carboxyphenyl)hexafluoropropane |
| 117205-07-9 |
Potassium perfluoro(2-ethoxyethane)sulfonate |
| 117338-23-5 |
2,3,5,6-Tetrafluoro-4-(trifluoromethyl)benzoyl fluoride |
| 117-34-0 | Diphenylacetic acid |
| 117341-57-8 |
3-Bromo-1,1,1-trifluoroacetone oxime |
| 117374-33-1 |
Allyl perfluorononanoate |
| 117382-22-6 |
2-Bromotetrafluoroethyl 1,2,2,2-tetrafluoroethyl ether |
| 117-42-0 |
8-Aminonaphthalene-1,3,6-trisulfonic acid |
| 117-43-1 | Epsilon acid |
| 117-46-4 | n-benzoyl h acid |
| 117539-28-3 |
4-Iodo-1,1,1,2,2-pentafluorooctane |
| 117-61-3 | benzidine 2,2'-disulphonic acid |
| 117-62-4 | sulpho tobias acid |
| 117711-60-1 |
1-(Bromodifluoromethyl)cyclohexene |
| 117-80-6 | 2,3-Dichloro-1,4-naphthoquinone |
| 117133-81-0 | Isobutyl alpha-cyano-3,4-methylenedioxycinnamate |
| 1177301-99-3 | 8-Hydroxyjulolidine hydrochloride |
| 117898-57-4 | 5,5'-Dimethyl-9-ethyl-3-(2-hydroxyethyl)-3'-(3-sulfatobutyl)thiacarbocyanine betaine |
| 117907-43-4 |
4-Amino-2-nitrodiphenylamine-2'-carboxylic acid |
| 117924-33-1 |
Di-tert-butyl N,N-diethylphosphoramidite |
| 118-03-6 | 2-Naphthylamine-3,6,8-trisulfonic acid |
| 118202-04-3 |
8-Iodoperfluoro-2,5-dimethyl-3,6-dioxaoctanoyl fluoride |
| 118202-06-5 |
8-Bromoperfluoro(2,5-dimethyl-3,6-dioxaoctanoyl) fluoride |
| 118-32-1 |
7-Hydroxy-1,3-naphthalenedisulfonic acid |
| 118-46-7 | 8-Amino-2-naphthol |
| 1184-76-5 |
Diiododifluoromethane |
| 118-47-8 | 1-(4'-Sulfophenyl)-3-carboxy-5-pyrazolone |
| 1184-84-5 |
Ethylene sulfonic acid |
| 118-48-9 |
Isatoic anhydride |
| 1185023-70-4 |
3,3-Dichloro-1,1,1-trifluoroacetone trihydrate |
| 118-58-1 | Benzyl Salicylate |
| 1186-54-5 |
2,3,3,3-Tetrafluoropropionyl chloride |
| 118-69-4 |
2,6-Dichlorotoluene |
| 118-75-2 | Chloranil |
| 118-79-6 | 2,4,6-Tribromophenol |
| 1188371-11-0 |
Potassium tetrafluoroterephthalate |
| 118864-75-8 |
(S)-1-PHENYL-1,2,3,4-TETRAHYDRO ISOQUINOLINE |
| 118-88-7 | para toluidine orhto sulphonic acid |
| 118-91-2 |
2-Chlorobenzoic acid |
| 1189187-93-6 |
1-fluoro-8-iodooctane |
| 1189187-98-1 |
1-fluoro-7-iodoheptane |
| 118-92-3 | Anthranilic acid |
| 118164-50-4 | trans, trans-4- (3, 4-Difluorophenyl)-4' -ethyl-1, 1'-bi (cyclohexane) |
| 1185-55-3 | Trimethoxy(methyl)silane |
| 1187-93-5 | Perfluoromethylvinyl Ether （PMVE） |
| 118832-72-7 | Acetic acid, [[[3,5-bis(1,1-dimethylethyl)-4-hydroxyphenyl]methyl]thio]-, C10-14-isoalkyl esters |
| 118-93-4 |
2'-Hydroxyacetophenone |
| 119-17-5 | 1:3 SPMP 1-(3-Sulfophenyl)-3-methyl-5-pyrazolone |
| 119285-89-1 |
2,2-Bis(trifluoromethyl)-1H,1H-heptafluoropentyloxirane |
| 119-28-8 | 1,7-Cleve's Acid |
| 1193-21-1 |
4,6-Dichloropyrimidine |
| 119-32-4 | 4-Methyl-3-nitroaniline |
| 119-33-5 |
4-Methyl-2-nitrophenol |
| 1193-62-0 |
methyl pyrrole-2-carboxylate |
| 1193-65-3 |
3-QUINUCLIDINONE HYDROCHLORIDE |
| 119-36-8 | Methyl Salicylate |
| 119-40-4 | Phenyl J-acid |
| 1194-65-6 |
2,6-Dichlorobenzontrile |
| 119-47-1 | 2,2'-Methylenebis(4-methyl-6-tertbutylphenol) |
| 119532-26-2 |
1-(2,3-DICHLOROPHENYL) PIPERAZINE HYDROCHLORIDE |
| 119-65-3 | Isoquinoline |
| 119-70-0 | 4,4'-Diamino diphenyl amino- 2-sulfonic acid |
| 119-75-5 |
2-Nitrodiphenylamine |
| 119-79-9 | 1,6-Cleve's acid |
| 119-79-9 | 1,6-Cleve's acid |
| 119-90-4 | o-Dianisidine |
| 119-93-7 | o-Tolidine |
| 1193-24-4 | 4,6-Dihydroxy Pyrimidine |
| 119389-05-8 | 4-Phenylethynylphthalic anhydride |
| 1195-45-5 | 4-Fluorophenyl isocyanate |
| 1196-57-2 | 2-Hydroxyquinoxaline |
| 1196-69-6 | Indole-5-carbaldehyde |
| 1196-79-8 | 2,5 Dimethylindole |
| 1196155-38-0 | 2-Chloro-6-Trifluoromethyl-4Cyanopyridine |
| 1198-14-7 | 5-Bromo-8-hydroxyquinoline |
| 1198-27-2 | 1-Aminonaphthalen-2-ol hydrochloride |
| 1198395-24-2 | N-([1,1'-biphenyl]-2-yl)-9,9-dimethyl-9H-fluoren-2-amine |
| 1198-62-5 |
1,4-Dichlorotetrafluorobenzene |
| 1198-63-6 |
1,3-Diaminotetrafluorobenzene |
| 120-11-6 | Benzyl Isoeugenol |
| 120120-26-5 |
Triethyl(trifluoromethyl)silane |
| 1201-31-6 |
2,3,4,5-Tetrafluorobenzoic acid |
| 120-14-9 | 3,4-Dimethoxybenzaldehyde |
| 120-18-3 | 2-Naphthalenesulfonic acid |
| 120193-44-4 |
Sodium pentafluorobenzenesulfonate |
| 120-20-7 |
3,4-Dimethoxy-Benzeneethanamine |
| 12027-06-4 |
Ammonium Iodide |
| 12029-98-0 |
IODINE PENTOXIDE |
| 120-43-4 | N-Carbethoxy piperazine |
| 120464-26-8 |
1-(Perfluorohexyl)oct-1-ene |
| 120464-27-9 |
1-(Perfluorohexyl)dec-1-ene |
| 120-47-8 | Ethyl -4-Hydroxybenzoate |
| 120-51-4 | Benzyl Benzoate |
| 1205-64-7 |
3-Methyl Diphenylamine |
| 120-61-6 | Dimethyl Terephthalate |
| 1206-46-8 |
Trimethyl(pentafluorophenyl)silane |
| 120695-82-1 |
2-Iodo-1-(perfluorohexyl)hexane |
| 120-71-8 |
p-Cresidine |
| 120-72-9 | Indole |
| 120-75-2 | 2-Methylbenzothiazole |
| 120-78-5 | 2,2'-Dithiobisbenzothiazole |
| 120801-75-4 |
Trimethylsilyl2-(fluorosulphonyl)difluoroacetate |
| 120-80-9 |
Pyrocatechol |
| 120-82-1 | 1,2,4-Trichlorobenzene |
| 120-83-2 |
2,4-Dichlorophenol |
| 120-94-5 | N-Methylpyrrolidine |
| 120118-14-1 | 4-Chloro-5-p-tolylimidazole-2-carbonitrile |
| 12018-10-9 | Copper Chromite |
| 121-01-7 |
2-Amino-5-Nitrobenzotrifluoride |
| 121-03-9 | 4-Nitrotoluene-2-sulfonic acid |
| 121-05-1 |
2-aminoethyldiisopropylamine |
| 121088-09-3 |
1,4-Bis(tert-butoxy)tetrafluorobenzene |
| 121099-07-8 |
Triisopropylphosphonium tetrafluoroborate |
| 1211120-17-0 |
2-Bromo-2,2-difluoroethylamine hydrochloride |
| 121-17-5 |
4-Chloro-3-Nitrobenzotrifluoride |
| 121-18-6 | 4-Chloro-3-nitrobenzenesulfonic acid |
| 121373-20-4 |
Bis[2-(trimethylsilyl)ethyl] N,N-diisopropylphosphoramidite |
| 121-47-1 | Metanilic acid |
| 12150-46-8 |
1,1′-Bis(diphenylphosphino)ferrocene |
| 121-50-6 |
3-Amino-4-Chlorobenzotrifluoride |
| 121-51-7 | 3-Nitrobenzenesulphonyl chloride |
| 121-54-0 |
Benzethonium chloride |
| 121-57-3 | Sulfanilic acid |
| 121629-14-9 |
Cyclohexanecarboxylic acid, 4,4-difluoro-, methyl ester |
| 121-71-1 | 3'-Hydroxyacetophenone |
| 121-71-1 | 3-Hydroxy Acetophenone |
| 121-73-3 | 1-Chloro-3-nitrobenzene |
| 121-79-9 |
Propyl gallate |
| 121-87-9 | OCPNA 2-CHLORO-4-NITROANILINE |
| 121-88-0 | 2-Amino-5-nitrophenol |
| 121-90-4 | Meta nitro benzoyl Chloride |
| 121-90-4 | m-Nitrobenzoyl chloride |
| 121-92-6 | Meta nitro benzoic acid |
| 12124-97-9 | Ammonium Bromide |
| 121482-73-3 | 4,5:4',5'-Dibenzo-1,1'-dibutyl-3,3,3',3'-tetramethylindadicarbocyanine perchlorate |
| 1215223-23-6 | 2-(4-aminophenoxy)-5-aminobiphenyl |
| 121888-69-5 | 1,4-Bis[4-(2-methacryloxyethyl)phenylamino]-9,10-anthraquinone |
| 121954-50-5 |
1,2-Bis(di-tert-butylphosphinomethyl)benzene |
| 122-00-9 | 4 Methyl Acetophenone |
| 122-01-0 |
4-Chlorobenzoyl Chloride |
| 122030-04-0 |
2,4,6-Trifluorobenzotrifluoride |
| 122033-54-9 |
4-Bromo-2,3,5,6-tetrafluorobenzoyl chloride |
| 122-04-3 | p-Nitrobenzoyl Chloride |
| 122-07-6 |
methylaminoacetaldehyde dimethyl acetal |
| 122-31-6 | 1,1,3,3-Tetraethoxypropane |
| 122-39-4 |
Diphenylamine |
| 122-40-7 | α-Amylcinnamaldehyde |
| 122502-50-5 |
3-(2-Chloro-1,1,2-trifluoroethoxy)-1,2-propeneoxide |
| 122502-53-8 |
3-(1,1,2,3,3,3-Hexafluoropropoxy)-1,2-propenoxide |
| 122509-72-2 |
6-Chloro-5-fluoroindole |
| 122-51-0 | Triethyl Orthoformate |
| 122-60-1 | Phenyl Glycidyl Ether |
| 122-62-3 | Dioctyl Sebacate |
| 122-63-4 | Benzyl Propionate |
| 122665-97-8 |
4,4-Difluorocyclohexanecarboxylic acid |
| 122708-97-8 |
Bis(3,5-dimethyl-4-methoxyphenyl)phosphine |
| 122-80-5 |
p-Aminoacetanilide |
| 122814-62-4 |
2-(Pentafluoroethyl)-2-(trifluoromethyl)-1,3-dioxolane |
| 122-84-9 | 4-Methoxyphenylacetone |
| 122894-73-9 |
Ethyl 2,3,4,5-tetrafluorobenzoate |
| 122957-33-9 |
4-[N-(4-Cyanophenyl)amino]-3-nitropyridine |
| 122-97-4 | Phenyl Propyl Alcohol |
| 122-99-6 | Phenoxy Ethanol Pure |
| 1220-78-6 | 2,2-Bis-(3-amino-4-hydroxyphenyl)propane |
| 12224-98-5 | Pigment Red 81 |
| 12237-62-6 | PIGMENT VIOLET 27 |
| 12237-63-7 | Pigment Red 169 |
| 12239-87-1 | Pigment Blue 15:2 |
| 1226-46-6 | 4,4´-Bis(dimethylamino)thiobenzophenone |
| 1228468-74-3 | bis(4-(dibenzo[b,d]furan-2-yl)phenyl)amine |
| 122860-33-7 | N-Cbz-4-(hydroxymethyl)piperidine |
| 122-96-3 |
N,N’-bis(2-hydroxyethyl)piperazine |
| 122980-86-3 |
3(5)-Difluoromethyl-5(3)-phenylpyrazole |
| 123-04-6 |
3-(chloromethyl)heptane |
| 123-08-0 |
4-Hydroxybenzaldehyde |
| 123-11-5 | Para Anisyl Aldehyde |
| 123-28-4 | Didodecyl 3,3'-Thiodipropionate |
| 123-30-8 | 4-Aminophenol |
| 123-31-9 | Hydroquinone |
| 123343-16-8 |
Pyrithiobac-sodium |
| 123-35-3 | Myrcene |
| 123-42-2 | Diacetone Alcohol |
| 123-51-3 | Iso Amyl Alcohol Flavour Grade |
| 123-54-6 | Acetyl Acetone |
| 123-56-8 | Succinimide |
| 123-61-5 | 1,3-Phenylene diisocyanate |
| 123629-51-6 |
5H,5H,6H,6H,7H,7H,8H,8H-Perfluoro(4,4,9,9-tetramethyldodecane) |
| 123-68-2 | Allyl Hexanoate (Allyl Caproate) |
| 123-75-1 | Pyrrolidine |
| 123-92-2 | Iso Amyl Acetate |
| 123174-58-3 | Fluorescence Red |
| 123334-15-6 | 1H-Indole-3-methanol HCl |
| 123560-52-1 | 1-Ethoxy--2, 3-difluoro-4-[[(trans, trans)-4'-propyl[1, 1'-bicyclohexyl]-4-yl] methoxy] benzene1-Ethoxy--2, 3-difluoro-4-[[(trans, trans)-4'-propyl[1, 1'-bicyclohexyl]-4-yl] methoxy] benzene |
| 12389-75-2 | DTPA-FeNa |
| 1239-45-8 |
Ethidium Bromide |
| 1239478-87-5 |
5-[Di(1-adamantyl)phosphino](1,3,5-triphenyl-1H-pyrazol-4-yl)-1H-pyrazole |
| 123950-44-7 |
4-Amino-2,6-difluorobenzotrifluoride |
| 123-95-5 |
N-Butyl Stearate |
| 123968-25-2 | 2-Propenoic acid, 2-(1-(3,5-bis(1,1-dimethylpropyl)-2-hydroxyphenyl)ethyl)-4,6-bis(1,1-dimethylpropyl)phenyl ester |
| 123973-33-1 |
2-Amino-4,6-difluorobenzotrifluoride |
| 1239972-69-0 |
3(5)-Nonafluorobutyl-5(3)-(trifluoromethyl)pyrazole |
| 124-02-7 |
diallylamine |
| 1240309-75-4 |
3(5)-Perfluorohexyl-5(3)-(trifluoromethyl)pyrazole |
| 124-04-9 | Adipic Acid |
| 124-13-0 | n-Octanal (Aldehyde C8) |
| 1241-94-7 |
DIPHENYL ISOOCTYL PHOSPHATE |
| 124-19-6 | Nonanal (Aldehyde C9) |
| 124-41-4 | Sodium Methylate |
| 124-42-5 |
Acetamidine Hcl |
| 1244856-02-7 |
1-(6-Chloroperfluorohexyl)trifluoroethanesultone |
| 1244856-03-8 |
4-(2,3-Dibromopropyl)-2,3,5,6-tetrafluorobenzoic acid |
| 1244856-04-9 |
Trimethylsilyl perfluoroheptanoate |
| 1244856-06-1 |
Trimethylsilyl perfluorononanoate |
| 1244856-07-2 |
1-(4-Chlorooctafluorobutyl)trifluoroethanesultone |
| 1244856-09-4 |
4-(2,3-Dibromopropyl)-2,3,5,6-tetrafluorobenzotrichloride |
| 1244856-10-7 |
4-(2,3-Dibromopropyl)-2,3,5,6-tetrafluorobenzotrifluoride |
| 1244856-11-8 |
2,2,3,3,4,4,4-Heptafluorobutyl perfluoroheptanoate |
| 124699-32-7 |
2-Pentafluoroethyl-4,5-dichloro-2,4,5-trifluoro-1,3-dioxolane |
| 124729-02-8 | 1-ethoxy-2, 3-difluoro-4-(4-pentylcyclohexyl) benzene |
| 124-73-2 |
1,2-Dibromotetrafluoroethane |
| 124898-13-1 |
Trimethyl(pentafluoroethyl)silane |
| 125042-82-2 |
Bis[1-chloro-2,2,2-trifluoro-1-(trifluoromethyl)ethyl] disulfide |
| 125070-38-4 |
4,4,5,5,6,6,7,7,7-Nonafluoroheptane-1,2-diol |
| 125-20-2 |
Thymolphthalein |
| 125353-44-8 |
(S)-2-Amino-1,1,1-trifluoropropanehydrochloride |
| 125370-60-7 |
3-(1H,1H,9H-Perfluorononyloxy)-1,2-propenoxide |
| 125401-75-4 |
Bispyribac |
| 125401-92-5 |
Bispyribac-sodium |
| 125-83-7 | Sebacic Acid Dihydrazide |
| 125051-32-3 | Bis(cyclopenta-1,3-diene)bis(1-(2,4-difluorophenyl)-3H-pyrrol-3-yl)titanium |
| 1255308-97-4 | 5H-benzo[4,5]thieno[3,2-c]carbazole |
| 125643 -61 -0 | Octyl-3.5-di-tert-butyl-4-hydroxy-hydrocinnamate |
| 125643-61-0 | Octyl-3.5-di-tert-butyl-4-hydroxy-hydrocinnamate |
| 1257220-44-2 | 7-bromo-12,12-dimethyl-10-phenyl-10,12-dihydroindeno[2,1-b]carbazo |
| 1259-35-4 |
Tris(pentafluorophenyl)phosphine |
| 125962-80-3 | 4-[4-(2-methyiphenyl) cyclohexyl] cyclohexan-1-one |
| 126015-32-5 |
3,3,4,4,5,5,5-Heptafluoropentanal |
| 126050-54-2 | 2,2'-Methylenebis(4,6-di-tert-butylphenyl) 2-ethylhexyl phosphite |
| 1262046-34-3 |
2-(Di-t-butylphosphino)-3-methoxy-6-methyl-2′,4′,6′-triisopropyl-1,1′-biphenyl |
| 126213-50-1 | 3,4-Ethylenedioxythiophene |
| 126266-75-9 |
1,1-Dichloro-3,3,3-trifluoroacetone hydrate |
| 1263044-00-3 |
Limonene trisiloxane |
| 126325-46-0 |
2-Amino-3-bromo-6-methylpyridine |
| 1264-62-6 | Erythromycin Ethylsuccinate |
| 1264175-54-3 | 3-(2-Hydroxyethyl)-2-(2-methylthio-1-butenyl)-5-methylbenzothiazolium methylsulfate |
| 126-71-6 |
TRIISOBUTYL PHOSPHATE |
| 126764-17-8 | 1-Chloro-6,6-dimethyl-5-hept-2-en-4-ino |
| 126828-28-2 |
2-Chloro-1,6-dibromo-1,1,2-trifluorohexane |
| 126828-29-3 |
6-Bromo-1,1,2-trifluorohex-1-ene |
| 126-86-3 |
2,4,7,9-Tetramethyl-5-Decyne-4,7-Diol |
| 127117-30-0 |
1-Bromo-1,1,2,2-tetrafluorobutane |
| 127-21-9 |
1,3-Dichlorotetrafluoroacetone |
| 127294-77-3 |
3-methylaminopiperidine dihydrochloride |
| 127306-59-6 |
Ethyl2-Fluoro-propionate |
| 127-41-3 | α-Ionone |
| 127-42-4 | Alpha-Methylionone |
| 127-43-5 | Beta-Methyl ionone |
| 1274903-33-1 |
Ammonium 2-aminohexafluoroisopropoxide |
| 1274903-97-7 |
1-Bromo-3,4,4,4-tetrafluoro-3-(trifluoromethyl)butane |
| 127-51-5 | Gamma Methyl Ionone (70% & 95%) |
| 127589-63-3 |
Methyl 3-chlorotetrafluoropropionate |
| 127-68-4 | Sodium-m-nitrobenzenesulfonate |
| 127786-29-2 | 3-Amino-9,13b-dihydro-1-H-dibenzo[c,f]imidazio[1,5-a] azepine.HBr |
| 127852-28-2 | (R)-1-[Bis-3,5-(trifluoromethyl)phenyl]ethanol |
| 128-04-1 | N-(1,3-dimethyl-buty)-N'-phenyl-p-phenylenediamine |
| 128071-98-7 |
2-Fluoro-4-bromopyridine |
| 128-08-5 |
N-Bromosuccinimide |
| 128-09-6 |
N-Chlorosuccinimide |
| 128227-97-4 |
Ethyl 2-methyl-4,4,4-trifluorocrotonate |
| 128-37-0 | 2,6-Di-tert-butyl-4-methylphenol |
| 128-42-7 | 4,4'-Diaminostilbene-2,2'-disulphonic acid |
| 1281-00-1 | 3-Dimethylaminopropylchloride hydrochloride 65% solution |
| 128454-91-1 |
3,3-Bis(trifluoromethyl)-1-bromo-4,4,5,5,6,6,6-heptafluorohexane |
| 128454-94-4 |
3,3-Bis(trifluoromethyl)-1-bromo-4,4,5,5,6,6,6-heptafluorohex-1-ene |
| 128575-34-8 |
1,1′-Bi-2-naphthol bis(trifluoromethanesulfonate) |
| 128753-68-4 |
Benzyl-N,N-diisopropylchlorophosphoramidite |
| 128818-49-5 | 4-[(E)-phenyldiazenyl]phenyl-2-methacrylate |
| 128-93-8 |
1-Bromo-4-(methylamino)-anthraquinone |
| 129135-87-1 |
Potassium bis-nonafluoro-1-butanesulfonimidate, |
| 129257-23-4 |
5(3)-Methyl-3(5)-(perfluorohexyl)pyrazole |
| 129587-49-1 |
1-Bromo-4-iodo-1,1,2,2-tetrafluorobutane |
| 129-64-6 |
Nadic anhydride |
| 129670-05-9 |
4-(2-Chloro-1,1,2-trifluoroethoxy)-2-methylphenol |
| 129757-67-1 | Decanedioic acid, bis(2,2,6,6-tetramethyl-4-piperidinyl) ester, reaction products with tert-Bu hydroperoxide and octane |
| 129722-34-5 |
7-(4-Bromobutoxy)-3,4-dihydro-2(1H)-quinolinone |
| 129808-00-0 | 4,4'-(Ethyne-1.2-diyl)diphthalic Anhydride |
| 129909-90-6 | Amicarbazone |
| 129-96-4 |
chromotropic acid disodium salt |
| 129991-14-6 |
4,4-Bis(trifluoromethyl)-5,5,6,6,7,7,7-heptafluoroheptanoic acid |
| 1300-16-9 |
4-(2,6-Dimethylheptyl)phenol |
| 130049-82-0 |
3-(2-CHLOROETHYL)-9-HYDROXY-2-METHYL-6,7,8,9-TETRAHYDRO-4H-PYRIDO[1,2-A]PYRIMIDIN-4-ONE |
| 130137-05-2 |
4,5-DIFLUORO-2-IODOBENZOIC ACID |
| 130-14-3 | Sodium 1-Naphthalenesulfonate |
| 130-16-5 |
5-Chloro-8-hydroxyquinoline |
| 130-17-6 |
Dehydrothio-p-toluidinesulfonic acid |
| 130-23-4 | European k acid |
| 130284-53-6 |
5-Amino-2-chloro-3-bromopyridine |
| 130290-79-8 |
4-aminomethyltetrahydropyran |
| 13035-19-3 |
4-aminopiperidine |
| 13038-21-6 |
8-Nonen-1-ol |
| 13038-26-1 |
Methyl perfluoropentanoate |
| 130-85-8 | Pamoic Acid |
| 13005-36-2 | Potassium Phenylacetate |
| 1303-86-2 | Diboron Trioxide |
| 130345-50-5 | Quinoxaline-6-carboxaldehyde |
| 13036-02-7 | Dimethyl 5-hydroxyisophthalate |
| 13040-19-2 | Zinc bis[(9Z,12R)-12-hydroxyoctadec-9-enoate] |
| 13043-05-5 | Perfluoro-2,5-dimethyl-3,6-dioxanonanoic acid Ammonium Salt |
| 13057-08-4 |
Heptafluoroisopropyl acrylate |
| 13057-17-5 | Bromomethyl methyl ether |
| 13061-96-6 | Methylboronic acid |
| 130676-81-2 |
Triethoxy[4,4-bis(trifluoromethyl)-5,5,6,6,7,7,7-heptafluoroheptyl]silane |
| 130760-25-7 |
Perfluoro(2-ethyl-2-methyl-1,3-dioxole) |
| 13080-86-9 | 2,2-Bis[4-(4-aminophenoxy)phenyl]propane |
| 13080-89-2 | Bis[4-(4-aminophenoxy)phenyl]sulfone |
| 13081-18-0 | Ethyl trifluoropyruvate （E-TFPA） |
| 13085-73-9 | 3,3'-Bis(2-hydroxyethyl)-5,5'-dimethoxy-9ethylthiacarbocyanine bromide |
| 13086-84-5 |
Di-tert-butyl phosphite |
| 13089-11-7 | Methyl 3.3.3-trifluoropyruvate |
| 1309-42-8 | Magnesium Hydroxide |
| 1309602-05-8 |
Methyl 3-(2,2,3,3,4,4,5,5-octafluoropentoxy)propionate |
| 1309602-07-0 |
2-Chloro-5-(1,1,2,2-tetrafluoroethoxy)phenylacetic acid |
| 1309602-08-1 |
Isopropyl 2-hydroxy-3,3,3-trifluoro-2-(trifluoromethyl)propionate |
| 1309602-14-9 |
2-Methyl-4,4,5,5,6,6,7,7,7-nonafluorohept-2-ene |
| 1309602-60-5 |
Dimethoxybis(4-perfluorotolyl)silane |
| 1309602-61-6 |
1,4-Diisopropoxytetrafluorobenzene |
| 1309602-63-8 |
Ethyl 3-chloro-4,4,4-trifluorobutyrate |
| 1309602-68-3 |
2-Iodo-3,3,3-trifluoropropyl chlorosulfate |
| 1309602-70-7 |
4-(Dimethylamino)-2,3,5-trifluorobenzoic acid |
| 1309602-72-9 |
2-Bromo-2-iodo-1,1,1-trifluoropropane |
| 1309602-75-2 |
4-(Dibromomethyl)heptafluorotoluene |
| 1309602-76-3 |
Trimethylsilyl 2-(2-bromotetrafluoroethoxy) tetrafluoropropionate |
| 1309602-83-2 |
Potassium 2,2,3,4,4,4-hexafluorobutyrate |
| 13098-39-0 |
Hexafluoroacetone sesquihydrate |
| 1310-58-3 |
Potassium hydroxide |
| 1310584-14-5 |
Chloro(2-dicyclohexylphosphino-2′,4′,6′-triisopropyl-1,1′-biphenyl)[2-(2′-amino-1,1′-biphenyl)]PdII |
| 131-11-3 | Dimethyl phthalate |
| 131-27-1 |
2-Aminonaphthalene-4,8-disulfonic acid |
| 131274-22-1 |
Tri(tert-butylphosphonium)tetrafluoroborate |
| 13129-23-2 |
3-Furan Carboxylic Acid Methyl ester |
| 131341-86-1 |
4-(2,2-difluoro-1,3-benzdioxol-4-yl)-1h-pyrrole-3-carbonitrile |
| 13140-20-0 |
Perfluoro-2-methyl-3-oxahexane-1,6-dioyl difluoride |
| 13140-21-1 |
Perfluoro-2,8-dimethyl-3,7-dioxanonane-1,9-dioyl difluoride |
| 13140-24-4 |
Perfluoro-2,5,8,11,14,17-hexamethyl-3,6,9,12,15,18-hexaoxaheneicosanoyl fluoride |
| 13140-34-6 |
Methyl perfluoro(2-methyl-3-oxahexanoate) |
| 13140-35-7 |
Perfluoro(2-methyl-3-oxahexan)amide |
| 1314-23-4 |
Zirconium Dioxide |
| 1314-36-9 |
Yttrium(Ⅲ) oxide |
| 1314914-15-2 |
2-Acetoxy-4,4,4-trifluorobutyronitrile |
| 1314994-88-1 |
5,5,5-Trifluoropent-2-enoic acid |
| 131-55-5 | 2,2',4,4'-Tetrahydroxybenzophenone |
| 131-56-6 | 2,4-Dihydroxybenzophenone |
| 13161-30-3 |
2-Hydroxypyridine -n-oxide |
| 131628-34-7 |
3,4,4,4-Tetrafluoro-3-(heptafluoropropoxy)but-1-ene |
| 13175-44-5 |
7-octen-1-ol |
| 131803-37-7 |
1,4-Bis(chloromethyl)tetrafluorobenzene |
| 131-91-9 | 1-Nitroso-2-naphthol |
| 13139-17-8 | N-(Benzyloxycarbonyloxy)succinimide |
| 1314136-05-4 | 3-(2-Hydroxyethyl)-2-[2-(2-hydroxyethyl)-1-butenyl]-5-methylbenzothiazolium perchlorate |
| 131443-20-4 | 1,1'-Dibutyl-3,3,3',3'-tetramethylindadicarbocyanine perchlorate |
| 131512-74-8 | 2-Ethylhexyl alpha-cyano-5-phenyl-2,4-pentadienoate |
| 1316-98-9 | t-Butylferrocene |
| 13167-25-4 | N-(2,4,6-Trichloropehnyl)maleimide |
| 131707-24-9 | Ethyl 6-bromo-5-hydroxy-1-methyl-2-(phenylsulfanylmethyl)indole-3-carboxylate |
| 13171-18-1 | Hexafluoroisopropyl methyl ether （HFMOP） |
| 13189-00-9 | Zinc dimethacrylate |
| 13195-64-7 | Diisopropyl Malonate |
| 132123-54-7 |
3,4,5-Trifluorobenzaldehyde |
| 132-27-4 | Sodium 2-biphenylate |
| 13252-15-8 |
Perfluoro-2,5,8,11,14-pentamethyl-3,6,9,12,15-pentaoxaoctadecanoyl fluoride |
| 132-53-6 | 2-Nitroso-1-naphthol |
| 132539-06-1 |
OLANZAPINE |
| 132-54-7 | Phenyl 1-hydroxy-2-naphthoate |
| 13209-15-9 | α,α,α',α'-Tetrabromo-o-xylene |
| 132123-39-8 | 1,2, 3-trifluoro-5-[4-(4-propylcyclohexyl) phenyl] benzene |
| 132182-92-4 | 1,1,1,2,2,3,4,5,5,5-Decafluoro-3-methoxy-4-(trifluoromethyl)pentane；C6ME |
| 13228-39-2 | N-Ethyl-2-phenylindole |
| 132310-86-2 | 2-(4-propylcyclohexyl) propane-1, 3-diol |
| 1325-88-8 | PIGMENT BLUE 14 |
| 13252-13-6 | Perfluoro(2-methyl-3- oxahexanoic) acid |
| 13252-14-7 | Perfluoro-2,5-dimethyl-3,6-dioxanonanoic acid(PFDA) |
| 132557-73-4 | 5-Sulfo-2,3,3-trimethylindolenine |
| 13265-56-0 |
4,4,5,5,5-Pentafluoropentanenitrile |
| 13269-19-7 |
3-Amino-2-nitropyridine |
| 1327-33-9 | Antimony Trioxide |
| 1328-51-4 | SOLVENT BLUE 38 |
| 1328-53-6 | Pigment Green 7 |
| 132885-85-9 | HC BLUE 12 |
| 13289-97-9 | N,N-Diethylaniline Borane |
| 13292-87-0 | Dimethyl sulfide borane |
| 1330-43-4 | Sodium Borate |
| 1330-78-5 | Tricresyl phosphate |
| 133-08-4 |
diethyl butylmalonate |
| 133-13-1 |
diethyl ethylmalonate |
| 1332-07-6 | Zinc Borate |
| 133232-58-3 |
4-IODO-2-METHYLBENZOIC ACID |
| 13325-10-5 | 4-Amino-1-butanol |
| 133291-73-3 |
Ethyl 2,2,3,3-tetrafluoropropionylacetate |
| 13329-40-3 |
4-IODOACETOPHENONE |
| 133307-08-1 |
5-IODO-1,3-DICHLORO-2-FLUOROBENZENE |
| 133310-72-2 |
1-(Perfluorooctyl)tetradecane |
| 133-32-4 |
Indole 3 Buytric Acid |
| 133331-77-8 |
1-(Perfluorohexyl)octane |
| 13349-82-1 | 1-[2-(2-hydroxyethoxy)-ethyl]piperazine |
| 133-53-9 |
2,4-Dichloro-3,5-dimethylphenol |
| 1335-47-3 | Ditolyl methane |
| 1335-66-6 |
Isocyclocitral |
| 133609-46-8 |
Methyl perfluoro(2,5,8,11-tetramethyl-3,6,9,12-tetraoxapentadecanoate) |
| 13361-30-3 | Isopropyl Cyanoacetate |
| 13361-31-4 | Isobutyl Cyanoacetate |
| 13361-32-5 | Allyl Cyanoacetate |
| 13361-34-7 | 2-Ethylhexyl Cyanoacetate |
| 13361-53-0 | n-Hexyl Cyanoacetate |
| 13362-52-2 |
1,13-Tridecanediol |
| 133627-45-9 |
2-Chloro-3-amino-4-methylpyridine |
| 13371-17-0 | Buthyltriphenylphosphonium chloride |
| 133745-75-2 |
N-Fluorobenzenesulphonimide |
| 13380-89-7 |
Octahydro-4,7-Methano-1H-Inden-5-ol |
| 133-91-5 |
3,5-diiodosalicylic acid |
| 133986-51-3 | 2,2'-(Hydroxyimino)-bis-(ethanesulfonicacid)disodium salt |
| 134-20-3 | Methyl Anthranilate |
| 134039-54-6 | 5-Iodo-1,3,6-trimethyluracii |
| 13406-29-6 |
Tris(4-trifluoromethylphenyl)phosphine |
| 13410-01-0 |
Sodium Selenate |
| 134150-01-9 | 4-Propyiphenylboronic acid |
| 134-32-7 |
1-naphthylamine |
| 13453-24-2 |
GOLD (III) IODIDE |
| 134612-84-3 | 4'-Chloro-3,4-Dihydroxybenzophenone. |
| 1346176-00-8 |
4-Iodo-1,1,1-trifluoro-2-(trifluoromethyl)butane |
| 13462-90-3 |
Nickel Iodide Anhydrous |
| 13466-38-1 |
2-Hydroxy-5-bromopyridine |
| 13466-41-6 |
2-Hydroxy-4-methylpyridine |
| 13466-43-8 |
3-Bromo-2-hydroxypyridine |
| 13472-79-2 |
2-Hydroxy-5-iodopyridine |
| 13472-81-6 |
3,5-Dibromo-2-hydroxypyridine |
| 13472-85-0 |
2-Methoxy-5-bromopyridine |
| 134-85-0 |
4-Chlorobenzophenone |
| 13485-61-5 |
Nonafluoropentanamide |
| 134892-46-9 | 5-Bromo-6-isothiocyanatoquinoxaline |
| 134947-25-4 |
1-Benzoyl-3,5-bis(trifluoromethyl)pyrazole |
| 1350637-03-4 |
4,4-Bis(trifluoromethyl)-2-iodo-5,5,6,6,7,7,7-heptafluoroheptan-1-ol |
| 1350637-05-6 |
3-Chloro-2,4,5,6-tetrafluorobenzotrichloride |
| 1350637-06-7 |
2,3-Difluoro-2-(nonafluorobutyl)oxirane |
| 1350637-12-5 |
(2,3-Dibromopentafluoropropyl)pentafluorobenzene |
| 1350637-13-6 |
3,5-Dichloro-2,4,6-trifluorobenzotrichloride |
| 1350637-14-7 |
2,3-Difluoro-2-(perfluorohexyl)oxirane |
| 1350637-16-9 |
4-Ethoxy-2,3,5,6-tetrafluorostyrene |
| 1350637-17-0 |
1-Allyl-4-bromo-2,3,5,6-tetrafluorobenzene |
| 1350637-23-8 |
4,5,5,6,6,6-Hexafluoro-2-iodo-4-(trifluoromethyl)hexan-1-ol |
| 135139-00-3 |
(S)-(-)-2,2′-Bis[bis(3,5-dimethylphenyl)phosphino]-1,1′-binaphthyl |
| 135-19-3 | 2-Naphthol |
| 135206-84-7 |
2,2-Difluoroethyl p-toluenesulfonate |
| 13534-89-9 |
2,3-Dibromopyridine |
| 13534-97-9 |
5-Amino-2-bromopyridine |
| 13534-99-1 |
2-Amino-3-Bromopyridine |
| 13535-01-8 |
3-Amino-5-bromopyridine |
| 135-51-3 | R-Acid,disodium salt |
| 135-57-9 | o,o'-Dibenzamidodiphenyl disulfide |
| 135-61-5 | 3-Hydroxy-2'-methyl-2-naphthanilide |
| 135-65-9 | 3-Hydroxynaphthalene-2-carbonyl (3-nitrophenyl) amine |
| 135252-10-7 | N-[2,6-bis(1-methylethyl)-4-phenoxyphenyl]thiourea |
| 13539-13-4 | 2,5-bis(octyldithio)-1,3,4-thiadiazole |
| 13544-43-9 | 6-(Trifluoromethyl)indole |
| 13547-70-1 | 1-CHLOROPINACOLONE |
| 13558-31-1 | Rhodamine 110 |
| 135-76-2 |
Sodium 2-Naphthol-6-sulfonate Hydrate |
| 1358071-65-4 | 4-(4-Phenyl-piperazin-1-yl)-benzene-1, 3-diamine |
| 135841-49-5 |
Trimethyl(tridecafluorohexyl)silane |
| 135841-49-5 |
Trimethyl(perfluorohexyl)silane |
| 135984-68-8 |
2H,2H-Perfluorodecanal |
| 135861-56-2 | 1,3:2,4-Bis(3,4-dimethylobenzylideno) sorbitol |
| 136-23-2 | Zinc dibutyl dithiocarbamate(ZDBC,BZ) |
| 136-30-1 | Sodium dibutyldithiocarbamate |
| 136-47-0 | Tetracaine hydrochloride |
| 136049-37-1 |
Trimethylsilyl perfluoro(2-ethoxyethane)sulfonate |
| 136176-46-0 |
Sodium 7-chloroperfluoroheptanoate |
| 13623-25-1 |
6-Methoxy-1-indanone |
| 13634-93-0 |
4-Chlorotetrafluorothiophenol |
| 136403-80-0 |
2,2,3,3-Tetrafluoro-3-(1,2,2-trifluoroethenyloxy)-propan-1-ol |
| 13642-97-2 |
Pentafluorophenyl methacrylate |
| 136434-77-0 |
3-FLUORO-4-BROMOIODOBENZENE |
| 13648-79-8 |
Bis(pentafluorophenyl)bromophosphine |
| 136496-72-5 |
4-Carboxy-3-chlorophenylboronic acid |
| 13656-36-5 |
3,5-Dichloro-2,4,6-trifluorobenzoic acid |
| 136564-76-6 |
Ethyl 2-methyl-4,4,4-trifluorobutyrate |
| 136564-78-8 |
2-Methyl-4,4,4-trifluorobutyryl chloride |
| 136-85-6 | 5-Methylbenzotriazole |
| 136-95-8 | 2-Аminobenzothyasol |
| 13601-19-9 | Sodium Ferrocyanide |
| 136735-95-0 |
(S,S)-Methyl DuPhos |
| 13674-84-5 | Tris(chloropropyl) phosphate |
| 13676-47-6 | 2-(4-aminophenyl)5-amino-benzoxazole |
| 13676-49-8 | 2-(3-aminophenyl)-5-aminobenzimidazole |
| 136-77-6 |
4-hexyl-1,3-benzenediol |
| 136779-28-7 |
1,2-Bis((2S,5S)-2,5-diethylphospholano)benzene |
| 136802-85-2 |
Bis(3,5-dimethyl-4-methoxyphenyl)chlorophosphine |
| 13685-24-0 |
Bis(4-trifluoromethylphenyl)chlorophosphine |
| 13685-30-8 |
Bis(4-methoxyphenyl)chlorophosphine |
| 13688-56-7 | Trimethylsilyl methacrylate |
| 136909-72-3 |
4,4,5,5,6,6,6-Heptafluorohexan-2-one |
| 13695-31-3 |
2,2,3,3,4,4,4-Heptafluorobutyl methacrylate |
| 136997-71-2 | 1-Dimethylcarbamoyl-4-4(2-sulfoethyl)-pyridinium betaine |
| 136997-71-2 | 1-Dimethylcarbamoyl-4-(2-sulfoethyl)pyridinium betaine |
| 137131-12-5 |
Ethyl 5,5,5-trifluoropent-2-enoate |
| 137156-22-0 |
(S)-(+)-1,1′-Binaphthyl-2,2′-dioxychlorophosphine |
| 13716-10-4 |
Di-tert-butylchlorophosphine |
| 137219-86-4 |
(R)-(+)-2,2′-Bis[bis(3,5-dimethylphenyl)phosphino]-1,1′-binaphthyl |
| 137-26-8 | Tetramethyl thiuram disulfide |
| 137-29-1 | Copper dimithyl dithlocarbamate |
| 137-30-4 | Zinc dimethyl dithiocarbamate(ZDMC,PZ,ZDMD) |
| 137348-86-8 |
Di-tert-butyl N,N-diisopropylphosphoramidite |
| 137-43-9 | bromocyclopentane |
| 137506-19-5 |
N-(2-Hydroxyethyl)perfluoro(2,5-dimethyl-3,6-dioxanonan)amide |
| 137-51-9 | Aniline-2,4-disulfonic acid |
| 13755-38-9 |
Nitroprusside-disodium-dihydrate |
| 137628-16-1 |
3-Bromo-5-chloropyridin-2-ol |
| 137-66-6 | Ascorbyl palmitate |
| 13708-12-8 | 5-Methylquinoxaline |
| 137107-72-3 | 3-Butyl-1,1,2-trimethyl-1H-benz[e]indoliumiodide |
| 137147-59-2 | 4,5:4',5'-Dibenzo-1,1'-dibutyl-3,3,3',3'-tetramethylindadicarbocyanine hexafluorophosphate |
| 13736-22-6 | Sodium 4-formylbenze |
| 137398-54-0 | Diisopropyl xanthogen polysulphide |
| 13749-61-6 | n-isopropylmethacrylamide |
| 13774-81-7 | Borane Ammonia Complex |
| 1378864-58-4 |
3,4,4,4-Tetrafluoro-3-(trifluoromethoxy)butan-1-ol |
| 137897-99-5 | Bis(3,5-dichlorophenyl)disulfide |
| 1379295-32-5 |
4-Iodo-1,1,1,2,2-pentafluoropentane |
| 1379321-83-1 |
1-Chloro-3-iodo-1,1,2,2-tetrafluoropropane |
| 1379343-44-8 |
Trimethylsilyl 3,3,3-trifluoropropionate |
| 1379347-61-1 |
6-Bromo-1,1,1,2,2-pentafluorohexane |
| 1379358-31-2 |
Sodium 2,2,3,4,4,4-hexafluorobutyrate |
| 1379361-16-6 |
3,3,4-Tribromo-1,1,1,2,2-pentafluorobutane |
| 1379365-21-5 |
3-Iodo-5,5,5-trifluoropentan-1-ol |
| 138006-41-4 |
2,5-Dichloro-3-bromopyridine |
| 13846-22-5 |
Perfluoro-1,3-bis(vinyloxy)propane |
| 138526-69-9 |
1-Bromo-3,4,5-trifluorobenzene |
| 138564-58-6 |
2-AMINO-5-METHYLTHIOPHENE-3-CARBONITRILE |
| 138564-59-7 |
5-Methyl-2-(2-nitroanilino)-3-thiophenecarbonitrile |
| 138564-60-0 |
4-Amino-2-methyl-10H-thieno(2,3-b) (1,5)-benzodiazepine hydrochloride |
| 13859-31-9 |
2-Bromotetrafluoropropionic acid |
| 138-86-3 | d-Limonene |
| 13818-44-5 | 2-Methyl-2-Propenoic Acid (2-Oxo- 1,3-Dioxolan-4-yl) MethylEster |
| 13822-56-5 | 3-Aminopropyltrimethoxysilane |
| 13878-54-1 | Zinc bis(piperidine-1-carbodithioate) |
| 13889-98-0 | 1-ACETYL PIPERAZINE |
| 13897-55-7 |
4-METHYL-1,3'-CYCLOHEXANEDIAMINE |
| 1391033-22-9 |
7-Bromo-1,1,1,2,2,3,3-heptafluoroheptane |
| 1391033-23-0 |
5-Iodo-1,1,1,2,2,3-hexafluoro-3-(trifluoromethyl)heptane |
| 1391033-24-1 |
4-Methoxy-2,3,5,6-tetrfluorobenzotrichloride |
| 1391033-26-3 |
Methyl 1H,1H-perfluorohexyl ether |
| 1391033-28-5 |
4-Bromo-2,3,5,6-tetrafluorobenzotrichloride |
| 1391033-31-0 |
3-Iodo-5,5,6,6,7,7,8,8,9,9,9-undecafluorononan-1-ol |
| 1391033-32-1 |
4-Isopropoxy-2,3,5,6-tetrafluorostyrene |
| 1391033-36-5 |
Methyl 1H,1H-nonafluoropentyl ether |
| 139223-42-0 |
1-Bromo-6,6,7,7,8,8,8-heptafluoro-5,5-bis(trifluoromethyl)oct-2-ene |
| 13940-38-0 |
Sodium Para Periodate |
| 139-59-3 | 4-Phenoxyaniline |
| 139604-89-0 |
1-Iodo-1-(trifluoromethoxy)tetrafluoroethane |
| 139631-62-2 |
Cyclopropanesulfonyl chloride |
| 139-89-9 | HEDTA-3Na [N-(2-hydroxyethyl)ethylenediamine-N,N',N'-triacetic acid, trisodium salt, tryhydrate] |
| 13927-71-4 | Bis(dibutyldithiocarbamato-S,S')copper |
| 13927-77-0 | Nickel dibutyl dithiocarbamate |
| 139306-10-8 | (S)-3-[1-(Dimethylamino)ethyl]phenol |
| 13963-57-0 | Aluminum Acetyl Acetonate |
| 13980-76-2 | 1-(4-Methoxyphenyl)-5-mercaptotetrazole |
| 139903-87-0 |
5-Bromo-2-iodo-4,4,5,5-tetrafluoropentan-1-ol |
| 13991-08-7 |
1,2-Bis(diphenylphosphino)benzene |
| 13991-37-2 | Trans-2-Pentenoic Acid |
| 13999-39-8 | 3-Amino-4,5-dimethylisoxazole |
| 140-01-2 | DTPA-5Na |
| 140-11-1 | Benzyl Acetate |
| 140-22-7 | 1,5- Diphenilcarbaside, pfa |
| 140-26-1 | Phenyl Ethyl Iso Valerate |
| 140-29-4 | Benzyl Cyanide |
| 14035-96-2 |
dimethyl propylmalonate |
| 140-39-6 | Para Cresyl Acetate |
| 1404193-66-3 |
Perfluorohexanoyl bromide |
| 1404193-87-8 | Octafluoro-2-(fluorosulfonyl)pentanoyl fluoride |
| 1404193-88-9 | 3-(Perfluoropentyl)propan-1-ol |
| 1404194-04-2 | 9H-Perfluorononanoyl bromide |
| 140-53-4 | 4-Chloro Benzyl Cyanide |
| 140-75-0 | 4-Fluorobenzylamine |
| 14002-51-8 | 4-Biphenylcarbonyl chloride |
| 14025-15-1 | EDTA-CuNa2 |
| 14025-21-9 | EDTA-ZnNa2 |
| 14044-65-6 | Borane tetrahydrofuran |
| 1404491-67-3 | 2-(3,5-Dimethylphenyl)-5-Isobutylquinoline |
| 14064-10-9 | Diethyl Chloromalonate |
| 140647-19-4 |
1-Phenyl-3,5-bis(trifluoromethyl)pyrazole |
| 140681-55-6 |
1-(Chloromethyl)-4-fluoro-1,4-diazoniabicyclo[2.2.2]octanebis(tetrafluoroborate) |
| 14070-48-5 | 1-(3-Acetamidophenyl)-5-mercaptotetrazole |
| 140-82-9 |
2-(2-(diethylamino)ethoxy)ethanol |
| 141-04-8 | Diisobutyl ester of Nylon acid |
| 141-12-8 | Neryl Acetate |
| 14115-49-2 |
3,3-Bis(trifluoromethyl)-4,4,4-trifluorobutan-1-ol |
| 141-16-2 | Citronellyl butyrate |
| 14117-17-0 |
2,2-Bis(trifluoromethyl)-3,3,3-trifluoropropan-1-ol |
| 141522-69-2 |
1-Phenyl-2H,2H-perfluoroundecane-1,3-dione |
| 141-52-6 | Sodium Ethylate |
| 1415963-94-8 |
Potassium 9-chloroperfluorononanoate |
| 141680-53-7 |
2-Fluoroethyl acrylate |
| 141-75-3 | n-Butyryl chloride |
| 141-79-7 | Mesityl Oxide |
| 141-82-2 | 1,3-Propanedioic Aci |
| 141-84-4 | Rhodanine |
| 141460-19-7 | Dye N3 |
| 141-86-6 |
2,6-Diaminopyridine |
| 14188-94-4 |
3-Acetylpyridine-n-oxide |
| 141893-84-7 |
7H-Perfluoroheptanoyl bromide |
| 141914-99-0 | 1,2,3,3-Tetramethyl-benz[e]indolium tosylate |
| 141-95-7 |
Sodium malonate |
| 141977-66-4 |
1H,1H,-Perfluoro(2,5,8,11-tetramethyl-3,6,9,12-tetraoxapentadecan-1-ol) |
| 1420-40-2 |
DECAMETHONIUM IODIDE |
| 142-08-5 | 2-Hydroxypyridine |
| 1422-36-2 |
5,5,5-Trifluoro-4-(trifluoromethyl)pent-3-en-2-one |
| 1422-42-0 |
4,4,5,5,6,6,6-Heptafluoro-2-iodohex-2-en-1-ol |
| 142-25-6 | N,N,N’-Trimethylethylenediamine |
| 142-28-9 |
1,3-dichloropropane |
| 142-30-3 |
2,5-Dimethyl-3-Hexyne-2,5-Diol |
| 142421-57-6 |
Bis(3,5-ditrifluoromethylphenyl)chlorophosphine |
| 142-46-1 | 2,5-Dithiobiurea |
| 1426252-00-7 |
2,4,5,6-Tetrafluoro-3-(trifluoromethyl)benzyl chloride |
| 1426252-01-8 |
2,3,3,3-Tetrafluoropropanal hydrate |
| 1426252-03-0 |
4,4,5-Tribromo-1,1,1,2,2,3,3-heptafluoropentane |
| 142685-25-4 |
2,3,5,6-Tetrafluorophenyl trifluoroacetate |
| 142-68-7 |
Tetrahydropyran |
| 1428-33-7 |
Allyl 1,1,2,2-tetrafluoroethyl ether |
| 1428-41-7 |
Potassium octafluoroadipate |
| 142-90-5 |
Dodecyl methacrylate |
| 142-91-6 | Isopropyl palmitate |
| 1429188-77-1 |
5,5-Bis(trifluoromethyl)-6,6,7,7,8,8,8-heptafluoroocta-1,3-diene |
| 142-92-7 | Hexyl Acetate |
| 14206-62-3 | Sodium 3-Hydroxy-2-naphthoate |
| 14216-22-9 | N-ethyl-D-glucamine |
| 14239-68-0 | Cadmium diethyl dithiocarbamate |
| 1425710-74-2 | 4-(3-Vinylphenylazo)diphenylamine |
| 14273-90-6 | Methyl 6-bromohexanoate |
| 14283-07-9 | Lithium tetrafluoroborate in γ-Butyrolactone |
| 143062-83-3 |
(1R-CIS)2-Fluoro-Cyclopropanamine |
| 143062-84-4 |
Cyclopropanamine, 2-fluoro-,(1R,2S)-,4-methylbenzenesulfonate |
| 14312-89-1 |
Methyl perfluoroheptanoate |
| 143-15-7 | 1-bromododecane |
| 14324-82-4 |
Copper(II) 1,1,1-trifluoroacetylacetonate |
| 143-33-9 | Sodium Cyanide |
| 143173-90-4 | 3-Allyl-5-(N-ethylanilino)methylene-2thioxothiazolidin-4-one |
| 143174-04-3 | 8-Amino-2-(4-hydroxy-3-methylphenyl)azo-1naphthol-3,6-disulfonic acid disodium salt |
| 143193-48-0 | 1-(2-Chloro-5-sulfophenyl)-3-methyl-4-(4-dimethylaminobenzylidene)-2-pyrazolin-5-one triethylammonium salt |
| 143218-70-6 | 4,4'-Bis[bis(2-hydroxyethyl)amino]-4"-chlorotrityl chloride |
| 14324-55-1 | Zinc diethyl dithiocarbamate(ZDEC,EZ,ZDC) |
| 143254-82-4 | 1-chlorocarbonyl-4-piperidinopiperidine hydrochloride |
| 143269-53-8 | 4,5-Benzo-1'-ethyl-3-methylquinacarbocyanine iodide |
| 143269-62-9 | 2-Ethylhexyl alpha-cyano-3,4-dimethoxycinnamate |
| 143269-64-1 | 2-Ethylhexyl alpha-cyano-4-(3methyloxazolin-2-ylidene)crotonate |
| 143269-69-6 | 5-{2-[3-(2-Carboxyethyl)-2-benzoxazolylidene]ethylidene}-3-ehtyl-1-methyl-2-thiohydantoine potassium salt |
| 14338-32-0 |
2-CHLORO-1-METHYLPYRIDINIUM IODIDE |
| 143484-00-8 |
Ethyl 2-methyl-4,4,4-trifluorobutyrate |
| 14353-88-9 |
Bis(trifluoroacetoxy)iodopentafluorobenzene |
| 1435806-43-1 |
Trimethylsilyl nonafluoropentanoate |
| 1435806-66-8 |
Trimethylsilyl perfluorohexanoate |
| 143612-79-7 |
3-(4-CHLOROBUTYL)-5-CYANOINDOLE |
| 14371-84-7 | 4-Methoxy-2-nitrophenyldisulfide |
| 144-19-4 | Tert.Butyl peroxide |
| 144230-52-4 |
4,4-Difluoropiperidine hydrochloride |
| 144-29-6 | Piperazine Citrate |
| 1440-00-2 | 2,4-bis(2,4-Dihydroxyphenyl)-6-(4-methoxyphenyl)-1,3,5-triazine |
| 14402-88-1 | EDTA-MgNa2 |
| 1443-80-7 | 4'-Cyanoacetophenone |
| 14446-47-0 | thiazolidine hydrochloride |
| 14447-15-5 | n-Propyl Cyanoacetate |
| 1445-91-6 | (S)-(-)-1-Phenylethanol |
| 14451-86-6 | 2-Butyladamantan-2-ol |
| 1445-75-6 |
Diisopropyl methanephosphonate |
| 14459-95-1 | Potassium Ferrocyanide |
| 1445995-85-6 |
1-Bromo-1,1,2,2-tetrafluoroheptane |
| 14482-51-0 |
3,5-Dichloro-2-bromopyridine |
| 144-83-2 |
2-(p-Aminobenzenesulfonamido)pyridine |
| 1448-87-9 | 2-Chloroquinoxaline |
| 14484-64-1 | (OC-6-11)-Tris(dimethylcarbamodithioato-kappaS,kappaS')iron(III) |
| 144940-73-8 | 3-Carboxymethyl-5-[1-(3-methyl-2thiazolidinylidene)-2-propylidene]rhodanine sodium salt |
| 1450-81-3 | 2,5-dibromopentanoic acid |
| 145038-06-8 | 1-Butyl-2,3,3-trimethylbenz[e]indolium perchlorate |
| 145038-07-9 | 1-Butyl-2,3,3-trimethylbenz[e]indolium tosylate |
| 14533-84-7 |
Pentafluorophenyl trifluoroacetate |
| 145343-37-9 |
5,6,6-Trifluorohex-5-en-1-ol |
| 1454-53-1 | Ethyl N-Benzyl-3-oxo-4-piperidinecarboxylate HCl |
| 14548-74-4 |
1H,1H-Perfluoro(2,5-dimethyl-3,6-dioxanonan-1-ol) |
| 145638-46-6 | Sodium dibutyl dithiocarbamate |
| 145693-67-0 |
(3S,4S)-(-)-Bis(diphenylphosphino)pyrrolidine |
| 1457-47-2 | 3-Allylrhodanine |
| 145886-83-5 |
2,2,3,3,4,4,5,5-Octafluoropentanenitrile |
| 1459-29-6 | Bi(cyclohexane)-4,4'-dicarboxylic acid |
| 14590-53-5 | (S)-(+)-2,2-dimethylcyclopropane-1-carboxylic acid |
| 1459-55-8 |
| p-(1-Adamantyl)toluene |
| 1460-18-0 |
Pentadecanedioic Acid |
| 146137-76-0 |
2-FLUORO-5-IODOBENZALDEHYDE |
| 146195-65-5 |
1,1,1-Trifluoro-5-methoxy-5-methylhexane-2,4-dione |
| 14620-81-6 |
1H,1H-Perfluoro(2,5,8-trimethyl-3,6,9-trioxadodecan-1-ol) |
| 146270-01-1 |
2-chloro-4-(piperidinomethyl)pyridine |
| 14634-93-6 | Zinc diethyphenyl dithiocarbonate |
| 146431-69-8 |
2-Bromo-4,4,4-trifluorobutyl acetate |
| 14643-87-9 | Acrylic acid zinc salt |
| 146447-18-9 | 2-Chloro-4-Fluoro-5-BromoAnisole |
| 146447-26-9 | N-{4-[4-(Piperidinomethyl) Pyridyl-2-Oxy]-Cis-2-Butene} Pthalimide Maleic Acid |
| 14647-23-5 |
1,2-[Bis(diphenylphosphino)ethane]nickel(II) chloride |
| 14648-57-8 |
2-Ethyl-2-Adamantanol |
| 14657-64-8 | 3-Hydroxy phenyl phosphinyl propanoic acid |
| 14660-52-7 |
ethyl 5-bromovalerate |
| 146632-07-7 | METHACRYLOXYPROPYL TERMINATED POLYDIMETHYLSILOXANE |
| 146829-79-0 |
Bis[2-(fluorosulfonyl)tetrafluoroethyl] ether |
| 1468-95-7 | 9-Anthracenemethanol |
| 14691-89-5 | 4-Acetylamino-2,2,6,6-Tetramethylpiperidine-N-Oxyl (4-Acetamido-Tempo) |
| 146960-90-9 |
1,1′-Bis(dicyclohexylphosphino)ferrocene |
| 14704-41-7 |
3,5-Bis(trifluoromethyl)pyrazole |
| 147-14-8 | Pigment Blue 15:0 / 15:1 / 15:3 / 15:4 |
| 147008-88-6 | (R)-3-Amino-6-Carboxamido-1,2,3,4-Tetrahydrocarbezole Monohydrate |
| 14722-40-8 |
1,15-Pentadecanediol |
| 147253-67-6 |
(R,R)-Methyl DuPhos |
| 14726-36-4 | Zinc dibenzyldithiocarbamate |
| 1472-87-3 |
Dimethyl Brassylate |
| 147315-50-2 | 2-(4,6-Diphenyl-1,3,5-triazin-2-yl)-5-(hexyloxy)phenol |
| 14737-09-8 |
1-Bromo-2-(bromodifluoromethyl)cyclohexane |
| 14742-37-1 |
Ethyl (pentafluorophenoxy)acetate |
| 147492-59-9 |
1-(Perfluorohexyl)decane |
| 147531-11-1 |
diphenyl-(trifluoromethyl)-sulfonium trifluoromethanesulfonate |
| 14753-51-6 | 2,5-Dibromohydroquinone |
| 147613-95-4 | N,N-di-n-butyl-2-(1,2-dihydro-3-hydroxy- 6isopropyl-2-quinolylidene)-1,3- dioxoindan-5carboxamide |
| 1477-50-5 | 2-Indolecarboxylic acid |
| 14781-45-4 |
Copper(II) hexafluoroacetylacetonate hydrate |
| 147-82-0 |
2,4,6 Tri Bromo Aniline |
| 1478-61-1 | 2,2-Bis(4-hydroxyphenyl)hexafluoropropane |
| 147835-68-5 | 2.2'-bis-trifluoromethoxy-biphenyl-4,4'-diamine |
| 147874-76-8 |
3H,3H-Perfluorodecane-2,4-dione |
| 148043-70-3 |
5,5,6,6,6-Pentafluorohexanoic acid |
| 148043-73-6 |
4,4,5,5,5-Pentafluoropentan-1-ol |
| 14805-29-9 | exo-2,3-Norbornanedicarboximide |
| 14813-01-5 | 1-Benzyl-3-piperidinol |
| 14814-09-6 | 3-Mercaptopropyl)triethoxysilane |
| 14818-35-0 | 6-Cyclohexyl-4-methyl-2-pyrone |
| 1482416-44-3 |
1-Bromoperfluoro(4-methyl-3,6-dioxaoctane) |
| 1482416-52-3 |
1-Bromoperfluoro(4,7,10,13-tetramethyl-3,6,9,12,15-pentaoxaheptadecane) |
| 1483-72-3 |
DIPHENYLIODONIUM CHLORIDE |
| 1484-84-0 | 2-Piperidineethanol |
| 148612-17-3 |
2-Amino-3-nitro-5-chloro-4-MP |
| 148757-88-4 |
4,4,5,5,5-Pentafluoropentan-1-thiol |
| 148757-93-1 |
4,4,5,5,5-Pentafluoropent-2-en-1-ol |
| 148870-57-9 |
7,8-Dimethoxy-3-(3-iodopropyl)-1,3-dihydro-2H-3- benzazepin-2-one |
| 14892-14-9 |
(Pentafluorophenoxy)acetic acid |
| 1489-69-6 | Cyclopropane carboxaldehyde |
| 149021-58-9 |
2-propylheptyl acrylate |
| 1493-03-4 |
Difluoroiodomethane |
| 149-30-4 | 2-Mercaptobenzothiazole |
| 1493-13-6 |
Trifluoromethanesulfonic acid |
| 14940-68-2 |
Zirconium Silicate |
| 149-45-1 | Disodium pyrocatechol-3,5-disulfonate |
| 149-73-5 | Trimethyl Orthoformate |
| 1490-25-1 | Methylsuccinyl chloride |
| 14901-07-6 | β-Ionone |
| 14924-53-9 | Ethyl Cyclobutanecarboxylate |
| 14965-49-2 |
Methyl Ammonium Iodide |
| 1497-49-0 | Glutacondianil hydrochloride |
| 149897-41-6 | N-Cbz-4-iodomethylpiperidine |
| 1498-54-0 |
Diethylphosphoramidic dichloride |
| 1499-29-2 |
Bis(dichlorophosphonyl)methane |
| 150-13-0 | P-Aminobenzoic acid |
| 1501-84-4 |
2 Rimantadine Hydrochloride |
| 1503-98-6 |
Cyclobutanecarboxamide |
| 150433-22-0 |
5(3)-tert-Butyl-3(5)-(trifluoromethyl)pyrazole |
| 150622-65-4 |
Perfluoro(2-ethyl-1,3-dioxole) |
| 150624-30-9 |
2-Pentafluoroethyl-1,3-dioxolane |
| 150-76-5 | Para-Methoxy Phenol (MEHQ) |
| 150-78-7 | Hydroquinone Dimethyl Ether (HQDME) |
| 150-84-5 | Citronellyl Acetate |
| 150-88-9 | Zinc n-butyl xanthate |
| 150058-27-8 | Methyl 2-ethoxybenzoimidazole-4-carboxylate |
| 1501-05-9 | 4-Benzoyl Butyric Acid |
| 1502-22-3 | 2-(1-Cyclohexenyl)cyclohexanone |
| 151-50-8 | Potassium Cyanide |
| 1510824-40-4 | Di-(2-butoxy-5-tert.-octyl-phenyl)-1,6,7,16-tetrachloro-perylene-3,4,9,10-tetracarboxylic acid dimide |
| 15112-62-6 |
3-Iodo-2-Methylpyridine |
| 15128-82-2 |
2-Nitro-3-hydroxypyridine |
| 1513-44-6 | Trifluoromethylsulfoaniline |
| 1513-60-6 |
Ethyl 4,4,4-trifluoro-3-(trifluoromethyl)crotonate |
| 1513-88-8 |
1,1,1,2,2,3,3-Heptafluoro-5-iodopentane |
| 151411-98-2 |
2,4,6-Trifluorobenzyl bromide |
| 1514-82-5 |
2-BROMO-3,3,3-TRIFLUOROPROPENE |
| 1514-87-0 |
Methyl chlorodifluoroacetate |
| 1515-14-6 |
Hexafluoro-2-methylisopropanol |
| 1515-72-6 | N-Butylphthalimide |
| 15151-57-2 | 4-Hydroxy-3-nitro-2(1H)-quinolinone |
| 15164-44-0 |
4-IODOBENZALDEHYDE |
| 1516-55-8 | Boron trichloride-trimethylamine complex |
| 1517-69-7 | (R)-(+)-1-Phenylethanol |
| 151831-44-6 |
1-Bromo-1,1,2,2-tetrafluoropentane |
| 151831-45-7 |
1-Bromo-1,1,2,2-tetrafluorohexane |
| 151841-65-5 | Aluminum, hydroxybis[2,4,8,10-tetrakis(1,1-dimethylethyl)-6-hydroxyl-12H-dibenzo[d,g][1,3,2]dioxaphosphocin 6-oxidato] – (Main component) |
| 15191-68-1 |
1-(4-Methoxyphenyl)-4,4,4-trifluorobutane-1,3-dione |
| 1519-45-5 |
Ethylenebis[triphenylphosphonium] dibromide |
| 1522-22-1 |
1,1,1,5,5,5-Hexafluoroacetylacetone |
| 1522-92-5 |
Tribromoneopentyl alcohol |
| 152340-26-6 | N,N,N',N'-Tetrakis(4-dibutylaminophenyl)-p-phenylenediaminium hexafluorophosphate |
| 1524-26-1 |
4,4,4-Trifluorobut-1-ene |
| 15243-33-1 |
Triruthenium Dodecacarbonyl |
| 1524-54-5 |
Allyl 2,2,2-trifluoroethyl ether |
| 152459-95-5 |
4-[(4-METHYLPIPERAZIN-1-YL) METHYL]-N-[4-METHYL-3-[(4-PYRIDIN-3-YL PYRIMIDIN-2-YL) AMINO]-PHENYL]-BENZAMIDE |
| 152460-09-8 |
2-(2-Methyl-5-nitroanilino)-4-(3-pyridyl)pyrimidine |
| 152460-10-1 |
2-(5-Amino-2-methylanilino)-4-(3-pyridyl)pyrimidine |
| 152520-56-4 |
NEBIVOLOL HYDROCHLORIDE |
| 152684-30-5 |
5-Bromo-2-methoxy-3-nitropyridine |
| 152718-74-6 |
Trimethylsilyl 2-(heptafluoropropoxy)tetrafluoropropionate |
| 15274-43-8 |
Bis(tributylphosphine)nickel(II) chloride |
| 152922-71-9 | 1-(Hydroxy Methyl) Cyclopropane Acetonitrile |
| 1529-41-5 |
3-Chlorobenzyl cyanide |
| 1529784-41-5 |
Perfluoro-4-methyl-3,6-dioxaoctanesulfonyl chloride |
| 1530-32-1 | Ethyltriphenylphosphonium bromide |
| 153034-86-7 |
2-CHLORO-4-IODOPYRIDINE |
| 153034-90-3 |
2-CHLORO-4-IODONICOTINALDEHYDE |
| 1530-89-8 | N-Cyanomorpholine |
| 153305-67-0 |
2,2′-Bis(di-p-tolylphosphino)-1,1′-binaphthyl |
| 1533-45-5 | 2,2'-[Vinylenebis(4,1-phenylene)]bisbenzoxazole |
| 15337-18-5 | Zinc bis(dipentyldithiocarbamate) |
| 153505-37-4 | 4-Bromo-5-fluoro-1,2-phenylenediamine |
| 153559-45-6 |
METHYL 4-[(5,6,7,8-TETRAHYDRO-3,5,5,8,8-PENTAMETHYL-2-NAPHTHALENYL) CARBONYL] BENZOATE |
| 1535-75-7 |
2-(Trifluoromethoxy)aniline |
| 153614-61-0 |
2,3,4,5,6-Pentafluorobenzyl acrylate |
| 1536-23-8 |
2,3,4,5,6-Pentafluorobenzophenone |
| 1536-63-6 |
4-(2-Chloro-1,1,2-trifluoroethoxy)acetophenone |
| 15375-84-5 | EDTA-MnNa2 |
| 153810-64-1 |
Fluoromethyl 2,2,3,3-tetrafluoropropyl ether |
| 153922-24-8 |
Isopropyl N,N,N’,N’-tetraisopropylphosphorodiamidite |
| 15396-00-6 | 3-Isocyanatopropyl)trimethoxysilane |
| 15419-94-0 |
2-Hydroxy-4-acryloyloxybenzophenone |
| 1542-34-3 |
3,5-Difluoro-4-Iodoaniline |
| 154350-29-5 |
Cyclopropanesulfonamide |
| 15458-53-4 |
Trifluoromethanesulfonyl bromide |
| 154628-00-9 |
1-(Perfluorohexyl)tetradecane |
| 154628-01-0 |
1-(Perfluorohexyl)octadecane (tech.) |
| 1546-79-8 |
N-(Trifluoroacetyl)imidazole |
| 1546-95-8 |
7H-Perfluoroheptanoic acid |
| 1547-36-0 |
4,4,4-Trifluoro-3-hydroxy-3-(trifluoromethyl)butyric acid |
| 15475-27-1 |
Potassium diphenylphosphide, 0.5 M solution in THF |
| 1547-87-1 |
N,N-Dimethyl trifluoroacetamide |
| 15484-44-3 | Sodium 2-Chloroethanesulfonate |
| 15486-96-1 | 3-Bromopropionyl chloride |
| 1548-74-9 |
4-Amino-2,3,5,6-tetrafluorobenzamide |
| 15499-84-0 | 9,9'-Bis(4-Aminophenyl) Fluorene |
| 1550-09-0 |
1-fluoro-6-chlorohexane |
| 15501-33-4 |
Neopentyl Iodide |
| 1550-24-9 |
7-Chloroperfluoroheptanoic acid |
| 155-04-4 | 2-Mercaptobenzothiazole zinc salt |
| 155041-85-3 | 1-[4-(4- ethenylcyclohexyl) cyclohexyl]-4- methylbenzene |
| 1550-44-3 |
2,2-Difluoroethyl acetate |
| 1550-50-1 |
N,N-Dimethyl-1,1,2,2-tetrafluoroethylamine |
| 155093-22-4 |
N-(2,2-Difluoroacetyl)-2,2-difluoroacetohydrazide |
| 155311-12-9 |
Molybdenum(VI) dioxide bis(1,1,1-trifluoroacetylacetonate) |
| 155377-19-8 |
Ethyl 3-(trifluoromethyl)pyrazole-4-carboxylate |
| 1555-20-0 |
1,16-Dichloroperfluorohexadecane |
| 1555-27-7 |
Ethyl 5-chlorooctafluoropentanoate |
| 155613-52-8 |
(R)-(-)-1,1′-Binaphthyl-2,2′-dioxychlorophosphine |
| 1556-18-9 |
CYCLOPENTYL IODIDE |
| 155662-73-0 |
Molybdenum(VI) dioxide bis(1,1,1,5,5,5-hexafluoroacetylacetonate) |
| 15574-49-9 | Mecarbinate |
| 155768-85-7 |
1-(4-Fluorophenoxy)-2-aminopropane |
| 155795-24-7 | 10-Acetoxy-1.1'-bis(4-sulfobutyl)-4,5:4',4'-dibenzo-3,3,3',3'-tetramethylindatricarbo-cyanine betaine sodium salt |
| 155849-49-3 |
4-(Trifluoromethyl)piperidinehydrochloride |
| 1559-07-5 |
n-Butyl heptafluorobutyrate |
| 15590-90-6 |
3-Nitro-4-hydroxypyridine |
| 1559-86-0 |
1-Bromo-2,3,4,6-tetrafluorobenzene |
| 1559-87-1 |
1,3-Dibromotetrafluorobenzene |
| 1559-88-2 |
1-Bromo-2,3,5,6-tetrafluorobenzene |
| 156072-86-5 |
5-Bromo-3-methylpyridine-2-carbonitrile |
| 1561-52-0 |
2-Iodo-1-(trifluoromethoxy)tetrafluoroethane |
| 156186-28-6 |
1,10-Dichloroperfluorodecane |
| 156241-41-7 |
1,1,1,3,3,3-Hexafluoroisopropyl trifluoromethanesulfonate |
| 156243-64-0 |
4-Bromo-2,6-difluorobenzotrifluoride |
| 1562541-14-3 |
Potassium 2,3,4,5-tetrafluorobenzoate |
| 15629-92-2 |
1,3-[Bis(diphenylphosphino)propane]nickel(II) chloride |
| 1564-29-0 | Luminore orange-red 612T |
| 156589-82-1 | Ethyl 4-isopropylthiazole-2-carboxylate |
| 15666-97-4 | n-Octyl Cyanoacetate |
| 1568-65-6 | Dicyclohexylborane |
| 1570-45-2 |
Ethyl Isonicotinate |
| 15708-41-5 | EDTA-FeNa |
| 1571-65-9 | 3-Amino-4-hydroxybenzoic acid hydrochloride |
| 15721-02-5 | TCB 2,2-5,5 TETRA CHLORO BENZIDINE |
| 15721-78-5 | P,P'-DIOCTYLDIPHENYLAMINE |
| 15748-73-9 | Lead Salicylate |
| 157488-65-8 |
(R)-MONOPHOS |
| 1576-35-8 | Tosylhydrazide |
| 15791-87-4 | 4,6-Diaminoresorcinol |
| 15793-73-4 | Pigment Orange 34 |
| 15804-19-0 | 2,3-Dihydroxyquinoxaline |
| 158063-66-2 |
4-(Trifluoromethyl)nicotinic acid |
| 1582-18-9 |
2-Amino-3-methyl-1,1,1-trifluorobutane |
| 1584-03-8 | Perfluoro(2-methylpent-2-ene) |
| 15848-22-3 |
5-bromo-1-pentanol acetate |
| 15854-87-2 |
4-Iodo Pyridine |
| 15861-24-2 | 5-Indolecarbonitrile |
| 15862-31-4 |
2-Amino-3-bromo-5-nitropyridine |
| 15862-33-6 |
2-Hydroxy-3-bromo-5-nitropyridine |
| 15862-34-7 |
2-Hydroxy-5-bromo-3-nitropyridine |
| 15862-37-0 |
2,5-Dibromo-3-nitropyridine |
| 15879-93-3 | α-Chloralose |
| 15895-68-8 |
2,3,5,6-Tetrafluoro-4-(trifluoromethyl)benzonitrile |
| 1591-31-7 |
4-IODOBIPHENYL |
| 159269-48-4 |
1,4-Diazoniabicyclo[2.2.2]octane, 1-fluoro-4-methyl-, tetrafluoroborate(1-) (1:2) |
| 159294-99-2 |
3,4,5-Trifluorostyrene |
| 159623-34-4 |
Perfluoroheptanoyl bromide |
| 159623-35-5 |
Nonafluoropentanoyl bromide |
| 15997-62-3 | Acetic acid, 2,6-dioxo-3,6-dihydro-2H-pyran-4-yl ester |
| 16001-93-7 |
Tetramethyl methylenediphosphonate |
| 16004-15-2 |
4-IODOBENZYL BROMIDE |
| 16005-64-4 |
Bis(perfluoro-tert-butyl) trisulfide |
| 16013-85-7 |
2,6-Dichloro-3-nitropyridine |
| 16015-71-7 | 1-(3-Methoxyphenyl)piperazine DiHCl |
| 1603-40-3 |
2-Amino-3-methylpyridine |
| 1603-41-4 |
2-Amino-5-methylpyridine |
| 16043-40-6 | Pigment Red 122 |
| 16062-88-7 | Monobutyl Fumarate |
| 16063-80-2 |
4,4,4,4',4',4'-Hexafluoro-DL-valine |
| 16066-91-4 | 5-Iodoindole |
| 1608-26-0 |
Hexamethylphosphorous triamide |
| 16083-66-2 |
2-Iodo-1H,1H,2H,3H,3H-perfluorooctan-1-ol |
| 1609-86-5 | t-Butyl isocyanate |
| 16090-14-5 | Perfluoro-2-(2-fluorosulfonylethoxy) Propyl Vinyl Ether (PSEPVE；PSVE) |
| 1609373-97-8 | 2-methylbenzofuro[2,3-b]pyridin-8-ol |
| 16096-31-4 | 1,6-Hexanediol Diglycidyl Ether |
| 161094-94-6 |
4-Iodo-1,1,1,2-tetrafluoro-2-(trifluoromethyl)octane |
| 16110-09-1 |
2,5-Dichloropyridine |
| 161118-67-8 |
tert-Butylimino-tri(pyrrolidino)phosphorane |
| 161265-03-8 |
9,9-Dimethyl-4,5-bis(diphenylphosphino)xanthene |
| 1613293-20-1 |
Trimethylsilyl bromodifluoroacetate |
| 16143-80-9 | Pigment Green 8 |
| 1615-14-1 |
1-(2-hydroxyethyl)imidazole |
| 161531-51-7 |
2,4-DIFLUORO-5-IODOBENZOIC ACID |
| 161583-34-2 |
1-Bromo-1H,1H,2H,2H-perfluorooctane |
| 1616373-58-0 |
Trimethylsilyl 2,3,4,5-tetrafluorobenzoate |
| 1617-18-1 | Ethyl 3-butenoate |
| 1619-34-7 |
Quinuclidin-3-ol |
| 161958-58-3 |
2,4-Dibromo-3,3,4,4-tetrafluorobut-1-ene |
| 161981-34-6 |
7,7,8,8,8-Pentafluorooctan-1-ol |
| 1619-92-7 |
1,1,1,3,3,3-Hexafluoroisopropylamine |
| 1623-05-8 | Perfluoropropylvinyl Ether (PPVE) |
| 162303-51-7 | Poly butyl titanate |
| 162358-07-8 |
1-(2-IODOETHYL)-4-OCTYBENZENE |
| 16247-01-1 |
2-Hydroxyethylphosphine |
| 16251-00-6 |
1,4-Diethoxytetrafluorobenzene |
| 162515-68-6 | 2-(1-(Mercaptomethyl)Cyclopropyl) Acetic Acid |
| 16261-80-6 |
4-(Hexafluoro-2-hydroxyisopropyl)benzoic acid |
| 1626-74-0 |
2-Amino-1-[4-(trifluoromethyl)phenyl]propane |
| 1628-89-3 |
2-Methoxypyridine |
| 163105-89-3 |
2-Methoxypyridine-5-boronic acid |
| 16329-89-8 |
Methyl 2,3-dichlorotrifluoropropionate |
| 1633-22-3 |
[2,2]Paracyclophane |
| 1633-83-6 | 1,4-Butanesultone |
| 16331-52-5 | 9-Anthracenecyrbonyl chloride |
| 1634-02-2 | Tetrabutylthiuram disulfide |
| 163444-17-5 |
2-IODO-4-TRIFLUOROMETHYL ANILINE |
| 163457-23-6 |
3,3-Difluoropyrrolidinehydrochloride |
| 16355-92-3 |
1,10-diiododecane |
| 1635-61-6 |
5-chloro-2-nitroaniline |
| 163702-05-4 |
Ethyl nonafluorobutyl ether |
| 163702-07-6 |
Methyl nonafluorobutyl ether |
| 163702-08-7 | Methyl nonafluoroisobutyl ether；C4ME |
| 1640-39-7 | 2,3,3-Trimethylindolenine |
| 16415-12-6 | Hexadecyltrimethoxysilane |
| 16432-81-8 | 2-(4-Benzoyl-3-hydroxyphenoxy)ethyl acrylate |
| 1644-11-7 | 2-(Heptafluoropropoxy)hexafluoropropyl Trifluorovinyl Ether |
| 1644-11-7 |
Perfluoro(5-methyl-3,6-dioxanon-1-ene) |
| 1644-21-9 |
3-(1,1,2,2-Tetrafluoroethoxy)nitrobenzene |
| 16455-61-1 | EDDHA-Fe6% [Ethylenediamino-N,N'-bis(2-hydroxy-phenyl)acetic acid] |
| 1645-75-6 |
Hexafluoroacetone imine |
| 1645-76-7 | Hexafluoroacetone oxime |
| 1647-57-0 | 2,3,3,3-Tetrafluoropropionamide |
| 16486-97-8 | 1-Chloro-6-iodoperfluorohexane |
| 16486-98-9 | 1-Chloro-8-iodoperfluorooctane |
| 1648-99-3 | 2,2,2-Trifluoroethanesulfonyl chloride |
| 1649-08-7 | 1,2-Dichloro-1,1-difluoroethane |
| 1649-56-5 | Ethyl 11H-perfluoroundecanoate |
| 16498-81-0 | 2-Methoxy Nicotinic Acid |
| 16500-37-1 | Perfluoro(2,3-dimethylbutan-2-ol) |
| 1651-41-8 | 1H,1H,2H,2H,3H,3H-Perfluoroundecan-1-ol |
| 16523-54-9 | Dicyclohexylchlorophosphine |
| 1652-80-8 | 2,2-Dichlorohexafluoropropane |
| 1652-89-7 | Pentachloro-1,1,1-trifluoropropane (CFC-213ab) |
| 1653-16-3 | 2- Ethylhexyl Iodide |
| 165534-43-0 | 3-(Diethoxyphosphoryloxy)-1,2,3-benzotriazin-4(3H)-one |
| 165547-79-5 |
2-Hydroxy-3-nitro-4-chloropyridine |
| 1656-44-6 | 2,4-Dinitrobenzenesulphonyl chlorid |
| 16582-93-7 |
2,3,4,5-Tetrafluorobenzonitrile |
| 16582-94-8 |
2,3,4,5-Tetrafluorobenzamide |
| 16583-06-5 |
2,3,4,5-Tetrafluorobenzaldehyde |
| 16586-60-0 | 4-Chloro-3-nitrobenzamide |
| 16588-02-6 |
2-Chloro-5-nitrobenzonitrile |
| 1660-04-4 | 1-Acetyladamantane |
| 1661005-79-3 |
2,2,3,3,4,4,5,5,5-Nonafluoropentyl difluoromethyl ether |
| 166172-69-6 |
Bis(3,5-ditrifluoromethylphenyl)phosphine |
| 1662-01-7 | Bathophenanthroline |
| 16627-68-2 |
1,1,2,2-Tetrafluoroethyl 2,2,3,3-tetrafluoropropyl ether |
| 16627-71-7 |
1H,1H,5H-Octafluoropentyl 1,1,2,2-tetrafluoroethyl ether |
| 166330-10-5 |
Bis(2-diphenylphosphinophenyl) ether |
| 1663-61-2 | Triethylorthobenzoate |
| 16642-92-5 |
4- trifluoromethyl cinnamic acid |
| 1666-13-3 |
Diphenyl Diselenide |
| 1668-10-6 | Glycinamide hydrochloride |
| 1668-53-7 | 2-(2H-benzotriazole-2-yl)-5-[(1-ethylhexy)-oxy]phenol |
| 16691-43-3 | 3-Amino-5-mercapto-1,2,4-triazole |
| 16698-16-1 | Acetyl H Acid |
| 1670-14-0 | Benzamidine HCl |
| 167026-90-6 |
1-Iodononafluoro(3-methylbut-1-ene) |
| 1670-81-1 | 5-Indolecarboxylic acid |
| 1670-82-2 | Indole-6-carboxylic acid |
| 1670-83-3 | 7-Indolecarboxylic acid |
| 16712-64-4 | 6-Hydroxy-2-naphthoic Acid |
| 167308-43-2 |
tert-Butyl chlorodifluoroacetate |
| 16744-98-2 | 2-Fluorophenyl isocyanate |
| 1675-54-3 | Bisphenol A Diglycidylether |
| 16771-85-0 |
4-isobutoxybenzenaldehyde |
| 1677-46-9 | 4-hydroxy n-methyl 2-quinolone |
| 16790-64-0 |
Amantadine Formate |
| 1679-51-2 | 3-Cyclohexene-1-Methanol |
| 1679-53-4 | 10-Hydroxydecanoic Acid |
| 16803-97-7 | 4,4' diamono benzsulphanilide |
| 1682-20-8 |
4-Amino-2,3,5,6-tetrafluoropyridine |
| 1682-31-1 |
1-Iodo-1H,1H,2H,2H-perfluoroheptane |
| 16840-25-8 |
Tetrafluorobenzene-1,3-diol |
| 16851-56-2 / 78348-24-0 | (±)-2-Indolinecarboxylic acid |
| 16867-03-1 |
2-Amino-3-hydroxypyridine |
| 16878-50-5 |
(2-Chlorohexafluoroisopropyl)benzene |
| 168899-58-9 | 2-methyl-3-acetoxy benzoic acid |
| 168920-97-6 |
1-Phenyl-2H,2H-perfluoroheptane-1,3-dione |
| 16940-66-2 | Sodium Borohydride |
| 16956-91-5 |
1,4-Bis(trimethylsilyl)tetrafluorobenzene |
| 16982-21-1 | Ethylthioxamate |
| 1701-24-2 |
4-Chloro-2-(trifluoromethyl)quinoline |
| 17016-83-0 | [S]-4-Isopropyl-oxazolidinone |
| 17046-22-9 | n-Butyl isocyanateacetate |
| 17056-99-4 | Quinoxaline-5-ol |
| 170804-18-9 |
Ethyl 3-amino-4,4,4-trifluorobutyrate |
| 1709-70-2 | 2,4,6-Tris(3',5'-di-tert-butyl-4'-hydroxybenzyl)mesitylene |
| 17096-07-0 | 3-Methacryloyloxypropyltris(trimethylsilyloxy)silane |
| 1711-05-3 |
m-Anisoyl Chloride |
| 1711-06-4 | 3-Toluoyl chloride |
| 1711-07-5 |
3-Fluorobenzoyl Chloride |
| 1711-88-2 | 1,3,4-Oxadiazol-2(3H)-one,5-(1-methylethyl) |
| 171197-80-1 |
2-Fluoro-5-Iodopyridine |
| 17129-06-5 |
4-Ethoxy-1,1,1-trifluorobut-3-en-2-one |
| 17132-78-4 | Pyridine 2, 3 Dicyano / Pyridine-2,3-Dicarbonitrile |
| 17134-17-7 | Triethyleneglycol bischloroformate |
| 171408-76-7 | 2-Bromo-9,9'-spirobifluorene |
| 17159-79-4 |
Ethyl 4-oxocyclohexanecarboxylate |
| 1716-42-3 |
1-(3-chloropropoxy)-4-fluorobenzene |
| 1717-59-5 |
2-(Fluorosulphonyl)difluoroacetic acid |
| 17176-77-1 |
Dibenzyl phosphite |
| 17228-64-7 |
2-Methoxy-6-chloropyridine |
| 17229-14-0 | 2-(2-chloroethoxy)acetic acid ethyl ester |
| 17229-17-3 |
2-chloroethyl benzyl ether |
| 17247-58-4 | Cyclobutylmethyl bromide |
| 17249-80-8 | 3-chlorothiophene |
| 17282-01-8 |
3-Bromo-2-Fluoro-5-Methylpyridine |
| 17282-03-0 |
2-Chloro-3-bromo-5-methylpyridine |
| 1729-67-5 | Methyl-2,3-dibromopropionate |
| 1730-22-9 |
1,1,1,2,3-Pentafluorohexa-2,5-diene |
| 17311-31-8 | 2,3-Di(hydroxymethyl)quinoxaline-1,4-dioxide |
| 17315-76-3 | 2-Hydroxyglutacondianil hydrochloride |
| 1731-79-9 |
Dodecanedioic Acid Dimethyl Ester(DAM, Dimethyl Dodecanedioate) |
| 1732-08-7 |
Dimethyl Pimelate |
| 17327-33-2 |
4,4,4-Trifluoro-3-(trifluoromethyl)butyric acid |
| 17327-34-3 |
Ethyl 4,4,4-trifluoro-3-(trifluoromethyl)butyrate |
| 17327-35-4 |
4,4,4-Trifluoro-3-(trifluoromethyl)butan-1-ol |
| 173336-76-0 |
4-bromo-1-methoxy-2-(3-methoxy-propoxy)benzene |
| 17352-10-2 |
1H,1H,5H-Octafluoropentyl trifluoromethanesulfonate |
| 17354-14-2 |
Solvent Blue 35 |
| 1735-84-8 |
3-Chloro-2,4,5,6-tetrafluoropyridine |
| 1736-06-7 |
3'-Methyl-2,2,2-trifluoroacetophenone |
| 1736-60-3 |
Allylpentafluorobenzene |
| 1737-10-6 |
3-(1,1,2,2-Tetrafluoroethoxy)toluene |
| 1737-11-7 |
4-(1,1,2,2-Tetrafluoroethoxy)toluene |
| 1737-26-4 |
1-[4-(Trifluoromethyl)phenyl]ethanol |
| 17376-04-4 |
(2-IODOETHYL) BENZENE |
| 1737-93-5 |
3,5-Dichloro-2,4,6-trifluoropyridine |
| 17380-62-0 |
1-phenylcyclopentane carbonyl chloride |
| 17408-16-1 | 3-Nitropropiophenone |
| 17422-33-2 | 6-Chloroindole |
| 1743-87-9 |
5,6,7,8-Tetrafluorobenzo-1,4-dioxane |
| 17450-56-5 | Ethyl-3-benzoylacrylate |
| 17455-13-9 |
18-crown-6 |
| 17463-43-3 |
3,3,3-Trifluoro-DL-alanine |
| 174775-48-5 |
ETHYL 5-AMINO-1-BENZOFURAN-2-CARBOXYLATE |
| 17484-36-5 | 4-Methyl-3-nitroanisole |
| 17511-60-3 | Verdyl Propionate |
| 175161-86-1 | 2-(N-Carboxymethyl-N-phenyl)amino-4,6-dimercapto-1,3,5-triazine |
| 175230-50-9 |
Isopropyl 4,4,4-trifluoroacetoacetate |
| 17524-05-9 |
Molybdenum(VI) dioxide bis(acetylacetonate) |
| 17527-29-6 |
1H,1H,2H,2H-Perfluorooctyl acrylate |
| 17556-42-2 |
1-(4-Methoxyphenyl)-2,2,2-trifluoroethanol |
| 17557-23-2 | Neopentane Glycol Diglycidyl Ether |
| 17557-76-5 | 4,4'-Diaminobiphenyl-2,2'-dicarboxylic acid |
| 17559-01-2 |
1H,1H-Perfluoro(2,5-dimethyl-3,6-dioxanonanoyl) acrylate |
| 1757-72-8 | 1-Methyl-2-phenyl-3-indolecarboxaldehyde |
| 175838-97-8 |
4-(1,1,2,2-Tetrafluoroethoxy)biphenyl |
| 1758-46-9 |
2-phenoxyethylamine |
| 17587-22-3 |
1,1,1,2,2,3,3-Heptafluoro-7,7-dimethyloctane-4,6-dione |
| 1759-53-1 | Cyclopropanecarboxylic acid |
| 1760-24-3 | 3-(2-Aminoethylamino)propyltrimethoxysilane |
| 176161-55-0 | 5,6-Dichloro-2-(isopropylamino)benzimidazole |
| 17630-76-1 |
5-Chloroisatin |
| 1763-23-1 |
Perfluorooctanesulfonic acid |
| 1763-27-5 |
Ethyl trifluorovinyl ether |
| 1763-28-6 |
4,4,4-Trifluoro-3-(trifluoromethyl)crotonic acid |
| 17636-08-7 | 3,3'-Bis(2-carboxyethyl)-5,5'-dimethyl-9-ethylthiacarbocyanine betaine |
| 1765-26-0 |
2,2-Bis(trifluoromethyl)-1,3-dioxolane |
| 1765-40-8 |
2,3,4,5,6-Pentafluorobenzyl bromide |
| 1765-48-6 |
11H-Perfluoroundecanoic acid |
| 1765-92-0 |
(2,2,3,3,4,4,4-Heptafluorobutyl)oxirane |
| 1766-76-3 |
Decafluorobenzhydrol |
| 17672-26-3 | 3-Cyanophenylhydrazine hydrochloride |
| 1767-94-8 |
6H-Perfluorohex-1-ene |
| 17694-68-7 |
3-Acetylpyridine hbr |
| 177-11-7 | 4-Piperidone ethyleneketal |
| 1771-18-2 | 2-Methoxyphenothiazine |
| 17715-69-4 | 1-Bromo-2,4-dimethoxybenzene |
| 177168-18-2 | N-[2,5Bis(anilinomethylene)cyclopentylidene]-Nphenyl-phenyl-anilinium tetrafluoroborate |
| 1772-43-6 | 2,4,4-Trimethyl-2-oxazoline |
| 1774-47-6 |
Trimethylsulphoxonium Iodide |
| 177469-12-4 |
(R)-2-Amino-1,1,1-trifluoropropanehydrochloride |
| 17754-90-4 | 4-(Diethylamino)-salicylaldehyde |
| 17763-67-6 |
Phenyl trifluoromethanesulfonate |
| 17766-28-8 | 1-Cyclohexylpiperazine |
| 17768-36-4 |
3-Hydroxy-1-Adamantane Acetic Acid |
| 17768-41-1 | 1-(Aminomethyl)adamantane |
| 17773-10-3 |
(2-HYDROXYETHYL ) TRIMETHYLAMMONIUM IODIDE |
| 177760-52-0 | Ethyl 2-Aminooxazole-4-Carboxylate |
| 1779-49-3 | Methyltriphenylphosphonium bromide |
| 1779-51-7 | Butyltriphenylphosphonium bromide |
| 17796-82-6 | N-(cyclohexylthio)phthalimide |
| 1780-19-4 | 1,2,3,4-Tetrahydroquinaldine |
| 17812-07-6 | trans-3-Benzoylacrylic acid |
| 178176-80-2 |
2-Diphenylphosphino-1-naphthoic acid |
| 17823-40-4 |
4-Bromotetrafluorobenzonitrile |
| 17823-46-0 |
4-Bromo-2,3,5,6-tetrafluorobenzotrifluoride |
| 178312-47-5 |
Ethyl4,4-difluorocyclohexanecarboxylate |
| 17832-28-9 | 1,4-Butanediol monovinyl ether |
| 17852-52-7 |
4-(Aminosulfonyl)-phenylhydrazine hydrochloride |
| 178671-58-4 |
Pentaerythritol tetrakis(2-cyano-3,3-diphenylacrylate) |
| 1790-91-6 | 2,3-Dichloro-6,7-dimethoxyquinoxaline |
| 17911-93-2 | 6-Chloro-2,3-dimethylquinoxaline |
| 17913-18-7 |
1-chloro-4-methoxybutane |
| 1792-41-2 | 2,5-Dimethylbenzimidazole |
| 17927-72-9 | Titanium acetylacetonate |
| 1796-12-9 |
Bromodifluoroacetyl bromide |
| 179688-29-0 |
6,7-BIS-(2-METHOXYETHOXY)-4(3H)-QUINAZOLINONE |
| 179688-52-9 |
6-hydroxy-7-methoxy-3,4-dihydroquinazolin-4(3H)-one |
| 179688-53-0 |
6-acetoxy-7-methoxy-3,4-dihydroquinazolin-4(3H)-one |
| 17980-47-1 | Triethoxy(isobutyl)silane |
| 1798-06-7 |
4-IODO PHENYL ACETIC ACID |
| 1799308-80-7 |
Lithium 5-iodooctafluoro-3-oxapentanesulfonate |
| 17994-25-1 |
1-hydroxy-1-cyclopropanecarboxylic acid |
| 1799-47-9 |
Ethyl 9H-perfluorononanoate |
| 1799-84-4 |
1H,1H,2H,2H-Nonafluorohexyl methacrylate |
| 1801174-33-3 |
Ethyl 3-ethoxy-4,4,4-trifluorobutyrate |
| 18039-42-4 | 5-Phenyl-1H-tetrazole |
| 18063-02-0 |
2,6-Difluorobenzoyl chloride |
| 18063-03-1 |
2,6-Difluorobenzamide |
| 181028-79-5 |
Bisphenol A diphosphate |
| 181214-73-3 | 3-Methoxyperfluoro(2-methylbutane)；C5ME |
| 181314-48-7 | xylyl dibutylbenzofuranone |
| 18136-00-0 | 4,4'-Trimethylene-bis(piperidinopropionitrile) |
| 1813-83-8 |
1,10-Diiodo-3,3,4,4,5,5,6,6,7,7,8,8-dodecafluorodecane |
| 1814-89-7 |
1,1,1,3,3-Pentafluoropropan-2-ol |
| 1814916-50-1 |
2-Bromo-4,4,4-trifluorobutyronitrile |
| 18162-48-6 |
tert-Butyldimethylchlorosilane |
| 1816254-91-7 |
n-Butyldi(tert-butyl)phosphonium tetrafluoroborate |
| 181997-60-4 |
10-Bromo-1,1,1,2,2,3,3,4,4,5,5,6,6-tridecafluorodecane |
| 18202-73-8 | tert-Butylcarbamidine hydrochloride |
| 1820739-95-4 |
2,4,6-Trifluorobenzyl methacrylate |
| 1821-12-1 | 4-Phenylbutyric acid |
| 1821-27-8 | 4,4'-Dinitrodiphenylamine |
| 1822790-01-1 |
2,3,3,3-Tetrafluoropropanal hydrate |
| 1823272-01-0 |
Ethyl 2,3,3,3-tetrafluoro-2-(trifluoromethoxy)propionate |
| 1823362-61-3 |
1,3-Difluoroprop-2-yl trifluoroacetate |
| 1823369-75-0 |
1-Chloro-2,2,2-trifluoroethyl acetate |
| 1823-59-2 | Oxydiphthalicanhydride |
| 1824-81-3 |
2-Amino-6-methylpyridine |
| 1824865-30-6 |
1,2-Dibromo-3,3,4,4,4-pentafluorobut-1-ene |
| 18263-25-7 | 2-Bromohexadecanoic acid |
| 18269-97-1 |
Trimethylsilylmethyl methacrylate |
| 1827-19-6 |
(3-Bromo-2-chloro-2,3,3-trifluoropropyl)oxirane |
| 18282-51-4 |
4-IODOBENZYL ALCOHOL |
| 182918-13-4 | 2,4-Bis([1,1'-biphenyl]-4-yl)-6-chloro-1,3,5-triazine |
| 1829-92-1 |
TRIETHYLSULPHONIUM IODIDE |
| 1830-54-2 | Dimethyl acetone-1,3-dicarboxylate |
| 183065-68-1 |
4-Bromo-2,6-difluorobenzoic acid |
| 183208-36-8 | 5-Methoxy-7-azaindole |
| 183288-42-8 |
ETHYL 5-AMINO-1-BENZOFURAN-2-CARBOXYLATE HYDROCHLORIDE |
| 183322-17-0 |
2-Amino-4,5-bis(2-methoxyethoxy)benzoic acid ethyl ester hydrochloride |
| 18344-51-9 |
2-Amino-3-methyl-5-nitropyridine |
| 183547-74-2 |
1,1,1,2,2,3,3,4,4-Nonafluoro-7-iodoheptane |
| 1835-61-6 |
1-Chloro-2,3,5,6-tetrafluorobenzene |
| 1835-65-0 |
3,4,5,6-Tetrafluorophthalonitrile |
| 18368-63-3 |
6-Chloro-2-methylpyridine |
| 18368-64-4 |
2-Chloro-5-methylpyridine |
| 18368-71-3 |
2-Nitro-4-methylpyridine |
| 18368-73-5 |
2-Nitro-3-methylpyridine |
| 18368-76-8 |
2-Chloro-3-methylpyridine |
| 1841-46-9 |
1H,1H,9H-Perfluorononyl methacrylate |
| 184177-81-9 |
[4-[4-(4-HYDROXYPHENYL)-1-PIPERAZINYL] PHENYL] CARBAMIC ACID PHENYL ESTER |
| 1843-05-6 | 2-Hydroxy-4-n-octoxybenzophenone |
| 184475-71-6 |
4-(3-chloro-4-fluorophenylamino)-7-methoxyquinazolin-6-ol |
| 184783-32-2 |
(1E)-1-Ethoxy-4,4,5,5,5-pentafluoropent-1-en-3-one |
| 18479-58-8 | Dihydromyrcenol |
| 184910-53-0 |
1-Bromo-4-(trifluorovinyloxy)benzene |
| 185017-72-5 |
2-Chloro-3-Bromo-6-Methylpyridine |
| 185112-61-2 | 9-(3-bromophenyl)carbazole |
| 1852-04-6 |
Undecanedioic Acid |
| 18531-94-7 | (R)-(+)-2,2'-Dihydroxy-1,1'-binaphthyl |
| 18531-99-2 | (S)-(-)-2,2'-Dihydroxy-1,1'-binaphthyl |
| 185449-80-3 |
(S)-MONOPHOS |
| 18547-54-1 | 1,1,1,5,5,5-Hexamethyl-3-trimethylsilyloxy3-(4-vinylphenyl)trisiloxane |
| 18547-93-8 | 1,3-Bis(3- methacryloxypropyl)tetramethyldisiloxane |
| 185689-57-0 |
1H,1H,2H,2H-Perfluoroheptan-1-ol |
| 185848-06-0 |
4-(Trifluorovinyl)benzenesulfonyl fluoride |
| 18599-20-7 |
1,4-Dibromo-1,1,2,2-tetrafluorobutane |
| 18599-22-9 |
4-Bromo-3,3,4,4-tetrafluorobut-1-ene |
| 18600-59-4 | 2,2'-(1,4-Phenylene)bis(4H-3,1-benzoxazin-4-one) |
| 1866-17-7 |
ACETYL-BETA-METHYLTHIOCHOLINE IODIDE |
| 18680-27-8 | (1S,2S,3R,5S)-(+)-2,3-Pinanediol |
| 1868-53-7 |
Dibromofluoromethane(FC-21B2) |
| 1868-85-5 |
Tetrafluoro-4-(trifluoromethyl)phenylhydrazine |
| 186907-75-5 |
Allyl 2,2,3,3,3-pentafluoropropyl ether |
| 18698-96-9 |
2-IODOPHENYLACETIC ACID |
| 18699-87-1 |
3-Nitro-2-methylpyridine |
| 18704-37-5 | 8-Quinolinesulfonyl chloride |
| 1871-57-4 | 3-Chloro-2-chloromethyl-1-propene |
| 1873-54-7 | 3-Ethylquinoline |
| 1873-88-7 |
1,1,1,3,5,5,5-Heptamethyltrisiloxane |
| 1875-88-3 | 2-(4-chlorophenyl)ethan-1-ol |
| 187804-77-9 | 4-bromo-2, 3' , 4' , 5' -tetrafluoro-1, 1' -biphenyl |
| 1878-69-9 |
2-(3-IODOPHENYL)ACETIC ACID |
| 1882-69-5 | 5-methoxy-2-nitrobenzoic acid |
| 18830-44-9 |
Methyl3,3,3-trifluoropropionate |
| 18835-59-1 |
3,5-DIIODO-L-TYROSINE DI HYDRATE |
| 188429-64-3 |
1,1-Bis(dimethylamino)-2,2,2-trifluoroethane |
| 18853-32-2 |
3,4-Thiophenedicarbonitrile |
| 1885-48-9 |
Difluoromethyl 2,2,2-trifluoroethyl ether |
| 188639-80-7 |
(2-Iodoethyl)perfluorocyclohexane |
| 18876-34-1 | Phenyl Trimethicone |
| 188966-82-7 |
Isopropyl 4,4,4-trifluoromethylcrotonate |
| 18908-66-2 | 1-bromo-2-ethylhexane |
| 189189-12-6 | 4,5:4',5'-Dibenzo-1,1'-dibutyl-3,3,3',3'-tetramethylindacarbocyanine perchlorate |
| 1892-28-3 | Ethyl 2-iodobenzoate |
| 18931-60-7 |
1-(4-Chlorophenyl)-4,4,4-trifluorobutane-1,3-dione |
| 1893-38-5 |
Methyl 2,2,3,3-tetrafluoropropionate |
| 189347-40-8 |
4,4-Difluoro-1-(4-metoxyphenyl)butane-1,3-dione |
| 1897-41-2 |
2,3,5,6-Tetrachloro-terephthalonitrile |
| 1897-52-5 |
2,6-Difluorobenzontrile |
| 189816-05-5 | 4-Chloro-7-methoxy-2-phenylquinoline |
| 1898-91-5 |
Decafluorocyclohexanone |
| 1899-93-0 | 3-Methylbenzenesulphonyl chloride |
| 18995-35-2 | 1-tert-butoxy-4-chlorobenzene |
| 19012-03-4 | 1-Methyl-3-indolecarboxaldehyde |
| 19053-14-6 | 4,4'-Diiodo-p-terphenyl |
| 190723-12-7 |
2,5-dibromo-3,4-thiophene dicarboxylic acid |
| 19094-56-5 | 2-Chloro-5-iodo-benzoic acid |
| 19102-90-0 |
Dimethyl Hexadecanedioate |
| 19129-92-1 | Methyl-2-bromopentanoate |
| 19186-97-1 |
Tris(tribromoneopentyl)phosphate |
| 19219-98-8 | 2,5,6-Trimethylbenzoxazole |
| 19241-16-8 | 2,6-Dimethylphenyl isothiocyanate |
| 192569-10-1 |
2-Iodo-1,1,2,2-tetrafluoroethyl chlorosulfate |
| 193140-71-5 |
Ethyl 3,3,3-trifluoro-DL-alaninate hydrochloride |
| 1934-75-4 | Sodium Dicyanamide |
| 19351-18-9 | 2,2-Dimethylthiazolidine |
| 19351-18-9 | 2,2-Dimethylthiazolidine |
| 19381-50-1 | Naphtholgreen B |
| 19398-61-9 |
2,5-Dichlorotoluene |
| 194149-25-2 |
Bis(3,5-dimethylphenyl)diethylaminophosphine |
| 19430-93-4 |
1H,1H,2H-Perfluorohex-1-ene |
| 1943-82-4 | Phenethyl isocyanate |
| 1944-05-4 |
2,3,4,5,6-Pentafluorobenzhydrol |
| 1946796-71-9 |
5H,5H,6H,7H,8H,8H-Perfluoro(4,4,9,9-tetramethyldodec-6-ene) |
| 1948-33-0 | Tertiary Butyl Hydroquinone (TBHQ) |
| 1948-40-9 |
4-HYDROXY-3,5-DIIODOBENZALDEHYDE |
| 19486-93-2 |
Ethyl 3-hydroxy-4,4,4-trichlorobutyrate |
| 19487-71-9 | 4-(2-Anilinovinyl)-1-ethylquinolinium iodide |
| 19501-58-7 | 4-Methoxyphenylhydrazine hydrochloride |
| 1951-26-4 |
2-Butyl-3-(3,5-Di iodo-4-Hydroxybenzoyl)Benzofuran |
| 1953-54-4 | 5-Indolol |
| 1953-99-7 |
3,4,5,6-Tetrachlorophthalonitrile |
| 195628-73-0 | 2,4-Bis(2,4-dimethylphenyl)-6-(2-hydroxy-4-isooctyloxyphenyl)-1,3,5-triazine |
| 195868-36-1 | Phenyl Trimethicone |
| 1964-77-8 | 5-Bromo-2-methyl-benzimidazole |
| 196597-11-2 |
5-Bromo-4,4,5,5-tetrafluoropent-2-en-1-ol |
| 19701-19-0 |
2-Vinylhexafluoroisopropanol |
| 19727-83-4 | 6-Nitroindoline |
| 19755-53-4 |
2-Bromo-3-nitropyridine |
| 19798-77-7 |
4-Amino-3-chloropyridine |
| 19798-80-2 |
2-Amino-4-chloropyridine |
| 1980008-22-7 |
Perfluoro(2,3-dimethyl-4-oxaheptan-2-ol) |
| 1980039-01-7 |
2-Cyano-1,1,3-trichloro-1,3,3-trifluoropropan-2-yl acrylate |
| 1980040-36-5 |
5,5-Bis(trifluoromethyl)-6,6,7,7,8,8,8-heptafluorooctan-1-ol |
| 1980040-36-5 |
2-Cyanohexafluoropropan-2-yl acrylate |
| 1980044-60-7 |
2-Cyano-1,3-difluorotetrachloropropan-2-yl acrylate |
| 1980064-18-3 |
1,2-Diisoprpopoxytetrafluorobenzene |
| 1980086-27-8 |
Trimethyl(perfluoro-1,1,2-trimethyl-3-oxahexyloxy)silane |
| 1980086-52-9 |
2-Cyano-1,3-dichlorotetrafluoropropan-2-yl acrylate |
| 19812-64-7 |
1,14-Tetradecanediol |
| 19814-75-6 |
9,9-Dimethyl-9H-xanthene |
| 19817-92-6 | Uridine-5'-triphosphoric acid trisodium salt |
| 1984-15-2 |
Methylenediphosphonic acid |
| 19842-76-3 |
2,3,5,6-Tetrafluorobenzaldehyde |
| 19853-64-6 | 6,7-Dichloroquinoxaline |
| 19853-79-3 | 2,4-Dichloro-3-methylaniline |
| 1990-90-5 |
4-Amino-3-methylpyridine |
| 1992-15-0 |
1,4-Bis(2-hydroxyhexafluoroisopropyl)benzene |
| 1992-91-2 |
4,4,5,5,6,6,6-Heptafluorohexane-1,2-diol |
| 19932-26-4 |
3-(2,2,3,3-tetrafluoropropoxy)-1,2-epoxypropane |
| 19932-27-5 |
3-(1H,1H,5H-Octafluoropentoxy)-1,2-propenoxide |
| 1996-88-9 |
1H,1H,2H,2H-Perfluorodecyl methacrylate |
| 19982-07-1 | 1-Acetamido-3,5-dimethyladamantane |
| 1998-61-4 |
4-Bromotetrafluorophenol |
| 1998-66-9 |
4-Bromo-2,3,5,6-tetrafluoroaniline |
| 1999-00-4 | Ethyl p-fluorobenzoylacetate |
| CAS NO | Product Name |
| 20017-49-6 |
4-(Heptafluoroisopropyl) tetrafluorobenzotrifluoride |
| 2002-92-8 | 3-(Pentafluorophenyl)propionic acid |
| 2002-93-9 |
2,3,4,5,6-Pentafluorobenzyl acetate |
| 2002-99-5 |
4-Ethoxy-2,3,5,6-tetrafluorobenzotrifluoride |
| 2003-15-8 |
3-(2-Chloro-1,1,2-trifluoroethoxy)benzaldehyde |
| 200501-94-6 |
4-Iodo-1,1,1,2-tetrafluoro-2-(trifluoromethoxy)octane |
| 200501-96-8 |
4-Iodo-1,1,1,2-tetrafluoro-2-(trifluoromethoxy)butane |
| 20082-71-7 |
Chlorodimethyl(pentafluorophenyl)silane |
| 20083-07-2 |
Trimethyl(2,3,5,6-tetrafluorophenyl)silane |
| 20083-34-5 |
Triethoxy(pentafluorophenyl)silane |
| 20084-49-5 |
(1H,1H-Perfluorooctyl)oxirane |
| 2008-75-5 |
N-(2-chloroethyl)piperidine hydrochloride |
| 20098-14-0 |
5-Hydroxy-2-Adamantanone |
| 2009-83-8 | 6-Chorohexanol |
| 20103-09-7 | 2,5-Dichloro-1,4-phenylenediamine |
| 2010-61-9 |
Hexafluoro-2-(4-methylphenyl)propan-2-ol |
| 2010-63-1 |
2-(4-Chlorophenyl)hexafluoropropan-2-ol |
| 20109-59-5 |
Sodium perfluoroheptanoate |
| 201349-37-3 |
ENISAMIUM IODIDE |
| 2014-83-7 |
2,6-Dichlorobenzyl Chloride |
| 20205-29-2 | 1-Propyl-2,3,3-trimethylindolium iodide |
| 202134-57-4 |
2-[4-(Bromomethyl)phenyl]hexafluoropropan-2-ol |
| 2022-85-7 | 5-fluorocytosine |
| 202289-38-1 |
Bis(2-methoxyethyl)aminosulphurtrifluoride |
| 202420-04-0 | 1H-Benzotriazole, C-chloro-C-methyl-, sodium salt (1:1) |
| 202865-72-3 |
2-Bromo-5-Fluoro Iodobenzene |
| 202865-85-8 |
2-BROMO-5-IODOTOLUENE |
| 2030241-43-9 |
2-Bromo-1,1,2,2-tetrafluoroethyl chlorosulfate |
| 2031-23-4 |
1-(3-chloropropyl)-4-methylpiperazine dihydrochloride |
| 2031-67-6 | Triethoxymethylsilane |
| 203201-14-3 |
1H,1H,1H,3H,3H-Perfluorododecane-2,4-dione |
| 20325-40-0 | 3,3'-Dimethoxybiphenyl-4,4'-ylenediammonium dichloride |
| 20328-87-4 | 2,2'-[(2-Carboxy-pphenylene)bis(iminovinylene)]bis(3-ethyl-2thiazolinium) diiodide |
| 203302-90-3 |
1-Bromo-2-methyl-4,4,4-trifluorobutane |
| 203302-91-4 |
2-Hydroxy-2-(trifluoromethyl)butyronitrile |
| 203302-96-9 |
1,1-Dibromo-3,3,4,4,4-pentafluorobutan-2-one |
| 203303-02-0 |
4-Bromo-1,1,1-trifluoro-2-(trifluoromethyl)butane |
| 2035-72-5 | 2-Hydroxy-4-(methacryloyloxy)benzophenone |
| 2036-62-6 |
Chloropentafluoroacetone monohydrate |
| 203785-75-5 | 3-Allyl-5-(3-ethyl-4-methyl-2thiazolinylidene)rhodanine |
| 2038-03-1 |
4-(2-aminoethyl)morpholine |
| 2038-57-5 | 3-Phenyl-1-propylamine |
| 203866-13-1 |
N-BOC-cis-4-fluoro-L-proline |
| 203866-15-3 |
N-BOC-4,4-difluoro-L-proline |
| 203929-12-8 |
6-Iodo-3,3,4,4,5,5,6,6-octafluorohex-1 ene |
| 2039-87-4 | 2-Chlorostyrene |
| 20395-28-2 |
5-Chloropentyl acetate |
| 2040356-43-0 |
1,1-Bis(trifluoromethyl)-2,2,2-trichloroethyl acrylate |
| 20411-83-0 |
3-Chloro-2,2,3,3-tetrafluoropropan-1-ol |
| 204130-95-0 |
3(5)-Nonafluorobutyl-5(3)-phenylpyrazole |
| 2042-14-0 | 4-Methyl-3-nitrophenol |
| 204316-01-8 |
Trimethyl(nonafluorobutyl)silane |
| 2043217-94-1 |
1,1-Bis(trifluoromethyl)-2,2,2-trichloroethyl 2-сhloroacrylate |
| 2043218-06-8 |
1,1-Bis(trifluoromethyl)-2,2,3,3,3-pentafluoropropyl 2-fluoroacrylate |
| 2043-47-2 |
3,3,4,4,5,5,6,6,6-Nonafluorohexan-1-ol |
| 2043-53-0 |
1-Iodo-1H,1H,2H,2H-perfluorodecane |
| 2043-55-2 |
6-Iodo-1,1,1,2,2,3,3,4,4-nonafluorohexane |
| 2043-57-4 |
1-Iodo-1H,1H,2H,2H-perfluorooctane |
| 20440-93-1 | 4,4',4"-Trinitrotriphenylamine |
| 20440-95-3 |
4,4-Dimethyl Triphenylamine |
| 20469-89-0 |
2-bromoisobutyryl chloride |
| 2050-77-3 |
1 - Iodo Decane |
| 2050-9-1 | Iso Amyl Valerate |
| 20511-12-0 |
2-Amino-5-iodopyridine |
| 2052-01-9 |
2-bromoisobutyric acid |
| 20530-38-5 |
3,3,3-Trifluoropropionitrile |
| 20541-54-2 |
1-Diazo-2-naphthol-4-sulfonic acid |
| 20555-91-3 |
3,4-DICHLOROPHENYL IODIDE |
| 205750-82-9 |
ETHYL-2-FLUORO-4-IODOBENZOATE |
| 20583-66-8 |
3H,3H-Decafluoroheptane-2,4-dione |
| 205865-67-4 |
Ethyl trimethylsilyldifluoroacetate |
| 205926-99-4 |
4,4'-Di(hydroxy)octafluorobiphenyl hydrate |
| 20621-29-8 |
1,1,1-Trifluoromethanesulfinyl chloride |
| 2062-20-6 |
Dimethyl perfluorosuberate |
| 2062-98-8 | Perfluoro(2-methyl-3-oxahexanoyl) fluoride |
| 2063-40-3 |
3-(Pentafluorophenyl)propionyl chloride |
| 206439-63-6 | 1,1'-Di-n-butyl-3,3,3',3'-tetramethylnaphtho[1,2-d]-pyrrolo-2,2'-pentamethincyanine tetrafluoroborate |
| 2065-66-9 |
Methyltriphenylphosphonium Iodide |
| 206658-90-4 | 3-Aminophthalhydrazide sodium salt hemihydrate |
| 2067-33-6 | 5-bromopentanoic acid |
| 206752-36-5 | Benzamidine hydrochloride hydrate |
| 20677-73-0 |
2,2-diethoxy-N-methylethanamine |
| 20686-62-8 | 2-Methylnaphtho[2,1-d]thiazole |
| 206872-01-7 | 2-Amino-6-Bromo-4-methoxyphenol |
| 20698-04-8 |
3,6-DIIDOPYRIDAZINE |
| 20702-77-6 |
Neohesperidin dihydrochalcone |
| 2070-70-4 | Perfluoro(4-methylpent-2-ene) |
| 20712-16-7 |
2-Amino-5-chloro-3-methylpyridine |
| 207347-46-4 | Dye N719 |
| 207399-06-2 | IR-786 perchlorat |
| 207399-07-3 | 11-Chloro-1,1'-dipropyl-3,3,3',3'-tetramethyl-10,12-trimethyleneindatricarbocyanine iodide |
| 207511-11-3 | Sodium 2-mercaptobenzimidazole-5-sulfonate dihydrate |
| 207671-78-1 |
Hexafluoro-4-(trifluoromethyl)pent-2-enoyl chloride |
| 20769-85-1 | 2-bromo-2-methylpropionylbromide |
| 20776-67-4 | 2-Amino-5-chloro-3-methyl Benzoic Acid |
| 20780-49-8 | Di Methyl Octanyl Acetate |
| 20780-53-4 | (R)-(-)-Styrene oxide |
| 20815-52-5 | 4-Hydrazinopyridine hydrochloride |
| 20825-07-4 |
3H,3H-Octafluorohexane-2,4-dione |
| 2082-79-3 | Octadecyl 3-(3,5 -di-tert-butyl-4-hydroxyphenyl)propionate |
| 20826-04-4 | 5 Bromo Nicotinic Acid |
| 20867-94-1 |
4-Methoxy-2,3,5,6-tetrafluorobenzotrifluoride |
| 20925-85-3 |
2,3,4,5,6-Pentachlorobenzonitrile |
| 2094-72-6 |
1-Adamantane Carbonyl Chloride |
| 2094-73-7 | Adamantane-1-carboxylic acid ethyl ester |
| 20941-65-5 | Tellurium dimethyl dithiocarbamate |
| 2095-03-6 | Bisphenol F Diglycidylether |
| 20986-40-7 |
Ethyl-5-bromo nicotinate |
| 209980-47-2 | N1,N1'-([1,1'-Biphenyl]-4,4'-diyl)bis(N4-(naphthalen-1-yl)-N1,N4-diphe |
| 209995-38-0 |
2,4,5-Trifluorophenylacetic acid |
| 2104-19-0 |
Monomethyl Azelate |
| 21043-40-3 | 1-Cyclopentylpiperazine |
| 21045-62-5 |
4-Diethylamino-1,1,1-trifluorobut-3-en-2-one |
| 21049-36-5 |
Potassium perfluoroheptanoate |
| 21049-38-7 |
Potassium perfluorononanoate |
| 21049-39-8 |
Sodium perfluorononanoate |
| 2106-40-3 |
1-Chloro-2,4,6-trifluorobenzene |
| 2107-69-9 |
5,6-Dimethoxy-1-indanone |
| 2107-70-2 |
3-(3,4-Dimethoxyphenyl) propionic acid |
| 2110-78-3 | Methyl 2-hydroxyisobutyrate |
| 211108-50-8 |
4-Boc-Piperidinone,3-fluoro |
| 2113-51-1 |
2-IODOBIPHENYL |
| 2114-02-5 | Guanyl Thiourea |
| 211915-84-3 |
3-[[[2-[[(4-Cyanophenyl)amino]methyl]-1-methyl-1H-benzimidazol-5-yl]carbonyl]pyridin-2-ylamino]propionic acid ethyl ester |
| 211985-86-3 |
Dimethyl(trifluoromethyl)(vinyl)silane |
| 2120-70-9 | Phenoxyacetaldehyde |
| 212190-16-4 |
4,4,5,5,5-Pentafluoropentyl thiocyanate |
| 2122003-90-9 |
Methyl 2-(1,1,2,2-tetrafluorоethoxy)benzoate |
| 212322-56-0 |
3-[(3-AMINO-4-METHYLAMINO-BENZOYL)-PYRIDIN-2-YL-AMINO]-PROPIONIC ACID ETHYL ESTER |
| 2125-23-7 | 2,4,6-tris(2,4-dihydroxyphenyl)-1,3,5-triazine |
| 212563-43-4 |
1-Iodo-1H,1H-perfluoroheptane |
| 21260-46-8 | Bismuth tris(dimethyldithiocarbamate) |
| 21331-43-1 | 2-Amino-4-(2-naphthyl)thiazole |
| 2136-89-2 |
2-Chlorobenzotrichloride |
| 2138-24-1 |
TETRA-n-HEXYLAMMONIUM IODIDE |
| 214207-81-5 | Viologen |
| 2142-63-4 |
3’-Bromo Acetophenone |
| 21427-61-2 |
2-Hydroxy-3-Nitro-5-Chloro Pyridine |
| 21427-62-3 |
2,5-Dichloro-3-nitropyridine |
| 2144-08-3 |
2, 3, 4 Trihydroxy benzaldehyde |
| 2144-53-8 |
1H,1H,2H,2H-Perfluorooctyl methacrylate |
| 2145-68-8 |
6,6-Dimethyl-1,1,1,2,2-pentafluoroheptane-3,5-dione |
| 2149590-50-9 |
1,1-Bis(trifluoromethyl)-2,2,2-trichloroethyl methanesulfonate |
| 2149590-60-1 |
1,1,2,2,4,5,5-Heptafluoro-3-oxapent-4-enyl(trimethyl)silane |
| 2149590-68-9 |
1-Bromo-4-iodo-1,1,2,2-tetrafluoropentane |
| 2149602-18-4 |
1-Bromo-2-(2-iodotetrafluoroethoxy)tetrafluoroethane |
| 215181-91-2 |
2-Trimethylsilyloxy-1,1,1,5,5,5-hexafluoropent-2-en-4-one |
| 215370-93-7 | 4,5-Benzo-1,1'-dibutyl-3,3,3',3',5-pentamethylindacarbocyanine perchlorate |
| 21544-03-6 | Diglycidyl 4-Cyclohexene-1,2-dicarboxylate |
| 21544-81-0 |
4,6-Dimethoxyisatin |
| 2156-96-9 |
Decyl acrylate |
| 2156-97-0 |
Dodecyl acrylate |
| 215858-32-5 |
2,2,3,3-Tetrafluoropropanal hydrate |
| 2160-89-6 | 1,1,1,3,3,3-Hexafluoroisopropyl acrylate |
| 21615-34-9 |
o-Anisoyl Chloride |
| 21622-18-4 |
2,3,4,5-Tetrafluorobenzyl chloride |
| 21622-19-5 |
2,3,4,5-Tetrafluorotoluene |
| 2162-98-3 |
1,10-dichlorodecane |
| 2162-99-4 | 1,8-Dichloroethane |
| 2163-00-0 | 1,6-Dichlorohexane |
| 2163-06-6 |
1,6-Diiodo-3,3,4,4-tetrafluorohexane |
| 2163-48-6 |
diethyl propylmalonate |
| 21634-97-9 |
2,3,4,5,6-Pentafluorobenzyl propionate |
| 21635-69-8 |
vinyl sulphone ester of para cresidine |
| 21643-42-5 |
Tetradecyl acrylate |
| 21645-51-2 | Aluminum Hydroxide |
| 21652-57-3 |
1-Bromo-1H,1H,2H,2H-perfluorodecane |
| 21652-58-4 |
1H,1H,2H-Perfluorodec-1-ene |
| 2169-67-7 |
Bromodifluoroacetamide |
| 217186-74-8 |
Ethyl 5,5,5-trifluoropentanoate |
| 21727-90-2 |
8-chloro-1-octanol acetate |
| 21727-91-3 |
7-bromo-1-heptanol acetate |
| 21739-92-4 | 5-Bromo-2-chloro benzoic acid |
| 21740-00-1 |
2-IODO-5-BROMO BENZOIC ACID |
| 217973-03-0 | Sodium 1,4,7,10-tetraazacyclododecan-1,4,7-triacetate |
| 2180-30-5 |
4,4'-Bis(2-hydroxyhexafluoroisopropyl)biphenyl |
| 2181-42-2 |
Trimethylsulphonium Iodide |
| 21816-08-0 |
3-Bromo-1-Adamantane Carboxylic Acid |
| 2182-55-0 | Cyclohexyl vinyl ether |
| 21850-44-2 | Octabromoether |
| 21876-43-7 | Pyridinium butylsulfonate |
| 218768-84-4 | Melamine Polyphosphate |
| 21901-18-8 |
2-Hydroxy-3-Nitro-4-Methyl Pyridine |
| 21901-29-1 |
2-Amino-3-nitro-6-methylpyridine |
| 21901-34-8 |
2-Hydroxy-5-nitro-3-methylpyridine |
| 21901-40-6 |
2-Amino-4-methyl-5-nitropyridine |
| 21901-41-7 |
2-Hydroxy-4-methyl-5-nitropyridine |
| 2192-55-4 |
2-(Pentafluorophenoxy)ethanol |
| 21951-34-8 | 1-(4-Beta-hydroxyethylsulfonylphenyl-)-3-methyl-5-pyrazolone |
| 21959-36-4 |
N-ACETYL DIIODOTYROSINE ETHYL ESTER |
| 219777-03-4 |
4-Ethoxy-1,1,1-trifluorobutan-2-ol |
| 219834-94-3 |
(3-Methoxynaphthalen-1-yl)boronic acid |
| 21987-29-1 |
4,4-difluoro-Piperidine |
| 219904-94-6 |
1,2-Dichloro-1,1,2-trifluorooctane |
| 219904-95-7 |
1,2-Dichloro-1,1,2-trifluorooct-3-ene |
| 219904-98-0 |
(1,2-Dichlorotrifluoroethyl)cyclohexane |
| 220000-87-3 |
4-chloro-N-methyl-2-pyridinecarboxamide |
| 2200-70-6 |
4,4'-Di(hydroxy)octafluorobiphenyl |
| 220141-70-8 |
5-Fluoroorotic acid monohydrate |
| 22031-12-5 | 1,1,1-Tris(diphenylphosphinomethyl)ethane |
| 220469-13-6 | 7,8,8,8-Tetrafluoro-7-(trifluoromethyl)octan-1-ol |
| 22052-81-9 | Ethyl pentafluoroethyl ether |
| 22052-84-2 | Heptafluoroisopropyl methyl ether |
| 22071-15-4 | Ketoprofen |
| 2210-74-4 | 1,2-epoxy-3-(o-methoxyphenoxy)propane |
| 2210-79-9 | Cresol Glycidyl Ether |
| 22118-12-3 |
2-bromobutyryl chloride |
| 2213-63-0 | 2,3-Dichloroquinoxaline |
| 221347-71-3 | 5-Fluorobenzoxazole |
| 2215-89-6 | Oxybisenzoic acid; 4,4'-dicarboxy diphenylether |
| 2216-69-5 | 1-Methoxynaphthalene |
| 2216-92-4 | Ethyl N-phenylglycinate |
| 2217-41-6 | 1-Amino-5,6,7,8-tetrahydronaphthalene |
| 2218-52-2 |
Sodium difluoroacetate |
| 2218-54-4 |
Sodium heptafluorobutyrate |
| 22190-33-6 |
5-bromoindoline |
| 222026-50-8 |
5-Bromo-4-chloro-4,5,5-trifluoropentan-1-ol |
| 222037-87-8 |
Perfluorooctanoyl bromide |
| 2224-00-2 |
2-ethoxy-1-naphthalenecarboxylic acid |
| 2224-33-1 | Vinyl Tris(methylethylketoxime)silane |
| 22246-18-0 |
7-Hydroxy-2(1H)-3,4-dihydroquinolinone |
| 2226-96-2 | 4-Hydroxy-2,2,6,6-tetramethyl-piperidinooxy,free radical |
| 222725-20-4 |
5-Bromo-4,4,5,5-tetrafluoropentan-1-ol |
| 22280-62-2 |
2-Amino-6-methyl-5-nitropyridine |
| 22282-99-1 |
4-Bromo-2-methylpyridine |
| 22306-36-1 |
1-bromo-3-iodopropane |
| 2232-12-4 |
1,3- di iodo-5,5-dimethylhydantion |
| 22325-71-9 |
Nonafluoropentanenitrile |
| 2233-18-3 | 3,5-Dimethyl-4-hydroxybenzaldehyde |
| 2234-16-4 | 2, 4 Dichloro Acetophenone |
| 223463-13-6 |
5-Bromo-2-iodopyridine |
| 22346-43-6 | N-Methyl J acid |
| 22348-32-9 | (R)-α,α-Diphenyl-2-pyrrolidinemethanol |
| 22353-38-4 |
2-Hydroxy-3-chloro-5-nitropyridine |
| 22353-40-8 |
2,3-Dichloro-5-nitropyridine |
| 223668-64-2 |
Trimethoxy(pentafluorophenyl)silane |
| 223668-68-6 |
Dimethoxybis(pentafluorophenyl)silane |
| 2237-30-1 | 3-Aminobenzonitrile |
| 2240-88-2 |
3,3,3-Trifluoropropan-1-ol |
| 22419-35-8 |
4,4-difluorocyclohexanol |
| 224311-49-3 |
2-Di-tert-butylphosphino-2′-(N,N-dimethylamino)biphenyl |
| 224311-51-7 |
2-(Di-tert-butylphosphino)biphenyl |
| 2243-62-1 |
1,5-Diaminonaphthalene |
| 2244081-92-1 |
3-Hydroxy-1,3-bis(perfluorohexyl)butan-1-one |
| 2244083-78-9 |
Triethoxy[5,5-bis(trifluoromethyl)-6,6,7,7,8,8,8-heptafluorooctyl]silane |
| 2244083-88-1 |
Bis(5-fluorsulfonylperfluoro-3-oxapentyl) disulfide |
| 2244085-08-1 |
2-(Bromodifluoromethyl)-2,4,4,5,5-pentafluoro-1,3-oxathiolane |
| 2244085-29-6 |
Bis(perfluoro-6-vinyl-4-methyl-3,6-dioxahexyl) disulfide |
| 2244085-50-3 |
Bis(4H-octafluorobutyl) disulfide |
| 2244086-26-6 |
4,5-Dibromo-1,1,1,2,2,3-hexafluoro-3-(trifluoromethyl)pentane |
| 2244087-13-4 |
2-Iodo-3,3,3-trifluoropropan-1-ol |
| 2244087-17-8 |
Bis(7-methoxycarbonylperfluoro-4,7-dimethyl-3,6-dioxaheptyl) disulfide |
| 2244088-12-6 |
Methyl 8-bromoperfluoro(2,5-dimethyl-3,6-dioxaoctanoate) |
| 2244-16-8 | D-Carvone |
| 22466-49-5 |
Sodium 1,1,1,5,5,5-hexafluoroacetylacetonate |
| 2247-88-3 |
3-Fluoropyridin-4-amine |
| 22483-09-6 |
2-aminoacetaldehyde dimethyl acetal |
| 2248-46-6 |
Ethyl2,2-difluoro-2-phenylacetate |
| 2248-93-3 |
11H-Perfluoroundecanoyl chloride |
| 22509-74-6 | N-Carbethoxypthalimide |
| 2251-50-5 |
Pentafluorobenzoyl chloride |
| 22515-16-8 |
Diethyl 4,4-difluoroheptanedioate |
| 22515-18-0 |
4,4-Difluorocyclohexanone |
| 22515-91-9 |
5-Bromo-4,4,5,5-tetrafluoropent-2-ene |
| 22528-67-2 |
2-Bromoperfluoro(2-methylpentane) |
| 2253-14-7 |
1-Iodo-1H,1H-nonafluoropentane |
| 22535-49-5 |
4-acryloyloxybenzophenone |
| 2253-73-8 | Isopropyl isothiocyanate |
| 2261-99-6 |
1H,1H,7H-Perfluoroheptyl methacrylate |
| 2263-97-0 |
1,2,11,12-Tetrachloroperfluorododecane |
| 2264-00-8 |
1H,1H,5H-Octafluoropentyl p-toluenesulfonate |
| 2264-01-9 |
2,2,3,3,4,4,5,5-Octafluorohexan-1,6-diyl diacrylate |
| 2264-25-7 |
Sodium 7H-perfluoroheptanoate |
| 226575-14-0 |
3,4,4,4-Tetrafluoro-3-(trifluoromethoxy)but-1-ene |
| 2265-91-0 | 1,3-DIFLUORO-5-IODOBENZENE |
| 2268-24-8 | 1,2-Dichloro-1,2-difluoroethanesultone |
| 226909-72-4 | Methyl perfluorohexyl ether |
| 22715-46-4 | Sodium 5H-octafluoropentanoate |
| 22715-47-5 | Potassium 5H-octafluoropentanoate |
| 22767-90-4 | 1,1,1-Trifluoro-5,5-dimethylhexane-2,4-dione |
| 22832-87-7 | Miconazole nitrate |
| 228407-54-3 |
Perfluorononanoic anhydride |
| 2284-20-0 | 4-Methoxyphenylisothiocyanate |
| 2286-54-6 | 3,3-diphenylpropanenitrile |
| 22889-78-7 |
3,5-Dichloro-4-aminopyridine |
| 22918-01-0 |
2-Bromo-4-Chloropyridine |
| 2295-31-0 | 2,4-Thiazolidinedione |
| 2298-07-9 | 1-Amino-4-bromonaphthalene |
| 22984-54-9 | Methyl Tris(methylethylketoxime)silane |
| 22990-19-8 |
1-Phenyl-1,2,3,4-tetrahydro isoquinoline |
| 22990-77-8 |
Piperidin-2-ylmethylanamine |
| 229957-00-0 |
5(3)-Methyl-3(5)-[perfluoro(1-propoxyethyl)]pyrazole |
| 229980-58-9 |
1-Acetyl-5(3)-methyl-4-nitro-3(5)-(trifluoromethyl)pyrazole |
| 229980-59-0 |
1-Acetyl-4-bromo-5(3)-methyl-3(5)-(trifluoromethyl)pyrazole |
| 229980-60-3 |
1-Acetyl-5(3)-heptafluoropropyl-3(5)-(trifluoromethyl)pyrazole |
| 230295-07-5 |
4-Bromo-5(3)-phenyl-3(5)-(trifluoromethyl)pyrazole |
| 23039-97-6 |
Bis(4-fluorophenyl)chlorophosphine |
| 23056-36-2 |
2-Chloro-4-nitropyridine |
| 23056-39-5 |
2-Chloro-4-methyl-3-nitropyridine |
| 23056-46-4 |
2-Bromo-5-methyl-3-nitropyridine |
| 23056-47-5 |
2-Bromo-4-methyl-5-nitropyridine |
| 23128-74-7 | N,N'-(Hexane-1,6-diyl)bis[3-(3,5-di-tert-butyl-4-hydroxyphenyl)propanamide] |
| 231291-19-3 |
2-Bromo-3,4,4,4-tetrafluoro-3-(trifluoromethoxy)but-1-ene |
| 231291-22-8 |
6-(Trifluoromethyl)nicotinic acid |
| 231301-09-0 |
1-Acetyl-3(5)-nonafluorobutyl-5(3)-(trifluoromethyl)pyrazole |
| 231301-10-3 |
1-Acetyl-4-chloro-5(3)-methyl-3(5)-(trifluoromethyl)pyrazole |
| 231301-24-9 |
1-Acetyl-3(5)-heptafluoropropyl-5(3)-methylpyrazole |
| 231301-25-0 |
1-Acetyl-4-chloro-3(5)-heptafluoropropyl-5(3)-methylpyrazole |
| 231301-26-1 |
1-Benzoyl-3(5)-perfluorohexyl-5(3)-(trifluoromethyl)pyrazole |
| 231301-27-2 |
1-Benzoyl-5(3)-heptafluoropropyl-3(5)-(trifluoromethyl)pyrazole |
| 231301-28-3 |
1-Acetyl-5(3)-methyl-3(5)-perfluoro(1-propoxyethyl)pyrazole |
| 231301-29-4 |
1-Acetyl-3(5)-perfluorohexyl-5(3)-(trifluoromethyl)pyrazole |
| 231301-30-7 |
1-Acetyl-4-bromo-5(3)-methyl-3(5)-perfluoro(1-propoxyethyl)pyrazole |
| 231301-31-8 |
1-Acetyl-4-chloro-5(3)-methyl-3(5)-perfluoro(1-propoxyethyl)pyrazole |
| 23132-21-0 |
2-Bromo-3-methyl-5-nitropyridine |
| 23138-53-6 | Methyl 4-isocyanatobenzoate |
| 23144-52-7 |
8-chloro-1-octanol |
| 2314-97-8 |
Iodotrifluoromethane |
| 23152-63-8 |
2,2-Dichloro-3,3-bis(trifluoromethyl)oxirane |
| 2316-26-9 | 3,4-Dimethoxycinnamic acid |
| 231630-82-3 |
4-Bromo-5(3)-methyl-3(5)-perfluoro(1-propoxyethyl)pyrazole |
| 231630-92-5 |
1-Bromo-1,1,2,2-tetrafluorooctane |
| 2317-91-1 |
1-Chloro-1-fluoroethylene |
| 2318-25-4 | Ethyl 3-ethoxy-3-iminopropionate hydrochloride |
| 231947-18-5 |
1-Acetyl-4-chloro-3(5)-heptafluoropropyl-5(3)-phenylpyrazole |
| 231947-19-6 |
1-Benzoyl-5(3)-methyl-3(5)-(trifluoromethyl)pyrazole |
| 231947-20-9 |
1-Acetyl-5(3)-methyl-4-nitro-3(5)-perfluoro(1-propoxyethyl)pyrazole |
| 231947-22-1 |
1-Acetyl-5(3)-phenyl-3(5)-(trifluoromethyl)pyrazole |
| 231947-23-2 |
1-Acetyl-4-chloro-5(3)-phenyl-3(5)-(trifluoromethyl)pyrazole |
| 231947-24-3 |
1-Acetyl-3(5)-heptafluoropropyl-5(3)-phenylpyrazole |
| 231953-30-3 |
1-(2-Bromo-1-chlorotrifluoroethyl)cyclohexene |
| 231953-39-2 |
1-Iodoheptaluorobut-1-ene |
| 231955-60-5 |
1-Acetyl-4-bromo-5(3)-phenyl-3(5)-(trifluoromethyl)pyrazole |
| 231955-61-6 |
1-Acetyl-4-bromo-3(5)-heptafluoropropyl-5(3)-phenylpyrazole |
| 232-268-1 | Alpha Terpineol |
| 23216-67-3 | 3,3'-Bis(3-sulfopropyl)-4,5:4',5'-dibenzo-9ethylthiacarbocyanine betaine triethylammonium salt |
| 232278-00-1 |
1-Acetyl-4-bromo-5(3)-heptafluoropropyl-3(5)-methylpyrazole |
| 2324-98-3 |
2,3,5,6-Tetrafluoroanisole |
| 23249-96-9 | 1-(3-Aminophenyl)-5-mercaptotetrazole |
| 232587-49-4 |
4-Chloro-5(3)-methyl-3(5)-(perfluorooctyl)pyrazole |
| 232602-77-6 |
1-Bromo-2-(2-bromo-1-chlorotrifluoroethyl)cyclohexane |
| 232602-78-7 |
1-Bromo-4-chloro-1,1,2,2-tetrafluorobutane |
| 232602-79-8 |
5-Bromo-4-chloro-4,5,5-trifluoropentanoic acid |
| 232602-80-1 |
5-Bromo-4-chloro-4,5,5-trifluoropent-2-enoic acid |
| 232602-81-2 |
5-Bromo-4-chloro-4,5,5-trifluoropent-2-en-1-ol |
| 23323-37-7 | N-octy-D-glucamine |
| 23377-40-4 |
3-hexadecyloxy-1-propanol |
| 2340-84-3 |
1H,1H,2H,3H-Perfluoroundec-2-en-1-ol |
| 234096-23-2 |
4-Bromo-1,2-dichloro-1,1,2-trifluorobutane |
| 234096-31-2 |
2-Bromo-3,4,4,5,5,5-hexafluoro-3-(trifluoromethyl)pent-1-ene |
| 2341-25-5 | (6-Fluoroindol-3-yl)acetonitrile |
| 23426-63-3 | Methyl 2-bromo-methylpropionate |
| 2342-67-8 |
3,3,3-Trifluoropropyl p-toluenesulfonate |
| 2343-27-3 |
2-Fluorophenylglycine |
| 2343-89-7 |
Methyl 2-fluoroacrylate |
| 234443-22-2 |
5-Bromo-4,4,5,5-tetrafluoropentanoic acid |
| 234443-23-3 |
2-Bromotetrafluoropropionitrile |
| 234443-24-4 |
2-Bromo-3,4,4,4-tetrafluoro-3-(trifluoromethyl)but-1-ene |
| 2344-80-1 |
Chloromethyltrimethylsilane |
| 23449-08-3 | 2-(4-Bromophenyl)-4,6-diphenyl-1,3,5-triazine |
| 2346-00-1 | 2-Methyl-2-thiazoline |
| 2349-67-9 | 5-Amino-1,3,4-thiadiazole-2-thiol |
| 235088-70-7 |
2,3,4,5-Tetrafluorobenzylamine |
| 235106-08-8 |
1-Chloro-1-iodo-1H,2H,2H-perfluorooctane |
| 235106-10-2 |
2-Chloro-3,4,4,4-tetrafluoro-3-(trifluoromethyl)but-1-ene |
| 235106-11-3 |
4-Chloro-1,1,2-trifluorobut-1-ene |
| 235106-12-4 |
4-Chloro-5(3)-methyl-3(5)-(trifluoromethyl)pyrazole |
| 235106-13-5 |
4-Chloro-5(3)-phenyl-3(5)-(trifluoromethyl)pyrazole |
| 2351-37-3 | 4,4'-Biphenyldicrbonyl chloride |
| 23530-42-9 | N-Isopropyl-2-nitrobenzenesulphonamide |
| 2354-05-4 |
Pentachloro-1,1,2-trifluoropropane |
| 2356-16-3 |
Triethyl 2-fluoro-2-phosphonoacetate |
| 2358-22-7 |
Perfluoroheptanamide |
| 23593-75-1 | Clotrimazole |
| 2365-82-4 |
Methyl4,4,4-trifluorobutyrate |
| 2366-52-1 |
1-Fluorobutane |
| 2366-70-3 |
4,4,4-Trifluorobutan-2-one |
| 236736-19-9 |
1,2-Dibromo-1H,1H,2H-perfluorohexane |
| 23674-20-6 | 9-Bromo-10-phenylanthracene |
| 2367-76-2 |
2-Bromo-1,3,5-trifluorobenzene |
| 2367-82-0 |
1,2,3,5-Tetrafluorobenzene |
| 23680-84-4 | 4-Amino-2-chloro-6,7-dimethoxyquinazoline |
| 2369-18-8 |
2-Fluoro-3-Methylpyridine |
| 2369-19-9 |
2-Fluoro-5-Methylpyridine |
| 2370-63-0 | 2-Ethoxyethyl methacrylate |
| 2370-88-9 |
1,3,5,7-Tetramethylcyclotetrasiloxane |
| 23726-91-2 | Beta Damascone |
| 2373-98-0 | 3,3'-Dihydroxybenzidine |
| 23743-26-2 |
1,2-Bis(dicyclohexylphosphino)ethane |
| 23749-58-8 | Luminore yellow-green 490PT |
| 2377-81-3 |
Tetrafluoroisophthalonitrile |
| 23779-97-7 |
4-Chloro-8-(trifluoromethyl)quinoline |
| 2378-02-1 | Perfluoro-tert-butanol |
| 2378-95-2 |
Diethyl N-[4-(methylamino)benzoyl]-L-glutamate; |
| 23790-49-0 |
Perfluorohexanenitrile |
| 2379-55-7 | 2,3-Dimethylquinoxaline |
| 2379-56-8 | 6-Nitro-2,3-dihydroxyquinoxaline |
| 2379-60-4 | 2,3-Dichloro-6-nitroquinoxaline |
| 2380-94-1 | 4-Indolol |
| 2382-96-9 | 2-Mercaptobenzoxazole |
| 2386-87-0 | 3,4-Epoxycyclohexylmethyl-3,4-Epoxycyclohexane Carboxylate |
| 23877-12-5 |
Tert-butyl 2-bromoisobutyrate |
| 2390-59-2 | BASIC VIOLET 4 |
| 23920-15-2 | HC BLUE 11 |
| 2393-23-9 | 4-Methoxybenzylamine |
| 239463-94-6 |
2,3,3,4,4,4-Hexafluoro-2-(trifluoromethyl)butyloxirane |
| 239463-95-7 |
4,5,5,6,6,6-Hexafluoro-4-(trifluoromethyl)hexanoic acid |
| 239463-96-8 |
4,5,5,6,6,6-Hexafluoro-4-(trifluoromethyl)hexan-1-ol |
| 239463-97-9 |
4,5,5,6,6,6-Hexafluoro-4-(trifluoromethyl)hex-2-ene |
| 239463-98-0 |
4,5,5,6,6,6-Hexafluoro-4-(trifluoromethyl)hex-2-enoic acid |
| 239463-99-1 |
4,5,5,6,6,6-Hexafluoro-4-(trifluoromethyl)hex-2-en-1-ol |
| 239464-00-7 |
5-Iodo-1,1,1,2,2,3-hexafluoro-3-(trifluoromethyl)hexane |
| 239464-01-8 |
5-Iodo-1,1,1,2,2,3-hexafluoro-3-(trifluoromethyl)nonane |
| 239464-02-9 |
5-Iodo-1,1,1,2,2,3-hexafluoro-3-(trifluoromethyl)pentane |
| 23949-66-8 | N-(2-ethoxyphenyl)-N'-(2-ethylphenyl)-Ethanediamide |
| 2396-26-1 |
4-(Heptafluoroisopropyl)toluene |
| 239795-57-4 |
3,4,4,5,5,5-Hexafluoro-3-(trifluoromethyl)pent-1-ene |
| 239795-58-5 |
Hexafluoro-4-(trifluoromethyl)pent-2-enoic acid |
| 2398-81-4 |
Nicotinic Acid-N-Oxide |
| 2399-48-6 |
Tetrahydrofurfuryl acrylate |
| 23999-64-6 | 6-Methoxy-2-methylbenzoxazole |
| 2401-21-0 |
1,2-DICHLORO-3-IODOBENZENE |
| 2402-77-9 |
2,3-Dichloropyridine |
| 2402-78-0 |
2,6-Dichloropyridine |
| 24047-72-1 | (1R,2R,5R)-(+)-2-Hydroxy-3-Pinanone |
| 24057-28-1 | Pyridinium p-Toluenesulfonate |
| 24065-33-6 | 5-chlorothiophene-2-carboxylic acid |
| 24066-82-8 | Ethoxycarbonylmethyl isothiocyanate |
| 2407-68-3 | 3-(Dimethylamino)acrylnitril |
| 2409-55-4 |
2-tert butyl-4-methyl phenol |
| 24139-57-9 | alpha-Cyano-5-phenyl-2,4-pentadienic acid |
| 24165-10-4 |
Nonafluoro-tert-butyl trifluoroacetate |
| 2417-72-3 |
Methyl p-Bromomethylbenzoate |
| 241819-51-2 |
2-Bromo-3,4,4,4-tetrafluoro-3-(heptafluoropropoxy)but-1-ene |
| 2420-87-3 | 3,3',4,4'-Biphenyltetracarboxylic dianhydride |
| 2421-28-5 | 3,3'4,4'-Benzophenonetetracarboxylicdianhydride |
| 2424-01-3 |
N-methyldiallylamine |
| 24250-85-9 |
4-IODO-L-PHENYLALANINE |
| 2425-54-9 |
1-chlorotetradecane |
| 2425-79-8 | 1,4-Butanediol Diglycidyl Ether |
| 2425-85-6 | Pigment Red 3 |
| 2426-02-0 |
3,4,5,6-Terahydrophthalic Anhydride |
| 2426-08-06 | N-Butyl Glycidyl Ether |
| 2427-71-6 | 6-Chloro-2-hydroxyquinoxaline |
| 24279-39-8 |
2,6-Dichloro-4-(trifluoromethyl)aniline |
| 242812-08-4 |
(Trifluorovinyl)cyclohexane |
| 24308-84-7 | Zinc Benzenesulfinate dihydrate |
| 243128-38-3 |
4-Iodo-2-heptafluoropropoxy-1,1,1,2-tetrafluorobutane |
| 243128-39-4 |
4-Iodo-2-heptafluoropropoxy-1,1,1,2-tetrafluoropentane |
| 243128-40-7 |
4,5,5,5-Tetrafluoro-4-(heptafluoropropoxy)pentanoic acid |
| 243128-41-8 |
4,5,5,5-Tetrafluoro-4-(heptafluoropropoxy)pentan-1-ol |
| 243128-42-9 |
2,3,3,3-Tetrafluoro-2-(heptafluoropropoxy)propyloxirane |
| 243128-48-5 |
1,2,4-Tribromo-3,3,4,4-tetrafluorobutane |
| 243139-56-2 |
4-Iodo-1,1,1,2-tetrafluoro-2-(trifluoromethoxy)pentane |
| 243139-57-3 |
4,5,5,5-Tetrafluoro-4-(trifluoromethoxy)-2-iodopent-2-en-1-ol |
| 243139-58-4 |
4,5,5,5-Tetrafluoro-4-(trifluoromethoxy)pentanoic acid |
| 243139-59-5 |
4,5,5,5-Tetrafluoro-4-(trifluoromethoxy)pentan-1-ol |
| 243139-60-8 |
2,3,3,3-Tetrafluoro-2-(trifluoromethoxy)propyloxirane |
| 243139-62-0 |
4,5,5,5-Tetrafluoro-4-(trifluoromethyl)pentanoic acid |
| 243139-63-1 |
4,5,5,5-Tetrafluoro-4-(trifluoromethyl)pent-2-ene |
| 243139-64-2 |
4,5,5,5-Tetrafluoro-4-(trifluoromethyl)pent-2-enoic acid |
| 243139-65-3 |
4,5,5,5-Tetrafluoro-4-(trifluoromethyl)pent-2-en-1-ol |
| 243139-70-0 |
2H,3H-Perfluoronon-2-enoic acid |
| 24332-20-5 |
1,1,2-trimethoxyethane |
| 243659-12-3 |
5(3)-Methyl-3(5)-(perfluorooctyl)pyrazole |
| 2436-90-0 | Dihydro Myrcene |
| 2438-32-6 | Dexchlorpheniramine maleate |
| 243863-42-5 |
1-(Trifluorovinyl)cyclohexene |
| 24386-93-4 |
5-IODOTUBERCIDIN |
| 24389-25-1 | Phosphorodifluoridic acid, lithium salt ；LiPO2F2 |
| 2440-22-4 | 2-(2-Hydroxy-5-methylphenyl)benzotriazole |
| 244022-66-0 |
4-Chloro-5(3)-methyl-3(5)-(perfluorohexyl)pyrazole |
| 244033-12-3 |
1-Acetyl-3(5)-heptafluoropropyl-5(3)-methyl-4-nitropyrazole |
| 244187-01-7 |
1-Acetyl-3,5-bis(trifluoromethyl)pyrazole |
| 244214-00-4 |
1-Acetyl-5(3)-methyl-3(5)-(trifluoromethyl)pyrazole |
| 24424-99-5 | Di-tert-butyl dicarbonate |
| 24425-40-9 | 5-Aminoindane |
| 2445-60-5 | 1,3-Dimethyl-5-[2-(1-methyl-2pyrrolidinylidene)ethylidene]-2-thiohydantoine |
| 24470-78-8 |
Isopropyltriphenylphosphonium Iodide |
| 24482-88-0 |
Ethyl 3-chlorotetrafluoropropionate |
| 24484-93-3 |
Methyl-4-Chloropicolinate |
| 24485-01-6 |
5,7-Dichloro-3H-Imidazo(4,5b)Pyridine |
| 24487-91-0 | 3-methoxy-2-methylbenzoyl chloride |
| 24490-03-7 |
Ethyl 3-(trifluoromethyl)crotonate |
| 2449-05-0 | Dibenzyl azodicarboxylate |
| 24503-62-6 |
3-Chlorotetrafluoropropionyl chloride |
| 24528-41-4 |
2,3,3,3-Tetrafluoropropanal hydrate |
| 2454-35-5 | 3-Acetoxy Acetophenone |
| 2455-24-5 |
Tetrahydrofurfuryl methacrylate |
| 2457-47-8 |
3,5-Dichloropyridine |
| 2457-76-3 |
4-Amino-2-chlorobenzoic acid |
| 2459-07-6 |
Methyl Picolinate |
| 2459-09-8 |
Methyl Isonicotinate |
| 2460-77-7 | 2,5-Di-tert-butyl-p-benzoquinone |
| 24613-65-8 |
1,9-diiodononane |
| 24623-24-3 | 6-Nitroindan-1-one |
| 24638-29-7 |
2,3-Diamino-5-methylpyridine |
| 2465-27-2 | BASIC YELLOW2 |
| 24650-42-8 | BDK |
| 24690-53-7 |
3,4,4,4-Tetrafluoro-3-(trifluoromethyl)but-1-yne |
| 2469-55-8 |
1,3-Bis(3-aminopropyl)-1,1,3,3-tetramethyldisiloxane |
| 247069-27-8 |
2,6-Diamino-3,5-difluoropyridine |
| 247113-92-4 |
2-(Pentafluoroprop-1-enyl)tetrahydrofuran |
| 247113-93-5 |
4-Chloro-5(3)-methyl-3(5)-perfluoro(1-propoxyethyl)pyrazole |
| 247126-42-7 |
1-Benzoyl-3(5)-nonafluorobutyl-5(3)-(trifluoromethyl)pyrazole |
| 247170-16-7 |
5(3)-Methyl-4-nitro-3(5)-[perfluoro(1-propoxyethyl)]pyrazole |
| 247170-22-5 |
4-Chloro-3(5)-heptafluoropropyl-5(3)-methylpyrazole |
| 24717-85-9 |
Citronellyl Tiglate |
| 24720-09-0 | Alpha-Damascone |
| 247220-81-1 |
5(3)- Methyl-3(5)-(nonafluorobutyl)pyrazole |
| 247220-82-2 |
4-Chloro-5(3)-methyl-3(5)-(nonafluorobutyl)pyrazole |
| 247220-85-5 |
4-Chloro-3(5)-heptafluoropropyl-5(3)-phenylpyrazole |
| 247220-87-7 |
4-Chloro-5(3)-methyl-3(5)-(perfluoropentyl)pyrazole |
| 2474-50-2 | 2,3-Dihydroxy-6,7-dimethylquinoxaline |
| 24772-63-2 |
1,8-diiodooctane |
| 2479-46-1 | 1,3'-Bis(4-aminophenoxyl)benzene |
| 24796-94-9 | Oxazine 1 |
| 24801-88-5 | 3-(Triethoxysilyl)propyl Isocyanate |
| 24812-13-3 |
1-Bromo-3,5-dichloro-2,4,6-trifluorobenzene |
| 248262-31-9 |
2,3,5,6-Tetrfluoro-4-(trifluoromethyl)benzyl chloride |
| 24854-43-1 | 3-Mercapto-4-methyl-1,2,4-triazole |
| 24905-87-1 | 4-(2-Hydroxyethyl)amino-2-nitroaniline |
| 24929-99-5 |
Trimethylsilyl heptafluorobutyrate |
| 24930-02-7 |
Trimethylsilyl pentafluoropropionate |
| 24937-78-8 | Redispersible Polymer Powders |
| 2495-35-4 | Benzyl Acrylate |
| 2499-59-4 |
Octyl acrylate |
| 25013-16-5 | Butylated Hydroxyanisole (BHA) |
| 25015-63-8 | Pinacol borane |
| 25017-08-7 |
4-Chlorovalerophenone |
| 2501-94-2 |
tert-Butylphosphine |
| 2507-61-1 |
Trans-4-fluoro-L-proline |
| 2503-56-2 | 7-Hydroxy-5-methyl-1,3,4-triazaindolizine |
| 25038-32-8 | Styrene isoprene copolymer |
| 2510-99-8 | Benzeneacetic acid |
| 25102-12-9 | EDTA-2K |
| 25118-59-6 | 4-Bromo-3-chlorobenzoic acid |
| 2512-29-0 | Pigment Yellow 1 |
| 25134-21-8 | Methyl-3,6-endomethylene-1,2,3,6-tetrahydrophthalic anhydride |
| 25152-49-2 | Rhodamine 19 |
| 25153-40-6 | PVM/MA Copolymer |
| 25154-52-3 |
Nonylphenol |
| 25154-55-6 |
Nitrophenol |
| 2516-33-8 | Cyclopropanemethanol |
| 2516-34-9 | Cyclobutylamine |
| 2516-96-3 |
2-Chloro-5-nitrobenzoic acid |
| 2516-99-6 |
3,3,3-Trifluoropropionic acid |
| 25194-01-8 |
2,6-Dichloro-4-nitropyridine |
| 25229-97-4 |
2-Cyano-3-morpholinoacrylamide |
| 2523-42-4 |
2- Iodo Fluorene |
| 25235-85-2 | 4-Chloroindole |
| 25245-34-5 | 1-Bromo-2,5-dimethoxybenzene |
| 2525-62-4 | n-Hexyl isocyanate |
| 25252-00-0 | 2-Bromo-5-iodobenzoic acid |
| 25264-81-7 |
Perfluoroheptanamidine |
| 25265-77-4 | 2,2,4-trimethyl-1,3-pentanediol monoisobutyrate |
| 25265-77-4 | Texanol |
| 2526-64-9 |
Triphenylphosphine dichloride |
| 2527-58-4 |
2,2'-Dithiobis(N-methylbenzamide) |
| 25291-12-7 |
2-Iodo-1H,1H,1H,2H,3H,3H-perfluorodecane (tech) |
| 25291-17-2 |
1H,1H,2H-Perfluorooct-1-ene |
| 25293-64-5 | 4,5-epoxytetrahydrophthalic acid diglycidylester |
| 2530-83-8 | 3-Glycidyloxypropyltrimethoxysilane |
| 2530-85-0 | 3-(Trimethoxysilyl)propyl Methacrylate |
| 253199-16-5 | 1-ethoxy-2, 3-difluoro-4-(4- vinylcyclohexyl) benzene |
| 25322-68-3 | Polyoxyethylene glycol |
| 253267-38-8 | N,N,N',N'-Tetrakis[4-bis(3-cyanopropyl)aminophenyl]-p-phenylenediaminum hexafluorophosphate |
| 253267-46-8 | N,N,N',N'-Tetrakis[4-bis(3-cyanopropyl)aminophenyl]-p-phenylenediaminum dihexafluorophosphate |
| 25333-42-0 |
(R) -3-Quinuclidinol |
| 25364-98-1 |
1,1,2-Trifluoro-2-chloroethyl 2,2,2-trifluoroethyl ether |
| 2536-91-6 | 2-Amino-6-methylbenzothiazole |
| 25369-78-2 | 5-Chloro-2-mercaptobenzimidazole |
| 25371-54-4 | 1-Octadecylphosphonsäuredimethylester |
| 2537-48-6 |
Diethyl cyanomethylphosphonate |
| 25376-45-8 |
META DIAMINOTOLUENE |
| 253870-02-9 |
5-formyl-2,4-dimethyl-1H-pyrrole-3-carboxylic acid |
| 253882-74-5 |
4-Allylheptafluorotoluene |
| 2549-51-1 | Vinyl chloroacetate |
| 25497-29-4 |
2-Chloro-1,1-difluoroethane |
| 2549-87-3 |
2-Hydroxy-4-allyloxybenzophenone |
| 2550-26-7 | Benzyl Acetone |
| 25535-16-4 |
Propidium Iodide |
| 25550-51-0 | 3 or 4-methyl-hexahydrophthalic anhydride |
| 25561-30-2 |
N,O-Bis(trimethylsilyl)trifluoroacetimide |
| 255837-19-5 |
2-(Di-tert-butylphosphino)-2′-methylbiphenyl |
| 25597-16-4 |
Ethyl 4,4,4-trifluorocrotonate |
| 25625-62-1 | 2,3-Dimercapto-6-methylquinoxaline |
| 2565-47-1 | Methyl barbituric acid |
| 25655-41-8 |
Povidone Iodine - Powder |
| 25675-41-6 | Bi(cyclohexane)-4,4'-dicarbonyl dichloride |
| 2568-30-1 |
2-chloromethyl-1,3-dioxolane |
| 25711-72-2 | (3-Aminophenyl)-Urea |
| 25713-60-4 | 2,4,6-Tris(2,4,6-tribromophenoxy)-1,3,5-triazine |
| 2571-39-3 |
3,4-Dimethyl Benzophenone |
| 25736-86-1 | Polyethylene glycol monomethacrylate |
| 2580-56-5 | BASIC BLUE 26 |
| 258506-68-2 |
3-Chloro-6-trifluoromethyl-pyridazine |
| 25852-47-5 | Polyethylene Glycol Dimethacrylate |
| 2587-00-0 |
2,6-Dichloropyridine-n-oxide |
| 25895-60-7 |
Sodium Cyano Borohydride |
| 2589-57-3 | Dimethyl 2,2’-Azobis(2-methylpropionate) |
| 2591-86-8 | N-Formyl piperidine |
| 25973-55-1 | 2-(3,5-Di-t-amyl-2-hydroxyphenyl)benzo-triazole |
| 25979-07-1 |
tert-Butyldichlorophosphine |
| 25981-82-2 | 2,3,3,5-Tetramethylindolenine |
| 25981-83-3 | 5-Chloro-2,3,3-trimethylindole |
| 25983-13-5 | 6,7-Dichloro-2,3-dihydroxyquinoxaline |
| 25983-14-6 | 2,3,6,7-Tetrachloroquinoxaline |
| 2601-33-4 | N,N-Dimethyl-N-tetradecylaminoacetic betaine |
| 2602-17-7 | 3,3'-Diethylthiacyanine ethylsulfate |
| 2602-34-8 | Triethoxy(3-glycidyloxypropyl)silane |
| 26040-65-3 |
ethyl 7-chloroheptanoate |
| 26074-52-2 | 2-bromobutyryl bromide |
| 26103-07-1 | Chloromethyl 1,1,1,3,3,3-hexafluoroisopropyl ether (Sevochlorane) |
| 26131-32-8 | Methyl perfluoro(2,5-dimethyl-3,6-dioxanonanoate) |
| 261-33-4 | N,N-Dimethyl-N-tetradecylamino-acetic betaine |
| 26116-12-1 | 2-(aminomethyl)-1-ethylpyrrolidine |
| 261373-04-0 |
2,3-Dibromo-6-methylpyridine |
| 26142-30-3 | Polypropylene Glycol Diglycidyl Ether |
| 261503-26-8 |
2-Chloro-1H,1H-perfluorooct-1-ene |
| 261503-33-7 |
2,2-Dichloro-1,1,1-trifluorooct-3-ene |
| 261503-34-8 |
1,2-Dichloro-1,1,2-trifluoropentane |
| 261503-39-3 |
7H-Perfluoroheptanal hydrate |
| 261503-40-6 |
3H,3H-Perfluorooctane-2,4-dione |
| 261503-42-8 |
Perfluorononanoyl bromide |
| 261503-43-9 |
4,4-Bis(trifluoromethyl)-5,5,6,6,7,7,7-heptafluorohept-2-enoic acid |
| 261503-44-0 |
3,3-Bis(trifluoromethyl)-4,4,5,5,6,6,6-heptafluorohex-1-yne |
| 261503-61-1 |
Methyl 7-chloroperfluoroheptanoate |
| 261503-64-4 |
2-Chloro-3,3,4,4,5,5,5-heptafluoropent-1-ene |
| 261503-65-5 |
Methyl 9-chloroperfluorononanoate |
| 261503-66-6 |
2-Chloro-3,4,4,5,5,5-hexafluoro-3-(trifluoromethyl)pent-1-ene |
| 261503-67-7 |
Methyl 5-chlorooctafluoropentanoate |
| 261503-68-8 |
5-Chlorooctafluoropentanoyl fluoride |
| 261503-69-9 |
2-Chloro-3-heptafluoropropoxy-3,4,4,4-tetrafluorobut-1-ene |
| 261503-70-2 |
2-Chlorotetrafluoropropionyl bromide |
| 261503-71-3 |
2-Chloro-3,4,4,4-tetrafluoro-3-(trifluoromethoxy)but-1-ene |
| 261503-73-5 |
1,1,1,2,2,3,3-Heptafluoro-5-iodohexane |
| 261503-77-9 |
4,5,5,6,6,6-Hexafluoro-4-trifluoromethyl-2-iodohex-2-en-1-ol |
| 261503-78-0 |
1,1,1,2,2,3-Hexafluoro-3-(trifluoromethyl)non-4-ene |
| 261503-79-1 |
3,4,4,5,5,5-Hexafluoro-3-(trifluoromethyl)pent-1-yne |
| 26163-03-1 |
2-Amino-3-bromo-5-chloropyridine |
| 261760-00-3 |
3,4,4,4-Tetrafluoro-3-(heptafluoropropoxy)butyral |
| 261760-01-4 |
3,4,4,4-Tetrafluoro-3-(heptafluoropropoxy)but-1-yne |
| 261760-03-6 |
5-Heptafluoropropoxy-5,6,6,6-tetrafluorohexane-2,4-dione |
| 261760-05-8 |
4-Iodo-2-heptafluoropropoxy-1,1,1,2-tetrafluorooctane |
| 261760-06-9 |
4,5,5,5-Tetrafluoro-4-heptafluoropropoxy-2-iodopent-2-en-1-ol |
| 261760-07-0 |
1,1,1,2-Tetrafluoro-2-(heptafluoropropoxy)oct-3-ene |
| 261760-08-1 |
4,5,5,5-Tetrafluoro-4-(heptafluoropropoxy)pent-2-ene |
| 261760-09-2 |
4,5,5,5-Tetrafluoro-4-(heptafluoropropoxy)pent-2-enoic acid |
| 261760-10-5 |
4,5,5,5-Tetrafluoro-4-(heptafluoropropoxy)pent-2-en-1-ol |
| 261760-11-6 |
Perfluoro(2-methyl-3-oxahexanoyl) bromide |
| 261760-12-7 |
2,2,3,3-Tetrafluoropropanal hydrate |
| 261760-14-9 |
3,4,4,4-Tetrafluoro-3-(trifluoromethoxy)but-1-yne |
| 261760-17-2 |
1,1,1,2-Tetrafluoro-2-(trifluoromethoxy)oct-3-ene |
| 261760-18-3 |
4,5,5,5-Tetrafluoro-4-(trifluoromethoxy)pentan-2-one |
| 261760-19-4 |
4,5,5,5-Tetrafluoro-4-(trifluoromethoxy)pent-2-ene |
| 261760-20-7 |
4,5,5,5-Tetrafluoro-4-(trifluoromethoxy)pent-2-enoic acid |
| 261760-21-8 |
4,5,5,5-Tetrafluoro-4-(trifluoromethoxy)pent-2-en-1-ol |
| 261760-23-0 |
4-Iodo-1,1,1,2-tetrafluoro-2-(trifluoromethyl)hexane |
| 261760-24-1 |
4-Iodo-1,1,1,2-tetrafluoro-2-(trifluoromethyl)pentane |
| 261760-25-2 |
4,5,5,5-Tetrafluoro-4-trifluoromethyl-2-iodopent-2-en-1-ol |
| 261760-26-3 |
1,1,1,2-Tetrafluoro-2-(trifluoromethyl)oct-3-ene |
| 261760-97-8 |
1,2,4-Trichloro-1,1,2-trifluorobutane |
| 261760-98-9 |
2,3,4-Trichloro-3,4,4-trifluorobut-1-ene |
| 261761-00-6 |
1-(Perfluorohexyl)hex-1-ene |
| 261761-01-7 |
2-Iodo-1H,1H,3H-perfluoronon-2-en-1-ol |
| 261761-10-8 |
1-Trifluoroacetyl-3,5-bis(trifluoromethyl)pyrazole |
| 261761-12-0 |
5,5-Bis(trifluoromethyl)-6,6,6-trifluorohexa-1,3-diene |
| 261761-15-3 |
(3,4,4-Trifluorobut-3-enoxy)benzene |
| 261761-18-6 |
3(5)-Heptafluoropropyl-5(3)-(trifluoromethyl)pyrazole |
| 261761-31-3 |
1,1,2-Trifluoropent-1-ene |
| 261761-76-6 |
Perfluorocyclohexanecarbonyl bromide, |
| 261761-77-7 |
Methyl perfluorocyclohexyl ketone |
| 261778-37-4 |
1-Trifluoroacetyl-3(5)-nonafluorobutyl-5(3)-(trifluoromethyl)pyrazole |
| 261778-38-5 |
1-Trifluoroacetyl-3(5)-perfluorohexyl-5(3)-(trifluoromethyl)pyrazole |
| 261778-39-6 |
1-Trifluoroacetyl-3(5)-heptafluoropropyl-5(3)-(trifluoromethyl)pyrazole |
| 261778-40-9 |
1-Trifluoroacetyl-5(3)-methyl-3(5)-(trifluoromethyl)pyrazole |
| 261778-43-2 |
1-Nonafluoropentanoyl-5(3)-methyl-3(5)-(trifluoromethyl)pyrazole |
| 2617-98-3 | 5.6.7.8-Tetrahydroquinaldine |
| 26189-59-3 |
1-Chloro-N,N,2-trimethyl-1-propenylamine |
| 261953-36-0 | 6-Iodo-1H-indazole |
| 2620-76-0 | 2-(4-Bromophenyl)-1-phenylbenzimidazole |
| 2621-79-6 | N-Methyl-N-phenylurethane |
| 26218-04-2 | p-Aminobenzoesure-2-ethylhexylester |
| 2622-14-2 |
Tricyclohexylphosphine |
| 262296-38-8 |
1-Bromo-1,1-difluorohept-2-ene |
| 2623-87-2 |
4-bromobutyric acid |
| 2623-95-2 | 2-bromodecanoic acid |
| 26272-85-5 |
3-IODOOXETANE |
| 26274-35-1 | 2,4-diphenylpyridine |
| 2628-16-2 | 4-Vinylphenyl Acetate |
| 2629-68-7 |
1,4-Bis(chlorodifluoromethyl)benzene |
| 26381-41-9 | Basic Brown 16 |
| 26391-06-0 | N,N—diethyl-2-Cyanoacetamide |
| 2641-34-1 |
Perfluoro(2,5-dimethyl-3,6-dioxanonanoyl) fluoride |
| 2641-89-6 | Tetrabromohydroquinone |
| 26420-79-1 |
1-chloro-3-benzyloxypropane |
| 26444-49-5 |
CRESYL DIPHENYL PHOSPHATE |
| 26475-18-3 |
4,4'-Dimethyloctafluorobiphenyl |
| 2648-47-7 |
5H-Octafluoropentanal |
| 26496-94-6 | ethyl-4-(bromo methyl)benzoate |
| 26537-88-2 | 2,3,3,3-Tetrafluoro-2-(1,1,2,2,3,3,3-heptafluoropropoxy)propan-1-ol |
| 2654-57-1 | 1-Phenyl-3-methyl-5-pyrosolone |
| 26544-17-2 | Dioctyl Azelate |
| 26544-38-7 | Dodecenyl Succinic Anhydride |
| 2657-87-6 | 3,4'-Diaminodiphenyl Ether |
| 265981-13-3 |
2-Bromo-3-Iodopyridine |
| 26628-22-8 | Sodium Azide |
| 26644-86-0 |
Dichloromethyl 2,2,2-trifluoroethyl ether |
| 26654-39-7 | 4,4-Dimethyl-2-oxazolidone |
| 26672-22-0 |
2-[(4-amino-3-methoxyphenyl)sulphonyl]ethyl hydrogen sulphate |
| 26672-24-2 | Vinyl sulphone ester of 2,5-dimethoxy aniline |
| 26675-46-7 |
Difluoromethyl 1-chloro-2,2,2-trifluoroethyl ether (Isoflurane) |
| 26680-54-6 | Octehyl Succinic Anhydride |
| 26717-76-0 |
Ethyl 2,2-dimethyltrifluoroacetoacetate |
| 26741-53-7 | 3,9-Bis(2,4-di-tert-butylphenoxy)-2,4,8,10-tetraoxa-3,9-diphosphaspiro[5.5] undecane |
| 26761-45-5 | Neodecanoic Acid Glycidyl Ether |
| 26780-96-1 | Polymerized-2,2,4-trimethyl-1, 2dihydroquinolie(RESIN) |
| 2680-3-7 | N,N-Dimethylacrylamide |
| 26807-65-8 | Indapamide |
| 2681-00-7 |
1,8-Diiodo-3,3,4,4,5,5,6,6-octafluorooctane |
| 2682-45-3 | 2-Methylnaphtho[1,2-d]thiazole |
| 2682-49-7 | 1,3-Thiazolan-2-one |
| 2687-12-9 | Cinnamyl chloride |
| 2687-25-4 |
2,3-DIAMINOTOLUENE |
| 2687-91-4 |
1-Ethyl-2-pyrrolidone |
| 2687-94-7 |
N-octylpyrrolidin-2-one |
| 2687-96-9 |
N-dodecyl-2-pyrrolidone |
| 2688-84-8 |
2-PHENOXYANILINE |
| 26915-72-0 | Methoxy poly(ethylene glycol) monomethacrylate |
| 26954-17-6 |
2,4,4,5,5-Pentafluoro-2-trifluoromethyl-3-oxathiolane-1,1-dioxide |
| 26960-04-3 | 5-Chloro-1,2-dimethylbenzimidazole |
| 26966-75-6 |
ORTHO DIAMINOTOLUENE |
| 26983-52-8 |
Biphenol |
| 27048-04-0 | 2-Amino-6-chloro-3-nitropyridine |
| 2706-89-0 | Sodium nonafluoropentanoate |
| 2706-90-3 | Nonafluoropentanoic acid |
| 2708-97-6 | 1,2-Diiodotetrafluorobenzene |
| 27116-80-9 | 5(3)-Methyl-4-nitro-3(5)-(trifluoromethyl)pyrazole |
| 2711-81-1 | 3,3,4,5,5,5-Hexafluoropentan-2-ol |
| 2712-78-9 | Bis(trifluoroacetoxy)iodobenzene |
| 27137-33-3 | 3a,4,5,6,7,7a-Hexahydro-4,7-Methano-1H-Indenol |
| 271-63-6 | 7-Azaindole |
| 27105-98-2 | 4-Ethyl-4H-1,2,4-triazole-3-thiol |
| 2719-27-9 | Cyclohexanecarboxylic acid chloride |
| 27231-36-3 | 2-Mercapto-5-methylbenzimidazole |
| 27247-96-7 | 2-Ethylhexyl nitrate |
| 2725-22-6 | 2-[4,6-Di(2,4-dimethylphenyl)-1,3,5-triazine-2-yl]-5-(octyloxy)phenol |
| 2730-58-7 |
Ammonium pentafluoropropionate |
| 2730-62-3 |
2-Chloro-3,3,3-trifluoroprop-1-ene |
| 2730-62-3 |
2-Chloro-3,3,3-trifluoropropene |
| 27336-23-8 |
1,1-Dibromotetrafluoroethane |
| 27347-14-4 |
N-(4-methoxyphenyl)morpholine |
| 274-07-7 | Catecholborane |
| 27417-40-9 | N,N'-Ditolyl-p-phenylenediamine |
| 27425-55-4 | Coumarin 7 |
| 27465-51-6 |
4’-ethyl propionphenone |
| 27489-62-9 | trans-4-aminocyclohexanol |
| 27511-79-1 |
3-Amino-4-pyrazolecarboxamide hemisulfat |
| 2751-90-8 | Tetraphenylphosphonium bromide |
| 2754-41-8 | 1,2,4,5-cyclohexanetetracarboxylicdianhydride |
| 2759-28-6 | 1-Benzyl piperazine |
| 27607-77-8 |
Trimethylsilyl trifluoromethanesulfonate |
| 27639-98-1 |
Perfluoro(2,5,8-trimethyl-3,6,9-trioxadodecanoyl) fluoride |
| 27676-62-6 | 1,3,5-Tris(3,5-di-tert-butyl-4-hydroxybenzyl)-1,3,5-triazinane-2,4,6-trione |
| 2768-02-7 | Vinyltrimethoxysilane |
| 2769-72-4 | tert-Butyl isocyanoacetate |
| 2770-11-8 | 2-(4-chlorophenoxy)aniline |
| 27738-91-6 | 4,4´-Bis(chlorosulphonylphenyl)disulfide |
| 27744-59-8 |
Perfluoro(4-methyl-3,6-dioxaoctane)sulfonyl fluoride |
| 27746-90-3 | 3,3'-Bis(2-sulfatoethyl)-5,5'-diphenyl-9ethyloxacarbocyanine betaine |
| 277756-46-4 |
1-(Trifluoromethyl)cyclopropane-1-carboxylicacid |
| 27784-76-5 |
tert-Butyl diethylphosphonoacetate |
| 27821-45-0 | Uridine 5'-diphosphate disodium salt |
| 27854-30-4 |
2H,2H,3H,3H-Perfluorononanoic acid |
| 27858-32-8 | Di-iso-propoxy titanium bis ethyl acetoacetate |
| 2786-76-7 | Pigment Red 170 |
| 2787-79-3 |
2,3,5,6-Tetrafluoro-4-(trifluoromethyl)phenol |
| 27896-84-0 | 5-Nitrobenzimidazole Nitrate |
| 27905-45-9 |
1H,1H,2H,2H-Perfluorodecyl acrylate |
| 279246-65-0 | 1-[ (E)-prop-1-enyi]-4- (4- propylcyclohexyl) cyclohexane |
| 2794-15-2 |
3-(Methoxy)tetrafluoropropionyl fluoride |
| 2795-50-8 |
Ethyl 5H-octafluoropentanoate |
| 27969-56-8 | 1,1'-Bis(4-sulfophenyl)-5,5'-dihydroxy-3,3'-dimethylpyrazolo-4,4'-pentamethineoxonole |
| 27973-29-1 | 1,6-Dibromopyrene |
| 2797-79-7 |
4-Bromotetrafluorophenylhydrazine |
| 27992-32-1 |
6-Bromo-2-Hydroxypyridine |
| 28012-10-4 |
4-Dimethylaminoheptafluorotoluene |
| 281-23-2 |
Adamantane |
| 280-64-8 | 9-Borabicyclo[3.3.1]nonane |
| 28059-64-5 | 2-benzylaniline |
| 28073-51-0 | 4-(Acetamidomethyl)Benzenesulfonyl Chloride |
| 28082-82-8 | 6,7-Dimethyl-2-hydroxyquinoxaline |
| 28118-05-0 | 5-Chloro-9-ethyl-5'-phenyl-3-(4-sulfobutyl)-3'(3-sulfopropyl)oxacarbocyanine betaine sodium salt |
| 2814-77-9 | Pigment Red 4 |
| 28140-60-5 | Malondianil hydrochloride |
| 28165-50-6 | 2-Amino-6-bromophenol |
| 28172-08-9 | 5,5'-Bis(3-cyano-1-ethyl-4-methyl-6-oxo-2-pyridone)trimethine oxonole |
| 2818-69-1 | 2-Methyl-5-chlorobenzimidazole |
| 2818-70-4 | 5-Iodo-2-methylbenzimidazole |
| 2818-88-4 | 2-Methylbenzoselenazole |
| 28202-30-4 |
2-(1,1,2,2-Tetrafluoroethoxy)-5-nitrotoluene |
| 28202-31-5 | 2-(1,1,2,2-Tetrafluoroethoxy)nitrobenzene |
| 28202-32-6 | 4-(1,1,2,2-Tetrafluoroethoxy)nitrobenzene |
| 28219-60-5 | 2-Methyl-4-(2-2,3-trimethyl-3-cyclopenten-1-yl)-2-buten-1-ol |
| 28219-61-6 | Sandacanol |
| 2823-49-6 |
11-Chloroperfluoroundecanoic acid |
| 28240-70-2 |
1,3-Bis(dichlorophosphino)propane |
| 2825-82-3 |
Exo-Tetrahydrodicyclopentadiene |
| 2825-83-4 |
Endo-Tetrahydrodicyclopentadiene |
| 28314-80-9 |
2,4,6-Trifluorobenzoic acid |
| 2834-23-3 |
Chlorodifluoroacetic anhydride |
| 2835-68-9 | PABA (DB-70) P-AMINO BENZAMIDE |
| 283593-02-2 |
6-(1,2-Dibromotrifluoroethoxy)perfluorohexanenitrile |
| 2837-90-3 |
Sodium dichlorofluoroacetate |
| 2840-28-0 |
3-Amino-4-chlorobenzoic acid |
| 2843-27-8 | 2-Hydroxyformanilide |
| 28443-50-7 | 2-Amino-5-chlorophenol |
| 28489-43-2 |
2-Diethylamino-5-nitro-6-methylpyridine |
| 28489-45-4 | 2-Hydroxy-5-nitro-6-methylpyridine |
| 28509-44-6 | Methyl 2-chlorotetrafluoropropionate |
| 28523-86-6 | Fluoromethyl 1,1,1,3,3,3-hexafluoroisopropyl ether (Sevoflurane) |
| 2856-63-5 | 2-Chloro Benzyl Cyanide |
| 285978-18-9 | Uridine-5'-triphosphoric acid disodium salt |
| 28598-82-5 | 1-bromo-8-chlorooctane |
| 28598-83-6 |
1-chloro-10-bromodecane |
| 28627-00-1 |
2-Chlorotetrafluoropropionyl fluoride |
| 2863-98-1 | 4-Cyanophenylhydrazine hydrochloride |
| 2868-37-3 | Methyl Cyclopropanecarboxylate |
| 28705-46-6 | Ethyl 7-diethylaminocoumarin-3-carboxylate |
| 2871-01-4 | 4-(2-Hydroxyethyl)amino-3-nitroaniline |
| 28718-90-3 | 4’,6-Diamidino-2-phenylindole dihydrochloride |
| 2873-97-4 | Diacetone Acrylamide |
| 2875-18-5 |
2,3,5,6-Tetrafluoropyridine |
| 28777-98-2 | Octadecenyl Succinic Anhydride |
| 28781-85-3 |
2,2-Difluoropropionicacidethylester |
| 28783-41-7 | 4,5,6,7-tetrahydrothieno[3,2-c]pyridine hydrochloride |
| 28784-39-6 | 4,5-Benzo-3',9-diethyl-5'-methyl-3-(3sulfopropyl)thiacarbocyanine betaine |
| 28788-68-3 |
(Perfluorocyclohexyl)methanol |
| 28804-46-8 |
Dichloro-(2,2)-paracyclophane |
| 288315-03-7 |
3,3-Difluoroazetidinehydrochloride |
| 28868-76-0 | Dimethyl Chloromalonate |
| 28871-95-6 | endo-2,3-Norbornanedicarboximide |
| 2893-33-6 |
2,6-Dicyanopyridine |
| 28940-11-6 |
Methyl-1,5-benzodioxepan-3-one |
| 289-95-2 | Pyrimidine |
| 28920-43-6 | 9-Fluorenymethyl chloroformate |
| 2894-87-3 |
4-Hydroxynonafluorobiphenyl |
| 2897-60-1 | Diethoxy(3-glycidyloxypropyl)methylsilane |
| 28984-20-5 | Bis(dithiobenzil)nickel |
| 2905-25-1 | 2-Bromobenzenesulphonyl chloride |
| 2905-60-4 |
2,3-Dichlorobenzoyl Chloride |
| 2905-61-5 |
2,5-Dichlorobenzoyl Chloride |
| 29091-09-6 |
2,4-Dichloro-3,5-Dinitrobenzotrifluoride |
| 29097-12-9 | 3-Carbamoyl-4-methyl-6-hydroxy-N-ethyl-2-pyridone |
| 2917-78-4 |
dimethyl isopropylmalonate |
| 2920-38-9 | 4-(phenyl)benzonitrile |
| 29215-49-4 |
1-chloro-9-iodononane |
| 2923-16-2 |
Potassium trifluoroacetate |
| 2923-18-4 |
Sodium trifluoroacetate |
| 2923-26-4 |
Sodium perfluorohexanoate |
| 2924-15-4 | 2-Fluorophenylhydrazine hydrochloride |
| 2925-16-8 |
1,1-Difluoro-2-iodoethylene |
| 2925-22-6 |
Difluoroacetyl fluoride |
| 2925-59-9 |
9-Chloroperfluorononanoyl chloride |
| 2926-29-6 |
Sodium trifluoromethanesulfinate |
| 2926-99-0 |
2-Chloroethyl 1,1,2,3,3,3-hexafluoropropyl ether |
| 29385-43-1 | Methyl-1H-benzotriazole |
| 294-90-6 | 10-Tetraazacyclododecane |
| 2941-69-7 | 5-Methoxy-2-methylbenzothiazole |
| 2941-71-1 | 2,6-Dimethylbenzothiazole |
| 2941-78-8 |
5-Methylanthranilic acid |
| 2942-58-7 |
Diethyl cyanophosphonate |
| 2943-75-1 | Triethoxy-n-octylsilane |
| 2946-17-0 | 5-Methoxy-2-methylbenzoselenazole |
| 2946-20-5 | 2,5,6-Trimethylbenzoselenazole |
| 2949-22-6 | Ethyl isocyanatoacetate |
| 29514-94-1 |
Perfluoro(3-oxapent-4-ene)sulfonyl fluoride |
| 295-37-4 | 1,4,8,11-Tetraazacyclotetradecane |
| 29551-55-1 |
4-Methoxy-2,3,5,6-tetrafluorostyrene |
| 2955-88-6 |
N-(2-hydroxyethyl)pyrrolidine |
| 2958-87-4 | 2,3,6-Trichloroquinoxaline |
| 29617-66-1 | S-(-)-2-Chloropropionic acid |
| 29632-74-4 |
2-Fluoro-4-Iodoaniline |
| 29658-97-7 |
Dodecenylsuccinic acid |
| 2966-54-3 |
Potassium heptafluorobutyrate |
| 2967-60-4 |
1,1,1,2,2,3,3-Heptafluoro-7-iodoheptane |
| 29681-44-5 |
Methyl-5-Bromo Nicotinate |
| 2968-32-3 |
(RS)-2-Amino-1,1,1-trifluoropropanehydrochloride |
| 2968-33-4 |
3,3,3-Trifluoropropylamine hydrochloride |
| 2969-81-5 | Ethyl 4-bromobutyrate |
| 29712-28-5 |
(aminomethylene)bisphosphonic acid |
| 29761-21-5 |
DIPHENYL ISODECYL PHOSPHATE |
| 298-12-4 | Glyoxylic acid |
| 29819-73-6 |
4,5,5,5-Tetrafluoro-4-(trifluoromethyl)pentan-1-ol |
| 298-46-4 | Carbamazepine |
| 29823-18-5 | Ethyl 7-bromoheptanoate |
| 29823-21-0 | Ethyl-8-bromooctanoate |
| 29848-57-5 |
1-(difluoromethyl)-4-nitrobenzene |
| 2987-17-9 |
Cyclobutanecarboxaldehyde |
| 29898-25-7 | 1-Phenylhexan-3-one |
| 29927-08-0 | 2-Amino-5,6-dimethylbenzo-thiazole |
| 2993-85-3 |
1H,1H,7H-Perfluoroheptyl acrylate |
| 29949-64-2 |
Bis(o-tolyl)phosphine |
| 29949-72-2 |
Di-tert-butyl(n-butyl)phosphine |
| 2996-92-1 | Trimethoxyphenylsilane |
| CAS NO | Product Name |
| 300-87-8 | 3,5-Dimethylisoxazole |
| 30038-65-4 | 1,8(2H)-dione-4,5,6,7,9-hexahydro-9-(4-hydroxy-3-methoxy-phenyl)-3,3,6,6-tetramethyl-1H-xanthene |
| 3006-93-7 | 1,1'-(1,3-Phenylene)bis(1H-pyrrole-2,5-dione) |
| 300831-03-2 | 4-Carboxy-2-isopropylaminothiazole hydrobromide |
| 3010-96-6 | 2,2,4,4-Tetramethyl-1,3-cyclobutanediol, mix of isomers |
| 30184-96-4 | 4,4'-Bis(4-aminophenoxy)benzophenone |
| 3020-28-8 |
(IODOMETHYL) TRIPHENYLPHOSPHONIUM IODIDE |
| 3024-72-4 |
3,4-Dichlorobenzoyl Chloride |
| 3027-21-2 | Dimethoxymethylphenylsilane |
| 302964-24-5 |
2-amino-N-(2-chloro-6-methylphenyl)thiazole-5-carboxamide |
| 303-04-8 |
2,3-Dichlorohexafluorobut-2-ene |
| 303-07-1 | 2,6-Dihydroxybenzoic acid |
| 3030-80-6 | 2-Mercaptobenzimidazole zinc salt |
| 30320-28-6 |
1,1,1,2,2,3,3,5,5,5-Decafluoro-4-(trifluoromethyl)pentane |
| 3034-19-3 | 2-Nitrophenylhydrazine |
| 30377-52-7 |
Ethyl perfluorononanoate |
| 3039-83-6 |
Ethenesulfonic acid sodium salt |
| 3040-44-6 |
N-(2-hydroxyethyl)piperidine |
| 30428-47-8 |
2-Chloro-1,4-dibromo-1,1,2-trifluorooctane |
| 30428-56-9 |
1-Bromo-2-chloro-1,1,2-trifluorooct-3-ene |
| 30433-91-1 | thiophene-2-ethyl amine |
| 30450-62-5 | 7-Nitro-1,2,3,4-tetrahydroquinoline |
| 305-53-3 |
Iodoacetic Acid, Sodium Salt |
| 305-84-0 | L-Carnosine |
| 3054-95-3 | Acrolein diethyl acetal |
| 30563-77-0 | 1-Ethyl-2-methyl-5-trifluoromethylbenzimidazole |
| 30566-92-8 | 5-(N,N-Dibenzylglycyl)salicylamide |
| 3058-39-7 |
4-IODOBENZONITRILE |
| 3063-94-3 | 1,1,1,3,3,3 - Hexafluoroisopropyl methacrylate monomer |
| 3066-71-5 |
cyclohexyl acrylate |
| 30670-30-5 |
1H,1H,2H,2H-Perfluorodecylamine |
| 30674-80-7 | 2-Isocyanatoethyl methacrylate |
| 306-83-2 |
2,2-Dichloro-1,1,1-trifluoroethane (HCFC-123) |
| 3069-19-0 | Hexyltrimethoxysilane |
| 3069-21-4 | Dodecyltrimethoxysilane |
| 3069-29-2 | 3-(2-Aminoethylamino)propyldimethoxymethylsilane |
| 30693-53-9 | 4-Nitroaniline-2-sulfonic acid,ammonium salt |
| 306-94-5 |
cis/trans-Perfluorodecalin |
| 30707-77-8 | 1-(4-Aminophenyl)-3-pyrrolidino-2-pyrazolin-5-one |
| 307-22-2 |
1-Chloro-6H-perfluorohexane |
| 307-24-4 |
Perfluorohexanoic acid |
| 307-29-9 |
1H,1H-Perfluorooctylamine (tech.) |
| 307-30-2 |
1H,1H-Perfluorooctan-1-ol |
| 307-31-3 |
Perfluorooctanamidine |
| 307-34-6 |
Perfluorooctane |
| 307-35-7 |
Perfluorooctanesulfonyl fluoride |
| 307-59-5 |
Perfluorododecane |
| 307-62-0 |
Perfluorotetradecane |
| 30766-11-1 |
5-Bromopyridine-2-Carboxylic Acid |
| 307-70-0 |
1H,1H,11H-Perfluoroundecan-1-ol |
| 307-87-9 |
1H,1H-Perfluorononyl acrylate |
| 307-96-0 |
n-Butyl perfluorooctanoate |
| 307-99-3 |
1H,8H-Perfluorooctane |
| 308-13-4 |
Perfluorohexanoic anhydride |
| 308-28-1 |
Nonafluoropentanoic anhydride |
| 3087-36-3 | Tetra ethyl titanate |
| 3087-39-6 | Tetra-t-butyl titanate |
| 3095-95-2 |
Diethylphosphonoacetic acid |
| 30984-28-2 |
5-Methyl-1,1,1-trifluorohexane-2,4-dione |
| 309-88-6 |
N,N-Diethyl-1,1,2,3,3,3-hexafluoropropylamine |
| 31001-56-6 |
6-Chloroperfluorohex-1-ene |
| 31001-77-1 |
3-Mercaptopropylmethyldimethoxy silane |
| 3102-70-3 | 2,4,6-Trimethyl-1,3-benzenediamine |
| 3102-87-2 | 2,3,5,6-Tetramethyl-1,4-phenylenediamine |
| 310-71-4 |
Ethyl 2-chloro-1,1,2-trifluoroethyl ether |
| 3107-98-0 |
Dimethyl octafluoroadipate |
| 3108-07-4 |
Allyl 1H,1H,5H-octafluoropentyl ether |
| 3108-24-5 |
Ethyl perfluorooctanoate |
| 3109-94-2 |
Potassium perfluorohexanoate |
| 3110-03-0 |
5-Chlorooctafluoropentanoyl chloride |
| 311-28-4 |
Tetra Butyl Ammonium Iodide |
| 3115-68-2 | Tetrabutylphosphonium bromide |
| 311-81-9 |
1,2-Dichlorodifluoroethylene (E/Z isomer mixture) |
| 311-86-4 |
2-Bromo-3,3,3-trifluoropropan-1-ol |
| 311-89-7 |
Perfluorotributylamine |
| 3121-61-7 | 2-Methoxyethyl Acrylate |
| 31224-45-0 |
Trifluoroacetaldehyde diethyl acetal |
| 31253-34-6 |
2-Aminohexafluoroisopropanol (30% in dioxane or diglyme) |
| 312-94-7 |
2-(trifluoromethyl)benzene-1-carbonyl chloride |
| 313-72-4 |
Octafluoronaphthalene |
| 3130-19-6 | Bis((3,4-epoxycyclohexyl)methyl)adipate |
| 31377-23-8 |
Amantadine Sulphate |
| 314-41-0 |
2,3,4,6-Tetrafluoronitrobenzene |
| 3147-75-9 | 2(2'-Hydroxy-5'-t-octylphenyl) benzotriazole |
| 3150-40-1 |
4-Methyl-2,3,5,6-tetrafluoroanisole |
| 315-14-0 |
2,4,6-Trifluoronitrobenzene |
| 315-44-6 | 2',4'-Dihydroxy-2,2,2-trifluoro-acetophenone |
| 3153-37-5 | Methyl 4-chlorobutyrate |
| 31570-04-4 | Tris(2,4-di-tert-butylphenyl) Phosphite |
| 3158-91-6 | 2-Chlorodibenz[b,f][1,4]oxazepin-11(10H)-one |
| 3159-07-7 | 10,11-Dihydro-11-Oxodibenzo[b.f][1,4]thiazepine |
| 31599-61-8 |
4-IODO-o-XYLENE Or 1-IODO-3,4-DIMETHYLBENZENE |
| 31651-76-0 |
1-Naphthylphosphorodichloridate |
| 316808-11-4 |
Dimethyl 3-Bromopyridine-2,6-dicarboxylate |
| 3171-45-7 | 4,5-Dimethyl-1,2-phenylenediamine |
| 3172-52-9 | 2,6-dichlorothiophene |
| 3173-53-3 | Cyclohexyl isocyanate |
| 3173-56-6 | Benzyl isocyanate |
| 3173-72-6 |
1,5-Naphthalene Diisocyanate |
| 3176-77-0 | 2-Methyl-3-(3-sulfopropyl)naphtho[1,2-d]thiazolium betaine |
| 3177-22-8 | Sodium 2,4-Diaminobenzenesulfonate |
| 3179-31-5 | 3-Mercapto-1,2,4-triazole |
| 3179-47-3 |
n-Decyl methacrylate |
| 3179-76-8 | 3-Aminopropyldiethoxymethylsilane |
| 31872-62-5 |
3-Nitro-4-methoxypyridine |
| 31881-89-7 |
3,5-Dichloro-2,4,6-trifluorobenzonitrile |
| 3189-22-8 | 7-Methoxyindole |
| 31906-04-4 |
4-(4-Hydroxy-4-methylpentyl)-3-cyclohexene-1-carboxaldehyde |
| 31910-18-6 | 2,3-Dihydroxy-6-methoxyquinoxaline |
| 3194-55-6 | Hexabromo cyclododecane |
| 3196-15-4 | Methyl-2-bromobutyrate |
| 319-88-0 |
1,3,5-Trichlorotrifluorobenzene |
| 32042-38-9 |
2,2,2-Trifluoroethyl formate |
| 320-60-5 |
2,4-Dichlorobenzotrifluoride |
| 32072-96-1 | Hexadecenyl Succinic Anhydride |
| 3209-22-1 | 2,3-Dichloronitrobenzene |
| 3210-08-0 |
4-iodo-1-butanol |
| 321-28-8 |
2-fluoroanisole |
| 321-38-0 | 1-Fluoronaphthalene |
| 3217-47-8 |
2,3,5,6-Tetrafluoroterephthalaldehyde |
| 32180-75-9 | N-[4-(2,4-Di-tert.pentylphenoxy)butyl]-1-hydroxy-2-naphthamide |
| 321921-71-5 |
S Bis(1-Adamantyl)-n-Butylphosphine |
| 3219-63-4 |
Trimethylsilylmethanol |
| 32202-61-2 | 4-Aminoindane |
| 32210-23-4 | 4-tert-Butylcyclohexyl Acetate |
| 3225-26-1 | 4-Hydroxy TEMPO Benzoate |
| 32304-29-3 |
2,3,5,6-Tetrafluoro-4-(trifluoromethyl)phenylacetic acid |
| 32305-98-9 |
(-)-DIOP |
| 32308-83-1 |
Perfluoro-tert-butylsulfenyl chloride |
| 32315-10-9 | Triphosgene |
| 3234-02-4 | Trans-2,3-Dibromo-2-butene-1,4-diol |
| 32360-05-7 |
Octadecyl methacrylate |
| 3237-62-5 | 5,6-Dichloro-1-ethyl-2-methylbenzimidazole |
| 32387-21-6 | 1-Methyl-3-indolecarboxylic acid |
| 32387-83-0 | 2,3-Dimethyl-6-Methoxy-5-Quinozolinamine |
| 32388-00-4 | 6,7-Dimethoxy-2,3-dimethylquinoxaline |
| 3240-34-4 |
Iodobenzene Diacetate |
| 32438-31-6 | Phenoxyacetaldehyde diethylacetal |
| 32449-41-5 | 6-Brom-5-methyl-1,2,4-triazolo [1,5-a]pyrimidin-7-ol |
| 32477-35-3 |
N-(Heptafluorobutyryl)imidazole |
| 3248-91-7 | Basic Violet 2 |
| 325715-13-7 | N-(3-Acetylphenyl)-N-methylacetamide |
| 32588-76-4 | N,N-Ethylene-bis( tetrabromophthalimide) |
| 3259-03-8 |
2-(2-Ethoxyphenoxy)ethyl Bromide |
| 326-06-7 |
1-Phenyl-4,4,4-trifluorobutane-1,3-dione |
| 32634-35-8 | 5-Cyano-1-ethyl-2-methyl-3-(4-sulfobutyl)benzimidazolium betaine |
| 32634-36-9 | 5,5'-Dicyano-3-(4-sulfobutyl)-1,1',3'triethylimidacarbocyanine betaine |
| 3264-21-9 | 1-Acetylpyrene |
| 326-62-5 |
2-Fluorobenzyl cyanide |
| 32673-25-9 |
Di-tert-butylphenylphosphine |
| 326801-92-7 | 4,5:4',5'-Dibenzo-1,1'-diisopentyl-3,3,3',3'-tetramethylindadicarbocyanine hexafluorophosphate |
| 32687-78-8 | 1,2-Bis[3-(3,5-di-tert-butyl-4-hydroxyphenyl)propionyl]hydrazine |
| 3273-68-5 | Buzolic acid |
| 3274-12-2 |
4-Methyl-4-trichloromethyl-2,5-cyclohexadien-1-one |
| 327-54-8 |
1,2,4,5-Tetrafluorobenzene |
| 32768-54-0 |
2,3-Dichlorotoluene |
| 3277-26-7 | 1,1,3,3-Tetramethyldisiloxane |
| 32779-38-7 |
2-CHLORO-5-IODOPYRIMIDINE |
| 3279-76-3 |
2-Hydroxy-6-methylpyridine |
| 3279-90-1 | 6-Bromo-3,4-dihydro-1H-quinolin-2-one |
| 32804-77-6 | 2-Ethoxyethyl Cyanoacetate |
| 3282-30-2 | Pivaloyl chloride |
| 3283-07-6 | N,N,N´,N´-Tetrakis(4-aminophenyl)-1,4-phenylenediamine |
| 328-74-5 |
3,5-Di(trifluoromethyl)aniline |
| 328-84-7 |
3,4-Dichlorobenzotrifluoride |
| 32890-92-9 |
2,3,4,6-Tetrafluorobenzoic acid |
| 328933-65-9 | 4-(2-Hexamethyleneimine-1-yl-ethoxy)-Benzylalcohol hydrochloride |
| 3290-92-4 | Trimethylolpropane trimethacrylate |
| 329187-59-9 |
4-[(4,6-DICHLOROPYRIMIDIN-2-YL) AMINO] BENZONITRILE |
| 329322-83-0 | 3-Aminomethyl-4-Z-methoximino-pyrrolidine, dimethanesulfonate |
| 32955-21-8 | Ethyl 2-Aminothiazole-5-Carboxylate |
| 32974-30-4 |
(2,3,4,5,6-Pentafluorobenzyl)oxirane |
| 32974-36-0 |
2,3,4,5,6-Pentafluorobenzyl p-toluenesulfonate |
| 33027-66-6 | (Ethoxy)pentafluorocyclophosphazene |
| 33036-62-3 |
4-bromo-1-butanol |
| 3308-94-9 |
2-(3-chloropropyl)-2-(4-fluorophenyl)-1,3-dioxlane |
| 33100-27-5 |
15-crown-5 |
| 33104-02-8 |
Allyloxypentafluorobenzene |
| 331861-93-9 | Octyl-PTCDI |
| 3319-01-5 |
N-cyclohexylpiperidine |
| 3320-86-3 | 2-Nitrophenylisocyanate |
| 3321-96-8 |
2-Amino-3-(pentafluorophenyl)propionic acid |
| 33252-28-7 |
2-Chloro-5-cyanopyridine |
| 33252-30-1 |
2-Chloro-4-cyanopyridine |
| 3330-14-1 |
2H-Perfluoro(5-methyl-3,6-dioxanonane) |
| 3330-15-2 |
Heptafluoropropyl 1,2,2,2-tetrafluoroethyl ether |
| 3330-16-3 | 2H-Perfluoro-5,8-dimethyl-3,6,9-trioxadodecane；Freon E3 |
| 3332-29-4 | Ethoxyamine hydrochloride |
| 3336-58-1 |
Ammonium trifluoroacetate |
| 33420-52-9 |
2,2-Difluoropropanol |
| 334-29-2 |
5-fluoro-1-pentanol acetate |
| 334-42-9 |
1-fluoro-7-bromoheptane |
| 334-43-0 |
1-fluoro-7-chloroheptane |
| 3344-70-5 | 1,12-dibromododecane |
| 334-56-5 |
1-Fluorodecane |
| 334-61-2 |
1-fluoro-10-bromodecane |
| 334-62-3 |
1-fluoro-10-chlorodecane |
| 334-68-9 |
1-Fluorododecane |
| 33494-80-3 |
Di-tert-butylphosphate, potassium salt |
| 335-08-0 |
2-Hydroxy-2-(trifluoromethyl)propionitrile |
| 335086-35-6 | 3-Carboxymethyl-1,3-dimethyl-thioureido acetic acid, di-sodium salt |
| 335-10-4 |
Heptafluoroisobutyric acid |
| 33513-44-9 |
Disodium 2,4-disulfobenzaldehyde |
| 335-23-9 |
Perfluoro(1,3-diethylcyclohexane) |
| 335-27-3 |
Perfluoro(1,3-dimethylcyclohexane), tech. |
| 335-42-2 |
Heptafluorobutyryl fluoride |
| 335-53-5 |
Perfluorohexanoyl chloride |
| 335-54-6 |
Perfluorohexanamide |
| 335-56-8 |
1-Bromoperfluorohexane |
| 335-57-9 |
Perfluoroheptane |
| 335-58-0 |
1-Iodoperfluoroheptane |
| 335-64-8 |
Perfluorooctanoyl chloride |
| 335-65-9 |
1H-Perfluorooctane |
| 335-66-0 |
Perfluorooctanoyl fluoride |
| 335-67-1 |
Perfluorooctanoic acid |
| 335-70-6 |
1,8-Diiodoperfluorooctane |
| 335-95-5 |
Sodium perfluorooctanoate |
| 335-99-9 |
1H,1H,7H-Perfluoroheptan-1-ol |
| 336-01-6 |
8H-Perfluorooct-1-ene |
| 336-06-1 |
Octafluoroadipoyl dichloride |
| 336-07-2 |
1H,6H-Perfluorohexane |
| 336-08-3 |
Octafluoroadipic acid |
| 336-13-0 |
1-Bromoperfluorocyclohexane |
| 336-15-2 |
Chloroperfluorocyclohexane |
| 336-23-2 |
Potassium nonafluoropentanoate |
| 33626-98-1 | Methyl 6-Bromo-2-naphthoate |
| 33628-03-4 | 3,3'-Bis(3-sulfopropyl)-5,5'-diphenyl-9ethyloxacarbocyanine betaine sodium salt |
| 33630-94-3 |
2-Hydroxy-5-aminopyridine |
| 3363-56-2 | 2,5,6-Trimethylbenzimidazole |
| 336-59-4 |
Heptafluorobutyric anhydride |
| 336-62-9 |
Ethyl heptafluorobutyrylacetate |
| 3366-65-2 |
phenanthren-2-amine |
| 33682-78-9 | 1-Ethyl-6-methyl-2(1H)-quinolinethione |
| 337-20-2 |
Octafluorobutan-2-one |
| 337-28-0 |
Pentafluoropropionaldehyde ethyl hemiacetal |
| 33775-94-9 |
2-IODOTHIOANISOLE |
| 337-82-6 |
Ethyl 2,2,3,3-tetrafluoropropionate |
| 338-03-4 |
3-Hydroxy-3-methyl-4,4,4-trifluorobutyric acid |
| 3382-63-6 |
4-(((4-Fluorophenyl)imino)methyl)phenol |
| 3386-33-2 |
1-chlorooctadecane |
| 338-65-8 |
2-Chloro-1,1-difluoroethane |
| 338-75-0 |
1,2-Dichloro-3,3,3-trifluoropropane |
| 3388-04-3 | 2-(3,4-Epoxycyclohexyl)ethyltrimethoxysilane |
| 3391-83-1 | Musk R1 (11-Oxa Hexadecanolide) |
| 33925-77-8 |
10-bromo-1-decanol acetate |
| 3395-03-7 | 1,2-Dimethoxy-4,5-dinitrobenzene |
| 33953-86-5 |
2,2,2-TRIFLUOROACETALDEHYDE HYDRATE |
| 3395-91-3 |
Methyl 3-bromopropionate |
| 3400-45-1 | Cyclopentane carboxylic acid |
| 340-05-6 |
1-Phenyl-2,2,2-trifluoroethanol |
| 3406-84-6 | 4-Biphenyldisulphonyl chloride |
| 341-58-2 | 2,2'-Bis(trifluoromethyl)-4,4'-diamino biphenyl |
| 3420-02-8 | 6-Methylindole |
| 34202-69-2 | Hexafluoroacetone trihydrate (HFA • 3H2O) |
| 34206-40-1 | Tetra-(methylethylketoxime)silane |
| 342-25-6 |
2,4'-Difluorobenzophenone |
| 3430-13-5 |
5-Bromo-2-methylpyridine |
| 3430-14-6 |
5-Amino-2-methylpyridine |
| 3430-17-9 |
2-Bromo-3-methylpyridine |
| 3430-18-0 |
2,5-Dibromo-3-methylpyridine |
| 3430-21-5 |
2-Amino-5-bromo-3-methylpyridine |
| 3430-31-7 |
2,6-Dimethyl-3-bromopyridine |
| 343305-41-9 |
4-(tert-Butoxy)-2,3,5,6-tetrafluorostyrene |
| 343-93-1 | (6-Fluoroindole-3-ylmethyl)dimethylamine (6-Fluorogramine) |
| 34330-15-9 | 3-Allyl-5-(1-methyl-2-pyridylidene)rhodanine |
| 3437-95-4 | 2-Iodothiophene |
| 344-00-3 |
Ethyl 2-methyl-4,4,4-trifluoroacetoacetate |
| 344-03-6 |
1,4-Dibromotetrafluorobenzene |
| 344-04-7 |
Bromopentafluorobenzene |
| 344-07-0 |
Chloropentafluorobenzene |
| 344452-10-4 |
6-Iodo-1,1,1,2,2-pentafluorohexane |
| 3453-33-6 | 6-Methoxy-2-naphthaldehyde |
| 345-35-7 |
2-Fluorobenzyl Chloride |
| 345-40-4 |
2,2,3,3,3-Pentafluoro-1-phenylpropan-1-ol |
| 3454-28-2 |
Furfuryl methacrylate |
| 34552-13-1 |
3-Amino-2-chloro-5-methylpyridine |
| 34552-14-2 |
2-Bromo-3-amino-5-methylpyridine |
| 3457-46-3 |
4,4-Dichlorobenzil |
| 345-92-6 |
4,4'-Difluorobenzophenone |
| 34626-51-2 |
5-bromo-1-pentanol |
| 34662-32-3 |
4-Chloro-2-nitrobenzonitrile |
| 3468-11-9 | 1,3-Diiminoisoindoline |
| 34683-73-3 |
1-chloro-6-iodohexane |
| 3468-63-1 | Pigment Orange 5 |
| 3469-69-0 |
4-IODO-1H-PYRAZOLE |
| 34698-41-4 | 1-Aminoindane |
| 34701-14-9 | 4-Nitroindane |
| 34757-17-0 | Ethyl-2,2-dibromopropionate |
| 34761-47-2 |
Perfluoro(2,5,8,11-tetramethyl-3,6,9,12-tetraoxapentadecanoyl) fluoride |
| 34762-89-5 | trichloro(N,N-dimethylbenzylamine)boron |
| 34762-90-8 | Boron trichloride-dimethyloctylamine complex |
| 347-84-2 |
Benzyl-4-fluorophenyl ketone |
| 34803-66-2 |
1-(2-pyridinyl)piperazine |
| 3484-22-8 | 5-Nitro-2,3,3-trimethylindolenine |
| 34846-64-5 | 3-Cyanoquinoline |
| 348-54-9 |
2-Fluoroaniline |
| 34857-66-4 | 4-Trifluoromethylphenyl chloroformate |
| 3486-08-6 |
1-Iodoperfluoro-5-methylhexane |
| 348-75-4 |
3-Methyl-4,4,4-trifluorobutyric acid |
| 3492-24-8 |
1H,10H-Perfluorodecane |
| 34941-92-9 |
2-Fluoro-4-Chloropyridine |
| 349-43-9 |
Ethyl2-fluoropropionate |
| 349-49-5 |
2-Amino-4-trifluoromethyl-1,3-thiazole |
| 349-88-2 | 4-Fluorobenzenesulfonyl chloride |
| 350-03-8 |
3-Acetylpyridine |
| 35042-99-0 |
Difluoromethyl 2,2,3,3-tetrafluoropropyl ether |
| 350-57-2 |
(1,1,2,2-Tetrafluoroethoxy)benzene |
| 350608-55-8 |
Diethyl (1H,1H,2H,2H-perfluorooctyl)phosphonate |
| 350-92-5 |
3-Phenyl-1,1,1-trifluoroacetone |
| 35092-89-8 | 4-(methoxycarbonyl)-3-nitrobenzoic acid |
| 3510-66-5 |
2-Bromo-5-methylpyridine |
| 35109-88-7 |
2-IODOADENOSINE |
| 3511-90-8 |
4-Bromo-2,3,5,6-tetrafluoropyridine |
| 3512-17-2 |
2,4,6-Trifluoropyridine |
| 3516-87-8 |
Ethyl (pentafluorobenzoyl)acetate |
| 351-70-2 |
Benzyl trifluoroacetate |
| 35175-79-2 |
4-Methoxy-2,3,5,6-tetrafluorobenzyl alcohol |
| 35193-63-6 | (+/-)-1,1´-Binaphtyl-2,2´-diyl hydrogenphosphate |
| 352-11-4 |
4-Fluorobenzyl Chloride |
| 352-23-8 |
Ethyl3,3,3-trifluoropropionate |
| 352-24-9 |
Ethyl 4,4-difluoroacetoacetate |
| 352-32-9 |
p-Fluorotoluene |
| 352-33-0 |
P-chlorofluorobenzene |
| 352-34-1 |
4-Fluoroiodobenzene |
| 352-60-3 |
5-Iodo-1,1,1-trifluoropentane |
| 352-61-4 |
5,5,5-Trifluoropentan-1-ol |
| 352-70-5 |
m-Fluorotoluene |
| 352-87-4 | 2,2,2-Trifluoroethyl methacrylate |
| 3520-72-7 | Pigment Orange 13 |
| 3521-62-8 | Erythromycin Estolate |
| 352-91-0 |
1-fluoro-3-bromopropane |
| 35295-34-2 |
2-(1,1,2,2-Tetrafluoroethoxy)aniline |
| 35295-35-3 |
3-(1,1,2,2-Tetrafluoroethoxy)benzaldehyde |
| 35295-36-4 |
4-(1,1,2,2-Tetrafluoroethoxy)benzaldehyde |
| 3530-36-7 | 2-phenylethyl acrylate |
| 353-05-9 |
3-fluoro-1-propanol acetate |
| 353-36-6 |
Fluoroethane |
| 35350-31-3 | 4,4'-Dithio-bis(nitrotoluene) techn. |
| 353-54-8 |
Fluorotribromomethane (FC 11B3) |
| 353-83-3 |
2-iodo-1,1,1-trifluoroethane |
| 353-85-5 |
Trifluoroacetonitrile |
| 35386-24-4 |
1-(2-methoxyphenyl)piperazine |
| 354-08-5 |
Bromodifluoroacetic acid |
| 354-19-8 |
Dichlorofluoroacetic acid |
| 354-24-5 |
Chlorodifluoroacetyl chloride |
| 354-27-8 |
Chlorodifluoroacetyl fluoride |
| 354-28-9 |
Chlorodifluoroacetamide |
| 354-31-4 |
Trifluoroacetyl bromide |
| 354-32-5 |
Trifluoroacetyl chloride |
| 354-33-6 |
Pentafluoroethane |
| 354-34-7 |
Trifluoroacetyl fluoride |
| 354-37-0 |
Trifluoroacetamidine |
| 3543-72-4 |
ETHYL 4-(1-METHYL-5-NITRO-1H-BENZIMIDAZOL-2-YL) BUTANOATE |
| 3543-73-5 |
1-Methyl-5-amino-1H-benzimidazole-2-butanoic acid ethyl ester |
| 3543-74-6 |
5-[ Bis(2-hydroxyethyl)amino]-1-methyl-1H-benzimidazole-2-butanoic acid ethyl ester |
| 354-38-1 |
Trifluoroacetamide |
| 354-41-6 |
1-Iodo-1,1,2,2-tetrafluoroethane |
| 354-51-8 |
1-Chloro-1,2-dibromotrifluoroethane |
| 354-53-0 |
1-Bromo-2-chlorotetrafluoroethane |
| 35453-19-1 | 5-Amino-2,4,6-triiodoisophthalic acid |
| 354-54-1 |
2-Bromo-1-chloro-1-iodotrifluoroethane |
| 354-55-2 |
Bromopentafluoroethane |
| 354-56-3 |
Fluoropentachloroethane |
| 354-61-0 |
1,2-Dichloro-2-iodotrifluoroethane |
| 354-64-3 |
Iodopentafluoroethane |
| 354-65-4 |
1,2-Diiodotetrafluoroethane |
| 35466-83-2 | Allyl methyl carbonate |
| 354-69-8 |
3-Iodo-1,1,1,2,2-pentafluoropropane |
| 354-76-7 |
Pentafluoropropionamide |
| 35480-52-5 |
2,5-bis(2,2,2-trifluoroethoxy)benzoic acid |
| 35486-42-1 |
3,5-Dibromo-2-aminopyridine |
| 355-02-2 |
Perfluoro(methylcyclohexane) |
| 355-08-8 |
3,3,4,4,5,5,5-Heptafluoropent-1-ene |
| 355-17-9 |
Methyl heptafluoropropyl ketone |
| 355-20-4 |
2,3-Dichlorooctafluorobutane |
| 355-22-6 |
3,3,4,4,5,5,5-Heptafluoro-2-methylpentan-2-ol |
| 355-24-8 |
1,4-Dichlorooctafluorobutane |
| 355-27-1 |
1H,1H-Nonafluoropentylamine |
| 355-28-2 |
1H,1H-Nonafluoropentan-1-ol |
| 355-30-6 |
NONAFLUOROPENTALDEHYDE HYDRATE |
| 355-34-0 |
1H,1H-Perfluorohexylamine |
| 355-36-2 |
1-Bromo-6H-perfluorohexane |
| 355-37-3 |
1H-Perfluorohexane |
| 355-38-4 |
Perfluorohexanoyl fluoride |
| 355-40-8 |
1,6-Dichloroperfluorohexane |
| 355-41-9 |
1-Chloroperfluorohexane |
| 355-43-1 |
1-Iodoperfluorohexane |
| 355-47-5 |
1H,1H-Perfluorononylamine |
| 355-49-7 |
Perfluorohexadecane |
| 355-66-8 |
Octafluoroadipamide |
| 355-69-1 |
Iodoperfluorocyclohexane |
| 355-74-8 |
2,2,3,3,4,4,5,5-Octafluorohexane-1,6-diol |
| 355-75-9 |
Decafluorocyclohexene |
| 355-80-6 | 2,2,3,3,4,4,5,5-Octafluorpentanol |
| 35501-76-9 | 3,3'-Bis(4-sulfobutyl)-5,5'-diphenyl-9ethyloxacarbocyanine betaine sodium salt |
| 3558-24-5 | N-Methyl-2-phenylindole |
| 355-84-0 |
5,5,6,6,7,7,8,8,8-Nonafluorooctane-2,4-dione |
| 3558-60-9 | 2-Phenylethyl Methyl Ether |
| 355-86-2 |
Tris(1H,1H,5H-octafluoropentyl)phosphate |
| 355-93-1 |
1H,1H,5H-Octafluoropentyl methacrylate |
| 355-94-2 |
5-Bromo-1,1,1,2,2,3,3-heptafluoropentane |
| 355-95-3 |
4,4,5,5,6,6,6-Heptafluorohex-2-ene |
| 356-02-5 |
4,4,5,5,6,6,6-Heptafluorohexanoic acid |
| 356-03-6 |
4,4,5,5,6,6,6-Heptafluorohex-2-enoic acid |
| 356-18-3 |
1,2-Dichlorohexafluorocyclobutane |
| 356-24-1 |
Methyl heptafluorobutyrate |
| 356-26-3 |
Heptafluorobutanal ethyl hemiacetal |
| 356-27-4 |
Ethyl heptafluorobutyrate |
| 356-30-9 |
5,5,6,6,7,7,7-Heptafluoroheptane-2,4-dione |
| 356-32-1 |
Methyl 2,2,3,3,4,4-hexafluorobutyrate |
| 356-40-1 |
5,5,6,6,6-Pentafluorohexane-2,4-dione |
| 356-42-3 |
Pentafluoropropionic anhydride |
| 356-69-4 |
Methyl 2,2,3,3-tetrafluoro-3-(trifluoromethoxy)propionate |
| 356-73-0 |
5-Bromo-4-chloro-4,5,5-trifluoropent-2-ene |
| 356-86-5 |
2,2,3,3,3-Pentafluoropropyl acrylate |
| 35703-63-0 |
Sodium Iodide Dichloride |
| 3572-06-3 | 4-(3-Oxobutyl)phenyl acetate |
| 357-26-6 |
Octafluorobut-1-ene (mixture of isomers 10-20% Octafluorobut-2-ene) |
| 3577-63-7 | 2-Amino-5-sulfobenzoic acid |
| 357-83-5 |
N,N-Diethyl-2-chloro-1,1,2-trifluoroethylamine |
| 35794-11-7 |
3,5-dimethyl-piperidin |
| 35795-44-9 | 3-Ethyl-5-[2-(3-methyl-2thiazolidinylidene)ethylidene]-2-thioxo-4oxazolidone |
| 35795-45-0 | 3,3'-Diethyl-5-Phenyl-5',6',9-trimethyloxathiacarbocyanine perchlorate |
| 357-98-2 |
(1,1,2,3,3,3-Hexafluoropropoxy)benzene |
| 358-23-6 |
Trifluoromethanesulfonic anhydride |
| 358-37-2 |
n-Butyl 1,1,2,2-tetrafluoroethyl ether |
| 358-67-8 | Dimethoxy(methyl)(3,3,3-trifluoropropyl)silane |
| 35824-91-0 | 1,3-Dicyclohexylbarbituric acid |
| 359-01-3 |
2-Fluorobutane |
| 359-07-9 |
1-Bromo-2,2-difluoroethane (FC-142B1) |
| 359-12-6 |
Difluoroacetonitrile |
| 359-13-7 |
2,2-Difluoroethanol |
| 359-38-6 |
Difluoroacetamide |
| 359-41-1 |
(Trifluoromethyl)oxirane |
| 35948-25-5 | 9,10-Dihydro-9-oxa-10-phosphaphen anthrene-10-oxide |
| 359-49-9 |
2,3,3,3-Tetrafluoropropionic acid |
| 359-66-0 |
1,1-Dichloro-2-trifluoromethyl-3,3,3-trifluoropropene |
| 359-70-6 |
Perfluoro(triethyl)amine |
| 3602-55-9 | tert-Butyl-p-benzoquinone |
| 3603-43-8 |
N-(2-hydroxyethoxy)ethyl)piperidine |
| 36042-94-1 |
Bis(o-tolyl)chlorophosphine |
| 360-54-3 |
Methyl 3,3,3-trifluoro-2-(trifluoromethyl)propionate |
| 360-89-4 |
Octafluorobut-2-ene |
| 360-92-9 |
N,N-Diethyltrifluoroacetamide |
| 36140-83-7 | 1-Cyanoacetyl 3, 5 Dimethyl Pyrazole |
| 361442-00-4 |
- N-tert-Butyloxycarbonyl-3-Hydroxy-1-Adamantyl-D-Glycine |
| 3619-17-8 | Isobutyrohydrazide |
| 36239-09-5 | Ethyl malonyl chloride |
| 362-56-1 |
1,4-Dimethoxytetrafluorobenzene |
| 363-40-6 |
2',4',6'-Trifluoroacetanilide |
| 363-52-0 |
3-Fluorocatechol |
| 363-58-6 |
Ethyl 2-chloro-4,4,4-trifluoroacetoacetate |
| 3637-10-3 | 4-Hydroxy-2,2,6,6-tetrmethylpiperidinyloxy, free radical |
| 363-72-4 |
Pentafluorobenzene |
| 3637-31-8 |
4,4,5,5,5-Pentafluoropentanoic acid |
| 363-73-5 |
2,3,4,6-Tetrafluoroaniline |
| 363-75-7 |
N,N-Diethyl-1,1,2,3,3,3-hexafluoropropylamine |
| 3638-12-3 | 2-phenylethyl methacrylate |
| 363-81-5 |
2,4,6-Trifluoroaniline |
| 36393-83-6 | 3,3'-Bis(2-hydroxyethyl)-5,5',9trimethylthiacarbocyanine bromide |
| 36405-47-7 |
2,2,3,4,4,4-Hexafluorobutyl methacrylate |
| 36443-68-2 | Ethylene bis(oxyethylene) bis-(3-(5-tert-butyl-4- hydroxy-m-tolyl)propionate |
| 364-74-9 |
2,5-Difluoronitrobenzene |
| 3647-69-6 |
4-(2-chloroethyl)morpholine hydrochloride |
| 36483-57-5 |
Tribromoneopentyl alcohol |
| 365427-25-4 |
5(3)-(4-Methoxyphenyl)-3(5)-(trifluoromethyl)pyrazole |
| 365514-36-9 | 4,5:6',7'-Dibenzo-1,1',3,3,3',3'-hexamethylindacarbocyanine hexafluorophosphate |
| 365568-24-7 |
Perfluoro(tert-butyl) 2-fluoroacrylate |
| 36575-82-3 |
Dimethyl Pentadecanedioate |
| 36577-48-7 |
Zirconium Carbonate(ZBC) |
| 365996-30-1 |
(1S,2R)-N1-(tert-Butoxycarbonyl)-1,2-cyclohexanediamine |
| 36629-42-2 |
Methyl pentafluorobenzoate |
| 36635-61-7 | Tosylmethylisocyanide |
| 3665-51-8 | 2-Hydroxy-3-naphtoamide |
| 36673-16-2 | Tri ethanolamine titanate |
| 367-25-9 |
2,4-Difluoroaniline |
| 36727-29-4 | Isononanoyl Chloride |
| 367-57-7 |
1,1,1-Trifluoroacetylacetone |
| 367-64-6 |
n-Butyl trifluoroacetate |
| 367-86-2 |
4-Fluoro-3-Nitrobenzotrifluoride |
| 3678-62-4 |
2-Chloro-4-methylpyridine |
| 368-35-4 |
n-Butyl difluoroacetate |
| 368-43-4 |
Benzenesulfonyl fluoride |
| 368-53-6 |
5-(Trifluoromethyl)-1,3-phenylenediamine |
| 36865-41-5 |
1-bromo-3-methoxypropane |
| 368-66-1 |
Tris(trifluoromethyl)-1,3,5-triazine |
| 368-88-7 | 4-fluorobenzenesulphonic acid |
| 36878-20-3 | bis(nonylphenyl)amine |
| 369-22-2 |
Tris(difluoromethyl)-1,3,5-triazine |
| 36936-23-9 |
2-Amino-5-chloro-6-methylpyridine |
| 36936-27-3 |
2-Amino-5-chloro-4-methylpyridine |
| 3695-29-2 |
5-IODOPENTAN-2-ONE |
| 36961-64-5 | 2-(2-chloroethoxy)acetamide |
| 36978-41-3 | 2,3,3'4-Biphenyl tetracarboxylic dianhydride |
| 3699-66-9 |
Triethyl 2-phosphonopropionate |
| 37087-01-7 | Ammonium naphthalene-2-sulphonate |
| 3709-18-0 | 2,2,5-trimethyl-1,3-dioxane-4,6-dione |
| 371-41-5 |
4-Fluorophenol |
| 371-62-0 |
2-Fluoroethanol |
| 37172-53-5 | Dihydro Isojasmonate |
| 371-26-6 |
Ethyl4,4,4-trifluorobutyrate |
| 371-40-4 |
4-Fluoroaniline |
| 372-09-8 | Cyanoacetic Acid |
| 37206-42-1 | 2,2'-Bis(Ethylferrocenyl)Propane |
| 3721-95-7 | Cyclobutanecarboxylic acid |
| 372-20-3 |
3-Fluorophenol |
| 372-27-0 |
Ethyl 3-bromo-4,4,4-trifluorobutyrate |
| 372-30-5 |
Ethyl 3-hydroxy-4,4,4-trifluorobutyrate |
| 372-31-6 |
Ethyl 4,4,4-trifluoroacetoacetate |
| 372-38-3 |
1,3,5-Trifluorobenzene |
| 3724-43-4 | Vilsmeier reagent |
| 372-46-3 |
Fluorocyclohexane |
| 372-64-5 |
Bis(trifluoromethyl) disulfide |
| 37275-49-3 | Dicyclopentadiene alcohol |
| 372-91-8 |
1-fluoro-4-iodobutane |
| 373-09-1 |
4-fluoro-1-butanol acetate |
| 373-14-8 |
1-Fluorohexane |
| 3731-51-9 |
2-aminomethylpyridine |
| 3731-53-1 |
4-aminomethylpyridine |
| 373-18-2 |
1-fluoro-5-iodopentane |
| 373-28-4 |
1-fluoro-6-bromohexane |
| 373-30-8 |
1-fluoro-6-iodohexane |
| 373-44-4 | 1,8-Diaminooctane |
| 3731-16-6 | Ethyl 2-piperidone-3-carboxylate |
| 373-88-6 |
2,2,2-Trifluoroethylaminehydrochloride |
| 373-96-6 |
2,2-Difluoropropionic acid |
| 374-01-6 |
1,1,1-Trifluoropropan-2-ol |
| 374-14-1 |
2,2,3,3,3-Pentafluoropropylamine hydrochloride |
| 3741-80-8 | N-Benzothiazol-2-ylsulfanyl-N-tert-butyl-benzothiazole-2-sulfenamide |
| 374-25-4 |
4-Bromo-3-chloro-3,4,4-trifluorobut-1-ene |
| 374-26-5 |
3,4-Dichloro-3,4,4-trifluorobut-1-ene |
| 374-27-6 |
3,3,4,4,4-Pentafluorobut-1-ene |
| 374-35-6 |
2-Hydroxy-2-(trifluoromethyl)propionic acid |
| 374-39-0 |
2,3,3,4,4,4-Hexafluorobut-1-ene |
| 374-40-3 |
3,3,4,4,4-Pentafluorobutan-2-ol |
| 37441-29-5 | 5-Amino-2,4,6-triiodisophthaloyl acid dichloride |
| 374-41-4 |
Methyl pentafluoroethyl ketone |
| 374-60-7 |
Perfluoro(butylcyclohexane) |
| 374-88-9 |
Perfluorocyclohexanecarboxylic acid |
| 374-98-1 |
4-Iodo-1,1,1,2,2,3,3-heptafluorobutane |
| 374-99-2 |
2,2,3,3,4,4,4-Heptafluorobutylamine |
| 375-00-8 |
Heptafluorobutyronitrile |
| 375-01-9 |
2,2,3,3,4,4,4-Heptafluorobutan-1-ol |
| 375-02-0 |
2,2,3,3,4,4,4-Heptafluorobutyraldehyde |
| 375-03-1 |
Methyl heptafluoropropyl ether |
| 375-03-1 | Heptafluoro-1-methoxypropane;C3ME |
| 375-13-3 |
Heptafluorobutyryl bromide |
| 375-14-4 |
3,3,4,4,5,5,5-Heptafluoropentan-2-ol |
| 375-16-6 |
Heptafluorobutyryl chloride |
| 37517-81-0 | Methyl malonyl chloride |
| 375-19-9 |
Heptafluorobutanamidine |
| 375-21-3 |
Heptafluorobutyraldehyde hydrate |
| 375-22-4 |
Heptafluorobutyric acid |
| 37526-88-8 |
Benzyl Tiglate |
| 375-45-1 |
1,2,3,4-Tetrachlorohexafluorobutane |
| 375-48-4 |
1-Bromononafluorobutane |
| 375-50-8 |
1,4-Diiodooctafluorobutane |
| 375-51-9 |
2-Iodononafluorobutane |
| 375-53-1 |
Nonafluoropentanal hydrate |
| 375-60-0 |
Nonafluoropentanoyl chloride |
| 375-62-2 |
Nonafluoropentanoyl fluoride |
| 375-72-4 |
Perfluorobutanesulfonyl fluoride |
| 375-80-4 |
1,6-Diiodoperfluorohexane |
| 375-82-6 |
1H,1H-Perfluoroheptan-1-ol |
| 375-84-8 |
Perfluoroheptanoyl fluoride |
| 375-85-9 |
Perfluoroheptanoic acid |
| 375-95-1 |
Perfluorononanoic acid |
| 37595-74-7 |
N-Phenylbis(trifluoromethanesulphonimide) |
| 376-18-1 |
1H,1H,9H-Perfluorononan-1-ol |
| 376-27-2 |
Methyl perfluorooctanoate |
| 376-32-9 |
1-Iodo-1H,1H,7H-perfluoroheptane |
| 37640-57-6 | Melamine cyanurate |
| 376-50-1 |
Diethyl perfluoroadipate |
| 376-53-4 |
Octafluoroadipodinitrile |
| 376-69-2 |
5H-Octafluoropentanoyl bromide |
| 376-71-6 |
5H-Octafluoropentanoyl chloride |
| 376-72-7 |
5H-Octafluoropentanoic acid |
| 37677-14-8 |
Myrac Aldehyde |
| 376-84-1 |
1H,1H,5H-Octafluoropentyl acrylate |
| 376-87-4 |
Decafluoropent-1-ene |
| 37697-64-6 |
1,3-Dioxole,4,5-difluoro-2,2-bis(trifluoromethyl)- |
| 376-98-7 |
Methyl 1H,1H-heptafluorobutyl ether |
| 377-33-3 |
Tetrafluorosuccinimide |
| 377-36-6 |
1H,4H-Octafluorobutane |
| 377-38-8 |
Tetrafluorosuccinic acid |
| 377-46-8 |
4,5-Dibromo-1,1,1,2,2,3,3-heptafluoropentane |
| 377-52-6 |
Heptafluorobutanal methyl hemiacetal |
| 377-73-1 |
2,2,3,3-Tetrafluoro-3-(trifluoromethoxy)propionic acid |
| 3779-29-1 | Diethyl cyclobutane-1,1-dicarboxylate |
| 378-13-2 |
2-Chloro-1,4-dibromo-1,1,2-trifluorobutane |
| 378-16-5 |
Methyl 2,2,3,3,3-pentafluoropropyl ether |
| 37830-90-3 | 4,5-Dimethyl-1,3-dioxol-2-one |
| 378-34-7 |
(Heptafluoroisopropyl)benzene |
| 37858-04-1 |
1H,1H,2H,2H-Perfluorodecyl acetate |
| 378-67-6 |
Methyl 2-bromotetrafluoropropionate |
| 378-69-8 |
3,4-Dibromo-1,1,1,2,2-pentafluorobutane |
| 378-72-3 |
Ethyl pentafluoroethyl ketone |
| 378-75-6 |
Methylpentafluoropropionate |
| 378-76-7 |
Potassium pentafluoropropionate |
| 378-77-8 |
Sodiumpentafluoropropionate |
| 378-81-4 |
4-Chloro-1,1,2-trifluoro-1-butene |
| 37881-62-2 |
Octafluoroadipoyl difluoride |
| 3792-02-7 |
5,5,6,6,7,7,8,8,8-Nonafluorooctan-1-ol |
| 3796-24-5 |
4-(Trifluoromethyl)pyridine |
| 379-90-8 |
2,2,3,4,4,4-Hexafluorobutyric acid |
| 379-95-3 |
Dimethyl difluoromalonate |
| 3802-76-4 |
3,3,4,4-Tetrafluorotricyclo-[4.2.1.02,5]non-7-ene |
| 380-34-7 |
Ethyl 1,1,2,3,3,3-hexafluoropropyl ether |
| 380-44-9 |
Allyl 2-chloro-1,1,2-trifluoroethyl ether |
| 380-45-0 |
2-Chloroethyl 2-chloro-1,1,2-trifluoroethyl ether |
| 38050-71-4 | 9-Methoxy-9-borabicyclo(3.3.1)nonane |
| 380-57-4 |
2-Chloro-1,4-dibromo-1,1,2-trifluoropentane |
| 3806-34-6 | 3,9-Bis(octadecyloxy)-2,4,8,10-tetraoxa-3,9-diphosphaspiro[5.5]undecane |
| 38078-09-0 |
Diethylaminosulphurtrifluoride |
| 3808-20-6 | Luminore yellow-green 540T |
| 38103-06-9 | 4,4-(4,4'-isopropylidenediphenoxy)bis-(phthalic anhydride) |
| 381233-78-9 |
5-(2-Pyridyl)-1,2-dihydropyridin-2-one |
| 381233-96-1 |
2-Amino-5-bromo-3-iodopyridine |
| 38126-07-7 |
Bromodifluoroacetyl fluoride |
| 3814-34-4 |
1-bromo-2-ethylbutane |
| 381725-50-4 |
1-Phenyl-5-(Pyridine-2-yl)-Pyridin-2(1H)-One |
| 381-72-6 |
Difluoroacetyl chloride |
| 381-73-7 |
Difluoroacetic acid |
| 381-84-0 |
2-(Trifluoromethyl)acrylonitrile |
| 38185-56-7 |
5-Bromo-3-Chloro-2-Fluoropyridine |
| 38186-82-2 |
5-Amino-2-chloro-3-methylpyridine |
| 38186-83-3 |
5-Amino-2-bromo-3-methylpyridine |
| 381-88-4 |
1,1,1-Trifluorobutan-2-one |
| 381-98-6 |
2-(Trifluoromethyl)propenoic acid |
| 382-01-4 |
3-Bromo-1,1,1-trifluorobutan-2-one |
| 382-02-5 |
1,1,1-Trifluoro-3-methylbutan-2-ol |
| 382-03-6 |
1,1,1-Trifluoro-3-methylbutan-2-one |
| 382-14-9 |
2-(Bromomethyl)-1,1,1,3,3,3-hexafluoropropane |
| 382-10-5 | Hexafluoroisobutylene (HFIB) |
| 38212-30-5 | 1-(4-Methoxyphenyl)piperazine |
| 38213-69-3 | Bis(maltolato)oxovanadium(IV) |
| 382-17-2 |
2H-Hexafluoroisobutyronitrile |
| 382-19-4 |
3,3,3-Trifluoro-2-(trifluoromethyl)propionyl chloride |
| 382-22-9 |
3,3,3-Trifluoro-2-(trifluoromethyl)propionyl fluoride |
| 382-31-0 |
2,2,3,4,4,4-Hexafluorobutan-1-ol |
| 382-34-3 |
1,1,2,3,3,3-Hexafluoropropyl methyl ether |
| 382-40-1 |
Ethyl 2,2-dibromo-4,4,4-trifluoroacetoacetate |
| 382-43-4 |
3-Hydroxy-2-(trifluoromethyl)propionic acid |
| 382-90-1 |
Methyl-2(trifluoromethyl)acrylate |
| 382-93-4 |
Methyl 2,3,3,3-tetrafluoropropionate |
| 3831-49-0 |
1-Iodo-1,2,2,2-tetrafluoroethane |
| 3832-24-4 |
3-Amino-1,1,1-trifluoropropan-2-ol hydrochloride |
| 3832-48-2 |
Bromodifluoroacetyl chloride |
| 3832-65-3 |
1,4-Bis(1,1,2,2-tetrafluoroethoxy)benzene |
| 3834-42-2 |
Trimethyl(heptafluoropropyl)silane |
| 383-61-9 |
Ethyl dichlorofluoroacetate |
| 383-62-0 |
Ethyl chlorodifluoroacetate |
| 383-63-1 | Ethyl trifluoroacetate (ETFA) |
| 38330-80-2 | Methyl potassium malonate |
| 383-67-5 |
Allyl trifluoroacetate |
| 38369-95-8 | 2-(2,4-Dihydroxyphenyl)-4,6-diphenyl-1,3,5-triazine |
| 38377-38-7 | 4-fluorophenyl chloroformate |
| 383-84-6 |
1,1,2-Trifluorobut-1-ene |
| 3842-55-5 | 2-Chloro-4,6-diphenyl-1,3,5-triazine |
| 38432-77-8 |
2-Isoproyl-2-Adamantanol |
| 38436-14-5 |
1-Bromo-3,3,4,4,5,5,6,6,6-nonafluorohexane |
| 38436-17-8 |
1H,1H,1H,2H,2H-Perfluorohexane |
| 38436-18-9 |
8-Bromo-1,1,1,2,2,3,3,4,4-nonafluorooctane |
| 384-51-0 |
2,3-Dibromohexafluorobut-2-ene |
| 3846-71-7 | 2-(3,5-Di-tert-butyl-2-hydroxyphenyl)-2H-benzotriazole |
| 38465-55-3 | Bis(4-dimethylaminodithiobenzil)nickel |
| 384-67-8 |
2-Chloro-2,2-difluoroacetophenone |
| 38487-86-4 |
2-Amino-4-chlorobenzonitrile |
| 38533-61-8 |
2-Chloro-6-methoxy-3-nitropyridine |
| 385422-30-0 |
4-Hydroxy-2,3,5,6-tetrafluorostyrene |
| 38550-34-4 |
2-Iodo-1H,1H,1H,2H,3H,3H-perfluorononane |
| 38550-44-6 |
2-Iodo-1H,1H,2H,3H,3H-perfluorononan-1-ol |
| 38550-45-7 |
2-Iodo-1H,1H,2H,3H,3H-perfluoroundecan-1-ol |
| 38550-47-9 |
1H,1H,2H,3H-Perfluoronon-2-en-1-ol |
| 38565-52-5 |
(1H,1H-Perfluoroheptyl)oxirane |
| 38565-53-6 |
(1H,1H-Perfluorononyl)oxirane |
| 38565-61-6 |
1-Iodo-4-(perfluorohexyl)butane |
| 38565-62-7 |
1-Iodo-4-(perfluorooctyl)butane |
| 38568-21-7 |
2,2-Dibromohexafluoropropane |
| 38573-88-5 |
2,3-DifluoroBrmorobenzene |
| 3857-83-8 |
2-Naphthyl trifluoromethanesulfonate |
| 38584-37-1 |
3-Hydroxy-1-Adamantane Methanol |
| 38609-97-1 | Acridone acetic acid |
| 3864-99-1 | 2-(3',5'-Di-tert-butyl-2'-hydroxyphenyl) -5-chloro-2H-benzotriazole |
| 386704-12-7 |
2-(Trifluoromethyl)pyridine-5-carboxaldehyde |
| 387-43-9 | 4-Fluoroindole |
| 387-44-0 | 7-Fluoroindole |
| 387-45-1 |
2-Chloro-6-fluorobenzaldehyde |
| 3874-54-2 |
4’-fluoro-4-chlorobutyrophenone |
| 38749-79-0 |
3-Bromo-2-Methylpyridine |
| 3883-86-1 |
4H,4'H-Octafluorobiphenyl |
| 3886-70-2 | R-(+)-1-(1-Naphthyl) Ethylamine |
| 38870-89-2 | Methoxyacetyl chloride |
| 38875-53-5 |
2,3-Diamino-5-bromopyridine |
| 3888-44-6 | CHROMOTROPIC ACID |
| 3891-33-6 | 1,4-Butanediol divinyl ether |
| 38926-45-3 | 2,3,5,6-Pyridinetetramine |
| 389-40-2 |
2,3,4,5,6-Pentafluoroanisole |
| 38951-97-2 | Bis(4,4'-dimethoxydithiobenzil)nickel |
| 3896-11-5 | 2-(2'-Hydroxy-3'-tert-butyl-5'-methylphenyl)-5-chloro-benzotriazole |
| 38998-04-8 | 4-Hydroxy-7-methoxyindane |
| 3900-45-6 | 2-Acetyl-6-methoxynaphthalene |
| 3903-40-0 |
Monomethyl Dodecanedioate |
| 39098-97-0 |
"2-Thiopheneacetyl chloride " |
| 391-12-8 | 7-Trifluoromethylisatin |
| 3914-19-0 |
1,3-Bis(1,1,2,2-tetrafluoroethoxy)benzene |
| 39160-31-1 |
4-Fluoropyridinehydrochloride |
| 391-77-5 | 4-Chloro-6-fluoroquinoline |
| 39145-47-6 | 2-(4-chlorophenoxy)nitrobenzene |
| 39187-47-8 |
Methyl perfluoro(2,5,8-trimethyl-3,6,9-trioxadodecanoate) |
| 3923-52-2 |
1,1-Diphenyl-2-propyn-1-ol |
| 392-41-6 |
Methyl trifluoroacrylate |
| 392-56-3 |
Hexafluorobenzene |
| 392-56-3 |
Hexafluorobenzene |
| 392-57-4 |
1,4-Diiodotetrafluorobenzene |
| 392-63-2 |
N,N-Diethyl-2,3,3,3-tetrafluoropropionamide |
| 3927-60-4 |
Methyl hydrogen Hendecanedioate |
| 392-83-6 | 1-Bromo-2-(trifluoromethyl)benzene |
| 39252-69-2 | Ethyl 2-iodobenzoate |
| 39267-04-4 | 2,3-Dichloro-6-methoxyquinoxaline |
| 39267-05-5 | 2,3-Dichloro-6-methylquinoxaline |
| 3932-97-6 |
2,4-Dichloro-5-(trifluoromethyl)pyrimidine |
| 3934-20-1 | 2,4-Dichloropyrimidine |
| 393-52-2 |
2-Fluorobenzoyl Chloride |
| 393-55-5 |
2-Fluoronicotinic acid |
| 3937-56-2 | 1,9-Nonanediol |
| 393-75-9 |
4-Chloro-3,5-Dinitrobenzotrifluoride |
| 393-77-1 |
2,6-Dinitro-4-(trifluoromethyl)phenol |
| 39392-86-4 |
Iodophor |
| 394-33-2 | 4-Fluoro-2-nitrophenol |
| 394-46-7 |
2-Fluorostyrene |
| 394-47-8 |
2-Fluorobenzonitrile |
| 394-52-5 |
Pentafluoroethyl phenyl ketone |
| 394-59-2 |
4-(Trifluoroacetyl)toluene |
| 3946-32-5 |
Monomethyl Suberate |
| 39478-78-9 | 5-Bromo-2-methylaniline |
| 39492-90-5 | 3,5,7,9-Tetraoxaundecafluorodecanoic acid |
| 39499-31-5 | Perfluoro-3-oxabutyl Vinyl Ether |
| 3954-13-0 | n-Pentyl isocyanate |
| 39546-32-2 | 4-piperidinecarboxamide |
| 39549-31-0 | 2-Amino-4,6-dichloro-5-methylphenol hydrochloride |
| 396-01-0 |
Triamterene |
| 39650-63-0 | 2-(5-Aminopentyl)benzimidazole |
| 39654-39-2 | Perfluoro-3,5-dioxahexyl Vinyl Ether |
| 3967-54-2 | Chloroethylene carbonate |
| 39670-09-2 | Triethylene Glycol Monoethyl Ether Methacrylate |
| 39751-07-0 |
2,6-Adamantanedione |
| 39856-50-3 |
2-Nitro-5-bromopyridine |
| 39890-98-7 |
2,6-Dichloro-4-(trifluoromethyl)pyridine |
| 39891-70-8 | 3-Indolinecarboxylic acid |
| 39919-65-8 |
2,5-Dibromo-6-methylpyridine |
| 399-51-9 | 6-Fluoroindole |
| 399-52-0 | 5-Fluoroindole |
| 399-92-8 |
Ethyl 2,3,3,3-tetrafluoropropionate |
| 399-95-1 | 4-Amino-3-fluorphenol |
| 3999-38-0 | 2-Methylpyridine Borane |
| CAS NO | Product Name |
| 400-37-3 | 1,1,1-Trifluoroisopropyl acetate |
| 400-38-4 | Isopropyl trifluoroacetate |
| 400-49-7 | 1,1,1,4,4,4-Hexafluorobutan-2-one |
| 400-52-2 | tert-Butyl trifluoroacetate |
| 400-53-3 |
Trimethylsilyl trifluoroacetate |
| 400-54-4 |
1,1,1-Trifluorohexane-2,4-dione |
| 4005-51-0 | 2-Amino-1,3,4-thiadiazole |
| 400607-04-7 | 9-Bromo-10-(1-Naphthalenyl)Anthracene |
| 400607-05-8 | 9-bromo-10-(4-phenylphenyl)anthracene |
| 400607-31-0 | 9,9-diphenyl-9H-fluoren-2-ylboronic acid |
| 400607-46-7 | (10-(Naphthalen-1-yl)anthracen-9-yl)boronic acid |
| 400607-47-8 | [10-(4-phenylphenyl)anthracen-9-yl]boronic acid |
| 4006-38-6 |
Diisobutylphosphine |
| 40073-38-9 |
2-Amino-3-bromo-4-methylpyridine |
| 4008-48-4 |
5-Nitro-8-Hydroxyquinoline |
| 40119-17-3 | 3,4-Dimethoxyphenylhydrazine hydrochloride |
| 40137-22-2 |
3-methylamino-1,2-propanediol |
| 40145-10-6 |
6-iodo-1-hexanol |
| 401-49-0 |
1,1,2-Trifluoropenta-1,4-diene |
| 401-67-2 |
Difluoroacetic anhydride |
| 40172-65-4 | 2-Aminonaphtho[1,2-d]thiazole |
| 40174-39-8 | 2,3-Dimethyl-1H-benzo[e]indole |
| 401-78-5 |
3-Bromobenzotrifluoride |
| 401-79-6 |
3-Methylbenzotrifluoride |
| 401-81-0 |
3-Iodobenzotrifluoride |
| 401-94-5 |
3-Amino-5-nitrobenzotrifluoride |
| 401-99-0 |
3,5-Dinitrobenzotrifluoride |
| 40200-18-8 |
6-Chlorohexyl acetate |
| 4020-99-9 |
Methyl diphenylphosphinite |
| 402-31-3 |
1,3-Di(trifluoromethyl)benzene |
| 402-42-6 |
4-Fluorobenzotrichloride |
| 402-43-7 |
4-Bromobenzotrifluoride |
| 402-46-0 | 4-fluorobenzenesulphonamide |
| 4023-34-1 | Cyclopropanecarbonyl chloride |
| 402-50-6 |
4-(Trifluoromethyl)styrene |
| 4027-54-7 |
5(3)-Phenyl-3(5)-(trifluoromethyl)pyrazole |
| 40292-82-8 | Neodecanoyl Chloride |
| 40306-75-0 | 6-Acetylamino-2-amino-1- hydroxybenzene-4-sulfonic acid |
| 403-17-8 |
4-Chloro-3-fluorobenzoic acid |
| 403-33-8 |
Methyl 4-Fluorobenzoate |
| 403-43-0 |
4-Fluorobenzoyl Chloride |
| 403-61-2 |
4-(2-Chloro-1,1,2-trifluoroethoxy)aniline |
| 40372-72-3 | N,N'-Dibezylhydroxylamine |
| 40400-13-3 |
2-IODOBENZYL BROMIDE |
| 4043-59-8 |
1,3-diethoxy-2-propanol |
| 40465-45-0 | 4-Cyanophenyl isocyanate |
| 40470-68-6 | 4,4'-Bis(2-methoxystyryl)-1,1'-biphenyl |
| 40473-01-6 |
2-Bromo-5-chloropyridine |
| 40484-49-9 | 2-Methylbenzo[c,d]indole |
| 40497-11-8 | Ethyl 2,3-Dicyanopropionate |
| 40538-11-2 |
Diphenylphosphinostyrene |
| 4055-69-0 | 4-Methoxy-2,3-dihydroxybenzaldehyde |
| 40573-09-9 |
Perfluoro-3,7-dioxaoct-1-ene |
| 40596-44-9 |
4-iodo-1-butanol acetate |
| 40596-69-8 | Methoprene (racemate) |
| 40601-76-1 | Tris(4-tert-butyl-3-hydroxy-2,6-dimethylbenzyl) Isocyanurate |
| 406-10-0 |
Ethyl 4,4,4-trifluorocrotonate |
| 40615-36-9 |
4,4’-dimethoxytrityl chloride(DMT-Cl) |
| 4063-48-3 |
1,2-Bis(1,1,2,2-tetrafluoroethoxy)benzene |
| 406-39-3 |
1,1,1-Trifluorobut-2-ene |
| 406-42-8 |
1,3-Dibromo-1,1-difluorobutane |
| 406-78-0 |
1,1,2,2-Tetrafluoroethyl 2,2,2-trifluoroethyl ether |
| 406-81-5 |
1-Bromo-4,4,4-trifluorobutane |
| 406-85-9 |
4-Chloro-1,1,1-trifluorobutane |
| 406-86-0 |
4,4,4-Trifluorocrotononitrile |
| 406-89-3 |
1-Methoxy-3,3,3-trifluoropropene |
| 406-92-8 |
4,4,4-Trifluorocrotonoyl chloride |
| 406-93-9 |
4,4,4-Trifluorobutyric acid |
| 406-94-0 |
4,4,4-Trifluorocrotonic acid |
| 406-95-1 |
2,2,2-Trifluoroethyl acetate |
| 407-12-5 |
(2,2,2-Trifluoroethyl)oxirane |
| 40723-80-6 |
4-Iodo-1,1,1,2,2-pentafluorobutane |
| 407-25-0 |
Trifluoroacetic anhydride |
| 407-38-5 |
2,2,2-Trifluoroethyl trifluoroacetate |
| 407-47-6 |
2,2,2-Trifluoroethyl acrylate |
| 407-47-6 | 2,2,2-Trifluoroethyl acrylate |
| 4073-98-7 | 4,4'-Methylenebis (2,6-xylidine) |
| 4074-90-2 | ADIPIC ACID DIVINYL ESTER |
| 407-62-5 |
5,5,5-Trifluoropentanoic acid |
| 40775-78-8 | 7-Hydroxy-5-methyl-2-methylthio-1,3,4-triazaindolizine |
| 407-97-6 |
1-fluoro-5-bromopentane |
| 407-98-7 |
1-fluoro-5-chloropentane |
| 4084-38-2 |
2,3,5,6-Tetrafluorobenzyl alcohol |
| 40876-94-6 | N Ethyl 2 Methylindole |
| 4089-57-0 |
5-Fluorosulfonylperfluoro(2-methyl-3-oxapentanoyl) fluoride |
| 4089-58-1 |
8-Fluorosulfonylperfluoro(2,5-dimethyl-3,6-dioxaoctanoyl) fluoride |
| 40953-34-2 | 2-Aminoimidazole-4,5-dicarbonitrile |
| 4096-20-2 |
N-phenylpiperidine |
| 4100-80-5 |
3-Methyldihydrofuran-2,5-dione |
| 4101-68-2 | 1,10-dibromodecane |
| 4102-53-8 | 4-Iodo-2,6--dimethylaniline |
| 41051-15-4 |
methyl 4-methoxyacetoacetate |
| 41088-52-2 | 3,4-Epoxycyclohexane carboxylic acid, methyl ester |
| 41100-52-1 |
Memantine Hydrochloride |
| 41123-44-8 |
1H,1H,11H-Perfluoroundecyl methacrylate |
| 411235-57-9 |
Cyclopropylboronic acid |
| 41175-50-2 | 8-Hydroxyjulolidine hydrochloride |
| 41202-77-1 |
1-(2,3-DICHLOROPHENYL) PIPERAZINE |
| 41218-84-2 | (6,11H-Dihydro-5H-dibenz[b,e]azepine-6-ethyl)-amine |
| 41242-02-8 |
2-(1,1,2,3,3,3-Hexafluoropropoxy)aniline |
| 4125-25-1 |
Triisobutylphosphine |
| 41267-76-9 | Coumarin 102 |
| 41272-40-6 | BASIC GREEN 4 |
| 4128-73-8 | 4,4'-Oxybis(phenyl isocyanate) |
| 41302-32-3 |
ETHYL 5-IODOPENTANOATE |
| 4130-42-1 | 2,6-Di-tert-butyl-4-ethylphenol |
| 4133-35-1 | 6-Bromo-2-tetralone (bisulfite adduct) |
| 41382-23-4 | 6-Methoxy-2,3,3-trimethylindoline |
| 41405-35-0 |
7H-Perfluoroheptanoyl chloride |
| 4141-91-7 |
2-Iodo-1,1,1,3,3,3-hexafluoropropane |
| 41430-70-0 |
Ethyl perfluoroheptanoate |
| 41459-42-1 |
3-Bromo-2-(bromomethyl)propionic acid |
| 41463-83-6 |
3,3,3-Trifluoropropionyl chloride |
| 41484-35-9 | Thiodiethylene bis[3-(3,5-di-tert.-butyl-4-hydroxy- phenyl)propionate] |
| 41489-76-3 | 5-Formyl-2- hydroxybenzoic acid methyl ester |
| 4149-60-4 |
Ammonium perfluorononanoate |
| 41503-61-1 | 5,5'-Diphenyl-3,3',9-triethyloxacarbocyanine ethylsulfate |
| 41532-84-7 | 2,3,3-Trimethyl-3H-benz[e]indol |
| 41536-44-1 |
2-(4-morpholino)phenol |
| 41556-26-7 | Bis(1,2,2,6,6-pentamethyl-4-piperidyl) Sebacate |
| 41605-90-7 |
4-(3-chlorophenyl)morpholine |
| 41667-95-2 |
5,6-Dichloro Nicotinic Acid |
| 41739-23-5 |
1,1-Difluoroacetylacetone |
| 4175-37-5 | Octylated diphenylamine |
| 41771-35-1 |
1-(2-chloroethoxy)-2-ethoxyethane |
| 4180-26-1 |
1H,1H,9H-Perfluorononyl acrylate |
| 4181-05-9 | 4-Diphenylaminobenzaldehyde |
| 4182-80-3 | 1,4-Bis[N,N-bis(4-N,N-din-butylaminophenyl)amino]benzene |
| 4184-79-6 | 5,6-Dimethyl-1H-benzotriazole hydrate |
| 4185-69-7 | 1-(2,4-Dinitrophenyl)pyridinium chloride |
| 41859-57-8 | P-chloro benzoylTyramine |
| 41874-81-1 |
2-Bromotetrafluoropropionyl bromide |
| 4198-90-7 | 4-Cyano-2,6-dimethylphenol |
| 41995-30-6 |
2-Amino-3,5-dimethylpyridine |
| 42019-78-3 |
4-Chloro-4'-hydroxybenzophenone |
| 4202-14-6 |
Dimethyl 2-oxopropylphosphonate |
| 42031-15-2 |
1,1,1,3,3,3-Hexafluoroisopropyl trifluoroacetate |
| 42042-66-0 | N-Isopropyl-4-Hydroxybutyramide |
| 420-90-6 |
3-Bromo-3,3-difluoroprop-1-ene |
| 420-94-0 |
2-Bromo-2,2-difluoroethanol |
| 420-99-5 |
1-Chloro-2,2-difluoropropane |
| 42099-81-0 |
1-Ethoxy-2,3,5,6-tetrafluorobenzene |
| 421-00-1 |
2,2-Difluoropropylaminehydrochloride |
| 421-06-7 |
2-Bromo-1,1,1-trifluoroethane |
| 4214-28-2 |
2,4-DIMETHYL IODO BENZENE |
| 421-45-4 |
Chlorodifluoroacetyl bromide |
| 42145-66-4 |
2-(1,1,2,2-Tetrafluoroethoxy)toluene |
| 421-46-5 |
2-Bromo-1,1,1-trifluoropropane |
| 4214-73-7 |
2-Amino-5-cyanopyridine |
| 4214-74-8 |
3,5-Dichloro-2-aminopyridine |
| 4214-75-9 |
2-Amino-3-nitropyridine |
| 4214-76-0 |
2-Amino-5-nitropyridine |
| 4214-85-1 |
2-Amino-6-methyl-5-nitropyrimidin-4(3H)-one |
| 42149-74-6 | 2-Propoxyethyl chloride |
| 421-49-8 |
2-Amino-1,1,1-trifluoropropane |
| 421-50-1 |
1,1,1-Trifluoroacetone |
| 421-53-4 |
Trifluoroacetaldehyde hydrate |
| 421-70-5 |
1-Bromo-2-iodotetrafluoroethane |
| 42173-52-4 |
2-(Difluoromethoxy)toluene |
| 421-78-3 |
1-Chloro-2-iodotetrafluoroethane |
| 421-83-0 |
Trifluoromethanesulfonyl chloride |
| 421-90-9 |
2,2,3-Tribromo-1,1,1-trifluoropropane |
| 422-01-5 |
3-Bromo-1,1,1,2,2-pentafluoropropane |
| 422-02-6 |
3-Chloro-1,1,1,2,2-pentafluoropropane |
| 422-03-7 |
2,2,3,3,3-Pentafluoropropylamine |
| 422-04-8 |
Pentafluoropropionitrile |
| 422-05-9 |
2,2,3,3,3-Pentafluoropropan-1-ol |
| 422-05-9 | 2,2,3,3,3-Pentafluoro-1-propanol |
| 422-64-0 | Pentafluoropropionic Acid |
| 4221-80-1 | 2,4-Di-tert-butylphenyl 3,5-di-tert-butyl-4-hydroxybenzoate |
| 42221-52-3 |
2,3,4,5-Tetrachlorobenzoyl chloride |
| 422-22-0 |
2-Bromotetrafluoropropionamide |
| 4224-70-8 | 6-bromohexanoic acid |
| 422-59-3 |
Pentafluoropropionyl chloride |
| 422-61-7 |
Pentafluoropropionyl fluoride |
| 422-62-8 |
Pentafluoropropanamidine |
| 422-63-9 |
Pentafluoropropanal hydrate |
| 422-64-0 |
Pentafluoropropionic acid |
| 422-77-5 |
2-Bromoheptafluoropropane |
| 422-85-5 |
1-Bromoheptafluoropropane |
| 422-86-6 |
1-Chloroheptafluoropropane (FC 217A) |
| 42287-85-4 |
Ethyl 7H-perfluoroheptanoate |
| 42288-26-6 |
N-(4-Cyanophenyl)glycine |
| 42289-34-9 |
Potassium 2,3,5,6-tetrafluorophenolate |
| 42298-15-7 |
Potassium (trifluoromethyl)trifluoroborate |
| 4232-66-0 |
4-Chlorotetrafluorophenol |
| 423-31-4 |
1-Chloro-4H-octafluorobutane |
| 423-39-2 |
1-Iodononafluorobutane |
| 423-46-1 |
1H,1H-Perfluorohexan-1-ol |
| 42348-86-7 | 5-Chloroindan-1-one |
| 423-49-4 |
1H,1H-Perfluoroheptylamine |
| 423-50-7 |
Perfluorohexanesulfonyl fluoride |
| 423-53-0 |
1-Chloro-8H-perfluorooctane |
| 423-54-1 |
Perfluorooctanamide |
| 423-55-2 |
1-Bromoperfluorooctane |
| 423-56-3 |
1H,1H-Perfluorononan-1-ol |
| 423-72-3 |
1H,1H,13H-Perfluorotridecan-1-ol |
| 423-95-0 |
9H-Perfluorononanoyl chloride |
| 42415-20-3 |
Trifluoroacetaldehyde dimethyl acetal |
| 4241-66-1 |
4-Iodobenzenesulfonyl fluoride |
| 424-18-0 |
Methyl perfluorohexanoate |
| 4242-18-6 | 5,6,7,8-TETRAHYDRO-1-NAPHTHOIC ACID |
| 424-36-2 |
Ethyl nonafluoropentanoate |
| 424-64-6 |
2,2,3,3,4,4,4-Heptafluorobutyl acrylate |
| 4248-19-5 |
tert-Butyl carbamate |
| 42532-60-5 |
Heptafluoroisobutyronitrile |
| 425-38-7 |
3-(Trifluoromethoxy)tetrafluoropropionyl fluoride |
| 42566-65-4 |
2,2,3,3-Tetrafluoro-3-(trifluoromethoxy)propionic anhydride |
| 425-75-2 |
Ethyl trifluoromethanesulfonate |
| 425-87-6 |
Methyl 2-chloro-1,1,2-trifluoroethyl ether |
| 425-88-7 |
Methyl 1,1,2,2-tetrafluoroethyl ether |
| 426-54-0 |
2-Phenyl-1,1,1-trifluoropropan-2-ol |
| 426-58-4 |
Phenyl trifluoromethylsulfone |
| 426-65-3 | Ethyl Pentafluoropropionate |
| 4263-52-9 | Sodium 2-Bromoethanesulfonate |
| 42711-75-1 | 3-Hydroxyadamantane-1-carboxylic acid |
| 4273-98-7 | 2-Aminodiphenylsulfone |
| 42753-71-9 |
2-Amino-5-bromo-6-methylpyridine |
| 4282-29-5 |
3,4-thiophene dicarboxylic acid |
| 4282-40-0 |
1-Iodo Heptane |
| 42826-42-6 | Pivaloylhydrazide |
| 4284-09-7 |
3-Chloro-2,4,5,6-tetrafluorobenzotrifluoride |
| 4284-10-0 |
3,5-Dichloro-2,4,6-trifluorobenzotrifluoride |
| 42843-94-7 |
2-(ETHOXYCARBONYL)ETHYLTRIPHENYLPHOSPHONIUM BROMIDE |
| 428-59-1 |
Hexafluoropropene oxide |
| 428-63-7 |
2,2-Difluoropropane-1,3-diol |
| 4286-55-9 |
6-bromo-1-hexanol |
| 42872-30-0 | Ketoprofen Nitrile |
| 42874-03-3 |
Oxyfluorfen |
| 42882-31-5 | 1-(1-Naphthyl) Ethylamine |
| 4292-19-7 |
1-IODODODECANE |
| 42951-35-9 | 1-Butyl-2-methyl-1H-indole |
| 42951-39-3 | 2-Methyl-N-octylindole |
| 42986-22-1 | SULPHONATED VINYL SULPHONE PARA BASE |
| 430-51-3 |
Fluoroacetone |
| 430-67-1 |
2,2-Difluoroethylamine |
| 43076-61-5 |
4’-tert-butyl-4-chlorobutyrophenone |
| 431-05-0 |
1,1-Difluoroacetone |
| 431-21-0 |
1,2-Dibromo-3,3,3-trifluoropropane |
| 431-32-3 |
2,3,3,3-Tetrafluoropropionitrile |
| 431-34-5 |
3-Bromo-1,1,1-trifluoropropan-2-ol |
| 431-35-6 |
3-Bromo-1,1,1-trifluoroacetone |
| 431-36-7 |
1,1,1-Trifluorobutan-2-ol |
| 431-38-9 |
3-Amino-1,1,1-trifluoropropan-2-ol |
| 431-40-3 |
1,1,1-Trifluoroacetone oxime |
| 4314-35-6 |
(1Z)-2,2,2-Trifluoro-N'-hydroxyethanimidamide |
| 431-44-7 |
Methyl dichlorofluoroacetate |
| 431-46-9 |
Trifluoroacetaldehyde methyl hemiacetal |
| 431-47-0 |
Methyl trifluoroacetate |
| 431-52-7 |
1,1,2-Trichlorotrifluoroprop-1-ene |
| 4316-73-8 | Sodium Sarcosinate |
| 431-67-4 |
1,1-Dibromo-3,3,3-trifluoroacetone |
| 431-72-1 |
Trifluoropyruvic acid monohydrate |
| 4318-42-7 | N-Isopropyl piperazine |
| 4318-56-3 | 6-chloro-3-methyl uracil |
| 431-86-7 |
1,2-Dichloro-1,1,3,3,3-pentafluoropropane |
| 4318-78-9 |
3,5-Diaminepyridine |
| 431-89-0 |
1,1,1,2,3,3,3-Heptafluoropropane (FC 227ea) |
| 433-06-7 | 2,2,2-Trifluoroethyl p-Toluenesulfonate |
| 433-27-2 |
Trifluoroacetaldehyde ethyl hemiacetal |
| 4333-56-6 | Cyclopropyl bromide |
| 433-53-4 |
Methyl difluoroacetate |
| 434-45-7 |
2,2,2-Trifluoroacetophenone |
| 434-64-0 |
Octafluorotoluene |
| 434-90-2 |
Decafluorobiphenyl |
| 4355-11-7 | 1,1-Cyclohexanediacetic Acid |
| 4360-47-8 | Cinnamyl Nitrile |
| 436799-32-5 |
5-Bromo-2-(trifluoromethyl)pyridine |
| 438056-69-0 | 4-(4-Aminophenyl)morpholin-3-one |
| 4385-05-1 |
4-(2-(dimethylamino)ethyl)morpholine |
| 4389-45-1 |
3-Methylanthranilic acid |
| 4399-47-7 | Cyclobutyl bromide |
| 440-60-8 |
2,3,4,5,6-Pentafluorobenzyl alcohol |
| 4408-78-0 |
Phosphonoacetic acid |
| 4411-25-0 | 1-Adamantyl isocyanate |
| 4412-91-3 |
3-Furanmethanol |
| 4414-88-4 | 2-Benzimidazoleacetonitrile |
| 4415-73-0 |
1,1-bis(hydroxymethyl)cyclobutane |
| 4415-82-1 | Cyclobutanemethanol |
| 4419-11-8 | 2,2'-Azobis(2,4-dimethylvaleronitrile) |
| 4420-74-0 | 3-Mercaptopropyl)trimethoxysilane |
| 4421-08-3 | 3-methoxy-4-hydroxy benzonitrile |
| 4422-95-1 | 1,3,5-Benzenetricarboxylic acid chloride |
| 4424-03-7 | 3,6-Dihydroxy-9-(2-sulfophenyl)xanthylium betaine |
| 4430-45-9 | Octylisothiocyanate |
| 443-26-5 |
Ethyl 2-Fluorobenzoate |
| 4435-53-4 |
3-methoxybutyl acetate |
| 443-83-4 |
2-Chloro-6-Fluorotoluene |
| 4441-12-7 | Tris(4-morpholino)phosphine oxid |
| 445-03-4 |
2-Amino-5-Chlorobenzotrifluoride |
| 44507-93-9 |
Iododifluoroacetyl fluoride |
| 445264-61-9 |
2-Methoxypyridine-5-boronic acid pinacol ester |
| 445-27-2 |
2’-fluoroacetophenone |
| 445-28-3 |
2-Fluorobenzamide |
| 445-29-4 |
2-Fluorobenzoic acid |
| 4454-05-1 | 2-Methoxy-3,4-dihydro-2H-pyran |
| 445409-27-8 | Reaction product of N,N-bis(hydroxyethyl) coco-amides, coco-monoglycerides and molybdenum trioxide |
| 4457-32-3 | p-Nitrobenzyl chloroformate |
| 4457-71-0 | 3-Methyl-1,5-Pentanediol |
| 4459-18-1 |
Perfluoro-tert-butyl iodide |
| 446-10-6 | 4-Fluoro-2-nitrotoluene |
| 446-35-5 |
2,4-Difluoronitrobenzene |
| 446-52-6 |
2-Fluorobenzaldehyde |
| 4487-50-7 |
2-Amino-4-nitropyridine |
| 4487-59-6 |
2-Bromo-5-nitropyridine |
| 44925-09-9 |
2,2,2-Trichloroethyl acrylate |
| 4500-12-3 |
2-Adamantanone Oxime |
| 45101-66-4 |
6-chlorohexyl methacrylate |
| 45102-52-1 |
2,2,3,3-Tetrafluoropropyl methacrylate |
| 45115-53-5 |
2,2,3,3,3-Pentafluoropropyl methacrylate |
| 451-40-1 | 2 Phenyl Acetophenone (Deoxybenzoin) |
| 451-82-1 | 2-Fluorophenylacetic acid |
| 45102-52-1 | 2,2,3,3-Tetrafluoropropyl methacrylate |
| 45103-58-0 | Diethylene Glycol Monomethyl Ether Methacrylate |
| 4519-40-8 |
2,3-Difluorobenzenamine |
| 4522-93-4 |
Ethyl pentafluorobenzoate |
| 452-58-4 |
2,3-Diaminopyridine |
| 452-86-8 | 4-Methyl Catechol |
| 453-11-2 |
1-Chloro-3-fluoropropan-2-ol |
| 453-13-4 |
1,3-Difluoropropan-2-ol |
| 4531-49-1 | Pigment Yellow 17 |
| 453-34-9 |
3-Hydroxy-4,4,4-trifluorobutyramide |
| 453-35-0 |
3-Nitro-1,1,1-trifluoropropan-2-ol |
| 4534-73-0 | 1,2,3,4-Butanetetracarboxylic dianhydride |
| 4534-74-1 |
4-Ethylcyclohexanol |
| 454-31-9 |
Ethyl difluoroacetate |
| 4546-04-7 |
Tetraethyl p-xylylenediphosphonate |
| 454-63-7 |
3-(Trifluoromethyl)cyclohexanol,cis/trans |
| 454-89-7 |
3-(Trifluoromethyl)benzaldehyde |
| 4549-31-9 | 1,7-Dibromoheptane |
| 4549-32-0 | 1,8-dibromooctane |
| 455-13-0 |
4-IODOBENZOTRIFLUORIDE |
| 455-19-6 |
4-(Trifluoromethyl)benzaldehyde |
| 455-32-3 |
Benzoyl fluoride |
| 45534-08-5 | 3-Amino-5-methylthio-1,2,4-triazole |
| 455-38-9 |
3-Fluorobenzoic acid |
| 456-22-4 |
4-Fluorobenzoic acid |
| 456-42-8 |
3-Fluorobenzyl Chloride |
| 45644-21-1 |
2-Amino-6-chloropyridine |
| 456-48-4 |
3-fluorobenzaldehyde |
| 456-49-5 |
3-fluoroanisole |
| 456-55-3 |
(Trifluoromethoxy)benzene |
| 4567-98-0 |
Dimethyl Undecanedioate |
| 4570-41-6 | 2-Aminobenzoxazole |
| 458-37-7 |
Curcumin |
| 4584-46-7 | 2-Dimethylaminoethyl chloride hydrochloride |
| 4584-49-0 | 2-Dimethylaminoisopropyl chloride hydrochloride |
| 458-92-4 |
(Difluoromethoxy)benzene |
| 459-22-3 | 4-Fluorophenylacetonitrile |
| 459-57-4 | 4-Fluorbenzaldehyd |
| 459-59-6 |
4-Fluoro-N-methylaniline |
| 460-00-4 | 4-bromofluorobenzene |
| 46004-37-9 |
Methyl 2-chloro-4-aminobenzoate |
| 460-25-3 |
1,3-Dibromo-1,1-difluoropropane |
| 460-32-2 |
1-Bromo-3,3,3-trifluoropropane |
| 460-34-4 |
1,1,1-Trifluorobutane |
| 460-35-5 |
3-Chloro-1,1,1-trifluoropropane |
| 460-37-7 |
1-Iodo-3,3,3-trifluoropropane |
| 460-39-9 |
3,3,3-Trifluoropropylamine |
| 460-40-2 |
3,3,3-Trifluoropropanal |
| 4606-07-9 | Ethyl cyclopropanecarboxylate |
| 461-01-8 |
2-Chloro-1,4-dibromo-1,1,2-trifluorodecane |
| 461-17-6 |
1-Iodo-4,4,4-trifluorobutane |
| 461-18-7 |
4,4,4-Trifluorobutan-1-ol |
| 461-34-7 |
4,4,4-Trifluorobutyramide |
| 461-58-5 | Dicyandiamide |
| 461432-22-4 | (5-bromo-2-chlorophenyl)(4-ethoxyphenyl)methanone |
| 461432-23-5 | 5-bromo-2-chloro-4-ethoxydiphenylmethane |
| 461-82-5 |
4-Trifluoromethoxyaniline |
| 461-92-7 |
6-Methyl-1,1,1-trifluoroheptane-2,4-dione |
| 4620-70-6 |
N-tert-butylethanolamine |
| 462-08-8 |
3-Aminopyridine |
| 462-94-2 | 1,5-Diaminopentane |
| 462093-29-4 | 1,1'-Dibutyl-3,3,3',3'-tetramethylindadicarbocyanine hexafluorophosphate |
| 462-26-0 |
2-fluoro-1-ethanol acetate |
| 462-38-4 |
1-fluoro-3-chloropropane |
| 462-40-8 |
1-fluoro-3-iodopropane |
| 462-72-6 |
1-fluoro-4-bromobutane |
| 462-73-7 |
1-fluoro-4-chlorobutane |
| 4628-44-8 |
11-Fluorosulfonylperfluoro(2,5,8-trimethyl-3,6,9-trioxaundecanoyl) fluoride |
| 463-04-7 | Pentyl nitrit (amyl nitrit) |
| 463-11-6 |
1-Fluorooctane |
| 463-18-3 |
1-Fluorononane |
| 463-23-0 |
1-fluoro-9-chlorononane |
| 4635-59-0 | 4-Chlorobutyryl Chloride |
| 4641-57-0 | N-Phenyl-2-pyrrolidone |
| 4659-45-4 |
2,6-Dichlorobenzoyl Chloride |
| 466-37-5 |
2,2,2-TRIPHENYLACETOPHENONE |
| 467-63-0 | SOLVENT VIOLET 9 |
| 46834-56-4 | (-)-4'-Chlorotartranilic Acid |
| 4692-98-2 | 5-Bromoisatoic anhydride |
| 4694-91-1 | Nitrobenzoxazolone |
| 4707-23-7 |
Methyl 4-bromo-2,3,5,6-tetrafluorobenzoate |
| 4707-24-8 |
4-Bromo-2,3,5,6-tetrafluorobenzoic acid |
| 470-82-6 | Eucalyptol |
| 4714-67-4 | 4-Aminothiobenzamide |
| 4731-65-1 |
Tris(2-methoxyphenyl)phosphine |
| 4736-60-1 | Ethyltriphenylphosphonium iodide |
| 4737-41-1 |
1-chloro-2-ethylbutane |
| 4743-17-3 | 5-Chloroisatonic anhydride |
| 4746-97-8 | 1,4-Cyclohexanedione monoketal |
| 4753-59-7 | 4-Bromobutylacetate |
| 4755-50-4 | 4-Dimethylaminobenzoyl chloride |
| 476-60-8 |
Leucoquinizarin |
| 476639-90-4 |
Potassium (pentafluoroethyl)trifluoroborate |
| 4769-96-4 | 6-Nitroindole |
| 4769-97-5 | 4-Nitroindole |
| 4771-80-6 | 3-Cyclohexene-1-carboxylic acid |
| 477529-73-0 |
8-Iodo-3,3,4,4,5,5,6,6,7,7,8,8-dodecafluorooct-1-ene |
| 477557-80-5 | 4-Ethenyl-4' -propyl-1, 1' - bi cvclbhexyl |
| 477720-56-2 | 1-butoxy-2, 3-difluoro-4- (4-vinylcyclohexyl) benzene |
| 477788-45-7 | 1-(3-Aminophenyl)-5-mercaptotetrazole triethylammonium salt |
| 47823-88-1 | 9,9-Bis[4-(Aminophenoxy)phenyl]Fluorene |
| 4784-02-5 | 2,3-Dihydroxy-6,7-dimethoxyquinoxaline |
| 479094-62-7 |
Di-tert-butylmethylphosphine tetrafluoroborate salt |
| 4792-67-0 | 5-Chloroindole-2-carboxylic acid ethylester |
| 479-27-6 |
1,8-Diaminonaphthalene |
| 479633-63-1 | 4-Chloro-7-(p-toluenesulfonyl)-7H-pyrrolo[2,3-d]pyrimidine] |
| 4798-44-1 | 1-Hexen-3-ol |
| 48074-47-1 |
Vinylidene-1,1-diphosphonic acid, tetraisopropylester |
| 48076-44-4 |
1H,1H-Perfluoroheptyl methacrylate |
| 4813-57-4 |
Octadecyl acrylate |
| 48145-04-6 | Phenoxyethyl acrylate |
| 482-05-3 | Biphenyl-2,2-dicarboxylic acid |
| 4837-90-5 | 4-Methoxyindole |
| 484-17-3 |
9-Phenanthrol |
| 4848-43-5 |
2-(Diphenylphosphino)ethylamine |
| 4857-04-9 | 2-(Chloromethyl)-1H-benzimidazole |
| 4857-06-1 | 2-Chlorobenzimidazole |
| 4857-47-0 |
1,2-Naphthoxydiazole-4-sulfonic acid |
| 4860-03-1 |
1-chlorohexadecane |
| 486-73-7 | 1-Isoquinolinecarboxylic acid |
| 4865-84-3 | 1,2-Benzisoxazole-3-acetic acid |
| 487-89-8 | 3-Indolecarboxaldehyde |
| 488-23-3 | 1,2,3,4-Tetramethylbenzene |
| 4887-80-3 | 5-Methoxybenzimidazole |
| 4887-81-4 | 5-Methoxy-2-methylbenzimidazole |
| 4887-82-5 | 5-Chlorobenzimidazole |
| 488-93-7 |
3-Furioc Acid |
| 4897-84-1 |
Methyl 4-bromobutyrate |
| 490-11-9 | 3,4-pyridine dicarboxylic acid |
| 4910-40-1 |
4-Methoxy-2,3,5,6-tetrafluorobenzyl bromide |
| 491-37-2 | 4-Chromanone |
| 492-16-0 |
2-Phenyl-2-(trifluoroacetyl)acetonitrile |
| 492-37-5 | 2-Phenylpropionic Acid |
| 4926-28-7 |
2-Bromo-4-methylpyridine |
| 492-70-6 | Hydrobenzoin |
| 4926-55-0 | N-(2-Hydroxyethyl)-2-nitroaniline |
| 4928-88-5 | 1,2,4-Triazole-3-Carboxylic Acid Methylester |
| 492-97-7 |
2,2'-Bithiophene |
| 4930-98-7 | 2-Hydrazinopyridine |
| 4942-47-6 |
1-Adamantane Acetic Acid |
| 494762-23-1 | 1-Butyl-2-[2-[3-[2-(1-butyl-1,3-dihydro-3,3dimethyl-2H-indol-2-ylidene) ethylidene]-2(1H-1,2,4-triazol-1-yl)-1-cyclohexen-1yl]ethenyl]-3,3-dimethyl-3H-indolium tetrafluoroborate |
| 495-54-5 | SOLVENT ORANGE 3 |
| 49608-01-7 |
6-Chloro Nicotinic Acid Ethyl Ester |
| 496-11-7 | Indane |
| 496-15-1 | Indoline |
| 4965-33-7 | 7-Chloroquinaldine |
| 49663-94-7 | 1-Benzyl-1,8-diazabicyclo[5.4.0]undec-7-enium chloride |
| 496-72-0 |
3,4-DIAMINOTOLUENE |
| 497-18-7 | Carbohydrazide |
| 4979-32-2 | N,N-dicyclohexyl-2-benothiazole sulfenamide |
| 498-81-7 | Dihydro Terpineol |
| 498-94-2 |
Iso Nipecotic Acid |
| 498-95-3 |
Nipecotic Acid |
| 499-02-5 | 3-Methylene-cyclopropane-trans-1,2-dicarboxylic acid |
| 499-44-5 | Hinokitiol |
| 499-75-2 | Carvacrol |
| 4998-38-3 |
1H,1H,11H-Perfluoroundecyl acrylate |
| CAS NO | Product Name |
| 500-05-0 |
Coumalic Acid |
| 5001-18-3 |
1,3-Adamantanediol |
| 500-22-1 |
3-Pyridinecarboxaldehyde |
| 5006-22-4 | Cyclobutanecarbonyl chloride |
| 5006-62-2 |
Ethyl Nipecotate |
| 500-73-2 |
Phenyl trifluoroacetate |
| 501-00-8 |
3-Fluorobenzyl cyanide |
| 501-53-1 | Benzyl chloroformate |
| 501-94-0 | 4-(2-hydroxyethyl)phenol |
| 501-94-0 | 2-(4-Hydroxyphenyl)ethanol |
| 501-97-3 |
p-Hydroxyphenyl-propionic acid |
| 502161-03-7 |
3 Iodo N Phenyl Carbazole |
| 502-42-1 | Cycloheptanone |
| 5024-21-5 |
Dimethyl Tetradecanedioate |
| 502453-61-4 | HC BLUE 16 |
| 5026-62-0 | Benzoic acid, 4-hydroxy-, methyl ester, sodium salt |
| 5029-67-4 |
2-Iodopyridine |
| 503-09-3 |
Epifluorohydrin |
| 503155-88-24 |
3H-Heptafluoropentane-2,4-dione dihydrate |
| 5032-93-9 |
Bis(pentafluorophenyl)hydroxyphosphine |
| 503-60-6 | 1-Chloro-3-methyl-2-butene |
| 50358-63-9 | 6-Amino-5-bromoquinoxaline |
| 50378-83-1 | 1,3'-Diethyl-5',6-dimethoxy-2,2'-quinaselenacyanine iodide |
| 503821-94-1 |
3-BROMO-2-IODOBENZOIC ACID |
| 504-02-9 |
1,3-Cyclohexanedione |
| 50419-58-4 | 3,4-Dimethylanthranilic acid |
| 504-24-5 |
4-Aminopyridine |
| 504-29-0 |
2-Aminopyridine |
| 505-48-6 | 1,8-Suberic Acid |
| 50530-12-6 | 10-Bromodecanoic Acid |
| 50530-45-5 | 1,3,4-Thiadiazolidine-2,5-dithione, sodium salt (1:1)F |
| 505-52-2 |
Brassylic Acid |
| 505-54-4 |
Hexadecandioic acid |
| 5056-17-7 |
2,7-Dimethyl-2,4,6-octariene dial |
| 505-66-8 |
Homopiperazine |
| 50594-82-6 |
3,4,5-Trichlorobenzotrifluoride |
| 50601-47-3 |
2,2,2-Trichloroethyl methacrylate |
| 50650-59-4 |
2-Hydroxy-4-(trifluoromethyl)pyridine |
| 506-96-7 | Acetyl Bromide |
| 50662-95-8 | 2,3,3',4'-Diphenylether tetracarboxylicdianhydride |
| 50663-19-9 | 1,3-Dimethyl-5-[2-(3-methyl-2-thiazolidinylidene)ethylidene]-2-thioxoimidazolidin-4-one |
| 507-19-7 | 2-bromo-2-methylpropane |
| 507-20-0 | 2-Chloro-2-methylpropane |
| 50720-12-2 |
3-Bromo-5-Methoxypyridine |
| 50733-66-9 |
Dimethyl perfluoro-2-methyl-3-oxahexane-1,6-dioate |
| 50733-67-0 |
Dimethyl perfluoro-2,8-dimethyl-3,7-dioxanonane-1,9-dioate |
| 5074-71-5 |
Bis(pentafluorophenyl)phenylphosphine |
| 507485-96-3 |
1-Acetyl-3(5)-difluoromethyl-5(3)-phenylpyrazole |
| 507-52-8 |
2-(Trifluoromethyl)propan-2-ol |
| 507-63-1 |
1-Iodoperfluorooctane |
| 50777-76-9 |
o-Diphenylphosphinobenzaldehyde |
| 50807-74-4 |
2,2,3,3,3-Pentafluoropropyl 1,1,2,2-tetrafluoroethyl ether |
| 50816-19-8 |
8-bromo-1-octanol |
| 50820-65-0 | Methyl indole-6-carboxylate |
| 50824-05-0 | 4-trifluoromethoxybenzyl bromide |
| 50838-66-9 |
(4H-Octafluorobutyl)trifluorooxirane |
| 50838-67-0 |
(2-Chlorotetrafluoroethyl)trifluorooxirane |
| 50838-69-2 |
(4-Chlorooctafluorobutyl)trifluorooxirane |
| 5084-13-9 | N-(2-Tetradecyloxyphenyl)-4-(1-phenyl-5-tetrazolyl)thio-1-hydroxy-2-naphthamide |
| 50889-46-8 |
Dimethyl (2-oxo-3,3-difluoroheptyl)phosphonate |
| 50889-47-9 |
METHYL 2,2-DIFLUOROHEXANOATE |
| 5089-22-5 | 1,4-Bis-benzoxazolyl-naphthalene |
| 5089-76-9 |
Tetra-sec-butoxysilane |
| 50910-55-9 |
2 Amino 3,5 dibromo benzaldehyde |
| 509-34-2 | SOLVENT RED 49 |
| 51010-74-3 |
Morpholinosulphurtrifluoride |
| 510768-12-4 |
3(5)-Perfluorohexyl-5(3)-phenylpyrazole |
| 510768-14-6 |
4,5,5,5-Tetrafluoro-2-iodo-4-(trifluoromethoxy)pentan-1-ol |
| 51114-12-6 |
1,4-Bis(heptafluoroisopropyl)benzene |
| 511243-92-8 |
1-Acetyl-3(5)-nonafluorobutyl-5(3)-phenylpyrazole |
| 511243-93-9 |
1-Acetyl-3(5)-perfluorohexyl-5(3)-phenylpyrazole |
| 511243-94-0 |
1-Acetyl-3(5)-perfluorooctyl-5(3)-phenylpyrazole |
| 511292-99-2 |
(tert-Butylimido)tris(ethylmethylamino)tantalum |
| 51-17-2 | Benzimidazole |
| 51-21-8 | 5-Fluorouracil |
| 5121-90-4 |
2H,2H'-Octafluorobiphenyl |
| 5122-16-7 |
(Bromoacetyl)pentafluorobenzene |
| 51249-62-8 |
1,2-Dibromo-1H,1H,2H-perfluorooctane |
| 51249-63-9 |
1,2-Dibromo-1H,1H,2H-perfluorodecane |
| 51249-64-0 |
2-Bromo-1H,1H-perfluorooct-1-ene |
| 51249-65-1 |
2-Bromo-1H,1H-perfluorodec-1-ene |
| 512-51-6 |
Ethyl1,1,2,2-tetrafluoroethylether |
| 512-56-1 |
TRIMETHYL PHOSPHATE |
| 51-28-5 | 2,4-Dinitrophenol |
| 51294-16-7 |
Perfluoro(methyldecalin) (mixture of isomers) |
| 51308-99-7 |
9-Chloro-1-nonanol |
| 51309-10-5 |
10-chloro-1-decanol |
| 51309-11-6 |
10-chloro-1-decanol acetate |
| 513-36-0 |
Chloroisobutane |
| 51336-95-9 |
2-chloro-1-(3,4-difluorophenyl)ethanone |
| 513-38-2 |
Isobutyl Iodide |
| 513-48-4 |
2-IODOBUTANE or sec-BUTYL IODIDE |
| 51498-37-4 |
4-Hydroxypyridine-3-sulfonic acid |
| 51502-45-5 |
Methyl perfluorononanoate |
| 51526-03-5 |
1,7-diiodoheptane |
| 51579-56-7 |
Perfluorocyclohexanecarbonitrile |
| 516-12-1 |
N-Iodosuccinimide |
| 51-67-2 | 4-hydroxy phenylethylamine (Tyramine) |
| 5102-83-0 | Pigment Yellow 13 |
| 510774-77-3 | Perfluoro-2,5-dimethyl-3,6-dioxaheptanoic acid Ammonium Salt |
| 510774-79-5 | Perfluoro-2,5-dimethyl-3,6-dioxaoctanoic acid Ammonium Salt |
| 5108-96-3 | Ammonium pyrrolidinodithiocarboxylate |
| 51146-56-6 | Dexibuprofen |
| 5117-07-7 | 5,5'-Dithio-bis(1-phenyltetrazole) |
| 512-26-5 | Lead Citrate |
| 51257-37-5 | 4,5-Diphenyl-3-ethyl-2-{3-ehtyl-5-[2-(1-ethyl-4-quinolinylidene)ethylidene]-4-oxo-2-thiazolidinylidene}methylthiazolium bromide |
| 5131-58-8 | 4-Nitro-m-phenylene diamine |
| 5131-60-2 | 4-Chloro-m-phenylene diamine |
| 51368-55-9 | isopropyl 2-bromo-2-methylpropionate |
| 51437-32-2 | 5,6-Dimethoxy-2-methylbenzimidazole |
| 5146-66-7 | Geranyl Nitrile |
| 5153-25-3 | 2-Ethylhexyl 4-hydroxybenzoate |
| 51566-62-2 | Citronellyl Nitrile |
| 516-05-2 | Methylmalonic acid |
| 5160-02-1 | Pigment Red 53:1 |
| 5164-76-1 | Diemthyl glutaconate |
| 5172-06-5 |
1-Chloro-2,3,4,6-tetrafluorobenzene |
| 517-23-7 |
2-Acetylbutyrolactone |
| 51755-83-0 | 3-Mercapto-1-hexanol |
| 51772-35-1 | N-[(1,1,3,3-tetramethylbutyl)phenyl]naphthalen-1-amine |
| 51776-71-7 |
Benzene, 1-bromo-4-(difluoromethyl)- |
| 51851-37-7 | Triethoxy-1H,1H,2H,2H-tridecafluoro-n-octylsilane |
| 51858-17-4 | 1,1'-Bis(4-sulfophenyl)-3,3'-dicarboxy-5,5'dihydroxypyrazolo-4,4'-pentamethineoxonole dipotassium salt |
| 518-67-2 |
Dimidium bromide |
| 51899-44-2 | n-Octylferrocene |
| 5192-03-0 | 5-Aminoindole |
| 51934-41-9 | Ethyl 4-iodobenzoate |
| 51963-82-7 | 4-(4-Amino-2,5-diethoxyphenyl)morpholine |
| 519-73-3 |
Tri phenyl Methane |
| 5197-62-6 | 2-[2-(2-chloroethoxy)ethoxy]-ethanol |
| 5200-38-4 |
Ethyl 2,2,3,4,4,4-hexafluorobutyrate |
| 5202-85-7 |
5-Chloroanthranilamide |
| 5202-89-1 |
Methyl 2-amino-5-chlorobenzoate |
| 52092-47-4 |
2-Nitro-5-chloropyridine |
| 521-31-3 | 3-Aminophthalhydrazide |
| 5216-17-1 |
2,3,5,6-Tetrafluorobenzonitrile |
| 5216-22-8 |
2,3,5,6-Tetrafluoro-4-(trifluoromethyl)benzoic acid |
| 5216-25-1 |
4-Chlorobenzotrichloride |
| 52191-15-8 |
4-(2-bromoethoxy)benzaldehyde |
| 52200-48-3 |
2-Chloro-3-bromopyridine |
| 52218-35-6 |
6-Hydroxyethylsulfonyl-2-naphthalamine |
| 5223-06-3 | 5-Ethyl-2-pyridineethanol |
| 5230-78-4 |
2,3,5,6-Tetrafluorotoluene |
| 52328-77-5 |
1-Bromo-2-(1,1,2,3,3,3-hexafluoropropoxy)benzene |
| 52328-78-6 |
1-Bromo-4-(1,1,2,3,3,3-hexafluoropropoxy)benzene |
| 5232-99-5 | Ethyl diphenylmethylenecyanoacetate |
| 52328-05-9 | O-Methylisourea Hemisulfate |
| 52351-75-4 |
6-Methoxyisatin |
| 5243-24-3 |
1-Iodo-2,3,5,6-tetrafluorobenzene |
| 524-42-5 | 1,2-naphthoquinone |
| 52415-29-9 | 6-Bromoindole |
| 5242-49-9 | 4-(2-Benzoxazolyl)-4'-(5-methyl-2-benzoxazolyl)stilben |
| 52431-78-4 | 1-(4-Hydroxyphenyl)-5-mercaptotetrazole |
| 52447-22-0 |
Perfluoroheptanoyl chloride |
| 52447-23-1 |
Perfluorononanoyl chloride |
| 52462-29-0 | Dichloro(p-cymene)ruthenium(II) dimer |
| 52488-36-5 | 4-Bromoindole |
| 525-05-3 | Nitrozo–R-salt |
| 52509-14-5 |
(1,3-Dioxolane-2-ylmethyl)triphenylphosphoniumbromide |
| 52525-52-7 | 5,5'-Dimethyl-9-ethyl-3-(2-hydroxyethyl)-3'-(3-sulfopropyl)thiacarbocyanine betaine |
| 52525-55-0 | 3-Ethyl-9-methyl-3'-(3sulfatobutyl)thiacarbocyanine betaine |
| 5253-02-1 | alpha-Ethyl-m-nitrocinnamic acid |
| 52548-14-8 |
2-Iodo-5-methyl benzoic acid |
| 52589-39-6 | 4-Methyl Catechol Diacetic Acid Dimethyl Ester |
| 52591-27-2 |
1H,1H,2H,2H-Nonafluorohexyl acrylate |
| 5259-98-3 |
5-chloro-1-pentanol |
| 52605-52-4 |
1-(3-chlorophenyl)-4-(3-chloropropyl)piperazine hydrochloride |
| 526223-11-0 |
3-Iodo-5,5,6,6,6-pentafluorohexan-1-ol |
| 52648-04-1 | 1-Bromo-6-methylheptane |
| 52671-64-4 | 3-Chloro-4-aminophenol hydrochloride |
| 52671-70-2 |
4-Bromo-1,1,1,2,2-pentafluorobutane |
| 526-75-0 |
2,3-dimethyl-Phenol |
| 52688-08-1 | 2-Octyl Cyanoacetate |
| 52688-11-6 | Cyclohexyl Cyanoacetate |
| 527-21-9 |
Tetrafluoro-1,4-benzoquinone |
| 527-62-8 | 4,6-Dichloro-2-amino phenol |
| 527-69-5 |
2-Furoyl chloride |
| 527-72-0 | thiophene-2-carboxylic acid |
| 5271-67-0 | thiophene-2-carboxylic acid chloride |
| 52736-71-7 | 6,7-Dichloro-2,3-dimethylquinoxaline |
| 52749-17-4 | 3-Carboxymethyl-3',9-diethyl-5,5'dimethylthiacarbocyanine betaine |
| 527751-45-7 |
1-Bromo-3-(1,1,2,2-tetrafluoroethoxy)benzene |
| 5280-68-2 | Pigment Red 146 |
| 52805-46-6 | 3-hydroxy-4-methoxy benzonitrile |
| 52807-27-9 | 4-Chloro-2-iodoanisole |
| 52808-36-3 |
1-(2-chloroethoxy)-2-methoxyethane |
| 5281-04-9 | Pigment Red 57:1 |
| 52829-07-9 | Bis(2,2,6,6-tetramethyl-4-piperidyl) Sebacate |
| 5285-60-9 |
4,4’-METHYLENEBIS[N-SEC-BUTYLANILINE] |
| 529-28-2 | 2-lodoanisole |
| 529-34-0 | Alpha-Tetralone |
| 52918-53-9 | N-{2-Chloro-5-[4-(2,4-di-tert.pentylphenoxy)butyramido]phenyl}-2-(4-carboxyphenoxy)pivaloylacetamide |
| 5292-43-3 | Tert Butyl bromoacetate |
| 5292-45-5 | 2-Nitro Dimethyl terephthalate |
| 5294-61-1 | Ranolazine Intermediates |
| 52997-43-0 | 7-bromomethylpentadecane |
| 53001-68-6 |
Methyl 2,3,4,6-tetrafluorobenzoate |
| 53001-69-7 |
Methyl 3-bromo-2,4,5,6-tetrafluorobenzoate |
| 53001-71-1 |
2,3,4,5-Tetrafluorobenzyl bromide |
| 53001-73-3 |
2,3,5,6-Tetrafluorobenzyl bromide |
| 53005-42-8 |
2-(1,1,2,3,3,3-Hexafluoropropyl)tetrahydrofuran |
| 53038-41-8 |
Hexafluoro-2-methylisopropyl acrylate |
| 53064-79-2 |
IODOMETHYL PIVALATE |
| 5307-14-2 | 2-Nitro-p-phenylenediamine |
| 53072-18-7 |
2,3,4,5-Tetrafluorobenzyl alcohol |
| 53075-09-5 |
N,N,N-Trimethyl-1-Adamantyl Ammonium Hydroxide |
| 5315-25-3 |
2-Bromo-6-methylpyridine |
| 531-91-9 | N,N'-Diphenylbenzidine |
| 5314-37-4 | 4,4´-Biphenyldisulphonic acid |
| 532-02-5 | Sodium 2-Naphthalenesulfonate |
| 532-28-5 | Mandelonitrile |
| 532-32-1 |
Sodium Benzoate |
| 5326-23-8 |
6-Chloro Nicotinic Acid |
| 532-82-1 | BASIC ORANGE 2 |
| 5328-01-8 | 1-Ethoxynaphthalene |
| 5328-37-0 | L-arabinose (plant origin) |
| 53295-44-6 | 5,6-Dimethoxy-1-indanone-2-ethyl carbonate |
| 533-58-4 | 2-Iodophenol |
| 533-68-6 | Ethyl-2-bromobutyrate |
| 533-75-5 | Tropolone |
| 5332-06-9 | 4-Bromobutyronitril |
| 5332-24-1 | 3-Bromoquinoline |
| 53330-94-2 | 5-Acetylindole |
| 53392-78-2 |
1,1,1-Trifluorohept-2-ene |
| 53392-87-3 |
1,1,1-Trifluorohex-2-ene |
| 534-03-2 |
2-amino-1,3-propanediol |
| 5344-27-4 |
4-(2-hydroxyethyl)pyridine |
| 5344-90-1 |
2-Aminobenzylalcohol |
| 534-52-1 | 2-Methyl-4,6-Dinitrophenol |
| 53408-94-9 | Tin (II) methanesulfonate |
| 5343-92-0 | 1,2-Pentanediol |
| 53449-14-2 | 6-Nitro-7-Chloro-4-Hyroxy quinazoline |
| 53463-68-6 |
10-bromo-1-decanol |
| 5348-42-5 | 4,5-Dichloro-1,2-phenylenediamine |
| 53484-15-4 | 5-Bromo-1-Methyl-1H-1,3-Benzodiazole |
| 5349-17-7 |
4-Bromoacetylpyridine hbr |
| 5350-57-2 |
Benzophenone hydrazone |
| 5350-93-6 |
5-Amino-2-chloropyridine |
| 53510-12-6 |
2,3-Dichloro-2-fluoropropionyl chloride |
| 535-11-5 |
Ethyl 2-bromopropionate |
| 5351-23-5 | 4-Hydroxybenzhydrazide |
| 5351-51-9 | 4,5-Dimethylthiazole-2-thione |
| 53575-08-9 |
Diethyl 1-naphthylmethylphosphonate |
| 53580-21-5 |
1-Phenyl-2H,2H-perfluorohexane-1,3-dione |
| 535-87-5 |
3,5-Diaminobenzoic acid |
| 53596-81-9 |
8-bromo-1-octanol acetate |
| 53596-82-0 |
9-bromo-1-nonanol acetate |
| 5360-80-5 |
3-Bromo-2,4,5,6-tetrafluorobenzotrifluoride |
| 5360-81-6 |
3-Chloro-2,4,5,6-tetrafluorobenzoic acid |
| 5360-82-7 |
2,3,4,6-Tetrafluorobenzotrifluoride |
| 536-17-4 | 5-(4-Dimethylaminobenzylidene) rhodanine |
| 53638-10-1 |
6-Iodo-5H,5H,6H-perfluorodecane |
| 536-38-9 |
4-Chlorophenacyl Bromide |
| 5366-84-7 |
6-Nitro-1,2,4 Diazo Acid |
| 536-80-1 |
IODOSOBENZENE |
| 53710-78-4 |
1-(3-chloropropyl)imidazole |
| 537-91-7 | Bis(3-nitrophenyl)disulfide |
| 5372-81-6 | Dimethyl 2-aminoterephthalate |
| 53761-50-5 | 1-Ethyl-2-quinolone |
| 538-75-0 | N,N’-Dicyclohexylcarbodiimide |
| 53880-86-7 | Dimethyldiphenylthioperoxydicarbamic acid |
| 53902-12-8 |
Tranilast |
| 53939-30-3 |
5-Bromo-2-chloropyridine |
| 539-74-2 | Ethyl-3-bromopropionate |
| 5392-40-5 | Citral |
| 5395-70-0 | N-Methylbenzene-1,4-DiamineDihydrochloride |
| 53967-21-8 | 6-(Bromomethyl)quinoxaline |
| 5398-36-7 | Ethyl 2-Aminothiazole-4-Carboxylate |
| 5398-44-7 |
2,6-DICHLOROISONICOTINIC ACID |
| 53988-10-6 | 2-Mercaptomethyl benzimidazole |
| 53997-99-2 |
3-(1,1,2,2-Tetrafluoroethoxy)phenol |
| 53998-00-8 |
2-(1,1,2,3,3,3-Hexafluoropropoxy)phenol |
| 540-37-4 |
4-IODOANILINE |
| 540-38-5 |
4-Iodophenol |
| 540-51-2 |
2-bromo-1-ethanol |
| 54052-90-3 |
2,2,3,4,4,4-Hexafluorobutyl acrylate |
| 540-72-7 | Sodium Thiocyanate |
| 5401-62-7 | 1,2-dibromocyclohexane |
| 5401-94-5 | 5-Nitroindazole |
| 5402-55-1 | thiophene-2-ethanol |
| 54060-30-9 | 3-Aminophenylacetylene |
| 540-87-4 |
3-Iodo-1,1,1-trifluorobutane |
| 5409-39-2 |
2-Amino-3-nitro-5-chloropyridine |
| 54127-63-8 |
5-Chloro-6-Hydroxynicotinic Acid |
| 5414-19-7 |
2,2'-dibromodiethyl ether |
| 541-53-7 | 2,4-Dithiobiuret |
| 54132-75-1 | 3,5-Dimethylphenyl isocyanate |
| 5416-80-8 | 2-Methyl-3-indolecarboxaldehyde |
| 541-73-1 |
541-73-1 |
| 5418-51-9 |
2-Hydroxy-5-nitropyridine |
| 5418-63-3 | 1,2,3,3-Tetramethyl-3H-indoliumiodid |
| 542-05-2 | 1,3-Acetonedicarboxylic acid |
| 542-05-2 | 1,3-Acetonedicarboxylic acid |
| 54-20-6 |
5-(Trifluoromethyl)uracil |
| 54-21-7 |
Sodium Salicylate |
| 542-18-7 | Chlorocyclohexane |
| 542-28-9 | δ-valerolactone |
| 54231-33-3 |
2-Nitro-3-bromopyridine |
| 542-58-5 |
2-Chloroethyl acetate |
| 542-69-8 |
Butyl Iodide |
| 543-49-7 |
2-Heptanol |
| 543-59-9 |
1-chloropentane |
| 5437-45-6 |
Benzyl bromoacetate |
| 54389-98-9 | 4,5:4',5'-Dibenzo-1,1',3,3,3',3'-hexamethylindadicarbocyanine perchlorate |
| 54396-44-0 |
2-Methyl-3-(Trifluoromethyl)aniline |
| 544-10-5 |
1-chlorohexane |
| 544-17-2 |
Calcium formate |
| 5445-17-0 |
Methyl 2-bromopropionate |
| 5445-19-2 | Methyl 2-bromohexanoate |
| 5445-51-2 | Cyclobutane-1,1-dicarboxylic acid |
| 54458-61-6 |
2,3,4,5-tetramethylcyclopentenone |
| 5446-92-4 |
2-Methoxy-5-nitropyridine |
| 54464-57-2 | Ethanone, 1-(1,2,3,4,5,6,7,8-octahydro-2,3,8,8-tetramethyl-2-naphthalenyl)-1-one (and isomers) |
| 544-77-4 |
1-IODOHEXADECANE |
| 5448-43-1 | 6-Chloroquinoxaline |
| 54512-75-3 | 1-bromo-5-chloropentane |
| 545387-09-5 | 1-Butyl-2,3,3-trimethyl-3H-benz[e]indolium hexafluorophosphate |
| 5454-83-1 | Methyl-5-bromopentanoate |
| 5455-94-7 |
2,2,5,5-Tetramethyltetrahydrofuran-3-one |
| 5459-58-5 | n-Butyl Cyanoacetate |
| 5464-12-0 |
1-(2-hydroxyethyl)-4-methylpiperazine |
| 5464-78-8 |
1-(2-METHOXYPHENYL) PIPERAZINE HYDROCHLORIDE |
| 546-56-5 | Octaphenylcyclotetrasiloxane |
| 5466-77-3 |
Iso-octyl p-methoxy cinnamate |
| 546-68-9 | Tetra isopropyl titanate |
| 5460-09-3 | H Acid Hydrate |
| 54628-89-6 | 1-(4-aminophenyl)–2,3-dihydro-1,3.3-trimethyl-1H-inden-5-amine |
| 54628-90-9 | 3-(4-Aminophenyl)-2,3-dihydro-1,1,3-trimethyl-1H-inden-5-amine |
| 54646-36-5 | Methoxypropyl-4-methylbenzol-sulfonate |
| 556-56-9 |
Allyl Iodide |
| 5468-66-6 | 2-(4-Chlorobenzyl)benzimidazole |
| 5468-75-7 | Pigment Yellow 14 |
| 54686-97-4 | 1,3:2,4-Di-(p-methylbenzylidene)sorbitol |
| 5469-66-9 |
1,3-Propanediol di-p-tosylate |
| 5470-11-1 |
Hydroxylamine hydrochloride |
| 5470-17-7 |
2-Chloro-3-bromo-5-nitropyridine |
| 5471-81-8 |
METHYL 4-IODO-3-METHYLBENZOATE |
| 5472-49-1 |
N-(3-chloropropyl)piperidine hydrochloride |
| 547-57-9 | Tropaeolin O |
| 5471-90-9 | N-(4-Hydroxyphenyl)Benzenesulphonamide |
| 547-65-9 |
α-methylene-γ-butyrolactone |
| 54811-38-0 |
5-iodo-2-methylbenzoic acid |
| 54822-22-9 |
Methyl 5H-octafluoropentanoate |
| 548-62-9 | BASIC VIOLET 3 |
| 54830-99-8 | Verdyl Acetate |
| 54864-78-7 |
3(5)-Heptafluoropropyl-5(3)-phenylpyrazole |
| 54932-74-0 |
5-Bromo-1,1,1-trifluoropentane |
| 5493-45-8 | Diglycidyl 1,2-Cyclohexanedicarboxylate |
| 54949-74-5 |
3,3,4,4,4-Pentafluorobutan-1-ol |
| 5496-71-9 | N,N,N',N'-Tetrakis(4-dibutylaminophenyl)-p-phenylenediaminum dihexafluoroantimonate |
| 54997-92-1 | 4-Butylbenzenesulphonyl chloride |
| 5509-65-9 |
2,6-Difluoroaniline |
| 55117-15-2 |
2-Chloro-6-Fluorobenzyl Chloride |
| 551-62-2 |
1,2,3,4-Tetrafluorobenzene |
| 5518-52-5 |
Tris(2-furyl)phosphine |
| 5518-62-7 |
1,2-Bis(phosphino)ethane |
| 55-22-1 |
Iso Nicotinic Acid |
| 552-22-7 |
THYMOL IODIDE or DITHYMOL DIIODIDE |
| 55258-28-1 |
tert-Butyl pentafluoropropionate |
| 5525-95-1 |
Diphenyl(pentafluorophenyl)phosphine |
| 552-89-6 |
2-Nitrobenzaldehyde |
| 55314-16-4 |
3-Dimethylamino-1-(3-pyridyl)-2-propen-1-one |
| 55321-69-2 |
4-(1,1,2,3,3,3-Hexafluoropropoxy)benzaldehyde |
| 55362-80-6 |
9-bromo-1-nonanol |
| 5536-61-8 |
Sodium methacrylate |
| 554-00-7 |
2,4-Dichloroaniline |
| 55406-53-6 |
3-IODO-2-PROPYNYL BUTYL CARBAMATE ( IPBC ) |
| 555-16-8 |
4-Nitrobenzaldehyde |
| 55-55-0 | 4-methylaminophenol sulfate |
| 55066-48-3 | 3-Methyl-5-phenyl-1-pentanol |
| 5511-18-2 | 1-Adamantancarboxamide |
| 55112-42-0 | 4-Methylpiperazine-1-carbonyl chloride hydrochloride |
| 552-30-7 | Trimellitic Anhydride |
| 552-82-9 | Methyldiphenylamine |
| 5521-55-1 | 5-Methyl-2-pyrazinecarboxylic acid |
| 55289-35-5 | 2-Bromo-6-nitrotoluene |
| 55289-36-6 | 2-Amino-6-bromotoluene |
| 553-03-7 | 3,4-Dihydro-1H-quinolin-2-one |
| 553-90-2 | Dimethyl oxalate |
| 55310-46-8 | Sodium dibenzyldithiocarbamate |
| 5537-71-3 | 3-（1-Cyanoethyl）-Benzoic Acid |
| 55526-63-1 | 2-Chloromalondianil hydrochloride |
| 556-08-1 | P-acetylamino benzoic acid |
| 5567-15-7 | Pigment Yellow 83 |
| 55671-55-1 | Dibromoborane Dimethyl Sulfide |
| 55690-60-3 | 2-Mercapto-5-methoxybenzothiazole |
| 55697-65-9 | 1-(2,4,5-Trichlorophenyl)-3-[2-chloro-5-(1-octadecenyl-1-succinimido)anilino]-2-pyrazolin-5-one |
| 55719-85-2 |
Phenyl Ethyl Tiglate |
| 55756-24-6 |
1H-Perfluorooct-1-yne |
| 5576-19-2 |
2,2'-Dibromooctafluorobiphenyl |
| 557-68-6 |
1-bromo-1-iodomethane |
| 55804-66-5 | Coumarin 314 |
| 5580-79-0 |
2,3,4,5-Tetrafluoronitrobenzene |
| 5580-80-3 |
2,3,4,5-Tetrafluoroaniline |
| 55810-48-5 |
Diethyl 4-(trifluoromethyl)tetrafluorophenylmalonate |
| 558-17-8 |
2-IODO-2-MEHTYLPROPANE |
| 558-86-1 |
1-Bromo-4H-octafluorobutane |
| 558-89-4 |
1-Chlorononafluorobutane |
| 558-95-2 |
Perfluorononanoyl fluoride |
| 559-11-5 |
1H,1H-Perfluoroheptyl acrylate |
| 559-14-8 |
Perfluorooct-1-ene |
| 55919-82-9 |
5-IODO-1H-INDAZOLE |
| 5593-70-4 | Tetra n-butyl titanate |
| 55944-70-2 |
7-chloro-1-heptanol |
| 55970-05-3 | 2-Methyl-benz[e]indole |
| 559-91-1 |
Heptafluoropropyl phenyl ketone |
| 561069-04-3 |
Triethoxy[2,3,5,6-tetrafluoro-4-(trifluoromethyl)phenyl]silane |
| 56183-63-2 |
Bis(diisopropylamino)chlorophosphine |
| 56-40-6 | Glycine |
| 564483-18-7 |
2-Dicyclohexylphosphino-2′,4′,6′-triisopropyl-1,1′-biphenyl |
| 564483-19-8 |
2-Di-tert-butylphosphino-2′,4′,6′-triisopropyl-1,1′-biphenyl |
| 565-42-4 |
2,2,3,3,3-Pentafluoropropyl p-toluenesulfonate |
| 56621-48-8 |
1-(4-HYDROXYPHENYL) PIPERAZINE |
| 56734-81-7 |
1H,2H-Perfluorooctanal |
| 56803-37-3 |
BUTYLATED TRIPHENYL PHOSPHATE ESTER |
| 56-81-5 | Glycerin |
| 561-41-1 | SOLVENT VIOLET 8 |
| 5614-37-9 | Cyclopentyl Methyl Ether |
| 563-52-0 | 3-Chloro-1-butene |
| 563-76-8 | 2-bromopropionyl Bromide |
| 563-78-0 | 2,3-Dimethyl-1-butene |
| 56341-41-4 | 5-Fluoro-2-oxindole |
| 56405-37-9 | 2-Methyl-3-(3-sulfopropyl)benzothiazolium betaine |
| 56674-87-4 | 5-Carboxyadamantan-2-one |
| 56718-71-9 | 4-(2-methoxyethyl)phenol |
| 5675-51-4 | 1,12-Dodecanediol |
| 5680-79-5 | Glycine Methyl Ester HCL |
| 5683-41-0 | 2,5,6-Trimethylbenzothiazole |
| 5685-06-3 | 2-Mercapto-4-methylthiazole |
| 56860-81-2 |
Difluoromethyl 2,2,3,3,3-pentafluoropropyl ether |
| 56860-82-3 |
Dichloromethyl 1,1,2,3,3,3-hexafluoropropyl ether |
| 56860-85-6 |
1,1,2,3,3,3-Hexafluoropropyl difluoromethyl ether |
| 56960-82-8 |
2-Amino-3-nitro-5-chloro-6-MP |
| 56985-74-1 | 2-bromopropionic acid sodium salt |
| 5700-49-2 |
Ethylenediamine Dihydriodide |
| 57-06-7 | Allyl isothiocyanate |
| 57-39-6 | Tris-1-(2-methylaziridinyl)Phosphine Oxide |
| 570-22-9 | Imidazole-4,5-dicarboxylic acid |
| 57028-96-3 | Polyhexamethylenguanidine hydrochloride |
| 57058-01-2 | 1-(4-Bromophenyl)-1H-tetrazole |
| 57061-71-9 |
1-(2-chloroethyl)-4-[3-(trifluoromethyl)phenyl]piperazine,dihydrochloride |
| 57069-95-1 |
Iodopentafluoroacetone |
| 5708-19-0 | (S)-(-)-3-cyclohexene carboxylic acid |
| 57124-20-6 |
7-Chloro-4-hydroxy-2-(trifluoromethyl)quinoline |
| 57152-87-1 |
1-chloro-10-iododecane |
| 571-55-1 |
Ethyl 2-ethoxymethylene-4,4,4-trifluoroacetoacetate |
| 5717-37-3 | 1-Ethoxycarbonylethylidenetriphenyl-phosphorane |
| 5718-83-2 | Rhodanine-3-acetic acid |
| 57227-28-8 |
1-(3-chloropropyl)-4-(2-hydroxyethyl)piperazine |
| 57260-71-6 | N-Boc Piperazine |
| 57325-39-0 |
1-(3-chloropropyl)-4-(2-hydroxyethyl)piperazine |
| 57325-39-0 |
1,1,1,2,2,3,3-Heptafluoronon-4-ene |
| 57325-40-3 |
1,1,1,2,2,3,3-Heptafluoronon-4-ene |
| 573-56-8 | 2,6-Dinitrophenol |
| 5736-46-9 |
Bis(pentafluorophenyl)methane |
| 5736-85-6 |
4-propoxybenzaldehyde |
| 5736-88-9 |
4-butoxybenzaldehyde |
| 5736-91-4 |
4-n-pentyloxybenzaldehyde |
| 57395-49-0 |
10-iodo-1-decanol |
| 5739-98-0 | 6,7-Dimethoxy-2-hydroxyquinoxaline |
| 57455-06-8 |
3-IODOBENZYL ALCOHOL |
| 5753-96-8 |
Ethyl 2-oxohexanoate |
| 57583-54-7 |
Tetraphenyl resorcinol bis(diphenylphosphate) |
| 576-55-6 | 3,4,5,6-Tetrabromo-o-cresol |
| 5762-64-1 | 2-Hydroxy-6-methylquinoxaline |
| 57-71-6 |
Diacetyl Monoxime |
| 577957-02-9 | Benzimidazole-4-carboxylic acid, 2-ethoxy ethyl ester |
| 578-57-4 |
2-bromoanisole |
| 57883-28-0 |
N-ethyl-7-nitro-1,2,3,4-tetrahydroquinoline |
| 578-85-8 | 1-Naphthol-3,6-disulfonic acid |
| 578-95-0 | Acridone |
| 57834-33-0 | Ethyl 4-[[(methylphenylamino)methylene]amino]benzoate |
| 57963-08-3 |
2-Amino-5,6-dimethylpyridine |
| 57981-02-9 |
O-(2,3,4,5,6-Pentafluorobenzyl)hydroxylamine hydrochloride |
| 580-13-2 |
2-bromonaphthalene |
| 5805-76-5 | 1-Ethyl-2-methylbenzimidazole |
| 58064-52-1 | 1-Formyl-4-methyl-3-thiosemicarbazide |
| 58079-51-9 | Triphenylphosphine |
| 5815-61-2 |
Tris(4-morpholino)phosphine |
| 582-60-5 | 5,6-Dimethylbenzimidazole |
| 5829-03-8 |
Ethyl 2-chlorotetrafluoropropionate |
| 583-39-1 | 2-Mercaptobenzimidazole |
| 5833-18-1 | Ethyl bis(2,4-dinitrophenyl)acetate |
| 58349-49-8 |
Perfluoropent-2-ene |
| 583-55-1 |
1-Bromo-2-Iodobenzene |
| 58380-92-0 |
3,3,4,5,5,5-Hexafluoro-2-methylpentan-2-ol |
| 584-20-3 |
3-Amino-4,4,4-trifluorobutyric acid |
| 584-93-0 | 2-bromovaleric acid |
| 58430-94-7 | Isononyl Acetate |
| 58480-17-4 | 2,3-Dimethylnaphtho[1,2-d]thiazolium tosylate |
| 58521-27-0 |
Potassium pentafluorobenzoate |
| 58551-83-0 |
2,4,6-Trifluorobenzaldehyde |
| 58556-45-9 |
5,5,6,6,6-Pentafluorohexan-1-ol |
| 585-79-5 | 3-bromonitrobenzene |
| 58537-99-8 | 2,6-dimethyl-4-hydaoxy benzonitrile |
| 5854-78-4 | O-tert-butyl-L-threonine tertbutyl ester |
| 58656-04-5 |
Tricyclohexylphosphonium tetrafluoroborate |
| 586-62-9 | Terpinolene |
| 586-75-4 | 4-Bromobenzoyl chloride |
| 586-76-5 | 4-Bromobenzoic acid |
| 586-95-8 |
4-Hydroxymethylpyridine |
| 58757-38-3 |
6-Chloro nicotinoyl Chloride |
| 587-90-6 | N,N´-Bis-4-nitrophenyl urea |
| 58808-59-6 |
4-(Trifluoroacetyl)benzoic acid |
| 58808-60-9 |
4-Trifluoroacetylbenzoyl chloride |
| 58816-79-8 |
Perfluorocyclohexanecarbonyl chloride |
| 588-23-8 | 4-Acetylamino-2',3-dimethylazobenzene |
| 588-63-6 |
1-bromo-3-phenoxypropane |
| 588729-99-1 |
2-Chloro-3-amino-5-bromopyridine |
| 5888-33-5 |
Isobornyl acrylate |
| 588-96-5 | 4-Bromophenetole |
| 589-10-6 |
1-bromo-2-phenoxyethane |
| 5891-21-4 |
5-Chloro-2-pentanone |
| 589-15-1 | 4-Bromobenzyl Bromde |
| 589-18-4 |
4-Methylbenzyl alcohol |
| 589-57-1 |
Diethyl chlorophosphite |
| 58971-11-2 | 3-Bromophenethylamine |
| 58985-18-5 | Dihydroterpinyl Acetate |
| 589-87-7 |
1-Bromo-4-Iodobenzene |
| 590-16-9 |
1-bromo-2-iodoethane |
| 590-76-1 |
4,4,4-Trifluorocrotonamide |
| 590-93-2 |
2-butynoic acid |
| 591-18-4 |
1-BROMO-3-IODOBENZENE |
| 591-50-4 |
Iodobenzene |
| 59158-81-5 |
Allyl 1,1,2,3,3,3-hexafluoropropyl ether |
| 591-87-7 |
Allyl acetate |
| 5922-60-1 |
5-Chloroanthranilonitrile |
| 59-23-4 | D-Galactose (plant origin) |
| 59237-53-5 |
6-Chloro-5-Nitronicotinic Acid Methyl Ester |
| 592-50-7 |
1-Fluoropentane |
| 592-55-2 |
1-bromo-2-ethoxyethane |
| 5927-65-1 |
7H-Perfluoroheptanoyl fluoride |
| 5927-67-3 |
Decafluoro-1,2-epoxycyclohexane |
| 593-03-3 |
3-Hexadecanol |
| 5930-66-5 |
3-Chlorotetrafluoropropionyl fluoride |
| 5930-67-6 |
Difluoromalonyl difluoride |
| 593-12-4 |
1-fluoro-8-bromooctane |
| 593-14-6 |
1-fluoro-8-chlorooctane |
| 593-70-4 |
Chlorofluoromethane (Freon-31) |
| 593-71-5 |
Chloroiodomethane |
| 594-09-2 |
Trimethylphosphine |
| 5945-33-5 |
Trimethylphosphine |
| 59-48-3 | 2-Oxindole |
| 590-28-3 | Potassium cyanate |
| 590-42-1 | tert.Butyl isothiocyanate |
| 590-92-1 | 3-bromopropionic acid |
| 591-27-5 | m-Aminophenol |
| 591-31-1 | 3-Methoxybenzaldehyde |
| 591-97-9 | 1-chloro-2-butene |
| 5911-08-0 | (Chloromethyl) cyclopropane |
| 593-04-4 | Boron trifluoride n-Butyl ether |
| 593-56-6 | Methoxylamine Hydrochloride |
| 59483-84-0 |
Bis(pentafluorophenyl)carbonate |
| 59489-71-3 | 2-Amino 5 Bromo Pyrazine |
| 59-50-7 |
4-Chloro-3-methylphenol |
| 5959-56-8 | 4-Aminonaphthalen-1ol hydrochloride |
| 596-27-0 |
O - Cresophthalein |
| 59665-23-5 |
2-Bromo-3,3,4,4,5,5,6,6,6-nonafluorohex-1-ene |
| 59665-24-6 |
1,2,2-Tribromo-1H,1H-perfluorohexane |
| 59665-25-7 |
1,2,2-Tribromo-1H,1H-perfluorooctane |
| 59665-26-8 |
1,2,2-Tribromo-1H,1H-perfluorodecane |
| 59673-82-4 | 3-Amino-4-Carbomethoxy-2',5'-Dichloro Benzanilide |
| 59690-88-9 | 3-Aminophenylurea hydrochloride |
| 597-71-7 | Pentaerythritol tetraacetate |
| 59703-00-3 | 4-Ethyl-2,3-dioxo-1- piperazine Carbonyl chloride |
| 597554-03-5 | 10-(2-Naphthyl)Anthracene-9-Boronic Acid |
| 598-21-0 | Bromoacetyl Bromide |
| 598-39-0 |
2-iodo-1,1-difluoroethane |
| 598-62-9 |
Manganese carbonate |
| 598-72-1 | 2-bromopropionic acid |
| 5981-09-9 | 4,4',4"-Triaminotriphenylamine |
| 59820-43-8 | HC YELLOW 4 |
| 59862-10-1 | 1,1'-Bis(4-sulfobutyl)-3,3,3',3'-tetramethylilndadicarbocyanine betaine sodium salt |
| 59872-84-3 |
Pentafluoropropionaldehyde methyl hemiacetal |
| 59878-57-8 | 1-Cyclopropyl carbonyl piperazine |
| 5989-54-8 | L-Limonene |
| 599-91-7 | n-Propyltosylate |
| 599177-24-9 | 4,5:4',5'-Dibenzo-1,1',3,3,3',3'-hexamethylindacarbocyanine hexafluorophosphate |
| 59997-51-2 |
2-Diethylamino-5-amino-6-methylpyridine |
| CAS NO | Product Name |
| 60-00-4 | EDTA [Ethylenediamine tetraacetic acid] |
| 6002-34-2 |
tert-Butyldiphenylphosphine |
| 60061-68-9 |
4-Bromo-5(3)-methyl-3(5)-(trifluoromethyl)pyrazole |
| 6007-85-8 |
3,4-thiophene dicarboxylic anhydride |
| 60-09-3 | p-Aminoazobenzene |
| 60-12-8 | Phenyl Ethyl Alcohol |
| 600-00-0 | Ethyl 2-bromo-2-methylpropionate |
| 600-05-5 | 2,3-Dibromopropionic acid |
| 60129-85-3 |
Pentafluorophenyl trifluoromethanesulfonate |
| 601-75-2 | Ethylmalonic acid |
| 60164-51-4 | Perfluoropolyether ；PFPE Oil |
| 6018-41-3 |
Methyl Coumalate |
| 60239-18-1 |
1,4,7,10-tetraazacyclododecane-1,4,7,10-tetraacetic acid |
| 60249-67-4 |
3,3,4,5,5,5-Hexafluoropentan-2-one |
| 602-52-8 |
Homidium chloride |
| 602-56-2 |
9 Phenyl Acridine |
| 60274-60-4 |
1-chloro-5-iodopentane |
| 602-94-8 |
2,3,4,5,6-Pentafluorobenzoic acid |
| 60308-66-9 |
Perfluoro(2-methyl-3-oxahexanenitrile) |
| 603-11-2 |
3,4-Dichloronitrobenzene |
| 603-33-8 | Triphenyl Bismuth |
| 603-35-0 | Triphenylphosphin |
| 603-52-1 | N,N´-Diphenylurethane |
| 603-76-9 | N-Methylindole |
| 6037-91-8 |
2-Iodotetrafluoroethyl trifluorovinyl ether |
| 603-83-8 | 2-Methyl-3-nitroaniline |
| 6041-94-7 | Pigment Red 2 |
| 60433-11-6 |
cis-Perfluorodecalin |
| 60433-12-7 |
trans-Perfluorodecalin |
| 6044-68-4 | Acrolein dimethyl acetal |
| 60598-17-6 |
Methyl 2,2,3,3-tetrafluoropropyl ether |
| 60644-92-0 |
2,2-Bis(trifluoromethyl)-4,5-dichloro-4,5-difluoro-1,3-dioxolane |
| 6066-45-1 |
2-Bromotetrafluoropropionyl chloride |
| 6066-46-2 |
2-Chlorotetrafluoropropionyl chloride |
| 6066-47-3 |
2-Chlorotetrafluoropropionamide |
| 6066-82-6 |
N-Hydroxy Succinimide |
| 60710-80-7 | 3-Amino-4-methylbenzonitrile |
| 60728-41-8 | 1-Methyl-2-aminoterephthalate |
| 607373-83-1 |
2-Chloro-4-methoxy-5-nitropyridine |
| 60758-86-3 | 3-ethoxy-4-methoxy benzonitrile |
| 60760-42-1 | 4,5-Benzo-3,3'-bis(3-sulfopropyl)thiacyanine betaine triethylammonium salt |
| 608-05-9 |
5-Methylisatin |
| 608-25-3 |
2,6-dihydroxytoluene |
| 608-28-6 |
2-IODO-m-XYLENE |
| 60838-59-7 |
2,2,3,3,4,4-Hexafluorobutan-1-ol |
| 60838-60-0 |
1H,1H,6H-Decafluorohexan-1-ol |
| 60903-82-4 |
4-Chloro-2,3,5,6-tetrafluorotoluene |
| 609-12-1 |
Ethyl 2-bromoisovalerate |
| 609-23-4 |
2,4,6-TRIIODOPHENOL |
| 609-40-5 | 2-NITROTHIOPHENE |
| 6090-15-9 | 2,6-Dimethyl-5-hepten-2-ol |
| 6092-54-2 | n-Hexyl chloroformate |
| 60956-26-5 | 4-Bromo-2-nitrotoluene |
| 609-65-4 |
2-Chlorobenzoyl Chloride |
| 609-73-4 |
2-Iodo Nitro Benzene |
| 609779-51-3 | 2, 3-difluoro-1-rnethoxy-4-(4-propylcyclohexyl) benzene |
| 6099-90-7 |
Phloroglucinol dihydrate |
| 609-99-4 |
3,5-Dinitro salicylic acid |
| 61-73-4 | BASIC BLUE 9 |
| 610261-34-2 |
3,5-Dibromo-2-nitropyridine |
| 610-92-4 | 2,5-Dihydroxyterephthalic acid |
| 610-96-8 |
Methyl 2-Chlorobenzoate |
| 610-97-9 |
2-Iodo Methyl Benzoate |
| 611-10-9 | Ethyl 2-oxocyclopentanecarboxylate |
| 611-13-2 |
Methyl-2-Furoate |
| 611-19-8 |
2-Chlorobenzyl Chloride |
| 611-20-1 |
2-Cyanophenol |
| 611-36-9 | 4-hydroxy quinoline |
| 611-79-0 | 3,3'-Diaminobenzophenone |
| 61105-57-5 | 3,3'-Diethyl-9-methyloxacarbocyanine perchlorate |
| 61167-58-6 | Acrylic acid 2-tert-butyl-4-methyl-6-(2-hydroxy-3-tert-butyl-5-methylbenzyl)phenyl ester |
| 611-99-4 |
4.4'-dihydroxy benzophenone |
| 612-12-4 |
1,2-BIS-(CHLOROMETHYL)-BENZENE |
| 612-25-9 |
2-Nitrobenzyl alcohol |
| 612-58-8 | 3-Methylquinoline |
| 612-82-8 | 2,2'-dimethyl-4,4'-diaminobiphenyl-dihydrochloride |
| 612-83-9 | 3,3'-Dichlorobenzidine dihydrochloride |
| 61260-15-9 | 3-Dimethoxy Phosphoryl-3H-2-Benzofuran-1-One |
| 6129-62-0 |
2-Bromotetrafluoropropionyl fluoride |
| 613-03-6 | Pyrogallol A |
| 613-54-7 | 2-Bromoacetylnaphthalene |
| 613-62-7 | Benzyloxynaphthalene |
| 613-90-1 | Benzoyl Cyanide |
| 613-94-5 |
Benzoic acid hydrazide |
| 6140-17-6 |
p-Methylbenzotrifluoride |
| 61444-66-4 |
2,2,3,3-Tetrafluoropropionyl bromide |
| 614-98-2 |
Ethyl-3-Furoate |
| 6145-01-3 |
1,8-Diiodo-1,1,2,2,3,3,4,4,5,5,6,6-dodecafluorooctane |
| 614-80-2 | 2-Acetamidophenol |
| 614-97-1 | 5-Methylbenzimidazole |
| 61439-59-6 | 2-(4-Benzyloxyphenyl)ethanol |
| 6146-52-7 | 5-Nitroindole |
| 6148-64-7 | Ethyl potassium malonate |
| 615-15-6 | 2-Methylbenzimidazole |
| 615-16-7 | 2-Hydroxybenzimidazole |
| 615-18-9 | 2-Chlorobenzoxazole |
| 615-22-5 | 2-Methylthiobenzothiazole |
| 615-37-2 |
2-Iodotoluene |
| 615-41-8 |
1-CHLORO-2-IODOBENZENE |
| 615-43-0 |
2-Iodoaniline |
| 615-50-9 | 2,5-Diaminotoluene sulfate |
| 615-66-7 | o-Chloro-p-phenylenediamine |
| 615-83-8 | Ethyl-2-bromopentanoate |
| 615-94-1 | 2,5-Dihydroxy-1,4-benzoquinone |
| 615-96-3 | Ethyl 2-bromohexanoate |
| 6155-57-3 | Sodium Saccharin, 15% Moisture |
| 616-05-7 | 2-bromohexanoic acid |
| 616-25-1 | 1-Penten-3-ol |
| 616-30-8 |
3-amino-1,2-propanediol |
| 616-79-5 | 2-Amino-5-nitrobenzoic acid |
| 616-84-2 | 4-Amino-3-nitrobenzenesulfonic acid |
| 61617-00-3 | 1,3-dihydro-4(or 5)-methyl-2H-benzimidazole-2-thione, zinc salt |
| 6163-58-2 | Tri-o-tolyl phosphine |
| 6165-76-0 | Propargyl Tosylate |
| 61700-58-1 | 4-Cyanaminobenzoic acid |
| 61717-82-6 |
2-Iodoxybenzoic Acid |
| 61718-80-7 |
5-methoxy-1-(4-(trifluoromethyl)phenyl)-1-pentanone |
| 617718-46-4 |
3-fluoroazetidinehydrochloride |
| 61789-86-4 | Calcium Sulphonate |
| 6180-61-6 |
3-phenoxy-1-propanol |
| 618-46-2 |
3-Chlorobenzoyl Chloride |
| 618-51-9 |
3-Iodo Benzoic Acid |
| 61874-51-9 |
Isopropoxypentafluorobenzene |
| 618-87-1 | 3,5-Dinitroaniline |
| 618-88-2 | 5-Nitroisophthalic Acid |
| 61813-75-0 | SOLVENT BLUE 43 |
| 6188-98-3 |
Octafluoro-2-(trifluoromethyl)butan-2-ol |
| 6189-02-2 |
2-Chlorotetrafluoropropionic acid |
| 618-95-1 |
Methyl 3-nitrobenzoate |
| 618-98-4 |
Ethyl 3-nitrobenzoate |
| 619-08-9 | 2-Chloro-4-nitrophenol |
| 619-24-9 |
3-Nitrobenzonitrile |
| 6192-52-5 |
P-Toluene Sulphonic Acid |
| 619-44-3 |
4-Iodobenzoic Acid methyl ester |
| 619-58-9 |
4-Iodobenzoic Acid |
| 619-65-8 | 4-Cyanobenzoic acid |
| 619-67-0 | 4-Hydrazinobenzoic acid |
| 619-72-7 |
4-Nitrobenzonitrile |
| 619-73-8 |
4-Nitrobenzyl alcohol |
| 619-80-7 | P-Nitrobenzamide |
| 61921-39-9 | 4-bromobenzo[a]anthracene |
| 61931-68-8 | 2-Methyl-5-phynylbenzoxazole |
| 61932-63-6 | Pigment Red 210 |
| 6197-30-4 | Octocrylene |
| 61990-51-0 | 4-(acetylamino)benzoic acid -1-(dimethylamino)propan-2-ol (1:1) |
| 620-05-3 |
BENZYL IODIDE |
| 620-20-2 |
3-Chlorobenzyl Chloride |
| 62-33-9 | EDTA-CaNa2 |
| 62037-80-3 |
Ammonium perfluoro(2-methyl-3-oxahexanoate) |
| 62038-08-8 |
Perfluoroheptanenitrile |
| 62058-03-1 |
trans-4-Aminoadamantan-1-ol |
| 620-72-4 |
Phenyl bromoacetate |
| 62075-23-4 |
trans-4-Amino-1-Hydroadamantane Hydrochloride |
| 620-84-8 |
4 Methyl Di Phenyl Amine |
| 620-93-9 | 4,4'-Dimethyldiphenyl amine |
| 621-07-8 | 2,2'-methylenebis(4-methyl-6-tertbutylphenol) |
| 621-08-9 | Dibenzylsulfoxide |
| 62116-24-9 |
3-iodo-1-propanol acetate |
| 621-23-8 |
1,3,5 Tri Methoxy benzene |
| 6213-88-3 |
(E)-METHYL-3-IODOACRYLATE |
| 6214-18-2 | Isopropyl Benzenesulfonate |
| 6214-23-9 |
(Z)-3-Iodo Propenoic Acid Methyl Easter |
| 621-42-1 |
3-ACETAMIDOPHENOL |
| 621-56-7 |
3-diethylamino-1,2-propanediol |
| 621-59-0 |
3-Hydroxy-4-methoxybenzaldehyde |
| 6219-71-2 | 2-Chloro-1,4-phenylenediamine sulfate |
| 622-15-1 | N,N'-Diphenylformamidine |
| 622-40-2 |
4-(2-hydroxyethyl)morpholine |
| 6226-25-1 |
2,2,2-Trifluoroethyl trifluoromethanesulfonate |
| 62265-99-0 | 2,6-Dibromo-3-,methyl-4-nitro-anisole |
| 62265-99-0 | 2,6-Dibromo-3-methyl-4-nitroanisole |
| 622-86-6 |
2-chloroethyl phenyl ether |
| 622-93-5 |
3-diethylamino-1-propanol |
| 623-03-0 |
4-Chlorobenzonitrile |
| 623-04-1 |
4-Aminobenzyl alcohol |
| 623-05-2 |
4-Hydroxybenzyl alcohol |
| 6231-18-1 |
2,6-Dimethoxypyridine |
| 623-47-2 | Ethyl propiolate |
| 623-48-3 |
Ethyl Iodoacetate |
| 623-69-8 |
1,3-dimethoxy-2-propanol |
| 623-71-2 | 3-Chloropropionic acid ethyl ester |
| 62306-08-5 | 5-Cyano-1-ethyl-2-methylbenzimidazole |
| 62386-95-2 | Calcium/Sodium PVM/MA Copolymer |
| 624-28-2 |
2,5-Dibromopyridine |
| 624-31-7 | 4-lodotoluene |
| 624-38-4 |
1,4-Diiodobenzene |
| 624-65-7 | Propargyl Chloride Solution |
| 624-70-4 |
1-chloro-2-iodoethane |
| 624729-66-4 | 8-Amino-1,2,3,4-tetrahydronaphthalen-2-ol |
| 624-73-7 |
1,2-diiodoethane |
| 624-75-9 |
IODOACETONITRILE |
| 624-76-0 |
2-iodo-1-ethanol |
| 624-95-3 |
3,3-Dimethylbutan-1-ol |
| 625-36-5 | 3-Chloropropionyl chloride |
| 625-82-1 | 2,4-DIMETHYLPYRROLE |
| 625-86-5 | 2,5-Dimethylfuran |
| 625-92-3 |
3,5-Dibromopyridine |
| 625-95-6 |
3 - Iodo Toluene |
| 6259-76-3 | Hexyl Salicylate |
| 625-99-0 |
1-CHLORO-3-IODOBENZENE |
| 626-00-6 |
1,3 Diiodobenzene |
| 626-01-7 | 3-Iodoaniline |
| 626-05-1 |
2,6-Dibromopyridine |
| 626-35-7 | Ethyl Nitro Acetate |
| 626-39-1 |
1,3,5 Tri bromo benzene |
| 626-43-7 | 3,5-Dichloroaniline |
| 626-55-1 |
3-Bromopyridine |
| 626-60-8 |
3-Chloropyridine |
| 626-62-0 |
Iodocyclo Hexane |
| 626-64-2 |
4-Hydroxypyridine |
| 62669-60-7 | Oxazine 720 |
| 62669-66-3 | Rhodamine 19P |
| 6267-02-3 | High temperature reaction product of dipheny lamine and acetone |
| 62679-61-2 |
1-Phenyl-4,4-difluorobutane-1,3-dione |
| 6269-89-2 | 1-(4-Nitrophenyl)piperazine |
| 627-10-1 |
2-iodo-1-ethanol acetate |
| 627-18-9 | 3-Bromo-1-propanol |
| 62720-29-0 |
1,3-Dibromo-5-Fluoro-2-Iodobenzene |
| 627-27-0 |
3-buten-1-ol |
| 627-30-5 | 3-Chloro-1-Propanol |
| 627-31-6 |
1,3-diiodopropane |
| 627-32-7 |
3-iodo-1-propanol |
| 627-40-7 | Allyl methyl ether |
| 627-42-9 | 2-Methoxyethyl chloride |
| 627-59-8 |
MIAC |
| 6276-04-6 |
1-IODO-3,5-DINITROBENZENE |
| 627-91-8 | Mono Methyl Adipate |
| 627-93-0 | Dimethyladipate |
| 6271-80-3 | 4’-chloro-2-nitro-1,1’-biphenyl |
| 6272-45-3 | 3-[4-(Benzyloxy)phenyl]acrylic acid |
| 628-09-1 |
3-Chloropropyl acetate |
| 628-17-1 |
1-IODOPENTANE |
| 628-21-7 |
1,4-diiodobutane |
| 6283-25-6 |
2-Chloro-5-nitroaniline |
| 628-34-2 | 2-Chloroethyl ethyl ether |
| 6285-05-8 |
4'-Chloropropiophenone |
| 628-76-2 |
1,5-dichloropentane |
| 628-77-3 |
1,5-diiodopentane |
| 628-81-9 | n-Butylethylether |
| 628-87-5 | IDAN [Iminodiacetonitrile] |
| 628-89-7 | 2-(2-chloroethoxy)ethanol |
| 6283-63-2 | N,N-Diethyl-p-phenylenediamine sulfate |
| 6284-40-8 | N-methyl-D-glucamine |
| 62899-75-6 | N-Cyclohexyl-N-methyl carbamoyl chloride |
| 629-03-8 | 1,6-dibromohexane |
| 629-04-9 | 1-bromoheptane |
| 629-09-4 |
1,6-diiodohexane |
| 629-11-8 | 1,6-Hexanediol |
| 6291-23-2 |
4-(4-morpholino)phenol |
| 6291-26-5 |
Potassium difluoroacetate |
| 629-27-6 |
1-IODO OCTANE |
| 629-30-1 | 1,7-Heptanediol |
| 62932-94-9 |
2-Bromo-1-[4-Hydroxy-3-(Hydroxymethyl)Phenyl]Ethan-1-One |
| 629-40-3 | 1,6-Dicyanohexane |
| 629-41-4 | 1,8-Octanediol |
| 6294-17-3 | 1-bromo-6-chlorohexane |
| 6295-29-0 | 6,7-Dimethoxyquinoxaline |
| 6295-87-0 |
1-Aminopyridinium Iodide |
| 6297-22-9 |
Methyl 4-oxocyclohexanecarboxylate |
| 6298-11-9 | 4-PyridineethanethiolHydrochloride |
| 6298-37-9 | 6-Aminoquinoxaline |
| 63-74-1 | Sulfanilamide |
| 63022-06-0 | PIGMENT RED 81:5 |
| 63034-47-9 |
Chlorodifluoroacetaldehyde hydrate |
| 63069-48-7 | 4-Chloro-2-iodoaniline |
| 6309-61-1 | 2,3-Dihydroxy-6-methylquinoxaline |
| 6312-18-1 |
2-Chloro-2,2-difluoro-1,1-diphenylethanol |
| 6313-54-8 |
2-Chloropyridine-4-Carboxylic acid |
| 63139-21-9 | (4-ethyiphenyl) boronic acid |
| 631-40-3 |
TETRAPROPYL AMMONIUM IODIDE |
| 63148-57-2 |
Trimethylsiloxy terminatedpolymethyhydrosiloxane |
| 63148-97-0 | 3,3'-Bis(3-sulfopropyl)-5,5'-dimethoxythiacyanine betaine triethylammonium salt |
| 63149-01-9 | 5-Methoxy-2-methyl-3-(3-sulfopropyl)benzothiazolium betaine |
| 63149-05-3 | 2-Methylthio-3-(3sulfopropyl)benzothiazolium betaine |
| 63149-24-6 | 1-(4-Sulfobutyl)-2,3,3-trimethylbenz[e]indoliumbetaine |
| 63149-33-7 | 8-Hydroxyjulolidine-9-aldehyde |
| 6315-89-5 | 3,4 Dimethoxyaniline |
| 63157-72-2 | BASIC VIOLET 4 |
| 6317-85-7 | 4-Dimethylaminobenzoin |
| 6320-03-2 |
2-chlorothiophenol |
| 632-46-2 | 2,6-Dimethylbenzoic acid |
| 632-79-1 |
Tetrabromophthalic Anhydride |
| 632-99-5 | BASIC VIOLET 14 |
| 63231-60-7 | Microcrystalline wax |
| 63231-62-9 | Petroleum Resin (aromatic) |
| 6326-83-6 | Bis(carboxymethyl)trithiocarbonate |
| 633-03-4 | BASIC GREEN 1 |
| 6331-96-0 | 3,4 Dichloroaniline 6 sulfonic acid |
| 6332-56-5 |
2-Hydroxy-3-nitropyridine |
| 6334-18-5 |
2,3-Dichlorobenzaldehyde |
| 6334-25-4 | N,N,N,N-Tetrakis （2-Hydroxyethyl）Adipamide |
| 6334-97-0 | N-Acetyl J acid |
| 6337-43-5 | 2-[4-[2,2-Bis(ethoxycarbonyl)ethenyl]benzylidene]malonic acid diethyl ester |
| 63418-08-6 |
2,6-Dichloro-3,5-difluorophenol |
| 63428-84-2 | Polyamide Resin |
| 6344-72-5 | 6-Methylquinoxaline |
| 63449-39-8 | Chlorinated Paraffin |
| 6346-05-0 | 3-Benzyloxy-4-methoxy benzaldehyde |
| 635-46-1 | 1,2,3,4-Tetrahydroquinoline |
| 6351-10-6 | 1-Indanol |
| 635-21-2 |
5-Chloro Anthranilic Acid |
| 63524-66-3 | 2-Ethylhexyl alpha-cyano-3,4-methylenedioxycinnamate |
| 63539-54-8 |
N-(2,3,5,6-Tetrafluorophenyl)maleimide |
| 6357-93-3 |
Dioxy-γ-acid |
| 6358-30-1 | Pigment Violet 23 |
| 6358-31-2 | Pigment Yellow 74 |
| 6358-36-7 | BASIC YELLOW 37 |
| 6358-85-6 | Pigment Yellow 12 |
| 636-30-6 | 2,4,5 TCA 2,4,5-Trichloroaniline |
| 6361-41-7 | n-acetyl gammma acid |
| 636-73-7 |
Pyridine-3-sulfonic acid |
| 63684-99-1 | 1-(3,4-Dichlorophenyl)-5-mercaptotetrazole |
| 63693-10-7 |
2-(2,2,3,4,4,4-Hexafluorobutoxy)ethanol |
| 63693-13-0 |
2-(1,1,1,3,3,3-Hexafluoroisopropoxy)ethanol |
| 63697-17-6 | 1,3-Phenylenediamine Sulfate |
| 636-98-6 |
1-IODO-4-NITROBENZENE |
| 637-01-4 | N,N,N´,N´-Tetramethyl-1,4-phenylenediamine dihydrochloride |
| 63703-16-2 |
1-Iodo-6H-perfluorohexane |
| 6372-42-5 |
Cyclohexyldiphenylphosphine |
| 6375-47-9 | 3-Amino-4-Methoxy-Acetanilide |
| 637-87-6 |
4-Chloroiodobenzene |
| 637-88-7 |
1,4-Cyclohexanedione |
| 63812-15-7 |
2-Fluoroisobutyric acid |
| 638-16-4 | 1,3,5-Triazine-2,4,6-trithiol |
| 638-21-1 |
Phenylphosphine |
| 638-29-9 | n-Valeroyl Chloride |
| 6381-92-6 | EDTA-2Na Dihydrate |
| 63810-80-0 | 2,3-Dichloro-6,7-dimethylquinoxaline |
| 63811-40-5 | 2,2'-Dimercapto-4,4',6,6'tetrahydroxypyrimidino-5,5'pentamethineoxonole |
| 63843-89-0 | Propanedioic acid, 2-((3,5-bis(1,1-dimethylethyl)-4-hydroxyphenyl)methyl)-2-butyl-, 1,3-bis(1,2,2,6,6-pentamethyl-4-piperidinyl) ester |
| 638-45-9 |
1-Iodo Hexane |
| 63856-99-5 | 3-Chloro-2,4-dimethyleneglutacondianil hydrochloride |
| 63863-45-6 |
2,2,3,3-Tetrafluoro-3-trifluorovinyloxypropionic acid methyl ester |
| 638-79-9 |
1-Iodoperfluoropentane |
| 6388-47-2 | 2-Amino-3-chlorobenzoic acid |
| 63909-58-0 |
Diethyl (4-Fluorobenzyl)phosphonate |
| 6393-01-7 | 2,5-Dimethyl-p-phenylenediamine |
| 63967-46-4 |
1H,1H,1H,2H,3H-Perfluoronon-2-ene |
| 6401-00-9 |
2,2,3,3,3-Pentafluoropropyl trifluoromethanesulfonate |
| 6401-01-0 |
1H,1H-Heptafluorobutyl trifluoromethanesulfonate |
| 6401-02-1 |
2,2,3,3-Tetrafluoropropyl trifluoromethanesulfonate |
| 64-02-8 | EDTA-4Na Dihydrate |
| 64035-64-9 |
Trimethylsilylmethyl trifluoromethanesulfonate |
| 6408-72-6 |
Solvent Violet 59 |
| 641569-94-0 |
4-METHYL-3-[[4-(3-PYRIDINYL)-2-PYRIMIDINYL]AMINO] BENZOIC ACID |
| 641569-96-2 |
3-[(Aminoiminomethyl)amino]-4- methylbenzoic acid ethyl ester mononitrate |
| 641571-11-1 |
3-(4-Methyl-1H-imidazol-1-yl)-5-(trifluoromethyl) aniline |
| 64-17-5 | Ethanol |
| 6409-77-4 | Nuclear Fast Red Sodium Salt (C.I.60760) |
| 6410-30-6 | Pigment Red 8 |
| 6410-32-8 | Pigment Red 12 |
| 6417-83-0 | Pigment Red 63:1 |
| 6418-56-0 |
Diamyl amylphosphonate |
| 64248-58-4 |
1,2-DIFLUORO-4-IODOBENZENE |
| 64248-61-9 |
2,4-Difluorobenzotrifluoride |
| 643-22-1 | Erythromycin Stearate |
| 64346-30-1 | BASIC VIOLET 16 |
| 6436-90-4 | N-benzylglycine ethyl ester |
| 64365-17-9 | Hydrogenated Rosin Esters (Pentaerythritol) |
| 64381-99-3 | BASIC VIOLET 10 |
| 6443-72-7 |
3,4-Dimethoxycinnamonitrile |
| 6443-90-9 |
PYRIDINE IODINE MONOCHLORIDE COMPLEX |
| 644-97-3 | Dichlorophenyl Phosphine |
| 6448-95-9 | Pigment Red 22 |
| 6448-96-0 | Pigment Red 31 |
| 64488-52-4 | N-[4-(2-chloroacetyl)phenyl]methanesulfonamide |
| 64499-81-6 |
2,2-Bis(trifluoromethyl)tetrachloro-1,3-dioxolane |
| 645-36-3 |
2-aminoacetaldehyde diethyl acetal |
| 64609-91-2 |
Pentafluoropropionyl bromide |
| 6461-30-9 | 6-Methyl-2,4-dioxo-1,2,3,4-tetra-hydropyrimidine-5-sulfonyl chloride |
| 64665-57-2 | Tolyltriazole sodium salt |
| 64-69-7 |
Iodoacetic Acid |
| 646-97-9 |
2-Allylhexafluoroisopropanol |
| 647-12-1 |
Perfluooctanonitrile |
| 6471-49-4 | Pigment Red 23 |
| 6471-78-9 |
3-Amino-4-methoxy-toluene-6-sulfonic acid |
| 647-25-6 |
1,8-Dichloroperfluorooctane |
| 64739-16-8 |
Perfluoroheptanal hydrate |
| 64742-16-1 | Petroleum Resin |
| 64742-51-4 | Paraffin wax |
| 64742-54-7 | Distillates (petroleum), hydrotreated heavy paraffinic |
| 64742-55-8 | Distillates (petroleum), hydrotreated light paraffinic |
| 647-42-7 |
1H,1H,2H,2H-Perfluorooctan-1-ol |
| 647-44-9 |
7H-Perfluoro-1-heptanal |
| 6476-36-4 |
Triisopropylphosphine |
| 6476-37-5 |
Dicyclohexylphenylphosphine |
| 6478-73-5 | 5,6-Dichlorobenzimidazole |
| 647836-31-5 |
Potassium 5-fluorosulfonylperfluoro(2-methyl-3-oxapentanoate) |
| 647-84-7 |
4,4,5,5,6,6,6-Heptafluoro-2-iodohexan-1-ol |
| 6478-76-8 | 5,6-Dichloro-1-ethylbenzimidazole |
| 6478-79-1 | 5,6-Dichloro-2-methylbenzimidazole |
| 6480-68-8 | 3-Quinolinecarboxylic acid |
| 6482-24-2 |
1-bromo-2-methoxyethane |
| 648-42-0 |
Allyl 1H,1H-heptafluorobutyl ether |
| 6485-40-1 | L-Carvone |
| 6486-23-3 | Pigment Yellow 3 |
| 64872-77-1 | Butoconazole Nitrate |
| 64896-28-2 |
(2S,3S)-(-)-Bis(diphenylphosphino)butane |
| 6493-77-2 | 3-Cyclohexen-1-carboxylic acid methyl ester |
| 649-56-9 |
Ethyl 3-hydroxy-3-methyl-4,4,4-trifluorobutyrate |
| 649-65-0 |
1,1,1,5,5,5-Hexafluoro-4-hydroxy-4-methylpentan-2-one |
| 64997-81-5 |
Bis[1,2,2,2-tetrafluoro-1-(fluorocarbonyl)ethyl] trisulfide |
| 65055-17-6 |
4-Fluoro-3-chlorobenzoyl chloride |
| 65064-78-0 |
1H,1H,2'H,3H-Decafluorodipropyl ether |
| 65150-95-0 |
Perfluoro(2,5,8,11-tetramethyl-3,6,9,12-tetraoxapentadecanoic) acid |
| 651-80-9 |
2,3,5,6-Tetrafluorobenzotrifluoride |
| 651-83-2 |
2,3,5,6-Tetrafluoro-4-(trifluoromethyl)aniline |
| 651-84-3 |
Tetrafluoro-4-(trifluoromethyl)thiophenol |
| 65201-77-6 |
TETRABUTYLAMMONIUM PERIODATE |
| 652-03-9 |
Tetrafluorophthalic acid |
| 652-12-0 |
Tetrafluorophthalic anhydride |
| 652-18-6 |
2,3,5,6-Tetrafluorobenzoic acid |
| 652-22-2 |
Perfluoroacetophenone |
| 652-29-9 |
2',3',4',5',6'-Pentafluoroacetophenone |
| 652-30-2 |
(Dichloromethyl)pentafluorobenzene |
| 652-31-3 |
Pentafluorobenzamide |
| 652-32-4 |
4-Methyltetrafluorobenzoic acid |
| 652-34-6 |
4-Hydroxy-2,3,5,6-tetrafluorobenzoic acid |
| 652-36-8 |
2,3,5,6-Tetrfluoroterephthalic acid |
| 652-36-8 |
Tetrafluoroterephthalic acid |
| 65269-92-3 |
Chlorofluorometanesulfonyl chloride |
| 653-11-2 |
2,3,5,6-Tetrafluorophenylhydrazine |
| 653-20-3 |
Pentafluorophenylacetamide |
| 653-21-4 |
Pentafluorophenylacetic acid |
| 653-30-5 |
Pentafluorophenylacetonitrile |
| 653-31-6 |
2-(Pentafluorophenyl)ethanol |
| 653-34-9 |
2',3',4',5',6'-Pentafluorostyrene |
| 653-35-0 |
2,3,4,5,6-Pentafluorobenzyl chloride |
| 653-37-2 |
Pentafluorobenzaldehyde |
| 65370-42-5 |
4-Chloro-2-nitropyridine |
| 65-45-2 | Salicylamide |
| 65001-21-0 | 5 Bromo 3 Sulfonylchloride Pyridine |
| 65113-55-5 | SOLVENT BLACK 46 |
| 65122-06-7 | BASIC RED 14 |
| 65122-08-9 | BASIC RED 12 |
| 65138-66-1 | SOLVENT RED 39 |
| 65140-91-2 | Ethyl3,5-di-tert-butyl-4-hydroxybenzylphosphonate, calciumsalt(2:1) |
| 652130-42-2 | N-Cbz-4[(dimethoxyindanone-2-ethylcarboxylate)2-methyl]piperidine |
| 65277-42-1 | Ketoconazole |
| 6535-46-2 | Pigment Red 112 |
| 654-62-6 | 4-Amino-6-(trifluoromethyl)benzene-1,3-disulfonamide |
| 654-70-6 | 4-Amino-2-trifluoromethylbenzonitrile |
| 65447-77-0 | Polymer of dimethyl succinate and 4-hydroxy-2,2,6,6-tetramethyl-1-piperidine ethanol |
| 654-53-5 |
2,3,4,5-Tetrafluorobenzotrifluoride |
| 654646-61-4 | 5-Amino-1-(4-carboxyphenyl)-1H-tetrazole |
| 65510-61-4 |
1,6-Diiodo-1,1,2,2,3,3,4,4-octafluorohexane |
| 65550-77-8 |
5-Bromo-2-chloro-3-methylpyridine |
| 65550-81-4 |
2-Bromo-3-chloro-5-methylpyridine |
| 65550-82-5 |
2-Bromo-3-Iodo-5-Methylpyridine |
| 65733-16-6 | S-(+)-Methoprene |
| 657-35-2 |
1,1-difluoro-ethyl-benzene |
| 657-36-3 |
4-(TRIFLUOROMETHYL)PIPERIDINE |
| 657408-07-6 |
2-Dicyclohexylphosphino-2′,6′-dimethoxy-1,1′-biphenyl |
| 65749-30-6 |
LITHIUM IODOACETATE |
| 6574-98-7 |
2,4-Dichlorobenzonitrile |
| 65799-47-5 |
3-Glycidoxypropylmethyldimethoxy silane |
| 65864-64-4 |
(Difluoromethyl)trimethylsilane |
| 658-78-6 | 4-Nitrophenyl trifluoroacetate |
| 65854-91-3 | 4-Chloropivalanilide |
| 6588-63-2 |
Perfluorocyclohexanecarbonyl fluoride (tech) |
| 65921-65-5 |
5-iodo-1-pentanol acetate |
| 65997-05-9 | Polymerized Rosin |
| 65997-06-0 | Hydrogenated Rosin |
| 65997-12-8 | Pentaerythritol Ester of Polymerized Rosin |
| 65997-13-9 | Hydrogenated Rosin Esters (Glycerol) |
| 659-98-3 |
tert-Butyl 1,1,2,2-tetrafluoroethyl ether |
| 6602-28-4 |
3-Hydroxypyridine-n-oxide |
| 6602-54-6 |
2-Chloro-3-cyanopyridine |
| 6609-64-9 |
Ethylene chlorophosphate |
| 661-11-0 |
1-Fluoroheptane |
| 66137-74-4 |
5-Iodooctafluoro-3-oxapentanesulphonylfluoride |
| 661-82-5 |
3-Chlorotetrafluoropropionic acid |
| 661-95-0 |
1,2-Dibromohexafluoropropane |
| 661-97-2 |
1,2-Dichlorohexafluoropropane |
| 662-19-1 |
2-Chloro-3,3,3-trifluoro-2-(trifluoromethyl)propionyl chloride |
| 662-22-6 |
2-Hydroxy-3,3,3-trifluoro-2-(trifluoromethyl)propionic acid |
| 6622-91-9 |
4-Pyridyl acetic acid hcl |
| 66249-21-6 |
1H-Perfluorohex-1-ene |
| 662-50-0 |
Heptafluorobutyramide |
| 662-62-4 |
7-Chloroperfluoroheptanoyl chloride |
| 662-63-5 |
7-Chloroperfluoroheptanoyl fluoride |
| 66286-21-3 |
2',3',4',5'-Tetrafluoroacetophenone |
| 6628-77-9 |
5-Amino-2-methoxypyridine |
| 663-35-4 |
Ethyl pentafluoropropionylacetate |
| 6635-31-0 |
6-Hydroxy-5-nitronicotinic Acid |
| 66353-47-7 |
2,4-dichlorobutyrophenone |
| 6635-86-5 |
2-Amino-4-methyl-3-nitropyridine |
| 6636-55-1 |
Methyl-6-ChloroPicolinate |
| 663-73-0 |
2,2,3,3-Tetrafluoropropionyl chloride |
| 66416-72-6 |
4-Bromo-2-Iodoaniline |
| 66443-79-6 |
5-Chlorooctafluoropentanoic acid |
| 66443-80-9 |
8-Chloroperfluorooct-1-ene |
| 66443-82-1 |
(6-Chloroperfluorohexyl)trifluorooxirane |
| 665-09-8 |
Ethyl 4,4,4-trifluoro-3-hydroxy-3-(trifluoromethyl)butanoate |
| 665-31-6 |
2,2-Difluorosuccinicacid |
| 66534-97-2 |
Bis((2-diphenylphosphino)ethyl)ammonium chloride |
| 6656-49-1 |
2-Methyl-3-nitrobenzotrifluoride |
| 665-66-7 |
Amantadine Hydrochloride |
| 66670-23-3 |
(Perfluoro-tert-butoxy)trimethylsilane |
| 6669-03-0 |
(2,2,2-Trifluoroethoxy)pentafluorobenzene |
| 66-71-7 | o- Phenanthroline |
| 660-27-5 | Diisopropylammonium Dichloroacetate |
| 6609-56-9 | 2-Methoxybenzonitrile |
| 6610-29-3 | 4-Methyl-3-thiosemicarbazide |
| 661489-23-2 | 2-Propenenitrile, 3-(4-amino-3,5-dimethylphenyl)-,(2E)- HCI |
| 66176-17-8 | 3-Methylisatoic anhydrid |
| 6627-34-5 | 2,5-Dichloro-4-nitroaniline |
| 663161-10-2 | 4,5:4',5'-Dibenzo-1,1'-dibutyl-3,3,3',3'-tetramethylindatricarbocyanine hexafluorophosphate |
| 6633-61-0 | Methyl 2-aminothiazole-5-Carboxylate |
| 6635-20-7 | 5-nitro vanilline |
| 6637-22-5 | 2,3-dimethyl-6-methoxyquinoxaline |
| 6638-79-5 | N,O-Dimethylhydroxylamine Hydrochloride |
| 6639-79-8 | 6-Chloro-2,3-dihydroxyquinoxaline |
| 6639-82-3 | 6-Methoxyquinoxaline |
| 6640-22-8 | Pamoic Acid Disodium Salt |
| 6670-13-9 | 4,5-Diphenyl-2-mercaptobenzoxazole |
| 667-27-6 |
Ethyl bromodifluoroacetate |
| 66742-57-2 |
4-(3-fluorobenzyloxy)benzaldehyde |
| 66762-68-3 |
Ethyl 4-Methoxy-3-OXO-Butanoate |
| 667938-77-4 |
1,4-Bis(2-chlorohexafluoroisopropyl)benzene |
| 667940-34-3 | 9-naphthalen-2-yl-10-(4-naphthalen-1-ylphenyl)anthracene |
| 66804-94-2 |
Perfluoro(5-methyl-3,6-dioxanonane) |
| 66818-54-0 |
2,2,3,3,4,4,5,5-Octafluorohexan-1,6-diyl dimethacrylate |
| 6683-19-8 | Tetrakis[methylene-B-(3,5-di-tert-butyl-4-hydroxyphenyl)-propionate]-methane |
| 66840-50-4 |
Heptafluoropropyl pentafluoroethyl ether |
| 6684-11-3 | 2-Methylmalondianil hydrochloride |
| 6693-19-8 | Pentaerythritol Tetrakis(3-(3,5-di-tert-butyl-4-hydroxyphenyl)propionate) |
| 67033-41-4 |
1-(Bromomethyl)-4-(1,1,2,2-tetrafluoroethoxy)benzene |
| 670-80-4 |
4-(1-cyclohexen-1-yl)morpholine |
| 67133-88-4 |
5-iodo-1-pentanol |
| 6715-31-7 |
1,4-Bis(2,2,2-trifluoroethoxy)tetrafluorobenzene |
| 672-66-2 |
Dimethyl(phenyl)phosphine |
| 674335-88-7 |
Methyl 4,4,4-trifluoro-3-(trifluoromethyl)butyrate |
| 674-35-1 |
2-Iodo-4,4,4-trifluorobut-2-en-1-ol |
| 67-43-6 | DTPA [Diethylenetriamine-N,N,N',N'',N''-pentaacetic acid] |
| 67437-97-2 |
2-Chloro-2-(trifluoromethyl)perfluoropentane |
| 67443-38-3 |
5-Bromo-2-chloro-3-nitropyridine |
| 674-53-3 |
4,4,4-Trifluorobut-2-en-1-ol |
| 675112-70-6 |
4,4-Difluorocyclohexylaminehydrochloride |
| 675-14-9 |
2,4,6-Trifluoro-1,3,5-triazine |
| 67-52-7 | Barbituric Acid |
| 67-71-0 | Dimethylsulfone |
| 67014-36-2 | 5-Amino-6-methylbenzimidazolone |
| 672-78-6 | Methyl-p-toluensulfinate (solution, 30 weight % in toluene) |
| 6728-26-3 | Trans-2-Hexenal |
| 673-22-3 | 2-Hydroxy-4-Methoxybenzaldehyde |
| 67326-80-1 | 3,3'-Bis(3-sulfopropyl)-5-chloro-9-ethyl-5'phenyloxacarbocyanine betaine sodium salt |
| 675-20-7 | 2-Piperidone |
| 67554-50-1 |
Octylphenol |
| 675-62-7 |
(3,3,3-Trifluoropropyl)methyldichlorosilane |
| 67641-28-5 |
Pentafluoroallyl fluorosulfate |
| 67674-48-0 |
1,1,1,3,3,3-Hexafluoroisopropyl p-toluenesulfonate |
| 67-68-5 |
Methyl sulfoxide |
| 676-97-1 |
Methylphosphonic dichloride |
| 677-21-4 |
3,3,3-Trifluoropropene |
| 677-43-0 |
N,N-Dimethylphosphoramidodichloridate |
| 67762-77-0 |
PIBSA |
| 677-67-8 |
2,2-Difluoro-2-fluorosulfonylacetyl fluoride (8-10%-sultone) |
| 677-69-0 |
Heptafluoroisopropyl iodide |
| 677-77-0 |
2-Hydroxy-2-(trifluoromethyl)-3,3,3-trifluoropropionitrile |
| 67784-32-1 |
7H-Perfluoro-2,6-dioxaoctane |
| 677-84-9 |
Heptafluoroisobutyryl fluoride |
| 678-13-7 |
1,2-Dichloro-4-iodoperfluorobutane |
| 67815-57-0 |
1,3-Diiodotetrafluorobenzene |
| 678-18-2 |
Methyl nonafluorobutyl ketone |
| 678-32-0 |
1,2-Dibromoperfluoroheptane |
| 678-39-7 |
1H,1H,2H,2H-Perfluorodecan-1-ol |
| 67845-93-6 | 3,5-di-tert-butyl-4-hydroxybenzoic acid hexadecyl ester |
| 67846-56-4 | HC BLUE 124 |
| 6786-83-0 | SOLVENT BLUE 4 |
| 678-74-0 |
1-Iodo-1H,1H,5H-octafluoropentane |
| 67874-68-4 | Phenoxyacetaldehyde dimethylacetal |
| 67884-32-6 |
(R)-(+)-1,2-Bis(diphenylphosphino)propane |
| 67884-33-7 |
(S)-(-)-1,2-Bis(diphenylphosphino)propane |
| 678-98-8 |
1,1,1,2,2,3,3-Heptafluorohexane |
| 67899-41-6 |
Perfluoro(allylbenzene) |
| 679-02-7 |
4,4,5,5,6,6,6-Heptafluorohexan-1-ol |
| 679-03-8 |
4,4,5,5,6,6,6-Heptafluorohex-2-en-1-ol |
| 679-12-9 |
2,2,3,3,4,4-Hexafluorobutyric acid |
| 67914-60-7 |
1-ACETYL-4-(4-HYDROXYPHENYL) PIPERAZINE |
| 6792-31-0 |
Hexafluoropropene trimer (mixture of isomers) |
| 67939-65-5 | BASIC VIOLET 3 |
| 679-69-6 |
1,2-Dichloro-4-iodo-1,1,2-trifluorobutane |
| 679-85-6 |
3-Chloro-1,1,2,2-tetrafluoropropane |
| 679-87-8 |
1,1,2,2-tetrafluoro-3-iodopropane |
| 679-97-0 |
3,3,4,4-Tetrafluorobutan-2-one |
| 680-05-7 |
Methyl heptafluoroisobutyrate |
| 68007-08-9 |
IMIDAZOLIUM IODIDE |
| 68015-60-1 | Bisphenol amino sulfonyl ester |
| 680-15-9 |
Methylfluorosulphonyldifluoroacetate |
| 680-28-4 |
n-Butyl pentafluoropropionate |
| 68039-49-6 |
2,4-Dimethyl-3-cyclohexene-1-carboxaldehyde |
| 68-05-3 |
Tetra Ethyl Ammonium Iodide |
| 680-54-6 |
1,1,2,3,3,4,4-Heptafluorobut-1-ene |
| 680-65-9 |
Diethyl2,2-difluoromalonate |
| 68105-93-1 |
1-chloro-7-bromoheptane |
| 68123-13-7 | Basic Blue 99 |
| 68123-42-2 | 3-Carboxyethyl-2-methylbenzoxazolium bromide |
| 6813-38-3 | 2,2'-Dipyridyl-4,4'-dicarboxylic acid |
| 68155-66-8 | Ethanone, 1-(1,2,3,4,5,6,7,8-octahydro-2,3,8,8-tetramethyl-2-naphthalenyl)-1-one (and isomers) |
| 68155-67-9 | Ethanone, 1-(1,2,3,4,5,6,7,8-octahydro-2,3,8,8-tetramethyl-2-naphthalenyl)-1-one (and isomers) |
| 681-58-3 |
2,2,3,3-Tetrafluoropropyl acetate |
| 681-68-5 |
Allyl 2,2,3,3-tetrafluoropropyl ether |
| 68187-89-3 | Cocoyl Chloride |
| 68214-07-3 | Hexadecyltrimethylammonium hydrogen sulphate |
| 68239-70-3 | Triethylammonnium 5-(3-ethylbenzothiazol-2(3H)-ylidene)-4-oxo-2-thioxothiazolidine-3-acetate |
| 68259-00-7 | Basic Yellow 87 |
| 68296-59-3 | 9(or 10)-Methoxyphenaleno[2,3-a]benzimidazol-7-one |
| 683-08-9 |
Diethyl methylphosphonate |
| 68318-95-6 |
2-Bromo-3,3,4,4,4-pentafluorobut-1-ene |
| 68327-03-7 |
(1R,2R)-2-Aminocyclopentanol |
| 68333-79-9 | Ammonium polyphosphate |
| 68359-57-9 | 4-fluoro-3-phenoxybenzaldehyde |
| 683-81-8 |
Difluoromethyldimethylamine |
| 68391-30-0 | Basic Red 76 |
| 68391-31-1 | Basic Yellow 57 |
| 68391-32-2 | Basic Brown 17 |
| 683-98-7 |
Methyl bromodifluoroacetate |
| 684-07-1 |
3,3,3-Trifluoro-DL-lactic acid |
| 68411-46-1 | Benzenamine, N-phenyl-, reaction products with 2,4,4-trimethylpentene |
| 68412-26-0 | Bis(N,N-dibutan-1-ylcarbamodithioato-kappa(2)S)di-mu-oxido-dioxidodimolybdenum, sulfurized |
| 68413-24-1 | Cardanol Glycidyl Ether |
| 684-16-2 |
Hexafluoroacetone |
| 68435-07-4 |
3-Hydroxy-1-Methoxycarbonyl Adamantane |
| 6846-50-0 | TXIB (2,2,4-Trimethyl-1,3-pentanediol Diisobutyrate) |
| 6846-50-0 | TXIB |
| 684-78-6 |
N,O-Bis(trifluoroacetyl)hydroxylamine |
| 68479-98-1 |
DIETHYL METHYL BENZENE DIAMINE |
| 685-27-8 |
N-Methyl-bis(trifluoroacetamide) |
| 685-63-2 |
Hexafluorobut-1,3-diene |
| 685-83-6 |
Bis(diethylamino)chlorophosphine |
| 685-88-1 |
Diethyl2-fluoromalonate |
| 685-91-6 | N,N-diethyl acetamide |
| 6850-57-3 | 2-Methoxybenzyl amine |
| 68572-87-2 | 9-Phenanthreneboronic Acid |
| 68609-97-2 | Alkyl(C12-C14)Glycidyl Ether |
| 68610-51-5 | Reaction product of 4-methylphenol with dicyclopentadiene and isobutylene |
| 68647-35-8 | PIGMENT VIOLET 3:1 |
| 68647-73-4 | Tea Tree Oil |
| 6872-06-6 | 2-Methylindoline |
| 6872-17-9 | 5-Chloro-1,3,3-trimethyl-2-methyleneindoline |
| 68784-47-4 | Alkonolamine titanate complex |
| 68784-48-5 | Alkonolamine titanate complex |
| 68797-94-4 |
6-bromo-1-hexanol acetate |
| 688046-61-9 | (5-Chloro-2-methoxy-4-methylpyridyl)(4,5,6-trimethoxy-o-tolyl)methaneone |
| 688-29-9 |
3,3,3-Trifluoropropanal diethylacetal |
| 68834-05-9 |
1-Bromo-4-(1,1,2,2-tetrafluoroethoxy)benzene |
| 68877-2902 | Isobornyl Cyclohexanol |
| 68930-73-4 | 2,6-Dimethyl-5-ethoxybenzothiazole |
| 68937-41-7 |
TRIARYL PHOSPHATE ISOPROPYLATED |
| 68953-84-4 | 1,4-Benzenediamine N,N'-mixed phenyl and tolyl derivs |
| 69013-23-6 |
Hydride terminated methyhydrosiloxane dimethylsiloxane copolymer |
| 69045-79-0 |
2-Chloro-5-iodopyridine |
| 69056-67-3 |
3-(Trifluoromethyl)crotonic acid |
| 69066-98-4 |
1-Iodo-1-(trifluoromethoxy)tetrafluoroethane |
| 690-95-9 |
4,4,4-Trifluorobutyronitrile |
| 69102-90-5 | HTPB [Hydroxyterminated polymer of buta-1,3-diene] |
| 69113-59-3 |
3-IODOBENZONITRILE |
| 69116-71-8 |
Methyl fluoroformyl-2,2-difluoroacetate |
| 6920-22-5 | 1,2-Hexanediol |
| 692-05-7 |
1,1,2-Trifluorodec-1-ene |
| 692-50-2 |
Hexafluorobut-2-yne |
| 69279-97-6 | 2,2'-Bis(Ethylferrocenyl)Propane |
| 69304-37-6 |
1,3-Dichloro-1,1,3,3-tetraisopropyldisiloxane |
| 693-23-2 |
Dodecanedioic Acid(DDDA) |
| 693-36-7 | Dioctadecyl 3,3'-Thiodipropionate |
| 6935-44-0 | Ethyl-alpha-cyano-4-hydroxycinnamate |
| 6940-76-7 |
1-chloro-3-iodopropane |
| 6942-36-5 |
Methyl 2-bromo-5-nitrobenzoate |
| 6945-68-2 |
2-Amino-5-bromo-3-nitropyridine |
| 694-64-4 | 2,2-Ethylmethylthiazolidine |
| 6940-78-9 | 1-bromo-4-chlorobutane |
| 69430-35-9 | Hydrogenated Petroleum Resin |
| 695-06-7 |
Gamma-Hexalactone |
| 695-34-1 |
2-Amino-4-methylpyridine |
| 69555-14-2 |
N-(Diphenylmethylene) Glycine ethyl ester |
| 69563-88-8 | [(aminophenoxy)phenyl]hexafluoropropane |
| 6957-19-3 | 2,3,6,7-Tetramethylquinoxaline |
| 696-07-1 |
5- Iodo uracil |
| 696-40-2 |
3-IODOBENZYLAMINE |
| 696-62-8 | 4-lodoanisole |
| 6960-42-5 | 7-Nitroindole |
| 6960-45-8 | 7-Nitroindole-2-carboxylic acid |
| 6962-92-1 | 4-Chlorobutylacetate |
| 6962-92-1 | 4-Chlorobutyl acetate |
| 6969-71-7 |
1,2,4-triazole[4,3-a]pyridine-3(2H)-one |
| 697-11-0 |
Hexafluorocyclobutene |
| 6971-45-5 | 2-Methoxyphenylhydrazine hydrochloride |
| 697-18-7 |
Tetrafluoroethanesultone |
| 69-72-7 |
Salicylic acid |
| 697300-73-5 |
2-Amino-3-bromo-5-iodopyridine |
| 6975-13-9 |
Ethyl 3-methyl-4,4,4-trifluorobutyrate |
| 6976-93-8 | 2-Methoxyethyl Metacrylate |
| 69804-19-9 |
Perfluoro-5-methyl-4,7-dioxanona-8-enenitrile |
| 6984-99-2 |
Chloropentafluoroacetone monohydrate |
| 69861-02-5 | 3-(3-METHACRYLOXY-2-HYDROXYPROPOXY)PROPYLBIS( TRIMETHYLSILOXY)METHYLSILANE |
| 698-76-0 |
Octanolactone |
| 698-80-6 |
3,4-Difluorobenzyl chloride |
| CAS NO | Product Name |
| 700-06-1 | 3-Indolecarbinol |
| 700-16-3 |
Pentafluoropyridine |
| 700-17-4 |
2,3,5,6-Tetrafluoroaniline |
| 700-27-6 |
(Trifluoromethyl)maleic anhydride |
| 700-57-2 |
2-Adamantanol |
| 700-58-3 |
2-Adamantanone |
| 700-84-5 | 5-Fluoro-1-indanone |
| 700-87-8 | 2-Methoxyphenyl isocyanate |
| 70024-44-1 | 1,1'-Bis(4-sulfophenyl)-3,3'-dicarboxy-5,5'-dihydroxypyrazolo-4,4'-trimethine oxonole tetrasodium salt |
| 7003-32-9 | 2-Methylcyclohexylamine |
| 70086-62-3 |
1,1,5,5-Tetrafluoroacetylacetone |
| 70-11-1 |
2 Bromoacetophenone |
| 70126-48-6 |
3-(1,1,2,2-Tetrafluoroethoxy)benzoic acid |
| 701-27-9 | 3-fluorobenzenesulphonyl chloride |
| 701-34-8 | 4-Bromobenzenesulphonamide |
| 702-79-4 | 1,3-Dimethyladamantane |
| 70209-99-3 | C.I.Reactive Blue 69 |
| 7023-61-2 | Pigment Red 48:2 |
| 7025-19-6 | Rhodanine-3-propionic acid |
| 702-82-9 |
3-Amino-1-Adamantanol |
| 702-98-7 |
2-Methyl-2-Adamantanol |
| 70315-70-7 |
3-IODO-6-NITROINDAZOLE |
| 70321-86-7 | 2-(2H-Benzotriazole-2-yl)-4,6-bis(1-methyl-1-phenylethyl)phenol |
| 70-34-8 |
2,4-Dinitrofluorobenzene |
| 7035-68-9 | 1-Ethylbenzimidazole |
| 70356-09-1 | Avobenzone |
| 703-87-7 |
1,4-Dimethyltetrafluorobenzene |
| 703-95-7 |
5-Fluoroorotic acid monohydrate |
| 704-10-9 |
2,4-dichloro-5-fluoroacetophenone |
| 70445-33-9 | Ethyl Hexyl Glycerine |
| 7051-34-5 | cyclopropyl methyl bromide |
| 705-86-2 |
Delta-Decalactone |
| 706-14-9 |
Gamma-Decalactone |
| 70624-18-9 | Light Stabilizer 944 |
| 70627-52-0 |
N-(4-(benzyloxy)benzylidene)-4-fluorobenzenamine |
| 7065-46-5 | ert-Butylacetyl chloride(BAC) |
| 706-89-8 |
3-(2,2,3,3,3-Pentafluoropropoxy)-1,2-propenoxide |
| 70693-59-3 | 2-Amino-N-cyclohexyl-N-methyl benzenesulfonamide |
| 70-70-2 |
4'-Hydroxypropiophenone |
| 707-36-8 | 1-Chloro-3,5-dimethyladamantane |
| 707-37-9 | 3,5-Dimethyladamantan-1-ol |
| 70788-30-6 | 1-(2,2,6-Trimethylcyclohexyl)hexan-3-ol |
| 7073-94-1 |
1-Bromo-2-isopropylbenzene |
| 70755-50-9 |
Potassium perfluoro(4-methyl-3,6-dioxaoctane)sulfonate (Chromoxane) |
| 707-61-9 |
3-Methyl-1-phenyl-2-phospholene-1-oxide, tech. grade |
| 708-06-5 | 2-Hydroxy-1-naphthaldehyde |
| 70867-60-6 | 2,5-Dimethyl-6-methoxybenzoselenazole |
| 70877-62-2 | Bis(methacryloxy)butylpolydimethylsiloxane |
| 70900-21-9 |
Hydrideterminatedpolydimethylsiloxane |
| 709031-29-8 |
3-Hydroxy-1-Adamantyl-D-Glycine |
| 709-09-1 | 1,2-Dimethoxy-4-nitrobenzene |
| 709031-28-7 | 2-(3-Hydroxy-1-adamantyl)-2-oxoacetic acid |
| 709-21-7 |
2,2,2-Trifluoroethyl phenyl ketone |
| 70956-27-3 |
Solvent Violet 31 |
| 7096-39-1 |
2-Bromo-2,2-difluoroethylamine |
| 7096-51-7 |
3,3,4,4,4-Pentafluorobut-1-yne |
| 7098-80-8 | Solketal Methacrylate |
| 710-04-3 |
undecanoic delta-lactone |
| 7101-31-7 |
Dimethyl Diselenide |
| 71027-02-6 |
4,4,4-Trifluorocrotonic acid |
| 71077-14-0 | SOLVENT YELLOW 47 |
| 711-01-3 | Adamantane-1-carboxylic acid methyl ester |
| 711-38-6 |
4'-Methoxy-2,2,2-trifluoroacetophenone |
| 71195-64-7 | Diisobutyl ester of Nylon acid |
| 71195-85-2 |
Pentafluorophenyl acrylate |
| 71215-88-8 | 4-Methyl-2-nitrophenyl thiocyanate |
| 71216-20-1 | 5-Bromo-2-mercaptobenzothiazole |
| 7128-64-5 | 2,5-Bis(5-tert-butyl-2-benzoxazolyl)thiophene |
| 71301-98-9 | (2R)-2-(4-hydroxyphenoxy)propanoic acid ethyl ester |
| 71342-70-6 | Ethylene glycol bis-anhydro trimellitate |
| 71342-77-3 | BC-58 |
| 71359-97-2 |
(-)-O-Isopropylidene-2,3-dihydroxy-1,4-bis[bis(3,4-dimethylphenyl)phosphino]butane 25% wt in Toluene |
| 71360-06-0 |
Bis(3,5-dimethylphenyl)phosphine |
| 713-62-2 |
4-(1,1,2,2-Tetrafluoroethoxy)aniline |
| 71363-91-2 | 4-amino-N-(4-amino-3-chlorophenyl)benzamide |
| 713-95-1 |
Delta-Dodecalactone |
| 7139-89-1 | para phenylene diamine disulphonic acid |
| 7148-74-5 |
2-bromopropionyl chloride |
| 7149-10-2 |
Vanillylamine hydrochloride |
| 7149-80-6 | 5-Chloro-2-nitro-p-toluidine |
| 7152-24-1 | 2-(Methylthio)benzimidazole |
| 715-31-1 |
2-(Pentafluorophenyl)propan-2-ol |
| 7153-23-3 | 6,7-Dimethylquinoxaline |
| 715-37-7 |
Methyl 4-aminotetrafluorobenzoate |
| 7154-73-6 |
N-(2-aminoethyl)pyrrolidine |
| 715-51-5 |
3-Chlorophenanthrene |
| 7158-32-9 | 4,4'-Oxybisbenzoyl chloride |
| 71592-16-0 |
Potassium 2.2.3,3-tetrafluoropropionate |
| 71598-17-9 | BASIC RED 49 |
| 71626-98-7 |
Calcium Iodide Hydrate |
| 716-39-2 |
2,3-Naphthalenedicarboxylic Anhydride |
| 71643-66-8 | 4-Chloro-2-iodophenol |
| 7170-05-0 |
Octafluorohexanediamiddioxime |
| 71735-32-5 |
N-(Pentafluoropropionyl)imidazole |
| 71759-89-2 |
4-Iodoimidazole |
| 71769-53-4 |
Potassium hydroxide |
| 717843-55-5 |
3-Bromo-2-Isopropoxypyridine |
| 71786-67-9 | Alpha amino) (N - benzyl - methyl - hydroxy acetophenone between hydrochloride (BAH) |
| 71-81-8 |
ISOPROPAMIDE IODIDE |
| 718-64-9 |
Hexafluoro-2-phenylpropan-2-ol |
| 71878-19-8 | poly[ [6-[(1,1,3,3-tetramethylbutyl)amino]-1,3,5-triazine-2,4-diyl] [(2,2,6,6-teramethyl-4-piperidinyl)imino]-1,6-hexanediyl[(2,2,6,6- tetramethyl-4-piperidinyl)imino]] |
| 719-80-2 |
Ethyl diphenylphosphinite |
| 72016-05-8 |
4,4,5,5,6,6,7,7,7-Nonafluorohept-2-en-1-ol |
| 7209-00-9 |
2-Bromoglutaric acid diethyl este |
| 720-94-5 |
1-(4-Methylphenyl)-4,4,4-trifluorobutane-1,3-dione |
| 72114-82-0 |
2-Hydroxy-2-(trifluoromethyl)butyric acid |
| 721395-15-9 |
tert-Butyl (1R,2S)-2-(aminocyclopentyl)carbamate |
| 722-56-5 |
Diphenyl Iodonium Nitrate |
| 72291-30-6 |
methyl 2-cyano-2-methylpropanoate |
| 722-92-9 |
4-(Hexafluoro-2-hydroxyisopropyl)aniline |
| 72-40-2 | 4-Aminoimidazole-5-carboxamide hydrochloride |
| 72009-86-0 | O-Phenylphenoxyethyl Acrylate |
| 7216-95-7 | DTPA-5K |
| 72235-52-0 | 2,4-Difluorobenzylamine |
| 72432-03-2 | Miglitol |
| 7251-61-8 | 2-Methylquinoxaline |
| 726185-88-2 | 4"-Bromo-4,5:4',5'-dibenzo-1,1',3,3,3',3'-hexamethylindacarbocyanine perchlorate |
| 72676-55-2 | 5,5'-Dithiodi-1,3,4-thiadiazole-2(3H)-thione |
| 72721-02-9 | 5,6-Dimethoxybenzimidazole |
| 728039-63-2 | N,N-di([1,1'-biphenyl]-4-yl)-4'-bromo-[1,1'-biphenyl]-4-amine |
| 728040-39-9 |
4,4,4-Trifluorobut-2-enyl acetate |
| 72804-48-9 |
(Nonafluorobutyl)trifluorooxirane |
| 72829-09-5 |
1,12-Dodecanediol Dimethacrylate |
| 72848-57-8 |
Perfluoro(2-methyl-3-oxahexanoyl) chloride |
| 73018-09-4 |
2-hydroxy-6-Chloropyridine |
| 73096-42-1 | 5-(2-Bromophenyl)tetrazole |
| 730971-66-1 |
Methyl trimethylsilyldifluoroacetate |
| 73183-34-3 | Bis(pinacolato)diboron |
| 7319-16-6 | Methyl-1-propenyl ether |
| 73290-22-9 |
2-Bromo-5-iodopyridine |
| 7335-25-3 |
Ethyl 2-Chlorobenzoate |
| 7335-27-5 |
Ethyl 4-Chlorobenzoate |
| 7337-45-3 | tert-Butylamine borane |
| 73559-47-4 | Phenyl Trimethicone |
| 7357-70-2 | 2-Cyanothioacetamide |
| 7357-67-7 |
4-(3-chloropropyl)morpholine |
| 73583-37-6 | 4-Bromo-2-chloropyridine |
| 73781-91-6 |
6-Chloro nicotinic Acid Methyl Ester |
| 7379-35-3 |
4-Chloropyridine HCL |
| 7383-71-3 |
2,2,3,3-Tetrafluoropropyl acrylate |
| 7385-67-3 | Nile Red |
| 73866-23-6 | 5-Bromoacetyl salicylamide |
| 73895-98-4 |
2-Amino-6-bromo-4-methylpyridine |
| 73896-36-3 |
2-Amino-6-methoxy-3-nitropyridine |
| 7391-70-0 | 5-Cyclohexylbarbituric acid |
| 73942-87-7 |
7,8-Dimethoxy-1H-benzo[d]azepin-2(3H)-one |
| 7397-46-8 | Diethyl methoxy borane |
| 7397-62-8 | n-Butyl Glycolate |
| 7400-08-0 |
p-Hydroxy cinnamic acid |
| 74103-07-4 | Ketorolac Tromethamine |
| 74106-81-3 |
ethyl 2,2-difluorohexanoate |
| 74111-21-0 |
(S)-2-Aminocyclohexanol |
| 74-11-3 |
4-Chlorobenzoic acid |
| 74115-13-2 |
3-Hydroxy-5-Bromopyridine |
| 74165-64-3 | 3-Aminophthalhydrazide hydrochloride |
| 742-84-7 |
(6H-Perfluorohexyl)trifluorooxirane |
| 74289-57-9 |
Bis(3,5-dimethylphenyl)chlorophosphine |
| 74-31-7 | N,N'-Diphenyl-p-phenylenediamine |
| 74328-57-7 |
2,3,3,3-Tetrafluoro-2-(trifluoromethyl)propyloxirane |
| 74359-06-1 |
1,1,1,3,3,3-Hexafluoroisopropyl 2-fluoroacrylate |
| 74359-10-7 |
2,2,2-Trifluoroethyl 2-fluoroacrylate |
| 7439-69-2 |
Di-n-butyl N,N-diethylcarbamoylphosphonate |
| 7450-59-1 |
1,12-Dodecanediylbis(phosphonic acid) |
| 74543-22-9 |
1-Naphthylamine-3,8-disulfonic acid,sodium salt |
| 746180-23-4 |
4,4-Bis(trifluoromethyl)-5,5,6,6,7,7,7-heptafluoroheptyl acrylate |
| 7464-14-4 |
2-Hydroxy-3-nitro-5-methylpyridine |
| 7470-14-6 |
Phenanthrene-3-carboxylic acid |
| 74793-72-9 |
1-Bromo-1,1,2,2-tetrafluorooct-3-ene |
| 74-83-9 | 1-bromomethane in solvents |
| 74839-84-2 |
(2R,3R)-(+)-Bis(diphenylphosphino)butane |
| 748746-28-3 |
Methyl 3-amino-4,4,4-trifluorobutyrate |
| 74-88-4 |
Methyl Iodide |
| 7488-56-4 |
Selenium Sulfide |
| 74-94-2 | Dimethylamine borane |
| 74-96-4 | 1-bromoethane |
| 742-01-8 | Luminore red-violet 440PT |
| 7436-07-9 | 5-Nitroindane |
| 74385-09-4 | N-Carboxymethylbenzothiazolium bromide |
| 7440-42-8 | Amorphous Elemental Boron |
| 7443-25-6 | 2-(4-Methoxybenzylidene)propanedioic acid dimethyl ester |
| 7446-08-4 |
Selenium Dioxide |
| 74470-85-2 | 2,3,3-Trimethyl-3H-benz[g]indole |
| 74682-60-3 | 3-Hexylthio-1,2,4-triazole |
| 74853-08-0 | 1-(4-Aminophenyl)-4-(4-hydroxyphenyl)piperazine |
| 74863-82-4 | 3-Methyl-8-quinolinesulfonyl chloride |
| 7493-74-5 | Allyl Phenoxyacetate |
| 74-97-5 |
1-chloro-1-bromomethane |
| 7501-02-2 | 2-(2-Biphenyloxy)-ethanol |
| 75-03-6 |
Ethyl Iodide |
| 75-11-6 | Diiodomethane |
| 7512-17-6 | N-acetyl-d-glucosamine |
| 75-18-3 | Methyl sulfide |
| 75-22-9 | Trimethylamine borane |
| 75-25-2 | Bromoform (Tribromomethane) |
| 75-26-3 | 2-bromopropane |
| 75-30-9 |
2-Iodopropane OR Isopropyl Iodide |
| 7531-52-4 | L-Prolinamide |
| 7534-94-3 | Isobornyl methacrylate |
| 75-36-5 |
Acetyl Chloride |
| 753-90-2 |
2,2,2-Trifluoroethylamine |
| 7539-61-9 |
3-diisopropylamino-1-propanol |
| 754-12-1 |
2,3,3,3-Tetrafluoropropene |
| 75415-20-2 |
8-iodo-1-octanol acetate |
| 754-23-4 |
1-Chloro-1-iodotetrafluoroethane |
| 754-34-7 |
Heptafluoro-1-iodopropane |
| 754-43-8 |
Perfluoro-tert-butyl bromide |
| 7545-50-8 | Bis-(3-amino-4-hydroxyphenyl)Sulfone |
| 75-45-6 |
Chlorodifluoromethane (Freon 22) |
| 754-73-4 |
1-Iodo-4H-octafluorobutane |
| 75-47-8 |
Iodoform |
| 754-79-0 |
PERFLUOROHEXALDEHYDE HYDRATE |
| 75-52-5 |
Nitromethane |
| 755-25-9 |
Perfluorohex-1-ene |
| 7553-56-2 |
Iodine |
| 755-40-8 |
3,3,4,4,5,5,5-Heptafluoropentan-1-ol |
| 755-48-6 |
1,1,1,2,2,3,3-Heptafluoro-5-iodononane |
| 75549-02-9 |
7H-Perfluoro-4-methyl-3,6-dioxaoctanesulfonyl fluoride |
| 755-73-7 |
Methyl 3-methoxytetrafluoropropionate |
| 75-58-1 |
TETRA METHYL AMMONIUM IODIDE |
| 756-09-2 |
2,2,3,3-Tetrafluoropropionic acid |
| 756-12-7 |
Heptafluoroisopropyl trifluoromethyl ketone |
| 756-13-8 | Perfluoro(2-methyl-3-Pentanone) |
| 75-61-6 |
Dibromodifluoromethane(FC-12B2) |
| 75-63-8 |
Bromotrifluoromethane |
| 75-65-0 | Tetiary Butanol |
| 75-68-3 |
1-Chloro-1,1-difluoroethane (HCFC-142b) |
| 756-92-3 |
4-Iodo-1,1,1,2-tetrafluoro-2-(trifluoromethyl)nonane |
| 75-69-4 |
Fluorotrichloromethane |
| 757-04-0 |
4-Chloro-2,5-dibromo-4,5,5-trifluoropentan-1-ol |
| 757-06-2 |
2-Iodo-4,4,5,5,5-pentafluoropentan-1-ol |
| 75-76-3 |
Tetramethylsilane |
| 75777-49-0 |
2-Hydroxy-3,5,6-trifluoropyridine |
| 757950-13-3 |
3-FLUORO-5-IODOPYRIDINE |
| 75823-64-2 |
3(5)-Heptafluoropropyl-5(3)-methylpyrazole |
| 758-42-9 |
1,1,1-Trichlorotrifluoroacetone |
| 758-48-5 |
Perfluoro(diethylmethylamine) |
| 75853-08-6 |
1-(Pentafluorophenyl)ethanol |
| 75-85-4 |
2-Methyl-2-Butanol |
| 7585-41-3 | Pigment Red 48:1 |
| 75885-58-4 | (S)-(+)-2,2-dimethylcyclopropane-1-carboxamide |
| 75885-59-5 | DL-2,2-dimethylcyclopropane-1carboxylic acid |
| 75-88-7 |
2-Chloro-1,1,1-trifluoroethane |
| 75-89-8 |
2,2,2-Trifluoroethanol |
| 75-90-1 |
Trifluoroacetaldehyde |
| 7594-49-2 |
1,1-Bis(trifluoromethyl)-2,2,2-trichloroethanol |
| 75980-60-8 | TPO |
| 7598-26-7 |
2-Amino-3-nitro-5-methylpyridine |
| 7598-61-0 |
(2,2-Diethoxyethyl)-phosphonic acid diethyl ester |
| 7601-98-1 |
Bromodifluoroacetic anhydride |
| 7601-99-2 |
Bromodifluoroacetonitrile |
| 760212-58-6 | 1-(4-Bromophenyl)-2-phenyl-1H-benzo[djimidazole |
| 76-04-0 |
Chlorodifluoroacetic acid |
| 76-05-1 |
Trifluoroacetic acid |
| 760-67-8 | 2-Ethylhexanoyl chloride |
| 7606-84-0 |
2,3,5,6-TETRAIODOTEREPHTHALIC ACID |
| 760-99-6 |
1,1,2-Trifluorooct-1-ene |
| 76-12-0 |
1,2-Difluorotetrachloroethane |
| 76-13-1 |
1,1,2-Trichlorotrifluoroethane |
| 76-18-6 |
2-Chloroheptafluoropropane |
| 76189-55-4 |
(R)-(+)-2,2′-Bis(diphenylphosphino)-1,1′-binaphthyl |
| 76189-56-5 |
(S)-(-)-2,2′-Bis(diphenylphosphino)-1,1′-binaphthyl |
| 76-21-1 |
9H-Perfluorononanoic acid |
| 7621-51-4 |
1H-Perfluorooct-1-ene |
| 7623-09-8 | R - (-) - 2 - chloro propionyl chloride |
| 7624-35-3 | 1-tert.Butyl-5-mercaptotetrazole |
| 762-49-2 |
1-fluoro-2-bromoethane |
| 762-51-6 |
1-fluoro-2-iodoethane |
| 76334-30-0 |
9-iodo-1-nonanol |
| 76350-90-8 | 2-methyl-[1,1’-biphenyl]-3-methanol |
| 76-37-9 |
2,2,3,3-Tetrafluoropropan-1-ol |
| 764-13-6 |
2,5-Dimethyl-2,4-hexadiene |
| 76437-40-6 |
2,3,5,6-Tetrafluoro-4-(trifluoromethyl)benzyl bromide |
| 764-47-6 | n-Propyl vinyl ether |
| 764-48-7 | Ethylene glycol monovinyl ether |
| 7648-30-8 |
Ethyliododifluoroacetate |
| 764-99-8 | Diethylene glycol divinyl ether |
| 76433-27-7 | Styryl 6 |
| 7647-01-0 | Hydrochloric Acid |
| 7648-01-3 | 3-Ethylrhodanine |
| 765-04-8 |
1,11-Undecanediol |
| 765-12-8 | Triethyleneglycol divinyl ether |
| 765-14-0 | Dodecyl vinyl ether |
| 765-38-8 | 2-Methylpyrrolidine |
| 765-43-5 |
Cyclopropylmethyl ketone |
| 765-85-5 |
Methyl cyclobutanecarboxylate |
| 765-87-7 |
1,2-Cyclohexanedione |
| 766-11-0 |
2-Fluoro-5-Bromopyridine |
| 7664-93-9 | Sulfuric acid |
| 76674-21-0 |
Flutriafol |
| 766-84-7 |
3-Chlorobenzonitrile |
| 766-85-8 |
3-IODOANISOLE |
| 76697-50-2 | 1-Amino-2-(isopropylsulphonyl)benzene |
| 76697-58-0 | 1-Amino-2-(propylsulphonyl)benzene |
| 76711-87-0 |
5-Chloro-1H,1H-octafluoropentan-1-ol |
| 76711-89-2 |
7-Chloro-1H,1H-perfluoroheptan-1-ol |
| 767329-84-0 |
1H,1H-Perfluoro(2-methyl-3-oxaoctyl) acrylate |
| 7681-11-0 |
Potassium Iodide |
| 7681-55-2 |
Sodium Iodate |
| 7681-65-4 |
Copper (I) Iodide |
| 7681-82-5 |
Sodium Iodide |
| 76-83-5 |
Triphenylmethyl chloride |
| 76-84-6 |
Triphenylmethanol |
| 768-90-1 | 1-Bromoadamantane |
| 768-94-5 |
1-Adamantanamine |
| 768-95-6 | Adamantan-1-ol |
| 769-78-8 | Vinyl Benzoate |
| 7693-45-0 | 4-Chlorophenyl chloroformate |
| 7693-46-1 | 4-nitrophenyl chloroformate |
| 769-39-1 |
2,3,5,6-Tetrafluorophenol |
| 769-40-4 |
2,3,5,6-Tetrafluorothiophenol |
| 7696-70-0 | 4-Dimethylamino-4'-nitrosodiphenylamine |
| 769-68-6 |
2-phenylbutyronitrile |
| 7699-43-6 |
Zirconium Oxychloride(ZOC) |
| 76994-37-1 | BASIC GREEN 1 |
| 770-71-8 |
1-Adamantane Methanol |
| 77-08-7 | 5,5',6,6'-Tetrahydroxy-3,3,3',3'-tetramethyl-1,1'-spirobisindane |
| 77098-07-8 |
Tetrabromophthalic acid diester (esters with diethylene glycol and propylene glycol) |
| 77117-48-7 |
1H,1H,1H,2H,2H-Perfluorodecane |
| 771-56-2 |
Methylpentafluorobenzene |
| 771-60-8 |
2,3,4,5,6-Pentafluoroaniline |
| 771-61-9 |
Pentafluorophenol |
| 771-62-0 |
Pentafluorothiophenol |
| 771-63-1 |
Tetrafluorobenzene-1,4-diol |
| 77227-81-7 |
3,5-Dichloro-4-fluorobenzotrifluoride |
| 77295-58-0 |
6-iodo-1-hexanol acetate |
| 773-15-9 |
1-(Trifluoromethyl)trifluoroethanesultone |
| 7735-42-4 |
1,16-Hexadecanediol |
| 773-82-0 |
2,3,4,5,6-Pentafluorobenzonitrile |
| 77-55-4 | 1-Phenylcyclopentanecarboxylic acid |
| 77-57-6 | 1-Phenyl-1-cyclopentanecarbonitrile |
| 7758-05-6 |
Potassium Iodate |
| 77614-79-0 |
3,5-Bis(difluoromethyl)-1H-pyrazole |
| 7761-88-8 |
Silver Nitrate |
| 776-39-6 |
Ethoxypentafluorobenzene |
| 776-40-9 |
1,4-Bis(bromomethyl)tetrafluorobenzene |
| 77668-42-9 |
2,3-Dichlorobenzoyl nitrile/2,3-Dichlorobenzoyl cyanide |
| 7772-98-7 |
Sodium thiosulfate |
| 77-73-6 |
Dicyclopentadiene |
| 777-52-6 |
4-Nitrophenyl phosphorodichloridate |
| 77-77-0 | VS (Para Base Ester) |
| 77-78-1 | Dimethyl Sulphate |
| 7782-63-0 |
Ferrous sulfate |
| 7782-68-5 |
Iodic Acid ( Solution and Crystal form ) |
| 7783-00-8 |
Selenous Acid |
| 778-34-7 |
Pentafluorobenzotrichloride |
| 778-35-8 |
4-Methyl-2,3,5,6-tetrafluorobenzotrifluoride |
| 7783-60-0 |
Sulphurtetrafluoride |
| 778-36-9 |
Pentafluorobenzenesulfonamide |
| 77-83-8 |
Ethyl methylphenylglycidate |
| 7783-96-2 |
Silver Iodide |
| 7785-33-3 |
Geranyl Tiglate |
| 7785-66-2 |
Butyl Tiglate |
| 7787-33-9 |
Barium Iodide Dihydrate |
| 77876-39-2 |
(2S,4S)-(-)-Bis(diphenylphosphino)pentane |
| 7789-17-5 |
Cesium iodide |
| 77893-60-8 |
1H,1H,1H,3H,3H-Perfluorononan-2-one |
| 7789-80-2 |
Calcium Iodate |
| 7790-21-8 |
Potassium Metaperiodate |
| 7790-22-9 |
LITHIUM IODIDE TRIHYDRATE |
| 7790-28-5 |
Sodium Metaperiodate |
| 7790-31-0 |
Magnesium Iodide Octahydrate |
| 7790-42-3 |
POTASSIUM TRIIODIDE ( AQUEOUS SOLUTION -- 75% to 80% ) |
| 7790-44-5 |
Antimony Iodide |
| 77-90-7 |
Acetyl Tributyl Citrate |
| 7790-80-9 |
Cadmium Iodide |
| 7790-99-0 |
Iodine Monochloride |
| 77-93-0 | Tri Ethyl Citrate |
| 7704-34-98 | Insoluble sulfur 20% oil treated [Rhombic sulfur(IS70-20)] |
| 77061-58-6 | Basic Red 51 |
| 771-50-6 | Indole-3-carboxylic acid |
| 771-51-7 | (Indol-3-yl)acetonitrile |
| 7719-09-7 | Tionyl Chloride |
| 77418-33-8 | 3-Butyl-1-ethyl-5-[3-(4-sulfobutyl)-2-benzoxazolylidene]ethylidene-2-thiohydantoine potassium salt |
| 7745-91-7 | 3-Bromo-4-methylaniline |
| 7745-93-9 | 2-Bromo-4-nitrotoluene |
| 775-16-6 | 1-Benzyl-3-pyrrolidinone |
| 775-64-4 | 2-(1-Adamantyl)propan-2-ol |
| 7755-92-2 | N-Formyl piperazine |
| 7757-79-1 | Potassium nitrate |
| 7757-82-6 | Sodium Sulfate |
| 7757-83-7 | Sodium Sulfite |
| 777816-94-1 | Dye 1136 Dichlorophthalocyanine disulfonic acid cobalt complex |
| 778-28-9 | n-Butyltosylate |
| 77837-26-4 | 5,9-Dimethyl-3-ethyl-5'-phenyl-3'-(4-sulfobutyl)oxathiacarbocyanine betaine |
| 7784-13-6 | Alminium Chloride Hexahydrate |
| 77840-01-8 | COPPER FORMAZONE BLUE OF 4-SULFO ANTHRANILIC ACID |
| 7790-94-5 | Chlorosulfonic Acid |
| 7790-98-9 | Ammonium Perchlorate |
| 77-94-1 |
Tributyl Citrate |
| 77946-87-4 |
3-Methoxytetrafluoropropanamide |
| 77946-88-4 |
3-Methoxytetrafluoropropanenitrile |
| 77953-70-9 |
2-Amino-4-iminoheptafluoropent-2-ene, 95% |
| 77953-71-0 |
3H-Heptafluoro-2,2,4,4-tetra-hydroxypentane |
| 77968-17-3 |
3H- Heptafluoropentane-2,4-dione |
| 779-89-5 |
3-(Trifluoromethyl)cinnamic acid |
| 780-68-7 |
1-Phenyladamantane |
| 78-08-0 | Triethoxyvinylsilane |
| 78-19-3 | 3,9-Divinyl-2,4,8,10-tetraoxaspiro [5.5]undecane |
| 78-40-0 | Triethyl phosphate |
| 78-59-1 | Isophorone |
| 78-67-1 | 2,2'-Azobis(isobutyronitrile) |
| 78-76-2 | 2-bromobutane |
| 78-77-3 | 1-bromo-2-methylpropane |
| 780-69-8 | Triethoxyphenylsilane |
| 781-35-1 | 1,1-DIPHENYLACETONE |
| 78181-99-4 | BASIC YELLOW 96 |
| 78185-92-9 |
Ethyl 4,4,4,4',4',4'-hexafluoro-DL-valinate |
| 78190-05-3 | 1-(4-Carboxyphenyl)-1H-tetrazole |
| 78225-99-7 |
Perfluoroheptanoic anhydride |
| 78348-24-0 | (±)-2-Indolinecarboxylic acid |
| 784-14-5 |
2,3,4,5,6-Pentafluorobiphenyl |
| 78470-95-8 | 6,7-Dichloro-2-hydroxyquinoxaline |
| 78-51-3 |
TRIBUTOXY ETHYL PHOSPHATE |
| 785-30-8 | 4,4'-Diaminobenzanilide |
| 785-30-8 | 4,4' -Diaminobenzanilide |
| 78560-44-8 |
1H,1H,2H,2H-Perfluorodecyltrichlorosilane |
| 78607-32-6 |
2,5-Dichloro-3-aminopyridine |
| 78607-36-0 |
2-CHLORO-3-IODOPYRIDINE |
| 786-31-2 | 2,2,3,3-Tetrafluoropropyl 4-Toluenesulfonate |
| 78629-20-6 | 6,6-Dimethyl-1-hepten-4-yn-3-ol |
| 78649-41-9 |
IOMEPROL |
| 787618-22-8 |
2-Dicyclohexylphosphino-2′,6′-diisopropoxybiphenyl |
| 78762-71-7 |
tert-Butyl 4,4,4-trifluoromethylcrotonate |
| 787-70-2 | [1,1'-biphenyl]-4,4'-dicarboxylic acid |
| 788-67-0 |
3,3-Bis(trifluoromethyl)-2-fluoro-2-(pentafluoroethyl)oxirane |
| 79-08-3 |
Bromoacetic acid |
| 79-11-8 | Mono Chloro Acetic Acid |
| 79-14-1 | Glycolic Acid |
| 791-50-4 |
2,2,4,4-Tetrakis(trifluoromethyl)-1,3-dithietane |
| 79162-64-4 |
1-Iodo-8H-perfluorooctane |
| 79-19-6 | Thiosemicarbazide |
| 79272-26-7 |
3,3-Bis(trifluoromethyl)-4,4,5,5,6,6,6-heptafluorohex-1-ene |
| 79-30-1 | Isobutyryl chloride |
| 79-31-2 | Methoxyacetone |
| 79-38-9 |
Chlorotrifluoroethene |
| 79-41-4 | Methacrylic acid |
| 79424-03-6 |
Ethyl 4,4,4-trifluoro-2-butynoate |
| 79-43-6 |
Dichloro acetic acid |
| 79455-63-3 |
2-Chloro-6-Fluorobenzoyl Chloride |
| 79-51-6 |
1,3-Difluorotetrachloroacetone |
| 79-52-7 |
1,1,3-Trichloro-1,3,3-trifluoroacetone |
| 79-53-8 |
Chloropentafluoroacetone |
| 79538-02-6 |
4-Allyl-2,3,5,6-tetrafluorobenzoic acid |
| 79538-03-7 |
4-Methyl-2,3,5,6-tetrafluorobenzyl alcohol |
| 79538-29-7 |
2,4,6-Trifluorobenzoyl chloride |
| 79667-91-7 |
2,2-Difluoroethylamine hydrochloride |
| 79674-46-7 |
2,3,5,6-Tetrafluoro-4-(trifluoromethyl)benzyl alcohol |
| 796867-38-4 |
8-(2,4-Dimethoxyphenyl)-1,3,5,7-tetramethyl-2,4,6-trioxa-8-phosphatricyclo[3.3.1.13,7]decane |
| 79-74-3 | 2,5-Di-t-amylhydroquinone |
| 79-77-6 | Beta Ionone |
| 79851-29-9 |
Ethyl perfluoro(2-methyl-3-oxahexanoate) |
| 79865-03-5 |
Heptafluorobenzyl iodide |
| 79918-35-7 |
8-iodo-1-octanol |
| 799-34-8 |
3-(1H,1H,7H-Perfluoroheptyloxy)-1,2-propenoxide |
| 79-94-7 | Tetrabromobisphenol A |
| 790304-84-6 | 6-isopropylisoquinoline |
| 79099-07-3 | N-Boc-4-piperidone |
| 79234-33-6 | BASIC ORANGE 2 |
| 793-24-8 | N-(1,3-dimethyl-buty)-N'-phenyl-p-phenylenediamine |
| 79326-93-5 | 4-Bromobenzenesulphonic acid |
| 79669-49-1 | 5-Bromo-2-methyl benzoic acid |
| 79814-40-7 | R-(+)-2-Acetoxysuccinic anhydride |
| CAS NO | Product Name |
| 80043-98-7 |
Perfluoro(4-methyl-3,6-dioxaoctane)sulfonic acid |
| 80-04-6 | Hydrogenated bisphenol A |
| 80172-04-9 |
3,4,5-Trifluorobenzotrifluoride |
| 80201-33-8 |
2,3-Dichlorononafluoro-2-(trifluoromethyl)pentane |
| 802-93-7 |
1,3-Bis(2-hydroxyhexafluoroisopropyl)benzene |
| 80337-25-3 |
3,3,4,4,5,5,5-Heptafluoropent-1-yne |
| 80382-23-6 |
Loxoprofen sodium |
| 80-48-8 | Methyltosylate |
| 80510-04-9 |
1,2-Bis(phosphino)benzene |
| 80-58-0 | 2-bromobutanoic acid |
| 80-62-6 | Methyl methacrylate |
| 8000-34-8 | Clove Leaf Oil |
| 8000-41-7 | Gamma terpineol |
| 8000-41-7 | Terpineol MU |
| 8000-41-7 | Terpineol PG |
| 8000-41-7 | Terpineol EG |
| 8000-48-4 | Eucalyptus Oil |
| 8001-20-5 | Tung Oil |
| 80012-43-7 | 3-Amino-9, 13b-dihydro-1-H-dibenzo[c,f]imidazio[1,5-a] azepine |
| 80012-69-7 | 11H-Dibenz[b,e]azepine-6-carbonitrile |
| 8002-09-3 | Pine oil |
| 8002-74-2 | PE wax |
| 8002-9-3 | Pine Oil |
| 80058-93-1 | 2-isothiocyanato-1,3-bis(1-methylethyl)-5-phenoxybenzene |
| 8006-54-0 | Lanolin |
| 8006-64-2 | Gum Turpentine |
| 8006-90-4 | De-Mentholised Peppermint Oil |
| 8007-35-0 | α- Terpinyl acetate |
| 8009-03-8 | Petrolatum |
| 80-09-1 |
Bisphenol-s (4,4’-Sulfonyldiphenol) |
| 8013-07-8 | Epoxidized Soybean Oil |
| 8013-90-9 | Ionone |
| 8014-95-7 | Oleum 23% and 65% |
| 80166-90-1 | 5-Bromo-7-nitroindoline |
| 80407-52-9 | 1-(4-Carbamoylphenyl)-5-mercaptotetrazole |
| 8042-47-5 | White mineral oil (Petroleum) |
| 8050-09-7 | Gum Rosin |
| 8050-15-5 | Hydrogenated Rosin Esters (Methyl Esters) |
| 8050-25-7 | Liquid Rosin Ester |
| 8050-26-8 | Pentaerythritol Ester of Gum Rosin |
| 8050-31-5 | Glycerol Ester of Gum Rosin |
| 80530-55-8 | 2-（4-Cloromethyl）Phenylpropionic Acid |
| 80584-90-3 | N,N-Bis(2-ethylhexyl)-4-methyl-1H-benzotriazol-1-methanamine |
| 80693-00-1 | 3,9-Bis(2,6-di-tert-butyl-4-methylphenoxy)-2,4,8,10-tetraoxa-3,9-diphosphaspiro[5.5]undecane |
| 80722-63-0 | 1,3-BIS(3-METHACRYLOXYPROPYL)TETRAKIS(TRIMETHYLSILOXY)DISILOXANE |
| 80793-17-5 |
1H,1H,1H,2H,2H-Perfluorooctane |
| 80793-21-1 |
Methyl perfluorohexyl ketone |
| 80806-68-4 |
3-(Perfluorohexyl)propan-1-ol |
| 81-04-9 | Naphthalene-1,5-disulfonic acid |
| 81-05-0 |
2-Aminonaphthalene-5-sulfonic acid |
| 81-08-3 | Ortho Sulfo Benzoic Anhydride |
| 81110-73-8 |
RACECADOTRIL |
| 81-14-1 | Musk Ketone |
| 81190-28-5 |
(1H,1H-Perfluoropentyl)oxirane |
| 812-72-6 |
Allyl 1H,1H-perfluorooctyl ether |
| 812-87-3 |
7H-Dodecafluoroheptanealdehyde hydrate |
| 81290-20-2 |
Trimethyl(trifluoromethyl)silane |
| 813-03-6 |
5H-Octafluoropentanoyl fluoride |
| 813-77-4 |
Dimethyl chlorophosphate |
| 814-29-9 |
Tri-n-butylphosphine oxide |
| 81-50-5 | 1-Amino-4-Bromo-2-Methylanthracene-9,10-Dione |
| 815-06-5 |
N-Methyltrifluoroacetamide |
| 81-88-9 | BASIC VIOLET 10 |
| 813-44-5 | Perfluoro(2,4-dimethyl-3-Pentanone) |
| 814-68-6 | Acryloyl chloride |
| 815-23-6 |
Bromopentafluoroacetone |
| 81565-18-6 |
2-Chloro-4-(trifluoromethyl)pyridine |
| 81580-29-2 |
(4-Fluorophenoxy)propan-2-one |
| 81-63-0 |
1,4-Diamino-2,3-dihydroanthraquinone |
| 81-64-1 |
Quinizarin |
| 81782-77-6 | Undecavertol |
| 81-85-6 |
6-BROMO-3-METHYL-3H-DIBENZ[FIJ]ISOQUINOLINE-2,7-DIONE |
| 818-88-2 |
Monomethyl Sebacate |
| 819-19-2 |
Di-tert-butylphosphine |
| 819-46-5 |
4,4,4-Trifluorobutylamine |
| 821-09-0 | 4-penten-1-ol |
| 82113-65-3 |
N,N-Bis(trifluoromethylsulphonyl)amine |
| 821-38-5 |
Tetradecanedioic Acid |
| 821-41-0 |
5-hexen-1-ol |
| 821-48-7 |
bis(2-chloroethyl)amine hydrochloride |
| 821-55-6 |
2-Nonanone |
| 821-76-1 |
1,7-dichloroheptane |
| 821-99-8 |
1,9-dichlorononane |
| 822-39-9 |
Ethylene chlorophosphite |
| 823-40-5 |
2,6-Diaminotoluene |
| 823-56-3 |
2-Fluoro-3,5-Dichloropyridine |
| 823-85-8 | 4-Fluorophenylhydrazine hydrochloride |
| 823-96-1 | Trimethylboroxin |
| 82324-60-5 | ONAPSA 2-NITRO ANILINE-4-SULFONIC ACID |
| 82338-76-9 | PIGMENT BLUE 62 |
| 82416-71-5 |
Perfluorononanenitrile |
| 824-79-3 | Sodium p-toluenesulfinate |
| 824-80-6 | Sodium p-fluorobenzenesulfinate |
| 82428-30-6 | 3,4-Epoxycyclohexylmethyl methacrylate |
| 82614-84-4 |
(2,6-Dimethoxyphenyl)dichlorophosphine |
| 82633-43-0 |
5(3)-Methyl-3(5)-(perfluoropentyl)pyrazole |
| 82633-48-5 |
4-Bromo-3(5)-heptafluoropropyl-5(3)-methylpyrazole |
| 82633-52-1 |
4-Bromo-3(5)-heptafluoropropyl-5(3)-phenylpyrazole |
| 82633-69-0 |
3(5)-Heptafluoropropyl-5(3)-methyl-4-nitropyrazole |
| 826-62-0 |
1,2,3,6-Tetrahydro-3,6-methanophthalic anhydride |
| 827-08-7 |
1,2-Dibromotetrafluorobenzene |
| 827-15-6 |
Iodopentafluorobenzene |
| 82717-96-2 | N-(1-(S)-Ethoxycarbonyl-3-phenylpropyl)-L-alanine |
| 82-75-7 |
8-Amino-1-naphthalenesulfonic Acid |
| 827-95-2 |
3-nitrobenzoic acid sodium salt |
| 82799-44-8 |
2,4-diethyl-9H-thioxanthen-9-one |
| 82822-26-2 |
(Perfluoroheptanoyl)acetone |
| 82832-27-7 | 4-(4-fluorophenyl) -4'-propyl-1, 1'-bi (cyclohexane) |
| 82832-57-3 | trans，trans-4- (3, 4-Difluorophenyl)-4'-propyl-1, 1'-bi (cyclohexane) |
| 828-51-3 |
1-Adamantyl Carboxylic Acid |
| 828-73-9 |
Pentafluorophenylhydrazine |
| 82911-32-8 | 2-Mercapto-5-(4-sulfobutyl)thio-1,3,4-thiadiazole sodium salt |
| 82911-69-1 | N-(9-Fluorenylmethoxycarbonyloxy)succinimide |
| 82919-37-7 | Methyl-(1,2,2,6,6-pentamethyl-4-piperidyl)sebacate |
| 829-84-5 |
Dicyclohexylphosphine |
| 829-85-6 |
Diphenylphosphine, 30% Solution in Toluene |
| 82998-57-0 |
3-IODO-4-METHYL BENZOIC ACID |
| 830-09-1 |
p-Methoxy cinnamic acid |
| 83015-28-5 |
1-Bromo-2-(1,1,2,2-tetrafluoroethoxy)benzene |
| 830-50-2 |
1-(Pentafluorophenyl)ethanol |
| 831-75-4 |
3-(1,1,2,2-Tetrafluoroethoxy)aniline |
| 832-53-1 |
Pentafluorobenzenesulfonyl chloride |
| 83282-91-1 |
4-Methoxymethyl-2,3,5,6-tetrafluorobenzenemethanol |
| 83310-97-8 |
4,4,5,5,6,6,7,7,7-Nonafluoroheptan-1-ol |
| 83-31-8 | 1,8-Naphthosultone |
| 83-33-0 | Indan-1-one |
| 83-34-1 | Skatole |
| 833-66-9 |
Potassium 6-Hydroxy-2-naphthalenesulfonate |
| 83-38-5 |
2,6-Dichlorobenzaldehyde |
| 83643-84-9 |
Methyl 4,4,4-trifluoroacetoacetate |
| 836-78-2 |
2-(2-Hydroxyhexafluoroisopropyl)phenol |
| 836-79-3 |
4-(2-Hydroxyhexafluoroisopropyl)phenol |
| 83684-73-5 |
5,6-Difluoroisatin |
| 83-72-7 | 2-Hydroxy-1,4-naphthoquinone |
| 83048-65-1 | Trimethoxy(1H,1H,2H,2H-heptadecafluorodecyl)silane |
| 83511-07-3 | 3,7-Dihydroxy-2-naphthoic Acid |
| 83558-87-6 | 2,2-Bis(3-amino-4-hydroxyphenyl)hexafluoropropane |
| 83732-84-7 |
2-Naphthylamine 4,6,8 Trisulphonic Acid |
| 83-73-8 |
Diiodohydroxyquinoline OR Iodoquinol |
| 83789-90-6 |
4-Acetoxytetrafluorobenzoic acid |
| 838-57-3 | Ethyl 4-nitrobenzoylacetate |
| 83803-79-6 | BASIC BLUE 26 |
| 83863-33-6 |
5-IODO-2-METHYLANILINE |
| 83968-28-9 | BASIC VIOLET 1 |
| 84030-20-6 |
7-Methyl-1,5,7-triazabicyclo[4.4.0]dec-5-ene |
| 84077-96-3 |
7-chloro-1-heptanol acetate |
| 841313-56-2 |
Diethoxybis[2,3,5,6-tetrafluoro-4-(trifluoromethyl)phenyl]silane |
| 84145-17-5 |
Allyl nonafluoropentanoate |
| 84153-82-2 |
4,4,4-Trifluorobutylamine hydrochloride |
| 84163-13-3 |
6-FLUORO-3-(4-PIPERIDINYL)-1, 2-BENZISOXAZOLE HYDROCHLORIDE |
| 84207-08-9 |
Methyl 9H-perfluorononanoate |
| 84336-22-1 |
5H-Octafluoropentanal hydrate |
| 84349-27-9 |
Sodium bromodifluoroacetate |
| 845523-35-5 |
(1,1,2,3,3,3-Hexafluoropropoxy)pentafluorobenzene |
| 84562-13-0 |
2,3-Bis(diphenylphosphino)butane |
| 84567-13-5 |
Methyl 7H-perfluoroheptanoate |
| 84-57-1 | 1-(2,5-Dichloro-4-sulfophenyl)-3-methyl-5-pyrazolone |
| 84-66-2 | Di Ethyl Phthalate (DEP) |
| 84-67-3 | 2,2-dimethyl-4,4'-diaminobiphenyl |
| 84-72-0 | Ethylphthalylethylglycolate |
| 84-74-2 | Dibutyl Phthalate |
| 84-83-3 | 2-Formylmethylene-1,3,3-trimethylindoline |
| 84041-77-0 | 2,5-Bis[(2-hydroxyethyl)amino]-nitrobenzene |
| 841-77-0 | Benzhydryl piperazine |
| 84100-72-1 | Nuclear Fast Red Ammonium Salt (C.I.60760) |
| 842-07-9 | Sudan I |
| 842-18-2 | 7-Hydroxy-1,3-naphthalenedisulfonic acid dipotassium salt |
| 84211-30-3 | 3,4-dihydroxy-5-nitrio benzoic acid |
| 842138-74-3 | N-(5-Bromoquinoxalin-6-yl)thiourea |
| 84281-74-3 | BASIC BROWN 1 |
| 84434-47-9 | BASIC VIOLET 1 |
| 844646-88-4 | Quinoxaline-5-sulphonyl chloride |
| 84575-27-9 |
7-Methoxy-1H-indole-2,3-dione |
| 845866-79-7 |
2-IODO-4-TRIFLUOROMETHOXYANILINE |
| 846023-24-3 | 2-Cyano-N-(2,4-dichloro-5methoxyphenyl)acetamide |
| 84605-20-9 |
PIBSI |
| 84656-75-7 | 1-methyl-4- [4- (4- propylcyclohexyl) cyclohexyl]benzen e |
| 84680-95-5 |
1,1′-Bis(di-tert-butylphosphino)ferrocene |
| 84758-81-6 | Tert-Butyl 2-Amino-2-methyl propanoate hydrochloride |
| 847665-45-6 | K19 Dye |
| 84793-24-8 | N-(1-(S)-Ethoxycarbonyl-3-phenylpropyl)-L-alanyl-N-carboxyanhydride |
| 847947-33-5 |
2,6-Bis(trifluoromethyl)-4H-pyran-4-one |
| 84816-07-9 |
Methyl 2-chloro-3,3,3-trifluoro-2-(trifluoromethyl)propionate |
| 848337-76-8 |
Chloromethyl 2,2,3,3-tetrafluoropropyl ether |
| 84852-53-9 |
Decabromodiphenyl Ethane |
| 84852-53-9 | 1,2-Bis(pentabromophenyl) ethane |
| 84-86-6 |
4-Amino-1-naphthalenesulfonic acid |
| 84-87-7 |
4-hydroxynaphthalene-1-sulphonic acid |
| 84-89-9 |
1-Naphthylamine-5-sulfonic Acid |
| 85017-80-7 |
Lithium Iodide Hydrate |
| 85036-71-1 |
Potassium 3-(methoxy)tetrafluoropropionate |
| 85036-72-2 |
3-(Methoxy)tetrafluoropropionyl chloride |
| 85-15-4 | 2-Methylnaphtho[1,2-d]oxazole |
| 85175-59-3 |
(Z)-3-(3-chloropropyl)-7,8-diethyl-1H-benzo[d] azepin-2 (3H)-one |
| 85187-22-0 |
2-(1,1,2,2-Tetrafluoroethoxy)benzaldehyde |
| 85211-95-6 |
1-(Nonafluorobutyl)trifluoroethanesultone |
| 85331-33-5 |
3,5-Dichloro-2-cyanopyridine |
| 853-39-4 |
Decafluorobenzophenone |
| 85-42-7 | Hexahydrophthalic anhydride (HHPA) |
| 85-43-8 |
Tetrahydrophthalic Anhydride |
| 85-47-2 | 1-Naphthalenesulfonic acid |
| 855403-42-8 |
3-CHLORO-4-IODOPHENOL |
| 85-54-1 |
2-(4-Chloro-3-nitrobenzoyl)benzoic acid |
| 85567-21-1 |
3-(1,1,2,2-Tetrafluoroethoxy)-1,2-propenoxide |
| 85578-29-6 |
4-(1,1,2,2-Tetrafluoroethoxy)phenol |
| 85623-66-1 |
4-Isopropoxy-2,3,5,6-tetrafluorobenzotrifluoride |
| 856405-77-1 |
9,9-Dimethyl-4,5-bis(di-tert-butylphosphino)xanthene |
| 856851-34-8 |
3-IODOPYRIDINE -2,6-DIAMINE |
| 85694-31-1 |
Methyl 4,4,4-trifluorocrotonate |
| 857356-94-6 |
2-Di-tert-butylphosphino-3,4,5,6-tetramethyl-2′,4′,6′-tri-i-propylbiphenyl |
| 85737-06-0 |
2-Bromotetrafluoroethyl trifluorovinyl ether |
| 85-83-6 | Sudan IV |
| 858-46-8 |
Tris(pentafluoroethyl)-1,3,5-triazine |
| 85-91-6 | Di Methyl Anthranilate |
| 85116-37-6 | (-)-Beta-Chlorodiisopinocampheylborane |
| 85175-64-6 | 2-Mercaptobenzothiazole |
| 85209-91-2 | 2,4,8,10-Tetra-tert-butyl-6-(sodiooxy)-12H-dibenzo[d,g][1,3,2]dioxaphosphocin 6-oxide |
| 85237-56-5 | 2-Aminophenol-4-(N-methyl)sulfonamide |
| 85275-45-2 | N-Boc-3-hydroxypiperidine |
| 853908-50-6 | 6-Bromo-3-nitroquinolin-4-ol |
| 85849-33-8 |
(+)-O-Isopropylidene-2,3-dihydroxy-1,4-bis[bis(2-methylphenyl)phosphino]butane |
| 86030-43-5 |
Methyl N,N-diisopropylchlorophosphoramidite |
| 861347-86-6 |
3-CHLORO-5-IODOPHENOL |
| 861905-94-4 |
3-FLUORO-5-IODO-4-METHYLBENZOIC ACID |
| 86-29-3 | Diphenylacetonitrile |
| 863323-03-9 |
1-Iodo-4-(1,1,2,2-tetrafluoroethoxy)benzene |
| 86-48-6 | 1-Hydroxy-2-Naphthoic Acid |
| 86553-57-3 |
Perfluoro-3-oxapentane-1,5-bis(sulfonylchloride) |
| 86-55-5 | 1-Naphthoic Acid |
| 865-79-2 |
9-Chloroperfluorononanoic acid |
| 86-65-7 | 2-Aminonaphthalene-6,8-disulfonic acid |
| 867267-24-1 |
2,5-Dimethoxypyridine |
| 86-84-0 | 1-Naphthyl isocyanate |
| 868662-36-6 |
2-Trifluoromethyl-5-pyridineboric acid |
| 86-87-3 | 1-Naphthaleneacetic Acid |
| 86-88-4 | 1-Naphthylthiourea |
| 86-92-0 | PTMP 1(4-TOLYL ) PHENYL 3-METHYL 5-PYRALOZONE |
| 869306-69-4 |
Bis(3,4,5-trimethoxyphenyl)chlorophosphine |
| 86-93-1 | 1-Phenyl-5-mercaptotetrazole |
| 860-22-0 | Indigocarmine |
| 86087-23-2 | (S)-(+)-3-Hydroxytetrahydrofuran |
| 86087-24-3 | (R)-(-)-3-hydroxytetrahydrofuran |
| 86168-95-8 | Light Stabilizer 966 |
| 86213-20-9 | alpha-Cyano-3,4-dimethoxycinnamic acid |
| 864377-31-1 | 2-(3-bromophenyl)-4,6-diphenyl-1,3,5-triazinę |
| 86499-96-9 | （BTB) |
| 865-47-4 | Potassium tert-butoxide |
| 865758-96-9 | 2-[(6-chloro-3,4-dihydro-3-methyl-2,4-dioxo-1(2H)-pyrimidinyl)methyl]benzonitrile |
| 86771-76-8 | 5-Methoxy-2-nitro-p-toluidine |
| 868-77-9 | 2-hydroxyethyl methacrylate |
| 87-01-4 | 7-(Dimethylamino)-4-methyl-coumarin |
| 87-03-6 | RHODULINE ACID |
| 87-13-8 | Diethyl Ethoxymethylenemalonate |
| 87189-16-0 |
Potassium bromodifluoroacetate |
| 87-20-7 | Iso Amyl Salicylate |
| 87-25-2 |
Ethyl anthranilate |
| 87-44-5 | Beta Caryophyllene |
| 870-24-6 | 2-Chloroethylamine Hydrochloride |
| 870-50-8 | Di-tert-butylazodicarboxylate |
| 87129-32-6 | (2R)-2-(4-hydroxyphenoxy)propanoic acid butyl ester |
| 871466-65-8 | Dye Z907 |
| 872-32-2 | 2-Methyl-1-pyrroline |
| 872-36-6 | Vinylene carbonate |
| 872-50-4 | 1-Methyl-2-pyrrolidinone |
| 873-32-5 |
2-Chlorobenzonitrile |
| 873-55-2 | Sodium benzenesulfinate |
| 873-74-5 |
4-Aminobenzonitrile |
| 87375-53-9 |
(Perfluorohexyl)trifluorooxirane |
| 873895-41-1 |
2-(2-Aminoanilino)-5-methylthiophene-3-carbonitrile |
| 87-41-2 |
Phthalide |
| 87413-09-0 |
DESS-MARTIN PERIODINANE SOLUTION, 0.3M in METHYLENE CHLORIDE |
| 874-42-0 |
2,4-Dichlorobenzaldehyde |
| 874-60-2 |
p-Toluoyl Chloride |
| 874649-82-8 |
Methyl 6-fluoro-3,4-dihydro-2h-chromene-2-carboxylate |
| 874-90-8 | 4-Methoxybenzonitrile |
| 874375-17-4 | 4-Bromo-7-methylisatin |
| 87-51-4 |
Indole 3 Acetic Acid |
| 875-79-6 | 1,2-Dimethylindole |
| 875468-55-6 | 1-Ethoxy-4-[[(trans, trans)-4'- ethyl[1,1'-bicyclohexyl]-4-yl]methoxy]-2, 3-difluorobenzene |
| 87-59-2 |
2,3-Dimethylaniline |
| 876-08-4 |
4-(Chloromethyl)benzoyl chloride |
| 87-61-6 |
1,2,3-Trichlorobenzene |
| 87-63-8 |
2-chloro-6-methylaniline |
| 876-53-9 |
1,3-Dibromoadamantane |
| 87-68-3 |
Hexachloro-1,3-butadiene |
| 877264-44-3 |
2-IODO-5-FLUOROBENZALDEHYDE |
| 87771-40-2 |
IOVERSOL |
| 878156-87-7 | N,N-Dimethyl-5-chloroindole-2-carboxamide |
| 878160-69-1 |
4-Ethoxy-1,1,1-trifluorobut-3-en-2-ol |
| 87880-61-3 | 2,2'-Bis[4-(3-aminophenoxy)phenyl]propane |
| 879498-16-5 |
3-IODO-2-METHOXYBENZOIC ACID |
| 879643-71-7 |
FORMAMIDINIUM IODIDE |
| 879713-65-2 | 6-Bromo-2,3,3-trimethylbenzoindolenine |
| 879904-89-9 |
2,2′-Bis(di-tert-butylphosphino)biphenyl |
| 88022-48-4 |
Hexafluoro-4-(trifluoromethyl)pent-2-enoyl fluoride |
| 88-04-0 | 4-Chloro-3,5-dimethylphenol |
| 88-06-2 |
2,4,6-Trichlorophenol |
| 880-78-4 |
Pentafluoronitrobenzene |
| 88-12-0 | N-Vinyl-2-Pyrrolidone |
| 88-15-3 | 2-acetylthiophene |
| 88-16-4 | 2-Chlorobenzotrifluoride |
| 88-17-5 |
2-Aminobenzotrifluoride |
| 882050-69-3 |
2-Bromo-4,4,4-trifluorobutyric acid |
| 88-22-2 | meta xylidine ortho sulphonic |
| 88-23-3 | 4-chloro 2-amino phenol 6-sulphonic acid |
| 882687-80-1 |
4-IODO-2,2-DIMETHYLTETRAHYDRO-2H-PYRAN |
| 882855-71-2 |
Methyl4,4-difluorocyclohexanecarboxylate |
| 883521-27-5 |
4-Bromomethoxy-2,3,5,6-tetrafluorobenzotrifluoride |
| 883529-13-3 |
(4-Iodobutyl)perfluorocyclohexane |
| 883543-64-4 |
5,5,6,6,7,7,7-Heptafluoroheptan-1-ol |
| 883546-00-7 |
4-(Perfluorocyclohexyl)butan-1-ol |
| 883546-05-2 |
N-(Nonafluoropentanoyl)imidazole |
| 88-41-5 | Ortho Tertiary Butyl Cyclohexyl Acetate |
| 884494-87-5 |
3-Bromo-5-Chloro-2-Fluoropyridine |
| 884495-39-0 |
5-Bromo-2-methoxy-3-aminopyridine |
| 88-45-9 | p-Phenylenediamine-2-sulfonic acid |
| 88-50-6 | 2,5-Dichloroaniline-4-sulfonic acid |
| 885275-92-3 |
Ethyl 2,2-dimethyl-4,4,4-trifluorobutyrate |
| 885276-36-8 |
4,4,4-Trifluorobutyl hexanoate |
| 885276-39-1 |
4,4,4-Trifluorobutyl 4,4,4-trifluorobutyrate |
| 88-53-9 | CLT ACID 2-CHLORO-5-TOLUIDINE-4-SULPHONIC ACID |
| 88553-89-3 |
4-(2-Chloro-1,1,2-trifluoroethoxy)phenol |
| 88562-41-8 |
3,4,4,4-Tetrafluoro-3-(trifluoromethyl)but-1-ene |
| 88-58-4 | Di-Tertiary Butyl Hydroquinone (DTBHQ) |
| 886230-76-8 |
(E)-3-[2-(PYRIDIN-2-YL)ETHENYL]-1-(TETRAHYDRO-2H-PYRAN-2-YL)-1H-INDAZOL-6-AMINE |
| 88-63-1 | 1,3-Diaminobenzene-4-sulfonic acid |
| 886364-86-9 |
5-Bromo-2-Cyano-4-Methylpyridine |
| 886365-43-1 |
5-Bromo-3-Methylpicolinic Acid |
| 886371-78-4 |
4-fluoropicolinic acid |
| 88-64-2 | 3-Aminoacetanilide-4-sulfonic acid |
| 88-67-5 | 2-lodobenzoic acid |
| 886762-13-6 |
3,5-Bis(chloromethyl)-2,4,6-trifluorobenzotrifluoride |
| 886762-19-2 |
4,4,4,5-Tetrafluoro-4-heptafluoropropoxy-2-iodopentan-1-ol |
| 886762-23-8 |
3,5-Dimethyl-2,4,6-trifluorobenzoic acid |
| 886763-05-9 |
2-METHYL-4-(TRIFLUOROMETHOXY) IODOBENZENE |
| 88-68-6 |
2-Aminobenzamide |
| 88-68-6 | 2-Aminobenzamide |
| 88-72-2 | 2-Nitrotoluene |
| 887266-89-9 |
(Dibromomethyl)pentafluorobenzene |
| 887268-36-2 |
1-Fluoro-4-(1,1,2,2-tetrafluoroethoxy)benzene |
| 88-73-3 | 2-Chloronitrobenzene |
| 88-74-4 | o-Nitroaniline |
| 883-99-8 | Methyl 3-Hydroxy-2-naphthoate |
| 88358-74-1 | N,N,N',N'-Tetrakis(4-dibutylaminophenyl)-p-phenylenediaminium diperchlorate |
| 884241-42-3 | 5-Diethylamino-N-ethyl-2methylbenzothiazolium iodide |
| 88497-56-7 | Bromopolystyrene resin |
| 885-82-5 | 4-Hydroxy-3-nitrobiphenyl |
| 88526-47-0 | Hydrogenated Petroleum Resin |
| 885706-15-0 | 3-Chloro-4-(2-Methylpropyl)Benzoic acid |
| 886-38-4 | 2,3-Diphenyl-2-cyclopropen-1-one |
| 886363-70-8 | 2,6-dibromo-9,9,10,10-tetramethylanthracene |
| 887402-92-8 | N4,N4'-Diphenyl-N4,N4'-bis(9-phenyl-9H-carbazol-3-yl)-[1,1'-biphenyl]-4,4'-diamine |
| 88-75-5 |
2-Nitrophenol |
| 887-76-3 |
1-DIAZO-2-NAPHTHOL-4-SULFONIC ACID |
| 88821-04-9 | 2,2'-Bis[4-(3-aminophenoxy)phenyl]hexafluoropropane |
| 88962-86-1 |
1-bromo-5-iodopentane |
| 889940-13-0 |
3,3,3-Trifluoro-2,2-dimethylpropionic acid |
| 89044-65-5 |
1-bromo-4-iodobutane |
| 89129-69-1 |
Methyl 2H,2H,7H-perfluoro-3-oxoheptanoate |
| 89167-34-0 |
4-Chloro-3-iodopyridine |
| 89-25-8 | 1-3-5 PMP 1-,PHENYL 3-METHYL 5-PYRAZOLONE |
| 89-33-8 | P.C.E.P 1-PHENYL-3-CARBOETHOXY-5-PYRAZOLONE |
| 89-36-1 | 3-Methyl-1-(4-sulfophenyl)-2-pyrazolin-5-one |
| 894085-97-3 |
5-[bis(tert-butyl)phosphino]-1-(1-naphthalenyl)-1H-pyrazole |
| 894086-00-1 |
5-[Bis(tert-butyl)phosphino]-1′,3′,5′-triphenyl-1,4′-bi-1H-pyrazole |
| 89-51-0 | 2-CARBOXYPHENYLACETIC ACID |
| 89524-98-1 |
N-(tert-Butoxycarbonyl)-a-phosphonoglycine trimethyl ester |
| 89-55-4 |
5-Bromo salicylic Acid |
| 89608-37-7 |
3-Iodo-1,1,1-trifluoroheptane |
| 89-61-2 | 1,4-Dichloro-2-nitrobenzene |
| 89621-93-2 |
3-Iodo-5,5,6,6,7,7,7-heptafluoroheptan-1-ol |
| 89-62-3 | MNPT META NITRO PARA TOLUENE |
| 89-63-4 | 4-Chloro-2-nitroaniline |
| 89-64-5 |
4-Chloro-2-nitrophenol |
| 89740-38-5 |
1-Bromo-8H-perfluorooctane |
| 89-75-8 |
2,4-Dichlorobenzoyl Chloride |
| 89807-87-4 |
(Nonafluorobutyl)oxirane |
| 89809-64-3 |
5-Chloro-2-cyanopyridine |
| 89-83-8 | Thymol Crystal |
| 896-33-3 | Ethyltriphenylphosphonium chloride |
| 89616-40-0 | Benzyl Glycidyl Ether |
| 897671-69-1 | N-([1,1'-biphenyl]-4-yl)-9,9-dimethyl-9H-fluoren-2-amine |
| 89827-45-2 | 4-Bromodibenzo[b,d]furan |
| 89846-21-9 | Pyridine 2 |
| 89847-87-0 |
(2,2,3,3-Tetrafluoropropoxy)pentafluorobenzene |
| 89847-88-1 |
1,4-Bis(2,2,3,3-tetrafluoropropoxy)tetrafluorobenzene |
| 89866-61-5 |
5,5,5-Trifluorovaleronitrile |
| 89878-14-8 | Diethyl(3-pyridyl)borane |
| 89889-20-3 |
1,1,1,2,2,3,3,4,4,5,5,6,6-Tridecafluoro-9-iodononane |
| 89929-65-7 | 1,1'-Spiro-bis(3,3-dimethyl-5,6-dipropoxyindane) |
| 89940-48-7 |
7-iodo-1-heptanol |
| 89992-70-1 |
2-Cyanoethyl N,N-diisopropylchlorophosphoramidite |
| CAS NO | Product Name |
| 90-04-0 | o-Anisidine |
| 90-11-9 | 1-bromonaphthalene |
| 90-14-2 |
1-IODONAPHTHALENE |
| 90-15-3 | 1-Naphthol |
| 90177-96-1 |
1H,1H,8H,8H-Perfluorooctane-1,8-diol |
| 90-20-0 | H Acid |
| 90-33-5 | Coumarin 4 |
| 903513-58-6 |
4-Bromo-2,6-difluoropyridine |
| 904037-24-7 |
Perfluorohexaldehyde hydrate (diol) |
| 90-40-4 |
8-Hydroxy-2-naphthylamine-3,6-disulfonic acid |
| 90-41-5 | 2-Aminobiphenyl |
| 90-43-7 | O-Phenyl phenol |
| 90499-30-2 |
1-(Perfluorohexyl)dodecane |
| 90-50-6 |
3,4,5-Trimethoxy cinnamic acid |
| 90-51-7 | γ-Acid |
| 9002-84-0 | PTFE micronized powder |
| 9003-27-4 | Polyisobutene, Polyisobutylene |
| 9004-34-6 | Microcrystalline Cellulose |
| 9004-57-3 | Ethyl Cellulose |
| 9004-62-0 | Hydroxyethyl Cellulose |
| 9004-65-3 | Hydroxypropyl Methyl Cellulose |
| 9004-67-5 | Methyl Cellulose |
| 90076-65-6 | Lithium bis(trifluoromethanesulphonyl)imide |
| 9011-16-9 | PVM/MA Copolymer |
| 902518-11-0 | 9-(2-Bromophenyl)-9H-carbazole |
| 903-19-5 | 2,5-Bis(1,1,3,3-tetramethylbutyl)-1,4-benzenediol |
| 90319-52-1 | [R]-4-Phenyl-2-oxazolidinone |
| 9032-42-2 | Hydroxyethyl Methyl Cellulose |
| 90349-14-7 | 2,5-Dimethyl-4-nitrobenzimidazole |
| 9035-99-8 | Insoluble sulfur 20% oil treated [Polymeris sulfur] |
| 905-96-4 | 3,3'-Diethyloxacarbocyanine iodide |
| 90719-32-7 | [S]-4-Benzyl-2-oxazolidinone |
| 907607-07-2 |
Heptafluorobutyraldehyde hydrate |
| 907607-08-3 |
Perfluoropentanal hydrate |
| 90902-83-3 |
3-Amino-2-bromo-5-chloropyridine |
| 90999-87-4 |
3,4,4,4-Tetrafluoro-3-(trifluoromethyl)butan-1-ol |
| 91-00-9 | Aminodiphenylmethane |
| 91-01-0 |
Benzhydrol |
| 91-04-3 | 2,6-Bis(hydroxymethyl)-p-cresol |
| 91-15-6 |
Phthalonitrile |
| 91-16-7 |
Veratrol |
| 91-23-6 | 2-Nitroanisole |
| 912575-12-3 |
Ethyl 2-amino-5-iodobenzoate |
| 912578-73-5 |
2-Hydroxy-4,4,4-trifluorobutyronitrile |
| 91-29-2 | 4-Amino-4'-nitrodiphenylamine- 2'-sulfonic acid |
| 91-30-5 | 4-Aminodiphenylamine- 2-sulfonic acid |
| 91-44-1 | Coumarin 1 |
| 914637-05-1 |
1H,1H,1H,2H-Perfluoroheptan-2-ol |
| 914637-49-3 |
2H,2H,3H,3H-Perfluorooctanoic acid |
| 91-55-4 | 2,3-Dimethylindole |
| 915-76-4 |
Tris(heptafluoropropyl)-1,3,5-triazine |
| 91600-33-8 |
Ethyl 3-hydroxy-2-methyl-4,4,4-trifluorobutyrate |
| 91600-36-1 |
Ethyl 2-methyl-4,4,4-trifluorocrotonate |
| 91600-40-7 |
Ethyl 2-methyl-4,4,4-trifluorocrotonate |
| 91-63-4 | Quinaldine |
| 91-95-2 | 3,3'-Diaminobenzidine |
| 91-96-3 | N,N'-Diacetoacet-o-tolidide |
| 91101-24-5 | 1-(2-Chloro-5-sulfophenyl)-3-methyl-4-(4sulfophenyl)azo-2-pyrazolin-5-one disodium salt |
| 91192-32-4 | 2-Hydroxy-6-methoxyquinoxaline |
| 916678-14-3 |
2,2-Difluoroethyl ethyl carbonate |
| 917-61-3 | Sodium Cyanate |
| 91-76-9 |
Benzoguanamine |
| 917-92-0 | tert-Butylacetylene |
| 918-21-8 |
Hexafluoro-2,3-bis(trifluoromethyl)butane-2,3-diol |
| 919-30-2 | 3-Aminopropyltriethoxysilane |
| 91944-47-7 |
Trifluoropyruvic aldehyde (20% aqueous solution) |
| 921-26-6 |
Diisopropylphosphoramidous dichloride |
| 92339-07-6 |
2,3,5,6-Tetrafluoro-1,4-benzenedimethanol |
| 92-36-4 |
4-(6-Methylbenzothiazol-2-yl)aniline |
| 92-53-5 |
N-phenylmorpholine |
| 92-54-6 |
N-phenylpiperazine |
| 92-54-6 | 1-Phenylpiperazine |
| 926-02-3 |
Tert-Butyl Vinyl Ether |
| 92611-10-4 |
Methyl N,N,N’,N’-tetraisopropylphosphorodiamidite |
| 926923-52-6 |
1-fluoro-9-bromononane |
| 92-69-3 | 4-Phenylphenol |
| 92-70-6 | 3-Hydroxy-2-naphthoic Acid |
| 92-71-7 | 2,5-Diphenyloxazole |
| 927209-98-1 |
Cyclohexanecarboxamide, 4,4-difluoro- |
| 92737-01-4 |
1-Bromo-3,3,4,4,4-pentafluorobutan-2-one |
| 92-74-0 | 3-Hydroxynaphthalene-2-carbonyl (2-ethoxyphenyl) amine |
| 927-68-4 |
2-bromo-1-ethanol acetate |
| 92-77-3 | 3-Hydroxynaphthalene-2-carbonyl phenyl amine |
| 92-78-4 | 4'-Chloro-3-hydroxy-2-naphthanilide |
| 920-46-7 | Methacryloyl chloride |
| 920-66-1 | Hexafluoroisopropanol(HFIP) |
| 920283-23-4 | Sodium 3-(5-mercapto-1-tetrazolyl)-benzene sulfonate monohydrate |
| 92050-35-6 | 1,1'-Bis(4-sulfophenyl)-5,5'-dihydroxy-3,3',a-trimethylpyrazolo-4,4'-trimethine oxonoloe tripotassium salt |
| 92339-25-8 | 1-(3-Methoxycarbamidophenyl)-5-mercaptotetrazole |
| 92339-43-0 | 1-(3-Phenoxycarbamidophenyl)-5-mercaptotetrazole |
| 925-06-4 | Diisobutyl ester of Nylon acid |
| 926-65-8 | Isopropyl vinyl ether |
| 928-51-8 |
4-chloro-1-butanol |
| 928-55-2 | Ethyl-1-propenyl ether |
| 929080-18-2 |
1,3-Bis(1H,1H,5H-perfluoropentoxy)propan-2-ol |
| 929-37-3 | Di(ethylene glycol) monovinyl ether |
| 929-62-4 | Octyl vinyl ether |
| 93-00-5 | 2-Amino naphthalene-6-sulphonic acid |
| 93-01-6 | 2-Napthol-6-sulfonic acid |
| 93-04-9 | 2-Methoxy Naphthalene (Yara Yara) |
| 93-05-0 | N,N-Diethyl-p-phenylenediamine |
| 93-08-3 | 2'-Acetonaphthone |
| 93-10-7 | Quinaldic acid |
| 93-11-8 | 2-Naphthalenesulfonyl Chloride |
| 93-15-2 | Methyl Eugenol |
| 93-16-3 | Methyl Iso Eugenol |
| 93-17-4 | 3,4-Dimethoxyphenylacetonitrile |
| 93-18-5 | Nerolin Bromelia |
| 932710-63-9 |
Di-tert-butyl(4-dimethylaminophenyl)phosphine |
| 932-72-9 |
BENZENE, ( DICHLOROIODO ) |
| 93-28-7 | Eugenyl Acetate |
| 93-29-8 | Isoeugenol acetate |
| 93343-11-4 |
2,4,6-Trifluorotoluene |
| 933673-41-7 |
4-(1,1,2,3,3,3-Hexafluoropropoxy)acetophenone |
| 93449-21-9 |
3-(Methoxy)tetrafluoropropionic acid |
| 934759-09-8 |
3(5)-Difluoromethyl-5(3)-methylpyrazole |
| 93-4-9 | Yara Yara |
| 93-40-3 | 3,4-Dimethoxyphenylacetic Acid |
| 93496-85-6 |
Methyl 3,3,3-trifluoro-DL-lactate |
| 93-58-3 | Methyl Benzoate |
| 93-61-8 |
N-methylformanilide |
| 93634-87-8 |
tert-Butyldicyclohexylphosphine |
| 93-69-6 | 1-o-Tolylbiguanide |
| 93-92-5 | Styrallyl Acetate |
| 93-98-1 | Benzanilide |
| 93247-78-0 | Methyl indole-7-carboxylate |
| 933-88-0 | o-Toluoyl chloride |
| 93413-69-5 | Venlafaxine free base |
| 93413-76-4 | R,S-α-[1-(hydroxycyclohexyl)-4-methyoxy-benzeneacetonitrile] |
| 93413-77-5 | N,N-didesmethylvenlafaxine |
| 935-56-8 | 1-Chloroadamantane |
| 937-20-2 |
2,4’-dichloroacetophenone |
| 938-18-1 | 2, 4, 6 Trimethyl Benzoyl Chloride |
| 938-55-6 |
6-Dimethylaminopurine |
| 938-94-3 | 2-（4-methyl）Phenylpropionic Acid |
| 93857-83-1 | 2-{3-Allyl-5-[2-(1-ethyl-4(1H)quinolinylidene)ethylidene]-4-oxo-2thiazolidinylidene}methyl-5,6-dimethyl-3ethylbenzoxazolium bromide |
| 939-26-4 | 2-(Bromomethyl) Naphthalene |
| 939-27-5 | 2-Ethyl Naphthalene |
| 939-52-6 |
4-chlorobutylphenone |
| 93966-57-5 | 2-Cyano-3-(4-methoxyphenyl)-2-propenoic acid propyl ester |
| 94-09-7 | Ethyl P-Aminobenzoate |
| 94-13-3 | Propyl 4-hydroxybenzoate |
| 94158-44-8 |
1,1-dimethoxy-2-(2-methoxyethoxy)ethane |
| 94159-84-9 |
1H,1H,2H,3H,3H-Perfluoroundecane-1,2-diol |
| 94220-31-2 |
4-Allyl-2,3,5,6-tetrafluorobenzonitrile |
| 94-25-7 | Butyl-4-amino-benzoate |
| 94-26-8 | n-Butyl p-hydroxybenzoate |
| 94-28-0 |
Triethylene glycol bis(2-ethylhexanoate) |
| 944401-56-3 |
2-AMINO-5-BROMO-4-TRIFLUOROMETHYLPYRIDINE |
| 944-43-4 |
4-Amino-2,3,5,6-tetrafluorobenzoic acid |
| 94-52-0 | 5-Nitrobenzimidazole |
| 946-30-5 |
p-Nitrochlorobenzene-2-sulfonic acid,sodium salt |
| 94-96-2 | 2-ethyl-1,3-hexadiol |
| 94-97-3 | 5-Chloro Benzotriazole |
| 94050-90-5 | (2R)-2-(4-hydroxyphenoxy)propanoic acid |
| 941-37-7 | 1-Bromo-3,5-dimethyladamantane |
| 941-98-0 | 1 Acethyl Naphthalene (1 Acetonaphthone) |
| 942-01-8 | 1,2,3,4-Tetrahydrocarbazole |
| 942-24-5 | 3-Indolecarboxylic acid methyl ester |
| 94266-48-5 | Pine Oil |
| 943-03-3 | 2-Cyano-6-methoxybenzothriazole |
| 94334-64-2 | BC-52 |
| 944940-90-3 | 7-bromo-9,9-dimethyl-fluorene-2-carbaldehyde |
| 94525-05-0 | 1,4-Bis(4-amino-2-trifluoromethylphenoxy)benzene |
| 946525-30-0 | 2-Bromo-5-iodo-benzyl alcohol |
| 94695-48-4 |
2,3,4,5-Tetrafluorobenzoyl chloride |
| 94726-00-8 |
Ethyl 3,3,3-trifluoro-DL-lactate |
| 948-03-8 | Methyl 1-hydroxy-2-naphthoate |
| 948-65-2 | 2-Phenylindole |
| 948043-99-0 | 4'-Ethyl-3-fluoro-1, 1'-biphenyl |
| 948044-01-7 | 4'-propyl-3-fluorobiphenyl |
| 94856-25-4 | Aberchrom 670 |
| 94-99-5 |
2,4-Dichlorobenzyl Chloride |
| 950-68-5 |
Ethyl 4-aminotetrafluorobenzoate |
| 95-14-7 | 1,2,3-Benzotriazole |
| 95-20-5 | 2-Methylindole |
| 95-23-8 | 5-Aminobenzimidazolone |
| 95-25-0 |
CHLORZOXAZONE |
| 95-26-1 | 2,5-Dimethylbenzothiazole |
| 95-31-8 | N-Tertiarybutyl-2-benzothiazole sulfenemide |
| 95-33-0 | N-Cyclohexyl-2-benzothiazole sulfenamide |
| 95-48-7 |
o-cresol |
| 95-49-8 |
O-Chlorotoluene |
| 95-50-1 | 1,2-Dichlorobenzene |
| 95-52-3 |
o-Fluorotoluene |
| 95-54-5 | o-Phenylenediamine |
| 95-55-6 |
2-Aminophenol |
| 95-68-1 |
2,4-Dimethylaniline |
| 95-73-8 |
2,4- Dichlorotoluene |
| 95-75-0 |
3,4- Dichlorotoluene |
| 95-76-1 | 3,4-Dichloroaniline |
| 95-82-9 | 2,5-Dichloroaniline |
| 95-85-2 | 2-Amino-4-chlorophenol |
| 95-92-1 | Diethyl Oxalate |
| 95418-58-9 | 1-(tert-butoxy)-4-styrene |
| 95481-62-2 | Mixed Dibasic Esters |
| 95668-29-4 | 3-Trifluoromethylphenyl chloroformate |
| 95776-69-5 |
N,N-Dimethyl 2-bromodifluoroacetamide |
| 95-80-7 |
2,4-Diaminotoluene |
| 95842-03-8 |
Perfluoro-4-methyl-3,6-dioxaoctane |
| 95-88-5 |
4 Chlororesorcinol |
| 96-09-3 | Styrene Oxide |
| 96105-72-5 |
2-Amino-3,3,3-trifluoropropionicacidhydrochloride |
| 96-12-8 | 1,2-dibromo-3-chloropropane |
| 96183-46-9 |
(2R,4R)-(+)-Bis(diphenylphosphino)pentane |
| 96250-35-0 |
2,2,3,3,3-Pentafluoropropyl 2-fluoroacrylate |
| 96250-37-2 |
2,2,3,3-Tetrafluoropropyl 2-fluoroacrylate |
| 96-29-7 | Methyl Ethyl Ketoxime |
| 96-32-2 |
Methyl bromoacetate |
| 96-43-5 | 2-chlorothiophene |
| 96-45-7 | Ethylene thiourea |
| 96-48-0 |
γ-Butyrolactone |
| 96606-37-0 |
2,4,6-Trifluorobenzonitrile |
| 96-67-3 | 4-nitro 2-amino phenol 6-sulphonic acid |
| 96-69-5 | 4,4'-thio bis-(6-butyl-3-methyl-phenol) |
| 96-73-1 | 2-Chloro-5-nitrobenzenesulfonic acid |
| 967-95-3 |
Bis(2,3,5,6-tetrafluorophenyl)sulfide |
| 96-80-0 |
N,N-diisopropylethanolamine |
| 96916-53-9 |
2-Bromo-3,3,4,4,5,5,5-heptafluoropent-1-ene |
| 969-25-5 |
4-Aminoperfluorobiphenyl |
| 96-93-5 | 2-Amino-4-sulfo-6-nitrophenol |
| 96184-42-8 | 4-(4-ethenylcyclohexyl)benzonitrile |
| 96240-10-7 | 4-Amino-2,4-dihydro-5-(1-methylethyl)-3H-1,2,4-triazol-3-one(Aminotriazolinone) |
| 96478-09-0 | 2-[2-Hydroxy-5-[2-(methacryloyloxy)ethyl]phenyl]-2H-benzotriazole] |
| 96562-58-2 | (2R)-2-(4-hydroxyphenoxy)propanoic acid methyl ester |
| 96568-04-6 | Ethyl-2,6-Dichloro-5-Fluoro Pyridine-3-Acetoacetate |
| 96624-41-8 | (trans, trans) -4-ethyl-4'-propyl-1, 1' -Bicyclohexyl |
| 96624-52-1 | (trans, trans) -4-Butyl-4' -propyl-1, 1' -bicyclohexyl |
| 96829-58-2 | Orlistat |
| 97-00-7 | 2,4-Dinitrochlorobenzene |
| 97-05-2 |
5-Sulfosalicylic Acid |
| 97-06-3 | 2-Nitrotoluene-4-sulfonic acid |
| 97168-13-3 |
1,1,2-Trifluorobut-1-en-4-ol |
| 97-39-2 | 1,3-Di-o-tolylguanidine |
| 97416-84-7 |
Tetrabromobisphenol A dual (2,3-dibromo-2-methyl propyl) ether |
| 97483-77-7 |
5-Bromo-2-cyanopyridine |
| 97-52-9 | 2-Methoxy-4-nitroaniline |
| 97-53-0 | Eugenol |
| 97-54-1 | Isoeugenol |
| 97-62-1 | Ethyl Iso Butyrate |
| 97-63-2 | Ethyl methacrylate |
| 97739-46-3 |
1,3,5,7-Tetramethyl-2,4,8-trioxa-6-phenyl-6-phosphaadamantane |
| 97-74-5 | Tetramethyl thiuram monosulfide |
| 97-77-8 | Tetra ethyl thiuram disulfide |
| 97-85-8 | Octylic acid |
| 97-90-5 | Ethylene glycol dimethacrylate |
| 971-15-3 | Dipentamethylenethiuram hexasulfide |
| 971-66-4 | Pyridine triphenyl boron (PTB) |
| 97404-02-9 | Basic Orange 31 |
| 97453-89-9 | 4,5-Diphenyl-3-ethyl-2-methylthiazolium iodide |
| 976-56-7 | (3,5-Di-tert-butyl-4-hydroxybenzyl)phosphonic acid diethyl ester |
| 977-96-8 | 1,1'-Diethyl-2,2'-cyanine iodide |
| 97915-27-0 |
4,5-Dichloro-4,5,5-trifluoropentan-1-ol |
| 97966-00-2 |
2,3-Dichloro-5-bromopyridine |
| 97-97-2 |
Dimethylchloroacetal |
| 98015-45-3 |
2-tert-Butylimino-2-diethylamino-1,3-dimethyl-perhydro-1,3,2-diazaphosphorine |
| 98041-44-2 |
2-IODOPHENYL ISOTHIOCYANATE |
| 98-08-8 |
Benzotrifluoride |
| 98120-00-4 |
2,2,2-Trichloroethyl 2-fluoroacrylate |
| 98-13-5 |
Phenyltrichlorosilane |
| 98-15-7 |
3-Chlorobenzotrifluoride |
| 98-16-8 |
3-(Trifluoromethyl) aniline |
| 98-17-9 |
3-Hydroxybenzotrifluoride |
| 98198-48-2 |
2-Amino-5-bromo-4-methylpyridine |
| 98-30-6 | 2-Amino phenol-para-methyl sulphone |
| 98327-87-8 |
2,2′-Bis(diphenylphosphino)-1,1′-binaphthyl |
| 98-32-8 | 2-Aminophenol-4-sulfonamide |
| 98-33-9 |
2-Aminotoluene-5-sulfonic acid |
| 98-36-2 | 2-Chloroaniline-5-sulfonic acid |
| 98-37-3 | 2-Aminophenol-4-sulfonic acid |
| 98-43-1 | 2-Amino-4-sulfo benzoic acid |
| 98-44-2 | aniline 2,5-disulphonic acid |
| 98-46-4 |
3-Nitrobenzotrifluoride |
| 98-52-2 | 4-tert-Butylcyclohexanol |
| 98-55-5 | α-Terpineol |
| 98-56-6 |
p-Chlorobenzotrifluoride |
| 98-58-8 | 4-Bromobenzenesulfonyl chloride |
| 98-60-2 | 4-Chlorobenzenesulphonyl chloride |
| 98-61-3 |
4-Iodobenzenesulfonyl chloride |
| 98-64-6 | 4-Chlorobenzenesulphonamide |
| 98-66-8 | 4-Chlorobenzenesulphonic acid |
| 98-74-8 | 4 Nitrobenzene Sulphonyl Chloride |
| 98-77-1 | Piperidinium pentamethylenedithiocarbamate |
| 98-85-1 | Styrallyl Alcohol |
| 98-91-9 | Thiobenzoic Acid |
| 98-95-3 | Nitrobenzene |
| 98446-49-2 | 2,4-Dichloro-5-methoxyaniline |
| 98452-82-5 | Bis(hexafluoroisopropyl)itaconate |
| 98577-44-7 | 1,1-Bis(chloromethyl)-2,2-dibromocyclopropane |
| 987-65-5 | Adenosine-5-triphosphate disodium salt |
| 98737-29-2 | (2S,3S)-N-t-Boc-3-amino-1,2-epoxy-4-phenylbutane |
| 989-38-8 | Rhodamine 6G |
| 99-05-8 | 3-Aminobenzoic Acid |
| 99-06-9 | 3-Hydroxybenzoic Acid |
| 99199-60-7 |
6-Fluoro-3,4-dihydro-2H-1-benzopyran-2-carboxylic Acid |
| 99199-90-3 |
6-Fluoro-3,4-dihydro-2-oxiranyl-2H-1-benzopyran |
| 99-31-0 | 5-Aminoisophthalic Acid |
| 993-13-5 |
Methylphosphonic acid |
| 99324-96-6 |
4-Iodo-1,1,1,2-tetrafluoro-2-(trifluoromethyl)butane |
| 99324-97-7 |
6-Iodo-1,1,1,2-tetrafluoro-2-(trifluoromethyl)hexane |
| 99324-98-8 |
8-Iodo-1,1,1,2,2,3,3,4,4-nonafluorooctane |
| 99-33-2 | 3,5-Dinitrobenzoylchloride |
| 99338-16-6 |
1-Phenyl-2H,2H-perfluorononane-1,3-dione |
| 993-95-3 |
1,1,2,3,3,3-Hexafluoropropyl 2,2,2-trifluoroethyl ether |
| 99-54-7 | 3,4-Dichloronitrobenzene |
| 99-56-9 | 4-Nitro-o-phenylenediamine |
| 99-57-0 | 4-Nitro-2-aminophenol |
| 99586-65-9 |
4-Chloro picolinamide |
| 99-60-5 |
2-Chloro-4-nitrobenzoic acid |
| 99-61-6 |
3-Nitrobenzaldehyde |
| 99-63-8 | Isophthaloyl Chloride |
| 99646-28-3 |
(R)-(+)-2,2′-Bis(di-p-tolylphosphino)-1,1′-binaphthyl |
| 99669-96-2 |
1-chloro-7-iodoheptane |
| 99-76-3 | Methyl p-hydroxybenzoate |
| 99783-23-0 |
2-Methyl-4,4,4-trifluorobutyric acid |
| 99817-36-4 |
2,4-Dichloro-3-ethyl-6-nitrophenol |
| 99-86-5 | Alpha Terpinene |
| 99-87-6 | Para Cymene |
| 99-90-1 | 4 Bromo Acetophenone |
| 99904-16-2 |
Aminopropyl terminated polydimethylsiloxane |
| 99-91-2 | 4 Chloro Acetophenone |
| 99-93-4 |
4'-Hydroxyacetophenone |
| 99-94-5 | P-Toluic Acid |
| 99-96-7 | p-Hydroxybenzoic acid |
| 99-99-0 | 4-Nitrotoluene |
| 991-84-4 | 4-[[4,6-Bis(n-octylthio)-1,3,5-triazin-2-yl]amino]-2,6-di-tert-butylphenol] |
| 99189-60-3 | 1,1-Cyclohexanediacetic Acid Monoamide |
| 99208-50-1 | 10-(2,5-Dihydroxyphenyl)-10H-9-oxa-10-phospha-phenanthrene-10-oxide |
| 99229-76-2 | 1-(4-Carboxyphenyl)-5-mercaptotetrazole disodium salt |
| 99365-48-7 | 4-Bromo-2-oxyindole |
| 99395-88-7 | [S]-4-Phenyl-2-oxazolidinone |
| 99413-45-3 | 4-Vinyl benzyl methacrylate |
| 99610-72-7 | 4,6-Dinitro-2-(2-hydroxyethyl)aminophenol |
| 999-55-3 | Allyl acrylate |
,44c061b5-4932-4cf2-a70e-b06b277d504e,,{"tempId":"gdefault","gmapWidth":"100","gmapWidthUnit":"%","gmapHeight":"550","gmapHeightUnit":"px","gmapZoomLevel":17,"gmapScrollWheel":true}
ACCESS
服部商事株式会社
〒116-0013
東京都荒川区西日暮里2-26-2 日暮里UCビル 2F
Hattori Corporation
2F, Nippori UC building, 2-26-2, Nishinippori, Arakawa-Ku, Tokyo, 116-0013, Japan